mirror of
https://github.com/zebrajr/pytorch.git
synced 2025-12-07 12:21:27 +01:00
Summary: Pull Request resolved: https://github.com/pytorch/pytorch/pull/48340 This changes the context managed classes from using a decorator to define them to using inheritance. Inheritance allows the python static type checking to work correctly. ``` context.define_context() class Bar(object): ... context.define_context(allow_default=True) class Foo(object): ... ``` becomes ``` class Foo(context.Managed): ... class Bar(context.DefaultManaged): ... ``` Behavior differences: * arg_name has been removed since it's not used anywhere * classes need to call `super()` in `__enter__/__exit__` methods if they override (none do) This also defines a context.pyi file to add types for python3. python2 support should not be affected Test Plan: ci buck test //caffe2/caffe2/python:context_test //caffe2/caffe2/python:checkpoint_test Reviewed By: dongyuzheng Differential Revision: D25133469 fbshipit-source-id: 16368bf723eeb6ce3308d6827f5ac5e955b4e29a
744 lines
27 KiB
Python
744 lines
27 KiB
Python
## @package net_builder
|
|
# Module caffe2.python.net_builder
|
|
|
|
|
|
|
|
|
|
|
|
from caffe2.python import core, context
|
|
from caffe2.python.task import Task, TaskGroup
|
|
from caffe2.python.control_ops_util import add_if_op, add_while_op
|
|
|
|
|
|
class NetBuilder(context.Managed):
|
|
"""
|
|
Scope-driven mechanism for building nets, loops and conditional blocks.
|
|
Arguments:
|
|
name: NetBuilder's name
|
|
initial_scope: list of blobs that are available for reading/writing
|
|
Example:
|
|
from caffe2.python.net_builder import NetBuilder, ops
|
|
with NetBuilder() as nb:
|
|
c = ops.Const(5)
|
|
d = ops.Const(0)
|
|
with ops.loop():
|
|
ops.stop_if(ops.LE([c, ops.Const(0)]))
|
|
ops.Add([c, ops.Const(-1)], [c])
|
|
with ops.If(ops.GE([c, ops.Const(3)])):
|
|
ops.Add([d, ops.Const(10)], [d])
|
|
ops.Print(c, [])
|
|
ops.Print(d, [])
|
|
step = core.to_execution_step(nb)
|
|
"""
|
|
def __init__(self, name=None, initial_scope=None, _stop_blob_required=False,
|
|
_stop_blob=None, _fullname=None, _use_control_ops=False):
|
|
parent = NetBuilder.current(required=False)
|
|
assert not _fullname or not name, 'Cannot set both _fullname and name'
|
|
assert not _use_control_ops or \
|
|
(not _stop_blob_required and not _stop_blob), \
|
|
'Stop blobs are not used with control operators'
|
|
self.name = _fullname or '/'.join(
|
|
n for n in (parent.name if parent else None, name) if n
|
|
)
|
|
self._frozen = False
|
|
self._current_net = None
|
|
self._children = []
|
|
if parent:
|
|
# make sure parent has an up to date lexical scope computed
|
|
parent._update_lexical_scope()
|
|
self._init_lexical_scope = set(parent._lexical_scope) if parent else set()
|
|
if initial_scope:
|
|
self._init_lexical_scope |= set([str(b) for b in initial_scope])
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
self._stop_blob = _stop_blob
|
|
self._stop_blob_required = _stop_blob_required
|
|
self._use_control_ops = _use_control_ops
|
|
|
|
def stop_blob(self):
|
|
"""
|
|
Returns the BlobReference to the stop_blob of this NetBuilder.
|
|
If one is not yet available, creates one.
|
|
This function assumes that the stop_blob() will be used immediatelly
|
|
in the current net, so it doesn't initialize it if the current net is
|
|
the first of the builder.
|
|
"""
|
|
assert not self._use_control_ops, \
|
|
'Stop blobs are not used with control operators'
|
|
if self._stop_blob is None:
|
|
net = self.current_net()
|
|
self._stop_blob = core.BlobReference(
|
|
net.NextName('stop_blob'), net=net)
|
|
net.Const(False, blob_out=self._stop_blob)
|
|
if self._current_net != self._children[0]:
|
|
self._children.insert(0, core.Net('stop_blob_init'))
|
|
self._children[0].Const(False, blob_out=self._stop_blob)
|
|
return self._stop_blob
|
|
|
|
def stop_if(self, blob):
|
|
assert not self._use_control_ops, \
|
|
'Stop blobs are not used with control operators'
|
|
stop_blob = self.stop_blob()
|
|
ops.Or([stop_blob, blob], [stop_blob])
|
|
self._current_net = None
|
|
|
|
def _assert_mutable(self):
|
|
assert not self._frozen, (
|
|
'This NetBuilder (%s) has been built already.' % self.name)
|
|
|
|
def _update_lexical_scope(self):
|
|
"""
|
|
Updates lexical scope based on the current list of children.
|
|
Lexical scope contains names of blobs that are currently available
|
|
and were introduced in the net builder
|
|
"""
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
for child in self._children:
|
|
if isinstance(child, core.Net):
|
|
self._lexical_scope |= child.UsedBlobNames()
|
|
elif isinstance(child, NetBuilder) and child._use_control_ops:
|
|
self._lexical_scope |= child._lexical_scope
|
|
|
|
def _reset_children(self):
|
|
self._current_net = None
|
|
self._children = []
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
|
|
def add(self, child):
|
|
self._assert_mutable()
|
|
|
|
if self._use_control_ops:
|
|
assert isinstance(child, core.Net) or (
|
|
isinstance(child, NetBuilder) and child._use_control_ops), \
|
|
"Expected Net or NetBuilder with control ops"
|
|
|
|
self._current_net = None
|
|
self._children.append(child)
|
|
# to-do : check it's not a dag net
|
|
if isinstance(child, core.Net):
|
|
self._current_net = child
|
|
self._update_lexical_scope()
|
|
return child
|
|
|
|
def current_net(self, name=None):
|
|
self._assert_mutable()
|
|
if self._current_net is None or name is not None:
|
|
self.add(core.Net(name))
|
|
return self._current_net
|
|
|
|
def freeze(self):
|
|
for child in self._children:
|
|
if hasattr(child, 'freeze'):
|
|
child.freeze()
|
|
self._current_net = None
|
|
self._frozen = True
|
|
|
|
def get(self):
|
|
self.freeze()
|
|
return self._children
|
|
|
|
def __exit__(self, etype, *args):
|
|
super(NetBuilder, self).__exit__(etype, *args)
|
|
|
|
if self._use_control_ops and len(self._children) > 0:
|
|
_children = self._children
|
|
self._reset_children()
|
|
merged_net = NetBuilder.merge_nets(
|
|
_children, self._lexical_scope)
|
|
assert merged_net, "Expected a non-empty merge of children"
|
|
self._children = [merged_net]
|
|
|
|
self.freeze()
|
|
if etype is not None:
|
|
return
|
|
assert (not self._stop_blob_required) or self._stop_blob is not None, (
|
|
'This NetBuilder (%s) requires a stop condition ' % self.name +
|
|
'to be set with `stop` or `stop_if`')
|
|
|
|
@staticmethod
|
|
def merge_nets(nets_or_builders, outer_blob_names):
|
|
# Only nets or builders with control ops are allowed.
|
|
# Need to pay attention to external outputs, e.g.
|
|
# ...
|
|
# IfNet1 (cond_blob):
|
|
# (Net1)
|
|
# X = 1
|
|
# IfNet2 (...):
|
|
# X = X + 1
|
|
# ...
|
|
# In this example there're two children in then branch of IfNet1:
|
|
# a subnet Net1 that creates blob X and sets its value to one, and
|
|
# a net builder IfNet2 that (conditionally) increments X.
|
|
# From IfNet2's point of view X is an external input
|
|
# and output blob, it will be put into IfNet2 net's external_output.
|
|
# At the same time, from the point of view of IfNet1 X is purely local.
|
|
# Net.AppendNet just merges external outputs of the networks, so
|
|
# without checking this the result of Net1.AppendNet(IfNet2's net)
|
|
# would have blob X in external_output
|
|
|
|
net = None
|
|
for n in nets_or_builders:
|
|
cur = None
|
|
if isinstance(n, NetBuilder):
|
|
assert n._use_control_ops, \
|
|
"Merging of NetBuilder supported only for control ops"
|
|
nets = n.get()
|
|
assert len(nets) == 1 and isinstance(nets[0], core.Net), \
|
|
"Invalid control op net builder"
|
|
cur = nets[0]
|
|
else:
|
|
assert isinstance(n, core.Net)
|
|
cur = n
|
|
if net:
|
|
net.AppendNet(cur)
|
|
else:
|
|
net = cur
|
|
if net:
|
|
# correct external output
|
|
external_outputs = [o for o in net.Proto().external_output
|
|
if o in outer_blob_names]
|
|
net.Proto().external_output[:] = external_outputs
|
|
return net
|
|
|
|
def __str__(self):
|
|
return self.name or 'Un-named NetBuilder'
|
|
|
|
|
|
class Operations(object):
|
|
"""
|
|
Operations to be used in the context of a NetBuilder.
|
|
"""
|
|
def net(self, net=None, name=None):
|
|
"""
|
|
Retrieves the current net, or add a new net to the builder.
|
|
Args:
|
|
net: If provided, add the given net to the active builder.
|
|
Else, returns the current Net or creates a new one as needed.
|
|
name: if provided, creates a new Net with given name and makes
|
|
it the new current net of the active builder. Cannot
|
|
be provided if net is provided.
|
|
"""
|
|
assert name is None or net is None, (
|
|
'Cannot provide both `net` and `name`.')
|
|
if net is not None:
|
|
NetBuilder.current().add(net)
|
|
return net
|
|
return NetBuilder.current().current_net(name=name)
|
|
|
|
def __getattr__(self, op_type):
|
|
"""
|
|
Adds an operator call to the currently active Net.
|
|
"""
|
|
if op_type.startswith('__'):
|
|
raise AttributeError()
|
|
# We want hasattr to work properly even if no context is active.
|
|
if NetBuilder.current(required=False) is None:
|
|
raise AttributeError('No active NetBuilder.')
|
|
return getattr(self.net(), op_type)
|
|
|
|
def task_group(self):
|
|
"""
|
|
Creates a local task group which will execute as the next step of
|
|
the current NetBuilder.
|
|
"""
|
|
from caffe2.python import task
|
|
group = NetBuilder.current()
|
|
with task.Cluster():
|
|
with task.Node('local'):
|
|
tg = task.TaskGroup()
|
|
group.add(tg)
|
|
return tg
|
|
|
|
def stop(self):
|
|
"""
|
|
Stop execution of the current execution step.
|
|
Example:
|
|
ops.Print(a, 0)
|
|
ops.stop()
|
|
ops.Print(b, 0)
|
|
In the example, 'b' will never be printed.
|
|
"""
|
|
return self.stop_if(ops.Const(True))
|
|
|
|
def stop_if(self, blob):
|
|
"""
|
|
Stop execution of the current execution step if the
|
|
condition `blob` is met.
|
|
Example:
|
|
ops.Print(a, 0)
|
|
ops.stop_if(ops.LE([x, ops.Const(0)]))
|
|
ops.Print(b, 0)
|
|
In the example, 'b' will only be printed if the value of scalar
|
|
tensor 'x' is greater than 0.
|
|
"""
|
|
return NetBuilder.current().stop_if(blob)
|
|
|
|
def loop(self, iters=None, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute in a loop as the next step of
|
|
the current NetBuilder. If `iters` is provided, the loop will execute
|
|
for `iters` iterations and then stop. `iters` can be a constant or a
|
|
BlobReference. If `iters` is not provided, the loop will execute
|
|
until `ops.stop` or `ops.stop_if` is called.
|
|
Examples:
|
|
a = ops.Const(5)
|
|
with ops.loop():
|
|
ops.stop_if(ops.LE([a, ops.Const(0)]))
|
|
ops.Print(a, 0)
|
|
ops.Add([a, ops.Const(-1)], [a])
|
|
Above, 'a' will be printed 5 times, with values 5 to 1.
|
|
|
|
with ops.loop(10) as loop:
|
|
ops.LogInfo(loop.iter())
|
|
This will print the numbers from 0 to 9.
|
|
|
|
x = ops.Add([ops.Const(10), ops.Const(10)])
|
|
with ops.loop(x) as loop:
|
|
ops.LogInfo(loop.iter())
|
|
This will print the numbers from 0 to 19.
|
|
"""
|
|
return NetBuilder.current().add(_Loop(iters, name=name))
|
|
|
|
def stop_guard(self, has_stopped_blob=None, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute once as the next step of the
|
|
current NetBuilder. After execution, a bool tensor will indicate
|
|
whether the inner execution was halted with `stop` or `stop_if`.
|
|
Example:
|
|
a = ops.Const(True)
|
|
with ops.stop_guard() as sg1:
|
|
ops.stop_if(a)
|
|
ops.Print(ops.Const('did not stop'))
|
|
b = ops.Const(False)
|
|
with ops.stop_guard() as sg2:
|
|
ops.stop_if(b)
|
|
ops.Print(ops.Const('did not stop'))
|
|
ops.Print(sg1.has_stopped(), [])
|
|
ops.Print(sg2.has_stopped(), [])
|
|
In the example, 'did not stop' will be printed once,
|
|
followed by True and False.
|
|
"""
|
|
return NetBuilder.current().add(
|
|
_StopGuard(has_stopped_blob=has_stopped_blob, name=name))
|
|
|
|
def If(self, cond, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute once as the next step of the
|
|
current NetBuilder if the blob `cond` is True.
|
|
Example:
|
|
with ops.If(ops.Const(True)):
|
|
ops.Print(ops.Const('Will print'))
|
|
with ops.If(ops.Const(False)):
|
|
ops.Print(ops.Const('Wont print'))
|
|
The example will print 'Will print' once.
|
|
"""
|
|
return NetBuilder.current().add(_RunIf(cond, name=name))
|
|
|
|
def IfNet(self, cond, name=None):
|
|
"""
|
|
Same as If, but uses 'If' operator instead of execution step logic
|
|
"""
|
|
return NetBuilder.current().add(_RunIfNet(cond, name=name))
|
|
|
|
def Else(self, name=None):
|
|
"""
|
|
Else branch of IfNet, has to be specified immediately after IfNet.
|
|
Example:
|
|
with ops.IfNet(ops.LT([x, y])):
|
|
...
|
|
with ops.Else():
|
|
...
|
|
"""
|
|
return _RunElseNet(name=name)
|
|
|
|
def WhileNet(self, name=None):
|
|
"""
|
|
NetBuilder for 'While' control operator
|
|
"""
|
|
return NetBuilder.current().add(_RunWhileNet(name=name))
|
|
|
|
def Condition(self, name=None):
|
|
"""
|
|
Loop's condition, executed within WhileNet context
|
|
"""
|
|
assert isinstance(NetBuilder.current(), _RunWhileNet), \
|
|
"Use of Condition outside of WhileNet"
|
|
return _RunWhileCondition(name=name)
|
|
|
|
def task_init(self):
|
|
"""
|
|
Defines operations that will be executed once at task startup.
|
|
Useful when implementing processors, that don't have access to the Task
|
|
top-level structure.
|
|
|
|
This setup will be run only once, even if multiple instances of the task
|
|
will run in parallel. For instance-local initialization, use
|
|
`task_instance_init` instead.
|
|
|
|
Example:
|
|
def my_processor(rec):
|
|
with ops.task_init():
|
|
one = ops.Const(1)
|
|
two = ops.Const(1)
|
|
return Tuple(
|
|
ops.Add(rec[0](), zero), ops.Add(rec[1](), two))
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(Task.TASK_SETUP, setup)
|
|
return setup
|
|
|
|
def task_exit(self):
|
|
"""
|
|
Define operations to be executed once at task shutdown.
|
|
Useful when implementing processors, that don't have access to the Task
|
|
top-level structure.
|
|
|
|
This shutdown will be run only once, after all concurrent instances of
|
|
the task have already finished. For instance-local shutdown,
|
|
use `task_instance_exit` instead.
|
|
|
|
Example:
|
|
def read_queue(queue):
|
|
with ops.task_exit():
|
|
queue.close(ops.net())
|
|
return queue.read(ops.net())
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT)
|
|
self.net().add_attribute(Task.TASK_SETUP, setup)
|
|
return setup
|
|
|
|
def task_instance_init(self):
|
|
"""
|
|
Defines operations that will be executed once at startup of each
|
|
instance of a task. This can be seen as "thread_local" initialization.
|
|
It is guaranteed to run only after all `task_init` logic finishes.
|
|
|
|
This setup will be run concurrently for each instance of a task.
|
|
For global task initialization, use `task_init` instead.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(Task.TASK_INSTANCE_SETUP, setup)
|
|
return setup
|
|
|
|
def task_instance_exit(self):
|
|
"""
|
|
Defines operations that will be executed once at shutdown of each
|
|
instance of a task. This can be seen as "thread_local" finalization.
|
|
|
|
This shutdown will be run concurrently for each instance of a task.
|
|
For global task shutdown, use `task_exit` instead.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT)
|
|
self.net().add_attribute(Task.TASK_INSTANCE_SETUP, setup)
|
|
return setup
|
|
|
|
def local_init(self):
|
|
"""
|
|
Similar to `task_init`, but executes at TaskGroup's startup instead,
|
|
before any task of the group starts executing. This will run only
|
|
once on each node, before initialization of any task, so it can be
|
|
used e.g. to initialize blobs shared across tasks.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(TaskGroup.LOCAL_SETUP, setup)
|
|
return setup
|
|
|
|
def local_exit(self, name=None):
|
|
"""
|
|
Similar to `task_exit`, but executes at TaskGroup's exit instead,
|
|
after all tasks of the group finished execution.
|
|
This will run only once on each node.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT, name)
|
|
self.net().add_attribute(TaskGroup.LOCAL_SETUP, setup)
|
|
return setup
|
|
|
|
def task_reporter(self, interval_ms=1000, name=None):
|
|
"""
|
|
Define operations to be executed at every time interval from
|
|
task start-up to finish. These operations are guaranteed to
|
|
execute at least once after all other operations of the task are
|
|
finished.
|
|
|
|
Example:
|
|
with ops.task_reporter(interval_ms=10000):
|
|
ops.LogInfo('10s elapsed')
|
|
"""
|
|
return _ReporterBuilder(interval_ms, net=self.net(), name=name)
|
|
|
|
def local_reporter(self, interval_ms=1000, name=None):
|
|
"""
|
|
Similar to task_report, but operations defined within this block
|
|
will run repeatedly for as long as any of the tasks in the current
|
|
TaskGroup have not finished.
|
|
"""
|
|
return _ReporterBuilder(interval_ms, name=name)
|
|
|
|
|
|
ops = Operations()
|
|
|
|
|
|
class _ReporterBuilder(NetBuilder):
|
|
def __init__(self, interval_ms, net=None, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
self._net = net
|
|
self.interval_ms = interval_ms
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None:
|
|
step = core.to_execution_step(self)
|
|
step.RunEveryMillis(self.interval_ms)
|
|
if self._net:
|
|
self._net.add_attribute(Task.REPORT_STEP, step)
|
|
else:
|
|
TaskGroup.current().report_step(
|
|
step, interval_ms=self.interval_ms)
|
|
NetBuilder.__exit__(self, etype, *args)
|
|
|
|
|
|
class _SetupBuilder(NetBuilder):
|
|
INIT = 'init'
|
|
EXIT = 'exit'
|
|
|
|
def __init__(self, type, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
self.type = type
|
|
|
|
def setup(self, net):
|
|
if self.type == _SetupBuilder.INIT:
|
|
return core.to_execution_step(self)
|
|
|
|
def exit(self, net):
|
|
if self.type == _SetupBuilder.EXIT:
|
|
return core.to_execution_step(self)
|
|
|
|
|
|
class _RunOnce(NetBuilder):
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None and self._stop_blob is not None:
|
|
ops.stop()
|
|
NetBuilder.__exit__(self, etype, *args)
|
|
|
|
|
|
class _StopGuard(_RunOnce):
|
|
def __init__(self, has_stopped_blob=None, name=None):
|
|
_RunOnce.__init__(self, name)
|
|
self._stopped = has_stopped_blob
|
|
self._ran = False
|
|
|
|
def __enter__(self):
|
|
r = _RunOnce.__enter__(self)
|
|
self._stopped = ops.Const(True, blob_out=self._stopped)
|
|
return r
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None:
|
|
self._ran = True
|
|
ops.Const(False, blob_out=self._stopped)
|
|
_RunOnce.__exit__(self, etype, *args)
|
|
|
|
def has_stopped(self):
|
|
"""
|
|
Return a blob that will be set to scalar bool `True` after
|
|
this net builder ran, iff it was halted early.
|
|
"""
|
|
assert self._ran, 'Context not used yet.'
|
|
return self._stopped
|
|
|
|
|
|
class _Loop(NetBuilder):
|
|
def __init__(self, iters=None, name=None):
|
|
NetBuilder.__init__(self, name, _stop_blob_required=True)
|
|
if iters is not None:
|
|
self._inc = ops.Const(1)
|
|
self._iter = ops.Const(0)
|
|
self._num_iters = (
|
|
iters if isinstance(iters, core.BlobReference)
|
|
else ops.Const(iters))
|
|
else:
|
|
self._num_iters = None
|
|
|
|
def iter(self):
|
|
assert self._num_iters is not None, (
|
|
'This loop does not have a number of iterations.')
|
|
assert self._iter is not None, (
|
|
'iter() must be called from inside the loop context')
|
|
return self._iter
|
|
|
|
def __enter__(self):
|
|
builder = NetBuilder.__enter__(self)
|
|
if self._num_iters is not None:
|
|
ops.stop_if(ops.GE([self._iter, self._num_iters]))
|
|
return builder
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None and self._num_iters is not None:
|
|
self.current_net().Add([self._iter, self._inc], [self._iter])
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunIf(_RunOnce):
|
|
def __init__(self, cond_blob=None, name=None, _already_ran=None):
|
|
_RunOnce.__init__(self, name)
|
|
assert cond_blob or _already_ran
|
|
self._is_else = cond_blob is None
|
|
if _already_ran is None:
|
|
self._else_blob = ops.Not(cond_blob)
|
|
self._already_ran = ops.Const(False)
|
|
else:
|
|
self._already_ran = _already_ran
|
|
self._else_blob = _already_ran if cond_blob is None else (
|
|
ops.Or([_already_ran, ops.Not(cond_blob)]))
|
|
|
|
def __enter__(self):
|
|
r = _RunOnce.__enter__(self)
|
|
ops.stop_if(self._else_blob)
|
|
ops.Const(True, blob_out=self._already_ran)
|
|
return r
|
|
|
|
def Elif(self, cond, name=None):
|
|
assert not self._is_else, 'Else not allowed for an Else.'
|
|
return NetBuilder.current().add(_RunIf(
|
|
cond, name=name or self.name, _already_ran=self._already_ran))
|
|
|
|
def Else(self, name=None):
|
|
assert not self._is_else, 'Elif not allowed for an Else.'
|
|
return NetBuilder.current().add(
|
|
_RunIf(name=name or self.name, _already_ran=self._already_ran))
|
|
|
|
|
|
class _RunIfNet(NetBuilder):
|
|
"""
|
|
Generates a single net that uses If operator
|
|
"""
|
|
def __init__(self, cond_blob, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
assert cond_blob, 'Conditional blob is not specified for an If net'
|
|
self._cond_blob = cond_blob
|
|
self._then_net = None
|
|
self._else_net = None
|
|
|
|
def add(self, child):
|
|
return NetBuilder.add(self, child)
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
_then_nets = self._children
|
|
self._reset_children()
|
|
|
|
self._then_net = NetBuilder.merge_nets(
|
|
_then_nets, self._lexical_scope)
|
|
if not self._then_net:
|
|
self._then_net = core.Net('empty_then_net')
|
|
|
|
if_net = core.Net(self.name + '/if_net')
|
|
add_if_op(if_net, self._cond_blob, self._lexical_scope,
|
|
self._then_net, self._else_net)
|
|
|
|
self._current_net = if_net
|
|
self._children = [if_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunElseNet(NetBuilder):
|
|
"""
|
|
Else branch for _RunIfNet builder
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
parent = NetBuilder.current(required=False)
|
|
assert parent and len(parent._children) > 0 and \
|
|
isinstance(parent._children[-1], _RunIfNet), \
|
|
'Invalid use of Else builder'
|
|
self._if_builder = parent._children[-1]
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
_else_nets = self._children
|
|
self._reset_children()
|
|
|
|
self._if_builder._else_net = NetBuilder.merge_nets(
|
|
_else_nets, self._lexical_scope)
|
|
if self._if_builder._else_net:
|
|
if_else_net = core.Net(self.name + '/if_else_net')
|
|
add_if_op(
|
|
if_else_net,
|
|
self._if_builder._cond_blob,
|
|
self._lexical_scope,
|
|
self._if_builder._then_net,
|
|
self._if_builder._else_net)
|
|
self._if_builder._current_net = if_else_net
|
|
self._if_builder._children = [if_else_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunWhileNet(NetBuilder):
|
|
"""
|
|
Generates a single net that uses While operator
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
self._cond_builder = None
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
assert self._cond_builder, \
|
|
'Condition builder must be specified in While op'
|
|
|
|
_cond_blob = self._cond_builder._cond_blob
|
|
_cond_net = self._cond_builder._cond_net
|
|
|
|
loop_body = self._children
|
|
self._reset_children()
|
|
loop_body_net = NetBuilder.merge_nets(
|
|
loop_body, self._lexical_scope)
|
|
if not loop_body_net:
|
|
loop_body_net = core.Net('empty_loop_body_net')
|
|
|
|
while_net = core.Net(self.name + '/while_net')
|
|
add_while_op(while_net, _cond_blob, self._lexical_scope,
|
|
loop_body_net, _cond_net)
|
|
|
|
self._current_net = while_net
|
|
self._children = [while_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunWhileCondition(NetBuilder):
|
|
"""
|
|
Computes loop's condition, used in the context of WhileNet.
|
|
Last operator must have a single scalar boolean output that will be used
|
|
as a condition value, no other blobs created in the condition net are
|
|
visible outside of it
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
parent = NetBuilder.current(required=False)
|
|
assert parent and isinstance(parent, _RunWhileNet), \
|
|
'Invalid use of loop condition builder'
|
|
assert not parent._cond_builder, \
|
|
'Multiple loop condition builders specified'
|
|
assert len(parent._children) == 0, \
|
|
'Condition definition must be specified before the loop\'s body'
|
|
parent._cond_builder = self
|
|
self._cond_blob = None
|
|
self._cond_net = None
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
condition_body = self._children
|
|
self._reset_children()
|
|
self._cond_net = NetBuilder.merge_nets(
|
|
condition_body, self._lexical_scope)
|
|
assert self._cond_net, 'Invalid loop condition specified'
|
|
assert len(self._cond_net.Proto().op) > 0, 'Invalid condition net'
|
|
last_op = self._cond_net.Proto().op[-1]
|
|
assert len(last_op.output) == 1, 'Invalid condition net'
|
|
self._cond_blob = core.BlobReference(name=last_op.output[0], net=None)
|
|
|
|
self._current_net = self._cond_net
|
|
self._children = [self._cond_net]
|
|
NetBuilder.__exit__(self, type, *args)
|