mirror of
https://github.com/zebrajr/pytorch.git
synced 2025-12-07 12:21:27 +01:00
Summary: Disabling the test since its failing in ROCm4.2 Signed-off-by: Jagadish Krishnamoorthy <jagdish.krishna@gmail.com> Pull Request resolved: https://github.com/pytorch/pytorch/pull/59158 Reviewed By: mruberry Differential Revision: D28808953 Pulled By: ngimel fbshipit-source-id: 134f147ead6dc559d2cde49cf8343cd976e6c224
16992 lines
768 KiB
Python
16992 lines
768 KiB
Python
|
|
import math
|
|
import random
|
|
import string
|
|
import unittest
|
|
import io
|
|
import unittest.mock as mock
|
|
import itertools
|
|
import warnings
|
|
import pickle
|
|
from copy import deepcopy
|
|
from itertools import repeat, product
|
|
from functools import reduce
|
|
from operator import mul
|
|
from collections import OrderedDict
|
|
|
|
import torch
|
|
|
|
# TODO: remove this global setting
|
|
# NN tests use double as the default dtype
|
|
torch.set_default_dtype(torch.double)
|
|
|
|
from torch._six import inf, nan
|
|
import torch.backends.cudnn as cudnn
|
|
import torch.nn as nn
|
|
import torch.nn.functional as F
|
|
import torch.nn.init as init
|
|
import torch.nn.utils.rnn as rnn_utils
|
|
from torch.nn.utils import clip_grad_norm_, clip_grad_value_
|
|
import torch.nn.utils.parametrize as parametrize
|
|
import torch.nn.utils.prune as prune
|
|
from torch.nn.utils import parameters_to_vector, vector_to_parameters
|
|
from torch.nn import Parameter
|
|
from torch.nn.parameter import UninitializedParameter, UninitializedBuffer
|
|
from torch.nn.parallel._functions import Broadcast
|
|
from torch.testing import get_all_fp_dtypes
|
|
from torch.testing._internal.common_utils import freeze_rng_state, run_tests, TestCase, skipIfNoLapack, skipIfRocm, \
|
|
TEST_NUMPY, TEST_SCIPY, TEST_WITH_ROCM, download_file, \
|
|
get_function_arglist, load_tests, repeat_test_for_types, ALL_TENSORTYPES, \
|
|
ALL_TENSORTYPES2, suppress_warnings, TemporaryFileName, TEST_WITH_UBSAN, IS_PPC
|
|
from torch.testing._internal.common_cuda import TEST_CUDA, TEST_MULTIGPU, TEST_CUDNN, TEST_CUDNN_VERSION
|
|
from torch.testing._internal.common_nn import NNTestCase, NewModuleTest, CriterionTest, \
|
|
module_tests, criterion_tests, loss_reference_fns, \
|
|
ctcloss_reference, new_module_tests
|
|
from torch.testing._internal.common_device_type import instantiate_device_type_tests, dtypes, \
|
|
dtypesIfCUDA, precisionOverride, skipCUDAIfNoCudnn, skipCUDAIfCudnnVersionLessThan, onlyCUDA, onlyCPU, \
|
|
skipCUDAIfRocm, skipCUDAIf, skipCUDAIfNotRocm, onlyOnCPUAndCUDA, \
|
|
deviceCountAtLeast, largeTensorTest, expectedFailureMeta, skipMeta
|
|
from torch.nn import MultiheadAttention
|
|
|
|
from hypothesis import given
|
|
import torch.testing._internal.hypothesis_utils as hu
|
|
from torch.testing._internal.common_utils import _assertGradAndGradgradChecks, gradcheck, gradgradcheck, \
|
|
GRADCHECK_NONDET_TOL
|
|
from torch.testing._internal.common_utils import dtype2prec_DONTUSE
|
|
from torch.testing._internal.common_cuda import tf32_on_and_off, tf32_is_not_fp32, tf32_off, tf32_on
|
|
from torch.types import _TensorOrTensors
|
|
|
|
|
|
AMPERE_OR_ROCM = TEST_WITH_ROCM or tf32_is_not_fp32()
|
|
|
|
# load_tests from common_utils is used to automatically filter tests for
|
|
# sharding on sandcastle. This line silences flake warnings
|
|
load_tests = load_tests
|
|
|
|
if TEST_SCIPY:
|
|
from scipy import stats
|
|
import scipy.ndimage
|
|
|
|
if TEST_NUMPY:
|
|
import numpy as np
|
|
|
|
DOUBLE_TENSORTYPES = [torch.double]
|
|
|
|
|
|
# WARNING: If you add a new top-level test case to this file, you MUST
|
|
# update test/run_test.py to list it, otherwise it will NOT be run in
|
|
# CI.
|
|
|
|
|
|
class PackedSequenceTest(TestCase):
|
|
|
|
_type_by_name = {
|
|
'torch.DoubleTensor': (torch.DoubleTensor, 'double'),
|
|
'torch.FloatTensor': (torch.FloatTensor, 'float'),
|
|
# We leave out `'torch.HalfTensor': (torch.HalfTensor, 'half'),`
|
|
# because of an error in `pad_packed_sequence`
|
|
# > AttributeError: 'torch.HalfTensor' object has no attribute 'fill_'
|
|
'torch.LongTensor': (torch.LongTensor, 'long'),
|
|
'torch.IntTensor': (torch.IntTensor, 'int'),
|
|
'torch.ShortTensor': (torch.ShortTensor, 'short'),
|
|
'torch.CharTensor': (torch.CharTensor, 'char'),
|
|
'torch.ByteTensor': (torch.ByteTensor, 'byte'),
|
|
}
|
|
|
|
def __init__(self, *args, **kwargs):
|
|
super(PackedSequenceTest, self).__init__(*args, **kwargs)
|
|
self.batch_size = 5
|
|
self.max_length = 6
|
|
|
|
def _ordered_sequence(self, tensor_type):
|
|
"""Create ordered list of random sequences"""
|
|
seqs = [tensor_type(random.randint(1, self.max_length))
|
|
for _ in range(self.batch_size)]
|
|
if tensor_type == torch.ByteTensor:
|
|
seqs = [s.random_(0, 256) for s in seqs]
|
|
else:
|
|
seqs = [s.random_(-128, 128) for s in seqs]
|
|
ordered = sorted(seqs, key=len, reverse=True)
|
|
return ordered
|
|
|
|
def _padded_sequence(self, tensor_type):
|
|
"""Create Tensor of random padded sequences"""
|
|
ordered = self._ordered_sequence(tensor_type)
|
|
lengths = [len(i) for i in ordered]
|
|
padded_tensor = rnn_utils.pad_sequence(ordered)
|
|
return padded_tensor, lengths
|
|
|
|
def test_type_casts(self):
|
|
"""Test type casting of `PackedSequence` against type casting of tensor"""
|
|
for _, (input_type, _) in self._type_by_name.items():
|
|
for expected_type_str, (_, cast_str) in self._type_by_name.items():
|
|
for enforce_sorted in [True, False]:
|
|
padded, lengths = self._padded_sequence(input_type)
|
|
packed = rnn_utils.pack_padded_sequence(
|
|
padded, lengths, enforce_sorted=enforce_sorted)
|
|
# Apply cast to `PackedSequence` instance and unpack
|
|
masked = getattr(packed, cast_str)()
|
|
unpacked, lengths_out = rnn_utils.pad_packed_sequence(masked)
|
|
self.assertEqual(unpacked.type(), expected_type_str)
|
|
|
|
def test_wrong_order(self):
|
|
a = torch.ones(25, 300)
|
|
b = torch.ones(22, 300)
|
|
b_a = rnn_utils.pad_sequence([b, a])
|
|
self.assertRaises(
|
|
RuntimeError,
|
|
lambda: rnn_utils.pack_padded_sequence(b_a, [22, 25], enforce_sorted=True))
|
|
|
|
def test_total_length(self):
|
|
padded, lengths = self._padded_sequence(torch.FloatTensor)
|
|
max_length = max(lengths)
|
|
packed = rnn_utils.pack_padded_sequence(padded, lengths)
|
|
# test ValueError if total_length < max_length
|
|
for total_length in (-1, 0, max_length - 1):
|
|
for batch_first in (True, False):
|
|
def err_fn():
|
|
rnn_utils.pad_packed_sequence(packed, batch_first=batch_first,
|
|
total_length=total_length)
|
|
self.assertRaisesRegex(ValueError,
|
|
r'Expected total_length to be at least the '
|
|
r'length of the longest sequence in input',
|
|
err_fn)
|
|
# test that pad_packed_sequence returns results of correct length
|
|
for batch_first in (True, False):
|
|
no_extra_pad, _ = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first)
|
|
for total_length_delta in (0, 1, 8):
|
|
total_length = max_length + total_length_delta
|
|
unpacked, lengths_out = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first,
|
|
total_length=total_length)
|
|
self.assertEqual(lengths, lengths_out)
|
|
self.assertEqual(unpacked.size(1 if batch_first else 0), total_length)
|
|
if total_length_delta == 0:
|
|
ref_output = no_extra_pad
|
|
elif batch_first:
|
|
extra_pad = no_extra_pad.new_zeros(self.batch_size, total_length_delta)
|
|
ref_output = torch.cat([no_extra_pad, extra_pad], 1)
|
|
else:
|
|
extra_pad = no_extra_pad.new_zeros(total_length_delta, self.batch_size)
|
|
ref_output = torch.cat([no_extra_pad, extra_pad], 0)
|
|
self.assertEqual(unpacked, ref_output)
|
|
|
|
def test_to(self):
|
|
for enforce_sorted in (True, False):
|
|
padded, lengths = self._padded_sequence(torch.IntTensor)
|
|
a = rnn_utils.pack_padded_sequence(
|
|
padded, lengths, enforce_sorted=enforce_sorted).cpu()
|
|
|
|
self.assertIs(a, a.to('cpu'))
|
|
self.assertIs(a, a.cpu())
|
|
self.assertIs(a, a.to('cpu', dtype=torch.int32))
|
|
self.assertEqual(a.long(), a.to(torch.int64))
|
|
|
|
if torch.cuda.is_available():
|
|
for cuda in ['cuda', 'cuda:0' if torch.cuda.device_count() == 1 else 'cuda:1']:
|
|
b = a.cuda(device=cuda)
|
|
self.assertIs(b, b.to(cuda))
|
|
self.assertIs(b, b.cuda())
|
|
self.assertEqual(a, b.to('cpu'))
|
|
self.assertEqual(b, a.to(cuda))
|
|
self.assertEqual(a, b.to('cpu', dtype=torch.int32))
|
|
self.assertIs(b, b.to(dtype=torch.int32))
|
|
self.assertEqual(b.long(), b.to(dtype=torch.int64))
|
|
|
|
def test_to_memory_format(self):
|
|
m = torch.nn.Conv2d(in_channels=16, out_channels=32, kernel_size=2, bias=True)
|
|
m = m.to(memory_format=torch.channels_last)
|
|
for param in m.parameters():
|
|
if param.dim() == 4:
|
|
self.assertTrue(param.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
class TestAvgPool(TestCase):
|
|
def _sum_pool2d(self, x, kernel_size):
|
|
windows = torch.nn.functional.unfold(x, kernel_size=kernel_size, stride=kernel_size)
|
|
return torch.sum(windows, dim=1)
|
|
|
|
def _sum_pool3d(self, x, kernel_size):
|
|
# Because unfold does not support 3D sliding window we will split tensor to multiple tensors and calculate sum
|
|
h = kernel_size[0]
|
|
splited_x = [t.sum(0) for t in x.split(h) if t.size(0) == h]
|
|
# sum_pool2d assumes tensor in (1, 1, n, m) view, so unsqueeze two times
|
|
splited_x = [self._sum_pool2d(t.unsqueeze(0).unsqueeze(0), kernel_size[1:]) for t in splited_x]
|
|
joined_x = torch.cat(splited_x)
|
|
return joined_x.view(1, joined_x.numel())
|
|
|
|
def _avg_pool2d(self, x, kernel_size):
|
|
size = reduce((lambda x, y: x * y), kernel_size)
|
|
return self._sum_pool2d(x, kernel_size) / size
|
|
|
|
def _avg_pool3d(self, x, kernel_size):
|
|
size = reduce((lambda x, y: x * y), kernel_size)
|
|
return self._sum_pool3d(x, kernel_size) / size
|
|
|
|
def test_doubletensor_avg_pool2d(self):
|
|
n, m = 5, 8
|
|
input = torch.rand(1, 1, n, m)
|
|
for i in range(1, n + 1):
|
|
for j in range(1, m + 1):
|
|
actual = torch.nn.functional.avg_pool2d(input[0], (i, j))
|
|
actual = actual.view(1, actual.numel())
|
|
expected = self._avg_pool2d(input, (i, j))
|
|
self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5))
|
|
|
|
def test_avg_pool2d_with_zero_divisor(self):
|
|
self.assertRaisesRegex(RuntimeError, "divisor must be not zero",
|
|
lambda: F.avg_pool2d(torch.zeros(3, 3, 3), (2, 2), divisor_override=0))
|
|
|
|
def test_doubletensor_avg_pool2d_with_divisor(self):
|
|
n, m = 3, 3
|
|
input = torch.rand(1, 1, n, m)
|
|
for i in range(1, n + 1):
|
|
for j in range(1, m + 1):
|
|
for divisor in [1, 7, i * j]:
|
|
actual = F.avg_pool2d(input[0], (i, j), divisor_override=divisor)
|
|
actual = actual.view(1, actual.numel())
|
|
expected = self._sum_pool2d(input, (i, j)) / divisor
|
|
self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5))
|
|
|
|
def test_doubletensor_avg_pool3d(self):
|
|
h, w, d = 5, 6, 7
|
|
input = torch.rand(h, w, d)
|
|
for i in range(1, h + 1):
|
|
for j in range(1, w + 1):
|
|
for k in range(1, d + 1):
|
|
actual = torch.nn.functional.avg_pool3d(input.unsqueeze(0), (i, j, k))
|
|
actual = actual.view(1, actual.numel())
|
|
expected = self._avg_pool3d(input, (i, j, k))
|
|
self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5))
|
|
|
|
def test_doubletensor_avg_pool3d_with_divisor(self):
|
|
h, w, d = 6, 5, 7
|
|
input = torch.rand(h, w, d)
|
|
for i in range(1, h + 1):
|
|
for j in range(1, w + 1):
|
|
for k in range(1, d + 1):
|
|
for divisor in [1, 7, i * j]:
|
|
actual = torch.nn.functional.avg_pool3d(input.unsqueeze(0), (i, j, k), divisor_override=divisor)
|
|
actual = actual.view(1, actual.numel())
|
|
expected = self._sum_pool3d(input, (i, j, k)) / divisor
|
|
self.assertTrue(torch.allclose(actual, expected, rtol=0, atol=1e-5))
|
|
|
|
def test_avg_pool3d_with_zero_divisor(self):
|
|
self.assertRaisesRegex(RuntimeError, "divisor must be not zero",
|
|
lambda: F.avg_pool3d(torch.zeros(3, 3, 3, 3), (2, 2, 2), divisor_override=0))
|
|
|
|
def test_avg_pool1d_ceil_mode(self):
|
|
# Regression test for gh-36977
|
|
x = 10 * torch.randn((1, 16, 4))
|
|
y = torch.nn.functional.avg_pool1d(
|
|
x, ceil_mode=True, count_include_pad=True, kernel_size=1, stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
if TEST_CUDA:
|
|
y = torch.nn.functional.avg_pool1d(
|
|
x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=1, stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
|
|
def test_avg_pool2d_ceil_mode(self):
|
|
# Regression test for gh-36977
|
|
x = 10 * torch.randn((1, 16, 4, 4))
|
|
y = torch.nn.functional.avg_pool2d(
|
|
x, ceil_mode=True, count_include_pad=True, kernel_size=(1, 2),
|
|
padding=(0, 1), stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
if TEST_CUDA:
|
|
y = torch.nn.functional.avg_pool2d(
|
|
x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=(1, 2),
|
|
padding=(0, 1), stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
|
|
def test_avg_pool3d_ceil_mode(self):
|
|
# Regression test for gh-36977
|
|
x = 10 * torch.randn((1, 16, 4, 4, 4))
|
|
y = torch.nn.functional.avg_pool3d(
|
|
x, ceil_mode=True, count_include_pad=True, kernel_size=(1, 2, 3), stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
if TEST_CUDA:
|
|
y = torch.nn.functional.avg_pool3d(
|
|
x.to('cuda'), ceil_mode=True, count_include_pad=True, kernel_size=(1, 2, 3), stride=2)
|
|
self.assertTrue(not torch.isnan(y).any())
|
|
|
|
|
|
class TestNN(NNTestCase):
|
|
_do_cuda_memory_leak_check = True
|
|
_do_cuda_non_default_stream = True
|
|
|
|
def _forward(self, module, input: _TensorOrTensors):
|
|
with freeze_rng_state():
|
|
if isinstance(input, tuple):
|
|
return module(*input)
|
|
else:
|
|
return module(input)
|
|
|
|
def _backward(self, module, input: _TensorOrTensors, output, grad_output, create_graph=False):
|
|
output.backward(grad_output, retain_graph=True, create_graph=create_graph)
|
|
if isinstance(input, tuple):
|
|
return tuple(i.grad.data if i.grad is not None else None for i in input)
|
|
else:
|
|
return input.grad.data if input.grad is not None else None
|
|
|
|
def _forward_criterion(self, criterion, input, target, extra_args=None):
|
|
if extra_args is None:
|
|
extra_args = tuple()
|
|
if isinstance(input, tuple):
|
|
args = input + (target,) + extra_args
|
|
output = criterion(*args)
|
|
else:
|
|
output = criterion(input, target, *extra_args)
|
|
return output
|
|
|
|
def _backward_criterion(self, criterion, input, output, target, gradOutput=None, extra_args=None):
|
|
if extra_args is None:
|
|
extra_args = tuple()
|
|
input_tuple = input if isinstance(input, tuple) else (input,)
|
|
output_tuple = output if isinstance(output, tuple) else (output,)
|
|
for i in input_tuple:
|
|
if i.grad is not None:
|
|
i.grad.data.zero_()
|
|
args = input_tuple + (target,) + extra_args
|
|
if gradOutput is None:
|
|
gradOutput = torch.ones(())
|
|
criterion(*args).backward(gradOutput.to(output_tuple[0]))
|
|
if isinstance(input, tuple):
|
|
return tuple(i.grad.data for i in input)
|
|
else:
|
|
return input.grad.data
|
|
|
|
def _zero_grad_parameters(self, module):
|
|
for p in module.parameters():
|
|
if p.grad is not None:
|
|
with torch.no_grad():
|
|
p.grad.zero_()
|
|
p.grad.detach_()
|
|
|
|
def _get_parameters(self, module):
|
|
params = []
|
|
d_params = []
|
|
for p in module.parameters():
|
|
params.append(p)
|
|
d_params.append(p.grad)
|
|
return params, d_params
|
|
|
|
def _create_basic_net(self):
|
|
class Layer(nn.Module):
|
|
def __init__(self):
|
|
super(Layer, self).__init__()
|
|
self.layer_dummy_param = Parameter(torch.empty(3, 5))
|
|
self.register_buffer('layer_dummy_buf', torch.zeros(1, 3, 3, 7))
|
|
|
|
class Net(nn.Module):
|
|
def __init__(self):
|
|
super(Net, self).__init__()
|
|
self.l1 = Layer()
|
|
self.dummy_param = Parameter(torch.empty(3, 5))
|
|
self.register_buffer('dummy_buf', torch.zeros(7, 3, 3, 1))
|
|
|
|
l = Layer()
|
|
n = Net()
|
|
s = nn.Sequential(n, n)
|
|
|
|
return l, n, s
|
|
|
|
def test_requires_grad_(self):
|
|
m = self._create_basic_net()[-1]
|
|
assert len(list(m.buffers())) > 0, 'invalid test'
|
|
assert all(not b.requires_grad for b in m.buffers()) > 0, 'invalid test'
|
|
assert len(list(m.parameters())) > 0, 'invalid test'
|
|
assert all(p.requires_grad for p in m.parameters()) > 0, 'invalid test'
|
|
for requires_grad in (False, True):
|
|
self.assertIs(m.requires_grad_(requires_grad), m)
|
|
for p in m.parameters():
|
|
self.assertEqual(p.requires_grad, requires_grad)
|
|
for b in m.buffers():
|
|
self.assertFalse(b.requires_grad)
|
|
|
|
def test_module_backcompat(self):
|
|
from torch.serialization import SourceChangeWarning
|
|
path = download_file('https://download.pytorch.org/test_data/linear.pt')
|
|
with warnings.catch_warnings():
|
|
warnings.simplefilter('ignore', SourceChangeWarning)
|
|
m = torch.load(path)
|
|
input = torch.randn(2, 3, dtype=torch.float)
|
|
self.assertEqual(m(input).size(), (2, 5))
|
|
|
|
def test_conv_backcompat(self):
|
|
from torch.serialization import SourceChangeWarning
|
|
# This file was generated by running on PyTorch 1.0.1 on Python 2:
|
|
#
|
|
# import torch
|
|
# from torch import nn
|
|
# m = nn.Conv2d(1, 1, 1)
|
|
# torch.save(m, 'legacy_conv2d.pt')
|
|
#
|
|
# NB: This Pickle also contains some Unicode data!
|
|
path = download_file('https://download.pytorch.org/test_data/legacy_conv2d.pt')
|
|
with warnings.catch_warnings():
|
|
warnings.simplefilter('ignore', SourceChangeWarning)
|
|
m = torch.load(path, encoding='utf-8')
|
|
input = torch.randn((1, 1, 1, 1), dtype=torch.float)
|
|
self.assertEqual(m(input).size(), (1, 1, 1, 1))
|
|
|
|
def test_share_memory(self):
|
|
class Net(nn.Module):
|
|
def __init__(self):
|
|
super(Net, self).__init__()
|
|
self.p = nn.Parameter(torch.eye(5))
|
|
self.par = nn.ParameterList()
|
|
self.par.append(nn.Parameter(torch.randn(10)))
|
|
|
|
def forward(self, inp):
|
|
# NB: dead code
|
|
return inp.clone()
|
|
|
|
net = Net()
|
|
for p in net.parameters():
|
|
self.assertFalse(p.storage().is_shared())
|
|
for b in net.buffers():
|
|
self.assertFalse(b.storage().is_shared())
|
|
net.share_memory()
|
|
for p in net.parameters():
|
|
self.assertTrue(p.storage().is_shared())
|
|
for b in net.buffers():
|
|
self.assertTrue(b.storage().is_shared())
|
|
|
|
def _test_hooks(self, backward_register_fn):
|
|
module = nn.Sigmoid()
|
|
input = torch.ones(5, 5, requires_grad=True)
|
|
|
|
counter = {
|
|
'forwards': 0,
|
|
'backwards': 0
|
|
}
|
|
|
|
def fw_hook(inc, h_module, input, output):
|
|
self.assertIsInstance(input, tuple)
|
|
self.assertTrue(isinstance(output, torch.Tensor))
|
|
self.assertTrue(h_module is module)
|
|
self.assertEqual(input[0], torch.ones(5, 5))
|
|
self.assertEqual(output, torch.empty(5, 5).fill_(1 / (1 + 1 / math.e)))
|
|
counter['forwards'] += inc
|
|
|
|
def bw_hook(inc, h_module, grad_input, grad_output):
|
|
self.assertIsInstance(grad_input, tuple)
|
|
self.assertIsInstance(grad_output, tuple)
|
|
self.assertTrue(h_module is module)
|
|
self.assertEqual(grad_output[0], torch.ones(5, 5) * 2)
|
|
counter['backwards'] += inc
|
|
|
|
test_fwd = module.register_forward_hook(lambda *args: fw_hook(1, *args))
|
|
|
|
module(input)
|
|
module(input)
|
|
self.assertEqual(counter['forwards'], 2)
|
|
self.assertEqual(counter['backwards'], 0)
|
|
|
|
test_bwd = getattr(module, backward_register_fn)(
|
|
lambda *args: bw_hook(1, *args))
|
|
|
|
output = module(input)
|
|
self.assertEqual(counter['forwards'], 3)
|
|
self.assertEqual(counter['backwards'], 0)
|
|
|
|
output.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
self.assertEqual(counter['forwards'], 3)
|
|
self.assertEqual(counter['backwards'], 1)
|
|
|
|
output.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
self.assertEqual(counter['forwards'], 3)
|
|
self.assertEqual(counter['backwards'], 2)
|
|
|
|
test2_fwd = module.register_forward_hook(lambda *args: fw_hook(2, *args))
|
|
|
|
output = module(input)
|
|
self.assertEqual(counter['forwards'], 6)
|
|
self.assertEqual(counter['backwards'], 2)
|
|
|
|
test2_bwd = getattr(module, backward_register_fn)(lambda *args: bw_hook(2, *args))
|
|
|
|
module(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 9)
|
|
self.assertEqual(counter['backwards'], 5)
|
|
|
|
test2_bwd.remove()
|
|
|
|
module(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 12)
|
|
self.assertEqual(counter['backwards'], 6)
|
|
|
|
test2_fwd.remove()
|
|
|
|
module(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 13)
|
|
self.assertEqual(counter['backwards'], 7)
|
|
|
|
test_fwd.remove()
|
|
test_bwd.remove()
|
|
|
|
def test_hooks(self):
|
|
self._test_hooks("register_backward_hook")
|
|
self._test_hooks("register_full_backward_hook")
|
|
|
|
def test_hook_cpp(self):
|
|
bn = nn.BatchNorm1d(5)
|
|
|
|
def hook(module, grad_inputs, grad_outputs):
|
|
self.assertEqual(len(grad_inputs), 1)
|
|
self.assertEqual(len(grad_outputs), 1)
|
|
self.assertEqual(module, bn)
|
|
|
|
bn.register_full_backward_hook(hook)
|
|
output = bn(torch.randn(5, 5, requires_grad=True))
|
|
output.sum().backward()
|
|
|
|
def test_hook_invalid_outputs(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
|
|
def bw_fail1(self, grad_input, grad_output):
|
|
return grad_input[:-1]
|
|
|
|
def bw_fail2(self, grad_input, grad_output):
|
|
return grad_input + (torch.randn(2, 2),)
|
|
|
|
with module.register_backward_hook(bw_fail1):
|
|
with self.assertRaisesRegex(RuntimeError, 'got 0, but expected 1'):
|
|
module(input).sum().backward()
|
|
|
|
with module.register_backward_hook(bw_fail2):
|
|
with self.assertRaisesRegex(RuntimeError, 'got 2, but expected 1'):
|
|
module(input).sum().backward()
|
|
|
|
def test_hook_requires_grad(self):
|
|
test_self = self
|
|
|
|
class MyModule(nn.Module):
|
|
def forward(self, arg1, arg2, arg3):
|
|
test_self.assertTrue(arg1.requires_grad)
|
|
test_self.assertFalse(arg2.requires_grad)
|
|
test_self.assertTrue(arg3.requires_grad)
|
|
return arg1.sum() + arg2.sum() + arg3.sum()
|
|
|
|
inp = torch.rand(2, requires_grad=True)
|
|
mod = MyModule()
|
|
|
|
mod(inp, inp.detach(), inp)
|
|
# Ensure that requires grad is properly propagated
|
|
mod.register_full_backward_hook(lambda mod, gI, gO: None)
|
|
mod(inp, inp.detach(), inp)
|
|
|
|
def test_hook_no_requires_grad(self):
|
|
mod = nn.Linear(2, 3)
|
|
|
|
inp = torch.rand(1, 2)
|
|
|
|
return_val = "None"
|
|
hook_called = [0]
|
|
|
|
def hook(mod, grad_input, grad_output):
|
|
hook_called[0] += 1
|
|
for gI in grad_input:
|
|
self.assertIsNone(gI)
|
|
for gO in grad_output:
|
|
self.assertEqual(gO.size(), (1, 3))
|
|
|
|
if return_val == "grad_input":
|
|
return grad_input
|
|
elif return_val == "invalid":
|
|
# If the inputs were requiring gradients, this would be
|
|
# a valid return
|
|
return inp
|
|
elif return_val == "None":
|
|
return None
|
|
else:
|
|
raise RuntimeError("Invalid return_val string")
|
|
|
|
mod.register_full_backward_hook(hook)
|
|
|
|
# This should run and trigger the hook properly
|
|
mod(inp).sum().backward()
|
|
self.assertEqual(hook_called[0], 1)
|
|
|
|
return_val = "grad_input"
|
|
|
|
mod(inp).sum().backward()
|
|
self.assertEqual(hook_called[0], 2)
|
|
|
|
return_val = "invalid"
|
|
with self.assertRaisesRegex(RuntimeError, "where no input requires gradient"):
|
|
mod(inp).sum().backward()
|
|
|
|
def test_hook_last_arg_requires_grad(self):
|
|
mod = nn.L1Loss()
|
|
inp = torch.rand(1, requires_grad=True)
|
|
mod.register_full_backward_hook(lambda m, gI, gO: None)
|
|
|
|
try:
|
|
mod(inp.detach(), inp)
|
|
except Exception as ex:
|
|
self.fail("Unexpected exception: %s" % ex)
|
|
|
|
def test_hook_extra_input(self):
|
|
class MyModule(nn.Module):
|
|
def forward(self, non_tensor, tensor):
|
|
return tensor.clone(), non_tensor
|
|
|
|
inp = torch.rand(2, requires_grad=True)
|
|
mod = MyModule()
|
|
|
|
def hook(mod, grad_input, grad_output):
|
|
self.assertIsNone(grad_input[0])
|
|
self.assertIsInstance(grad_input[1], torch.Tensor)
|
|
|
|
self.assertIsInstance(grad_output[0], torch.Tensor)
|
|
self.assertIsNone(grad_output[1])
|
|
|
|
mod.register_full_backward_hook(hook)
|
|
out, _ = mod(True, inp)
|
|
out.sum().backward()
|
|
|
|
def test_hook_inplace(self):
|
|
class MyModule(nn.Module):
|
|
def forward(self, inp, do_inplace):
|
|
self.inp = inp
|
|
if do_inplace:
|
|
inp += 1
|
|
return inp.clone()
|
|
|
|
hook_called = [0]
|
|
|
|
def hook(mod, grad_input, grad_output):
|
|
hook_called[0] += 1
|
|
|
|
inp = torch.rand(10, requires_grad=True)
|
|
mod = MyModule()
|
|
mod.register_full_backward_hook(hook)
|
|
|
|
# No inplace should work
|
|
mod(inp, False).sum().backward()
|
|
self.assertEqual(hook_called[0], 1)
|
|
|
|
# Input inplace error should throw an error
|
|
with self.assertRaisesRegex(RuntimeError, "Output 0 of BackwardHookFunctionBackward is "
|
|
"a view and is being modified inplace."):
|
|
mod(inp.clone(), True)
|
|
|
|
# Input inplace error should throw an error if we try to re-use the view after they have
|
|
# been modified
|
|
local_inp = inp.clone()
|
|
out = mod(local_inp, False)
|
|
local_inp[0] *= 1
|
|
with self.assertRaisesRegex(RuntimeError, "Output 0 of BackwardHookFunctionBackward is "
|
|
"a view and its base or another view"):
|
|
# Any operation involving the view will fail here
|
|
mod.inp + 2
|
|
|
|
# Output inplace error should throw an error
|
|
out = mod(inp, False)
|
|
with self.assertRaisesRegex(RuntimeError, "BackwardHookFunctionBackward is a view "
|
|
"and is being modified inplace."):
|
|
out += 1
|
|
|
|
def test_hook_non_full_warning(self):
|
|
def noop(*args):
|
|
pass
|
|
|
|
a = torch.rand(2, requires_grad=True)
|
|
b = torch.rand(2, requires_grad=True)
|
|
|
|
# Check invalid input container
|
|
class MyModule(nn.Module):
|
|
def forward(self, l):
|
|
return l[0].clone(), l[1].clone()
|
|
|
|
m = MyModule()
|
|
m.register_backward_hook(noop)
|
|
|
|
with self.assertWarnsRegex(UserWarning, "does not take as input a single Tensor or a tuple of Tensors"):
|
|
m([a, b])
|
|
|
|
# Check invalid output container
|
|
class MyModule(nn.Module):
|
|
def forward(self, a, b):
|
|
return [a.clone(), b.clone()]
|
|
|
|
m = MyModule()
|
|
m.register_backward_hook(noop)
|
|
|
|
with self.assertWarnsRegex(UserWarning, "does not return a single Tensor or a tuple of Tensors"):
|
|
m(a, b)
|
|
|
|
# Check invalid output from different Nodes
|
|
class MyModule(nn.Module):
|
|
def forward(self, a, b):
|
|
return a.clone(), b.clone()
|
|
|
|
m = MyModule()
|
|
m.register_backward_hook(noop)
|
|
|
|
with self.assertWarnsRegex(UserWarning, "outputs are generated by different autograd Nodes"):
|
|
m(a, b)
|
|
|
|
# Check invalid forward with multiple Nodes
|
|
class MyModule(nn.Module):
|
|
def forward(self, a):
|
|
return a.clone().clone()
|
|
|
|
m = MyModule()
|
|
m.register_backward_hook(noop)
|
|
|
|
with self.assertWarnsRegex(UserWarning, "the forward contains multiple autograd Nodes"):
|
|
m(a)
|
|
|
|
def test_hook_backward_size(self):
|
|
# Make module with multiple operations in forward
|
|
# And different size for input and outputs
|
|
class MyModule(nn.Module):
|
|
def forward(self, arg1, arg2):
|
|
tmp = arg1.sum() * arg2
|
|
tmp = tmp + arg2.sum() * arg1.sum()
|
|
tmp = tmp.sum().view(1)
|
|
tmp = tmp.expand(8).contiguous()
|
|
return tmp
|
|
|
|
module = MyModule()
|
|
inp1 = torch.randn(5, 5, requires_grad=True)
|
|
inp2 = torch.randn(10, 10, requires_grad=True)
|
|
|
|
def bw_hook(module, grad_input, grad_output):
|
|
self.assertEqual(len(grad_input), 2)
|
|
self.assertEqual(grad_input[0].size(), torch.Size([5, 5]))
|
|
self.assertEqual(grad_input[1].size(), torch.Size([10, 10]))
|
|
self.assertEqual(len(grad_output), 1)
|
|
self.assertEqual(grad_output[0].size(), torch.Size([8]))
|
|
|
|
with module.register_full_backward_hook(bw_hook):
|
|
module(inp1, inp2).sum().backward()
|
|
|
|
def test_hook_backward_writeable(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
sig_x = torch.nn.functional.sigmoid(input)
|
|
|
|
def bw_hook(module, grad_input, grad_output):
|
|
for grad in grad_input:
|
|
self.assertTrue(isinstance(grad, torch.Tensor))
|
|
for grad in grad_output:
|
|
self.assertTrue(isinstance(grad, torch.Tensor))
|
|
return tuple(gi * 2 for gi in grad_input)
|
|
|
|
module.register_backward_hook(bw_hook)
|
|
module(input).backward(torch.ones(5, 5))
|
|
expected_grad = sig_x * (1 - sig_x) * 2
|
|
self.assertEqual(input.grad, expected_grad)
|
|
|
|
def test_hook_forward_preforward_writable(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
sig_x = torch.nn.functional.sigmoid(input)
|
|
|
|
def forward_pre_hook(m, input):
|
|
return torch.nn.functional.relu(input[0])
|
|
|
|
def forward_hook(m, input, output):
|
|
return -output
|
|
|
|
module.register_forward_pre_hook(forward_pre_hook)
|
|
module.register_forward_hook(forward_hook)
|
|
output = module(input)
|
|
expected_res = -torch.nn.functional.sigmoid(torch.nn.functional.relu(input))
|
|
self.assertEqual(output, expected_res)
|
|
output.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
mask = (input > 0).double()
|
|
expected_grad = -sig_x * (1 - sig_x) * 2 * mask
|
|
self.assertEqual(input.grad, expected_grad)
|
|
|
|
def test_to(self):
|
|
m = nn.Linear(3, 5)
|
|
self.assertIs(m, m.to('cpu'))
|
|
self.assertIs(m, m.to('cpu', dtype=torch.float32))
|
|
self.assertEqual(m.double(), m.to(torch.float64))
|
|
self.assertRaises(RuntimeError, lambda: m.to('cpu', copy=True))
|
|
|
|
if torch.cuda.is_available():
|
|
for cuda in ['cuda', 'cuda:0' if torch.cuda.device_count() == 1 else 'cuda:1']:
|
|
m2 = m.cuda(device=cuda)
|
|
self.assertIs(m2, m2.to(cuda))
|
|
self.assertEqual(m, m2.to('cpu'))
|
|
self.assertEqual(m2, m.to(cuda))
|
|
self.assertIs(m2, m2.to(dtype=torch.float32))
|
|
self.assertEqual(m2.double(), m2.to(dtype=torch.float64))
|
|
|
|
def test_zero_grad(self):
|
|
i = torch.randn(2, 5, requires_grad=True)
|
|
module = nn.Linear(5, 5)
|
|
for p in module.parameters():
|
|
p.requires_grad = False
|
|
module.zero_grad()
|
|
|
|
module.weight.requires_grad = True
|
|
module.zero_grad()
|
|
self.assertIsNone(module.weight.grad) # uninitialized grad
|
|
|
|
module(i).sum().backward()
|
|
self.assertIsNotNone(module.weight.grad)
|
|
self.assertGreater(module.weight.grad.data.abs().sum(), 0)
|
|
module.zero_grad()
|
|
self.assertEqual(module.weight.grad.data, module.weight.data.clone().zero_())
|
|
|
|
module.bias.requires_grad = True
|
|
module.zero_grad()
|
|
self.assertIsNotNone(module.weight.grad)
|
|
self.assertIsNone(module.bias.grad)
|
|
module(i).sum().backward()
|
|
self.assertIsNotNone(module.weight.grad)
|
|
self.assertIsNotNone(module.bias.grad)
|
|
self.assertGreater(module.weight.grad.data.abs().sum(), 0)
|
|
self.assertGreater(module.bias.grad.data.abs().sum(), 0)
|
|
module.zero_grad()
|
|
self.assertEqual(module.weight.grad.data, module.weight.data.clone().zero_())
|
|
self.assertEqual(module.bias.grad.data, module.bias.data.clone().zero_())
|
|
|
|
# Force set to None.
|
|
module.zero_grad(set_to_none=True)
|
|
self.assertIsNone(module.weight.grad)
|
|
|
|
|
|
def test_no_grad(self):
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
module = nn.Conv2d(2, 5, kernel_size=3, padding=1).to(dtype)
|
|
input = torch.randn(1, 2, 10, 10).to(dtype)
|
|
x = input
|
|
y = input.clone()
|
|
|
|
output = module(x)
|
|
self.assertTrue(output.requires_grad)
|
|
output.backward(torch.ones(1, 5, 10, 10))
|
|
|
|
with torch.no_grad():
|
|
output2 = module(y)
|
|
self.assertFalse(output2.requires_grad)
|
|
self.assertRaises(RuntimeError, lambda: output2.backward(torch.ones(1, 5, 10, 10)))
|
|
|
|
def test_invalid_conv1d(self):
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
module = nn.Conv1d(in_channels=3, out_channels=33, kernel_size=10, stride=1, bias=True).to(dtype)
|
|
input = torch.randn(1, 3, 4).to(dtype)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r'Calculated padded input size per channel: \(4\). ' +
|
|
r'Kernel size: \(10\). Kernel size can\'t be greater than actual input size'):
|
|
module(input)
|
|
|
|
# Negative stride check
|
|
module = nn.Conv1d(in_channels=3, out_channels=6, kernel_size=3, stride=-1, bias=True).to(dtype)
|
|
input = torch.randn(1, 3, 4).to(dtype)
|
|
with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'):
|
|
module(input)
|
|
|
|
def test_mismatch_shape_conv2d(self):
|
|
x = torch.randn(1, 10, 1, 28, 28)
|
|
w = torch.randn(6, 1, 5, 5)
|
|
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r'Expected 4-dimensional input for 4-dimensional weight \[6, 1, 5, 5\],' +
|
|
r' but got 5-dimensional input of size \[1, 10, 1, 28, 28\] instead'):
|
|
|
|
F.conv2d(x, w)
|
|
|
|
def test_conv2d_discontiguous_weight(self):
|
|
# Test for https://github.com/pytorch/pytorch/issues/55781
|
|
x = torch.ones(64, 16, 16, 16)
|
|
weight = torch.arange(0, 1.0, 1 / 2.0 ** 10).reshape(32, 16, 1, 2)[:, :, :, ::2]
|
|
self.assertFalse(weight.is_contiguous())
|
|
y = torch.nn.functional.conv2d(x, weight, None)
|
|
if torch.backends.mkldnn.is_available():
|
|
# Disable MKLDNN explicitly, so that either NNPACK or THCNN will be used
|
|
with torch.backends.mkldnn.flags(enabled=False):
|
|
y_ = torch.nn.functional.conv2d(x, weight, None)
|
|
self.assertEqual(y, y_)
|
|
self.assertEqual(y.sum(), 4186112.)
|
|
|
|
def test_invalid_conv2d(self):
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
module = torch.nn.Conv2d(1, 1, kernel_size=3, dilation=2, stride=2).to(dtype)
|
|
input = torch.empty(1, 1, 4, 4).to(dtype)
|
|
self.assertRaises(RuntimeError, lambda: module(input))
|
|
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, stride=1, bias=True)
|
|
input = torch.randn(1, 3, 1, 1)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r'Calculated padded input size per channel: \(1 x 1\). ' +
|
|
r'Kernel size: \(10 x 10\). Kernel size can\'t be greater than actual input size'):
|
|
module(input)
|
|
|
|
# Negative stride check
|
|
module = nn.Conv2d(in_channels=3, out_channels=6, kernel_size=4, stride=-1, bias=True).to(dtype)
|
|
input = torch.randn(1, 3, 4, 4).to(dtype)
|
|
with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'):
|
|
module(input)
|
|
|
|
# Zero stride check
|
|
module = nn.Conv2d(in_channels=3, out_channels=6, kernel_size=4, stride=0, bias=True).to(dtype)
|
|
input = torch.randn(1, 3, 4, 4).to(dtype)
|
|
with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'):
|
|
module(input)
|
|
|
|
def test_invalid_conv3d(self):
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
module = torch.nn.Conv3d(1, 1, kernel_size=3, dilation=2, stride=2).to(dtype)
|
|
input = torch.empty(1, 1, 4, 4, 4).to(dtype)
|
|
self.assertRaises(RuntimeError, lambda: module(input))
|
|
|
|
# Negative stride check
|
|
module = torch.nn.Conv3d(1, 1, kernel_size=3, stride=-2)
|
|
input = torch.empty(1, 1, 4, 4, 4)
|
|
with self.assertRaisesRegex(RuntimeError, 'non-positive stride is not supported'):
|
|
module(input)
|
|
|
|
def test_Conv1d_module_same_padding(self):
|
|
# Compare module against functional: without strides/dilation, asymmetric padding
|
|
x = torch.rand(1, 1, 20)
|
|
module = nn.Conv1d(in_channels=1, out_channels=1, kernel_size=10,
|
|
padding='same')
|
|
expect = F.conv1d(x, module.weight, module.bias, padding='same')
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# Test dilation, symmetric padding
|
|
module = nn.Conv1d(in_channels=1, out_channels=1, kernel_size=10,
|
|
padding='same', dilation=2)
|
|
expect = F.conv1d(x, module.weight, module.bias, padding='same', dilation=2)
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# Test non-zero padding_mode, requiring explicit padding
|
|
module = nn.Conv1d(in_channels=1, out_channels=1, kernel_size=10,
|
|
padding='same', padding_mode='replicate')
|
|
x_padded = F.pad(x, [4, 5], mode='replicate')
|
|
expect = F.conv1d(x_padded, module.weight, module.bias, padding='valid')
|
|
self.assertEqual(expect, module(x))
|
|
self.assertEqual(x.size(), expect.size())
|
|
|
|
# Test connstruction with invalid padding string raises
|
|
with self.assertRaisesRegex(ValueError, 'Invalid padding string'):
|
|
module = nn.Conv1d(in_channels=3, out_channels=33, kernel_size=10, padding='foo')
|
|
|
|
# Test connstruction with same padding and strides raises
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv1d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=2)
|
|
|
|
def test_Conv2d_module_same_padding(self):
|
|
# Compare module against functional:
|
|
# without strides/dilation, both symmetric and asymmetric padding
|
|
x = torch.rand(1, 1, 9, 20)
|
|
module = nn.Conv2d(in_channels=1, out_channels=1, kernel_size=(5, 10),
|
|
padding='same')
|
|
expect = F.conv2d(x, module.weight, module.bias, padding='same')
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# with dilation, symmetric padding
|
|
module = nn.Conv2d(in_channels=1, out_channels=1, kernel_size=(3, 4),
|
|
padding='same', dilation=(1, 2))
|
|
expect = F.conv2d(x, module.weight, module.bias, padding='same', dilation=(1, 2))
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# Test non-zero padding_mode, requiring explicit padding
|
|
module = nn.Conv2d(in_channels=1, out_channels=1, kernel_size=(3, 4),
|
|
padding='same', padding_mode='reflect')
|
|
x_padded = F.pad(x, [1, 2, 1, 1], mode='reflect')
|
|
expect = F.conv2d(x_padded, module.weight, module.bias, padding='valid')
|
|
self.assertEqual(expect, module(x))
|
|
self.assertEqual(x.size(), expect.size())
|
|
|
|
# Test connstruction with invalid padding string raises
|
|
with self.assertRaisesRegex(ValueError, 'Invalid padding string'):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='foo')
|
|
|
|
# Test connstruction with same padding and strides raises
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=2)
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=(1, 3))
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=(4, 1))
|
|
|
|
def test_Conv3d_module_same_padding(self):
|
|
# Compare module against functional:
|
|
x = torch.rand(1, 1, 4, 4, 4)
|
|
# without dilation, both symmetric and asymmetric padding
|
|
module = nn.Conv3d(in_channels=1, out_channels=1, kernel_size=(2, 3, 4),
|
|
padding='same')
|
|
expect = F.conv3d(x, module.weight, module.bias, padding='same')
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# with dilation, both symmetric and asymmetric padding
|
|
module = nn.Conv3d(in_channels=1, out_channels=1, kernel_size=(2, 3, 4),
|
|
padding='same', dilation=(3, 2, 1))
|
|
expect = F.conv3d(x, module.weight, module.bias, padding='same', dilation=(3, 2, 1))
|
|
self.assertEqual(expect, module(x))
|
|
|
|
# Test non-zero padding_mode, requiring explicit padding
|
|
module = nn.Conv3d(in_channels=1, out_channels=1, kernel_size=(2, 3, 4),
|
|
padding='same', padding_mode='circular')
|
|
x_padded = F.pad(x, [1, 2, 1, 1, 0, 1], mode='circular')
|
|
expect = F.conv3d(x_padded, module.weight, module.bias, padding='valid')
|
|
self.assertEqual(expect, module(x))
|
|
self.assertEqual(x.size(), expect.size())
|
|
|
|
# Test connstruction with invalid padding string raises
|
|
with self.assertRaisesRegex(ValueError, 'Invalid padding string'):
|
|
module = nn.Conv3d(in_channels=3, out_channels=33, kernel_size=10, padding='foo')
|
|
|
|
# Test connstruction with same padding and strides raises
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=2)
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=(1, 1, 3))
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=(1, 4, 1))
|
|
with self.assertRaisesRegex(ValueError, "padding='same'"):
|
|
module = nn.Conv2d(in_channels=3, out_channels=33, kernel_size=10, padding='same', stride=(5, 1, 1))
|
|
|
|
def _test_alpha_dropout(self, cls, input):
|
|
mean = input.mean()
|
|
std = input.std()
|
|
|
|
for p in [0.2, 0.5, 0.8]:
|
|
module = cls(p)
|
|
input_var = input.detach().clone().requires_grad_()
|
|
output = module(input_var)
|
|
# output mean should be close to input mean
|
|
self.assertLess(abs(output.data.mean() - mean), 0.1)
|
|
# output std should be close to input std
|
|
self.assertLess(abs(output.data.std() - std), 0.1)
|
|
output.backward(input)
|
|
|
|
def test_parameters_and_named_parameters(self):
|
|
def names(named_parameters):
|
|
return [k for k, _ in named_parameters]
|
|
|
|
l, n, s = self._create_basic_net()
|
|
|
|
self.assertEqual(len(list(l.parameters())), 1)
|
|
self.assertEqual(
|
|
names(l.named_parameters()),
|
|
['layer_dummy_param'])
|
|
|
|
self.assertEqual(len(list(n.parameters())), 2)
|
|
self.assertEqual(
|
|
names(n.named_parameters()),
|
|
['dummy_param', 'l1.layer_dummy_param'])
|
|
|
|
self.assertEqual(len(list(n.parameters(recurse=False))), 1)
|
|
self.assertEqual(
|
|
names(n.named_parameters(recurse=False)),
|
|
['dummy_param'])
|
|
|
|
self.assertEqual(len(list(s.parameters())), 2)
|
|
self.assertEqual(
|
|
names(s.named_parameters()),
|
|
['0.dummy_param', '0.l1.layer_dummy_param'])
|
|
|
|
def test_buffers_and_named_buffers(self):
|
|
def names(named_buffers):
|
|
return [k for k, _ in named_buffers]
|
|
|
|
l, n, s = self._create_basic_net()
|
|
|
|
self.assertEqual(len(list(l.buffers())), 1)
|
|
self.assertEqual(
|
|
names(l.named_buffers()),
|
|
['layer_dummy_buf'])
|
|
|
|
self.assertEqual(len(list(n.buffers())), 2)
|
|
self.assertEqual(
|
|
names(n.named_buffers()),
|
|
['dummy_buf', 'l1.layer_dummy_buf'])
|
|
|
|
self.assertEqual(len(list(n.buffers(recurse=False))), 1)
|
|
self.assertEqual(
|
|
names(n.named_buffers(recurse=False)),
|
|
['dummy_buf'])
|
|
|
|
self.assertEqual(len(list(s.buffers())), 2)
|
|
self.assertEqual(
|
|
names(s.named_buffers()),
|
|
['0.dummy_buf', '0.l1.layer_dummy_buf'])
|
|
|
|
def test_call_supports_python_dict_output(self):
|
|
class Net(nn.Module):
|
|
def __init__(self):
|
|
super(Net, self).__init__()
|
|
self.l1 = nn.Linear(10, 20)
|
|
self.register_backward_hook(self.hook)
|
|
self.check_backward_hook_flag = False
|
|
|
|
def hook(self, module, grad_out, grad_in):
|
|
self.check_backward_hook_flag = True
|
|
|
|
def forward(self, inputs):
|
|
return {"output": self.l1(inputs).sum()}
|
|
|
|
net = Net()
|
|
model_output = net(torch.randn([5, 10]))
|
|
model_output["output"].backward()
|
|
self.assertTrue(net.check_backward_hook_flag)
|
|
|
|
def test_children(self):
|
|
l1 = nn.Linear(2, 2)
|
|
l2 = nn.Linear(2, 2)
|
|
l3 = nn.Linear(2, 2)
|
|
l4 = nn.Linear(2, 2)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(l1, l2, l1, l2, subnet)
|
|
self.assertEqual(list(s.children()), [l1, l2, subnet])
|
|
|
|
def test_train_errors_for_invalid_mode(self):
|
|
class SubclassNet(nn.Module):
|
|
def __init__(self):
|
|
super(SubclassNet, self).__init__()
|
|
self.l1 = nn.Linear(2, 2)
|
|
|
|
def forward(self, inputs):
|
|
return self.l1(inputs)
|
|
|
|
subclass_net = SubclassNet()
|
|
sequential_net = nn.Sequential(nn.Linear(2, 2), nn.Linear(2, 2))
|
|
|
|
error_modes = ["invalid_str", torch.device('cpu')]
|
|
modules_to_check = [subclass_net, sequential_net]
|
|
|
|
for error_mode, module in itertools.product(error_modes, modules_to_check):
|
|
with self.assertRaises(ValueError):
|
|
module.train(error_mode)
|
|
|
|
def test_dir(self):
|
|
linear = nn.Linear(2, 2)
|
|
linear._test_submodule = nn.Linear(2, 2)
|
|
linear._test_parameter = Parameter(torch.empty(2, 2))
|
|
linear.register_buffer('_test_buffer', torch.empty(2, 2))
|
|
keys = dir(linear)
|
|
self.assertIn('_test_submodule', keys)
|
|
self.assertIn('_test_parameter', keys)
|
|
self.assertIn('_test_buffer', keys)
|
|
|
|
for key in keys:
|
|
self.assertTrue(hasattr(linear, key))
|
|
|
|
def test_repr(self):
|
|
# no extra information or sub-modules
|
|
empty_sequential = nn.Sequential()
|
|
expected_repr_empty = 'Sequential()'
|
|
self.assertEqual(repr(empty_sequential), expected_repr_empty)
|
|
|
|
# one liner extra information
|
|
linear = nn.Linear(1, 1)
|
|
expected_repr_linear = 'Linear(in_features=1, out_features=1, bias=True)'
|
|
self.assertEqual(repr(linear), expected_repr_linear)
|
|
|
|
# sub-modules repr
|
|
sequential = nn.Sequential(linear)
|
|
expected_repr_sequential = 'Sequential(\n' \
|
|
' (0): Linear(in_features=1, out_features=1, bias=True)\n' \
|
|
')'
|
|
self.assertEqual(repr(sequential), expected_repr_sequential)
|
|
|
|
def test_dir_digit(self):
|
|
model = nn.Sequential(nn.Linear(2, 2))
|
|
keys = dir(model)
|
|
self.assertNotIn('0', keys)
|
|
|
|
def test_named_children(self):
|
|
l1 = nn.Linear(2, 2)
|
|
l2 = nn.Linear(2, 2)
|
|
l3 = nn.Linear(2, 2)
|
|
l4 = nn.Linear(2, 2)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential()
|
|
with self.assertRaises(KeyError):
|
|
s.add_module('', l1)
|
|
with self.assertRaises(KeyError):
|
|
s.add_module('name.with.dot', l1)
|
|
s.add_module('layer1', l1)
|
|
s.add_module('layer2', l2)
|
|
s.add_module('layer3', l1)
|
|
s.add_module('layer4', l2)
|
|
s.add_module('subnet', subnet)
|
|
self.assertEqual(list(s.named_children()), [('layer1', l1), ('layer2', l2), ('subnet', subnet)])
|
|
|
|
def test_modules(self):
|
|
class Net(nn.Module):
|
|
def __init__(self):
|
|
super(Net, self).__init__()
|
|
self.l1 = l
|
|
self.l2 = l
|
|
self.param = torch.empty(3, 5)
|
|
|
|
l = nn.Linear(10, 20)
|
|
n = Net()
|
|
s = nn.Sequential(n, n, n, n)
|
|
self.assertEqual(list(s.modules()), [s, n, l])
|
|
|
|
def test_named_modules(self):
|
|
class Net(nn.Module):
|
|
def __init__(self):
|
|
super(Net, self).__init__()
|
|
self.l1 = l
|
|
self.l2 = l
|
|
self.param = torch.empty(3, 5)
|
|
self.block = block
|
|
l = nn.Linear(10, 20)
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(10, 20)
|
|
block = nn.Sequential()
|
|
block.add_module('linear1', l1)
|
|
block.add_module('linear2', l2)
|
|
n = Net()
|
|
s = nn.Sequential(n, n)
|
|
self.assertEqual(list(s.named_modules()), [('', s), ('0', n), ('0.l1', l),
|
|
('0.block', block), ('0.block.linear1', l1),
|
|
('0.block.linear2', l2)])
|
|
# test the option to not remove duplicate module instances
|
|
self.assertEqual(list(s.named_modules(remove_duplicate=False)), [
|
|
('', s), ('0', n), ('0.l1', l), ('0.l2', l),
|
|
('0.block', block), ('0.block.linear1', l1),
|
|
('0.block.linear2', l2),
|
|
('1', n), ('1.l1', l), ('1.l2', l),
|
|
('1.block', block), ('1.block.linear1', l1),
|
|
('1.block.linear2', l2)])
|
|
|
|
def test_register_buffer_raises_error_if_name_is_not_string(self):
|
|
m = nn.Module()
|
|
expected_error = 'buffer name should be a string. Got '
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'int'):
|
|
m.register_buffer(1, torch.rand(5))
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'):
|
|
m.register_buffer(None, torch.rand(5))
|
|
|
|
def test_register_buffer_raises_error_if_attr_exists(self):
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
del m.attribute_name
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
del m.attribute_name
|
|
m.add_module('attribute_name', nn.Module())
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
def test_register_buffer_raises_error_if_not_tensor(self):
|
|
m = nn.Module()
|
|
with self.assertRaises(TypeError):
|
|
m.register_buffer('attribute_name', 5)
|
|
|
|
def test_register_buffer_allows_overwriting_with_same_name(self):
|
|
m = nn.Module()
|
|
buffer1 = torch.rand(5)
|
|
buffer2 = buffer1 + 5
|
|
buffer3 = None
|
|
m.register_buffer('buffer_name', buffer1)
|
|
self.assertEqual(m.buffer_name, buffer1)
|
|
m.register_buffer('buffer_name', buffer2)
|
|
self.assertEqual(m.buffer_name, buffer2)
|
|
m.register_buffer('buffer_name', buffer3)
|
|
self.assertEqual(m.buffer_name, buffer3)
|
|
|
|
def test_buffer_not_persistent(self):
|
|
m = nn.Module()
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
def test_buffer_not_persistent_del(self):
|
|
m = nn.Module()
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
del m.buf
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
|
|
def test_buffer_not_persistent_overwrite(self):
|
|
m = nn.Module()
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
m.register_buffer('buf', torch.rand(5))
|
|
|
|
# can we overwrite a non-persistent buffer with a persistent one?
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 1)
|
|
|
|
# can we overwrite a persistent buffer with a non-persistent one?
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
def test_buffer_not_persistent_assign(self):
|
|
m = nn.Module()
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
|
|
# Assigning None removes the buffer but if we then assign a new Tensor
|
|
# to the same property, it should still be marked as a buffer.
|
|
m.buf = None
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
m.buf = torch.rand(5)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
# Assigning a Parameter removes the buffer.
|
|
m.buf = nn.Parameter(torch.rand(5))
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
self.assertTrue(len(m.state_dict()) == 1)
|
|
|
|
def test_buffer_not_persistent_load(self):
|
|
m = nn.Module()
|
|
m.register_buffer('buf', torch.rand(5), persistent=False)
|
|
m.load_state_dict({})
|
|
|
|
def test_register_parameter_raises_error_if_name_is_not_string(self):
|
|
m = nn.Module()
|
|
expected_error = 'parameter name should be a string. Got '
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'int'):
|
|
m.register_parameter(1, nn.Parameter())
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'):
|
|
m.register_parameter(None, nn.Parameter())
|
|
|
|
def test_register_parameter_raises_error_if_attr_exists(self):
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
del m.attribute_name
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
del m.attribute_name
|
|
m.add_module('attribute_name', nn.Module())
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
def test_register_parameter_allows_overwriting_with_same_name(self):
|
|
m = nn.Module()
|
|
param1 = nn.Parameter(torch.rand(5))
|
|
param2 = nn.Parameter(param1.data + 5)
|
|
param3 = None
|
|
m.register_parameter('param_name', param1)
|
|
self.assertEqual(m.param_name, param1)
|
|
m.register_parameter('param_name', param2)
|
|
self.assertEqual(m.param_name, param2)
|
|
m.register_parameter('param_name', param3)
|
|
self.assertEqual(m.param_name, param3)
|
|
|
|
def test_add_module_raises_error_if_attr_exists(self):
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
m.add_module('attribute_name', nn.Module())
|
|
|
|
del m.attribute_name
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
with self.assertRaises(KeyError):
|
|
m.add_module('attribute_name', nn.Module())
|
|
|
|
del m.attribute_name
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
with self.assertRaises(KeyError):
|
|
m.add_module('attribute_name', nn.Module())
|
|
|
|
@unittest.expectedFailure
|
|
def test_getattr_with_property(self):
|
|
class Model(nn.Module):
|
|
@property
|
|
def some_property(self):
|
|
return self.something_that_doesnt_exist
|
|
|
|
model = Model()
|
|
|
|
with self.assertRaisesRegex(
|
|
AttributeError,
|
|
r"'Model' object has no attribute 'something_that_doesnt_exist'"):
|
|
model.some_property
|
|
|
|
def test_Sequential_getitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
self.assertIs(n[0], l1)
|
|
self.assertIs(n[1], l2)
|
|
self.assertIs(n[2], l3)
|
|
self.assertIs(n[3], l4)
|
|
self.assertIs(n[torch.tensor(3, dtype=torch.int64)], l4)
|
|
self.assertEqual(n[1:], nn.Sequential(l2, l3, l4))
|
|
self.assertEqual(n[3:], nn.Sequential(l4))
|
|
self.assertEqual(n[:-1], nn.Sequential(l1, l2, l3))
|
|
self.assertEqual(n[:-3], nn.Sequential(l1))
|
|
self.assertEqual(n[::-1], nn.Sequential(l4, l3, l2, l1))
|
|
|
|
def test_Sequential_setitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3)
|
|
n[0] = l4
|
|
n[-1] = l4
|
|
n[torch.tensor(1, dtype=torch.int16)] = l1
|
|
self.assertIs(n[0], l4)
|
|
self.assertIs(n[1], l1)
|
|
self.assertIs(n[2], l4)
|
|
|
|
def test_Sequential_setitem_named(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(OrderedDict([
|
|
('linear1', l1),
|
|
('linear2', l2),
|
|
('linear3', l3),
|
|
]))
|
|
|
|
n[0] = l4
|
|
n[-1] = l4
|
|
self.assertEqual(n.linear1, l4)
|
|
self.assertEqual(n.linear3, l4)
|
|
|
|
def test_Sequential_delitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
del n[-1]
|
|
self.assertEqual(n, nn.Sequential(l1, l2, l3))
|
|
del n[1::2]
|
|
self.assertEqual(n, nn.Sequential(l1, l3))
|
|
|
|
def test_ModuleList(self):
|
|
modules = [nn.ReLU(), nn.Linear(5, 5)]
|
|
module_list = nn.ModuleList(modules)
|
|
|
|
def check():
|
|
self.assertEqual(len(module_list), len(modules))
|
|
for m1, m2 in zip(modules, module_list):
|
|
self.assertIs(m1, m2)
|
|
for m1, m2 in zip(modules, module_list.children()):
|
|
self.assertIs(m1, m2)
|
|
for i in range(len(modules)):
|
|
self.assertIs(module_list[i], modules[i])
|
|
|
|
check()
|
|
modules += [nn.Conv2d(3, 4, 3)]
|
|
module_list += [modules[-1]]
|
|
check()
|
|
modules.insert(1, nn.Linear(3, 2))
|
|
module_list.insert(1, modules[1])
|
|
check()
|
|
modules.append(nn.Tanh())
|
|
module_list.append(modules[-1])
|
|
check()
|
|
next_modules = [nn.Linear(5, 5), nn.Sigmoid()]
|
|
modules.extend(next_modules)
|
|
module_list.extend(next_modules)
|
|
check()
|
|
modules[2] = nn.Conv2d(5, 3, 2)
|
|
module_list[2] = modules[2]
|
|
check()
|
|
modules[-1] = nn.Conv2d(5, 2, 1)
|
|
module_list[-1] = modules[-1]
|
|
check()
|
|
idx = torch.tensor(2, dtype=torch.int32)
|
|
modules[2] = nn.Conv2d(5, 3, 2)
|
|
module_list[idx] = modules[2]
|
|
self.assertIs(module_list[idx], modules[2])
|
|
check()
|
|
self.assertEqual(module_list[1:], nn.ModuleList(modules[1:]))
|
|
self.assertEqual(module_list[3:], nn.ModuleList(modules[3:]))
|
|
self.assertEqual(module_list[:-1], nn.ModuleList(modules[:-1]))
|
|
self.assertEqual(module_list[:-3], nn.ModuleList(modules[:-3]))
|
|
self.assertEqual(module_list[::-1], nn.ModuleList(modules[::-1]))
|
|
del module_list[-1]
|
|
self.assertEqual(module_list, nn.ModuleList(modules[:-1]))
|
|
del module_list[1::2]
|
|
self.assertEqual(module_list, nn.ModuleList(modules[:-1][0::2]))
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_list += nn.ReLU()
|
|
with self.assertRaises(TypeError):
|
|
module_list.extend(nn.ReLU())
|
|
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 2)
|
|
l4 = nn.Linear(2, 3)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(
|
|
OrderedDict([
|
|
("layer1", l1),
|
|
("layer2", l2),
|
|
("layer3", l3),
|
|
("layer4", l4),
|
|
("subnet_layer", subnet)
|
|
])
|
|
)
|
|
modules = list(s.modules())
|
|
module_list = nn.ModuleList()
|
|
module_list.extend(s.modules())
|
|
check()
|
|
|
|
# verify the right exception is thrown when trying to "forward" through a ModuleList
|
|
self.assertRaises(NotImplementedError, module_list)
|
|
self.assertRaises(NotImplementedError, module_list, torch.rand(1, 3))
|
|
|
|
def test_ModuleDict(self):
|
|
modules = OrderedDict([
|
|
('act', nn.ReLU()),
|
|
('conv', nn.Conv2d(10, 10, 5)),
|
|
('fc', nn.Linear(5, 5)),
|
|
])
|
|
|
|
module_dict = nn.ModuleDict(modules)
|
|
|
|
def check():
|
|
self.assertEqual(len(module_dict), len(modules))
|
|
for k1, m2 in zip(modules, module_dict.children()):
|
|
self.assertIs(modules[k1], m2)
|
|
for k1, k2 in zip(modules, module_dict):
|
|
self.assertIs(modules[k1], module_dict[k2])
|
|
for k in module_dict:
|
|
self.assertIs(module_dict[k], modules[k])
|
|
for k in module_dict.keys():
|
|
self.assertIs(module_dict[k], modules[k])
|
|
for k, v in module_dict.items():
|
|
self.assertIs(modules[k], v)
|
|
for k1, m2 in zip(modules, module_dict.values()):
|
|
self.assertIs(modules[k1], m2)
|
|
for k in modules.keys():
|
|
self.assertTrue(k in module_dict)
|
|
check()
|
|
|
|
modules['conv'] = nn.Conv2d(3, 4, 3)
|
|
module_dict['conv'] = modules['conv']
|
|
check()
|
|
|
|
next_modules = [
|
|
('fc2', nn.Linear(5, 5)),
|
|
('act', nn.Sigmoid()),
|
|
]
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = OrderedDict([
|
|
('fc3', nn.Linear(5, 5)),
|
|
('act2', nn.Sigmoid()),
|
|
])
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = {
|
|
'fc4': nn.Linear(5, 5),
|
|
'act3': nn.Sigmoid()
|
|
}
|
|
modules.update(next_modules.items())
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = nn.ModuleDict([
|
|
('fc5', nn.Linear(5, 5)),
|
|
('act4', nn.Sigmoid()),
|
|
])
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
del module_dict['fc']
|
|
del modules['fc']
|
|
check()
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict.update(nn.ReLU())
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict.update([nn.ReLU()])
|
|
|
|
with self.assertRaises(ValueError):
|
|
module_dict.update([[nn.ReLU()]])
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict[1] = nn.ReLU()
|
|
|
|
s = nn.Sequential(modules)
|
|
module_dict = nn.ModuleDict(s.named_children())
|
|
check()
|
|
|
|
c = module_dict.pop('conv')
|
|
self.assertIs(c, modules['conv'])
|
|
modules.pop('conv')
|
|
check()
|
|
|
|
module_dict.clear()
|
|
self.assertEqual(len(module_dict), 0)
|
|
modules.clear()
|
|
check()
|
|
|
|
# verify the right exception is thrown when trying to "forward" through a ModuleDict
|
|
self.assertRaises(NotImplementedError, module_dict)
|
|
self.assertRaises(NotImplementedError, module_dict, torch.rand(1, 3))
|
|
|
|
def test_ParameterList(self):
|
|
def make_param():
|
|
return Parameter(torch.randn(10, 10))
|
|
parameters = [make_param(), make_param()]
|
|
param_list = nn.ParameterList(parameters)
|
|
|
|
def check():
|
|
self.assertEqual(len(parameters), len(param_list))
|
|
for p1, p2 in zip(parameters, param_list):
|
|
self.assertIs(p1, p2)
|
|
for p1, p2 in zip(parameters, param_list.parameters()):
|
|
self.assertIs(p1, p2)
|
|
for i in range(len(parameters)):
|
|
self.assertIs(parameters[i], param_list[i])
|
|
|
|
check()
|
|
parameters += [make_param()]
|
|
param_list += [parameters[-1]]
|
|
check()
|
|
parameters.append(make_param())
|
|
param_list.append(parameters[-1])
|
|
check()
|
|
next_params = [make_param(), make_param()]
|
|
parameters.extend(next_params)
|
|
param_list.extend(next_params)
|
|
check()
|
|
parameters[2] = make_param()
|
|
param_list[2] = parameters[2]
|
|
check()
|
|
parameters[-1] = make_param()
|
|
param_list[-1] = parameters[-1]
|
|
check()
|
|
idx = torch.tensor(2, dtype=torch.int32)
|
|
parameters[2] = make_param()
|
|
param_list[idx] = parameters[2]
|
|
self.assertIs(param_list[idx], parameters[2])
|
|
check()
|
|
self.assertEqual(param_list[1:], nn.ParameterList(parameters[1:]))
|
|
self.assertEqual(param_list[3:], nn.ParameterList(parameters[3:]))
|
|
self.assertEqual(param_list[:-1], nn.ParameterList(parameters[:-1]))
|
|
self.assertEqual(param_list[:-3], nn.ParameterList(parameters[:-3]))
|
|
self.assertEqual(param_list[::-1], nn.ParameterList(parameters[::-1]))
|
|
|
|
with self.assertRaises(TypeError):
|
|
param_list += make_param()
|
|
with self.assertRaises(TypeError):
|
|
param_list.extend(make_param())
|
|
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 2)
|
|
l4 = nn.Linear(2, 3)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(
|
|
OrderedDict([
|
|
("layer1", l1),
|
|
("layer2", l2),
|
|
("layer3", l3),
|
|
("layer4", l4),
|
|
("subnet_layer", subnet)
|
|
])
|
|
)
|
|
parameters = list(s.parameters())
|
|
param_list = nn.ParameterList()
|
|
param_list.extend(s.parameters())
|
|
check()
|
|
|
|
def test_ParameterDict(self):
|
|
parameters = OrderedDict([
|
|
('p1', Parameter(torch.randn(10, 10))),
|
|
('p2', Parameter(torch.randn(10, 10))),
|
|
('p3', Parameter(torch.randn(10, 10))),
|
|
])
|
|
|
|
parameter_dict = nn.ParameterDict(parameters)
|
|
|
|
def check():
|
|
self.assertEqual(len(parameter_dict), len(parameters))
|
|
for k1, m2 in zip(parameters, parameter_dict.parameters()):
|
|
self.assertIs(parameters[k1], m2)
|
|
for k1, k2 in zip(parameters, parameter_dict):
|
|
self.assertIs(parameters[k1], parameter_dict[k2])
|
|
for k in parameter_dict:
|
|
self.assertIs(parameter_dict[k], parameters[k])
|
|
for k in parameter_dict.keys():
|
|
self.assertIs(parameter_dict[k], parameters[k])
|
|
for k, v in parameter_dict.items():
|
|
self.assertIs(v, parameters[k])
|
|
for k1, m2 in zip(parameters, parameter_dict.values()):
|
|
self.assertIs(parameters[k1], m2)
|
|
for k in parameters.keys():
|
|
self.assertTrue(k in parameter_dict)
|
|
|
|
check()
|
|
|
|
parameters['p4'] = Parameter(torch.randn(10, 10))
|
|
parameter_dict['p4'] = parameters['p4']
|
|
check()
|
|
|
|
next_parameters = [
|
|
('p5', Parameter(torch.randn(10, 10))),
|
|
('p2', Parameter(torch.randn(10, 10))),
|
|
]
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = OrderedDict([
|
|
('p6', Parameter(torch.randn(10, 10))),
|
|
('p5', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = {
|
|
'p8': Parameter(torch.randn(10, 10)),
|
|
'p7': Parameter(torch.randn(10, 10))
|
|
}
|
|
parameters.update(sorted(next_parameters.items()))
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = nn.ParameterDict([
|
|
('p10', Parameter(torch.randn(10, 10))),
|
|
('p9', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
del parameter_dict['p3']
|
|
del parameters['p3']
|
|
check()
|
|
|
|
with self.assertRaises(TypeError):
|
|
parameter_dict.update(1)
|
|
|
|
with self.assertRaises(TypeError):
|
|
parameter_dict.update([1])
|
|
|
|
with self.assertRaises(ValueError):
|
|
parameter_dict.update(Parameter(torch.randn(10, 10)))
|
|
|
|
with self.assertRaises(TypeError):
|
|
parameter_dict[1] = Parameter(torch.randn(10, 10))
|
|
|
|
p_pop = parameter_dict.pop('p4')
|
|
self.assertIs(p_pop, parameters['p4'])
|
|
parameters.pop('p4')
|
|
check()
|
|
|
|
parameter_dict.clear()
|
|
self.assertEqual(len(parameter_dict), 0)
|
|
parameters.clear()
|
|
check()
|
|
|
|
def test_add_module(self):
|
|
l = nn.Linear(10, 20)
|
|
net = nn.Module()
|
|
net.l = l
|
|
net.l2 = l
|
|
net.add_module('empty', None)
|
|
self.assertEqual(net.l, l)
|
|
self.assertEqual(net.l2, l)
|
|
self.assertEqual(net.empty, None)
|
|
net.add_module('l3', l)
|
|
self.assertEqual(net.l3, l)
|
|
l3 = nn.Linear(20, 10)
|
|
net.add_module('l', l3)
|
|
self.assertEqual(net.l, l3)
|
|
self.assertRaises(TypeError, lambda: net.add_module('x', 'non-module'))
|
|
self.assertRaisesRegex(TypeError, 'module name should be a string. Got int',
|
|
lambda: net.add_module(1, l))
|
|
self.assertRaisesRegex(TypeError, 'module name should be a string. Got NoneType',
|
|
lambda: net.add_module(None, l))
|
|
|
|
def test_module_to_argparse(self):
|
|
net = nn.Sequential(nn.Linear(3, 3))
|
|
cpu = torch.device('cpu')
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(torch.long)
|
|
with self.assertRaises(TypeError):
|
|
net.to(None, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, torch.long, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, dtype=torch.long, non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to([])
|
|
with self.assertRaises(TypeError):
|
|
net.to({}, non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(torch.tensor(3, dtype=torch.long), non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, torch.tensor(3, dtype=torch.long), non_blocking=True)
|
|
|
|
def test_RNN_nonlinearity(self):
|
|
rnn = torch.nn.RNN(1, 10)
|
|
self.assertEqual(rnn.nonlinearity, 'tanh')
|
|
|
|
rnn = torch.nn.RNN(1, 10, nonlinearity='relu')
|
|
self.assertEqual(rnn.nonlinearity, 'relu')
|
|
|
|
with self.assertRaisesRegex(ValueError, 'Unknown nonlinearity'):
|
|
rnn = torch.nn.RNN(1, 10, nonlinearity='garbage')
|
|
|
|
def test_module_apply_inplace_op(self):
|
|
def add_one_inplace(t):
|
|
return t.add_(1.0)
|
|
|
|
# Test that applying an in-place operation to a module would bump
|
|
# the module's parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
pvm = m.weight.mul(m.weight)
|
|
m_weight_version_saved = m.weight._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(m.weight._version, m_weight_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pvm.backward(torch.randn(10, 20))
|
|
|
|
# Test that applying an in-place operation to a module would bump
|
|
# the module's parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
pgm = m.weight.grad.mul(m.weight.grad)
|
|
m_weight_grad_version_saved = m.weight.grad._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(m.weight.grad._version, m_weight_grad_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pgm.backward(torch.randn(10, 20))
|
|
|
|
def test_overwrite_module_params_on_conversion(self):
|
|
# Test that if the conversion function passed to `module._apply()`
|
|
# changes the TensorImpl type of `module`'s parameters, the `module`'s
|
|
# parameters are always overwritten, regardless of the value of
|
|
# `torch.__future__.get_overwrite_module_params_on_conversion()`.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20)
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m = m._apply(lambda t: torch.sparse_coo_tensor(torch.zeros([2, 1]), torch.ones([1]), torch.Size([10, 20])))
|
|
self.assertNotEqual(weight_ref.layout, m.weight.layout)
|
|
self.assertNotEqual(weight_grad_ref.layout, m.weight.grad.layout)
|
|
|
|
# Test that under the current default settings
|
|
# (`torch.__future__.get_overwrite_module_params_on_conversion() == False`),
|
|
# a view to a module's parameters is not pointing to the same storage as
|
|
# its base variable after converting the module to a different dtype.
|
|
m = nn.Linear(20, 10).float()
|
|
mw = m.weight[:]
|
|
m.double()
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0].dtype == torch.float)
|
|
self.assertTrue(mw._base[0][0].dtype == torch.double)
|
|
|
|
try:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(True)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# a view to a module's parameters is still pointing to the same storage as
|
|
# its base variable after converting the module to a different dtype.
|
|
m = nn.Linear(20, 10).float()
|
|
mw = m.weight[:]
|
|
m.double()
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0] == mw._base[0][0])
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# `float_module.double()` doesn't preserve previous references to
|
|
# `float_module`'s parameters or gradients.
|
|
m = nn.Linear(20, 10).float()
|
|
m.weight.grad = torch.randn(10, 20).float()
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m.double()
|
|
self.assertNotEqual(weight_ref.dtype, m.weight.dtype)
|
|
self.assertNotEqual(weight_grad_ref.dtype, m.weight.grad.dtype)
|
|
|
|
def add_one_inplace(t):
|
|
return t.add_(1.0)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an in-place operation to a module would bump the module's
|
|
# original parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
pvm = m.weight.mul(m.weight)
|
|
weight_ref = m.weight
|
|
m_weight_version_saved = weight_ref._version
|
|
m = m._apply(add_one_inplace)
|
|
# Test that the in-place operation bumps the original parameter's version counter
|
|
self.assertGreater(weight_ref._version, m_weight_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pvm.backward(torch.randn(10, 20))
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an in-place operation to a module would bump the module's
|
|
# original parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
pgm = m.weight.grad.mul(m.weight.grad)
|
|
weight_grad_ref = m.weight.grad
|
|
m_weight_grad_version_saved = weight_grad_ref._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(weight_grad_ref._version, m_weight_grad_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pgm.backward(torch.randn(10, 20))
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an out-of-place operation to a module doesn't bump
|
|
# the module's original parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
weight_ref = m.weight
|
|
m_weight_version_saved = weight_ref._version
|
|
m = m._apply(lambda t: torch.randn(t.shape))
|
|
self.assertEqual(weight_ref._version, m_weight_version_saved)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an out-of-place operation to a module doesn't bump
|
|
# the module's original parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
weight_grad_ref = m.weight.grad
|
|
m_weight_grad_version_saved = weight_grad_ref._version
|
|
m = m._apply(lambda t: torch.randn(t.shape))
|
|
self.assertEqual(weight_grad_ref._version, m_weight_grad_version_saved)
|
|
finally:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(False)
|
|
|
|
def test_type(self):
|
|
l = nn.Linear(10, 20)
|
|
net = nn.Module()
|
|
net.l = l
|
|
net.l2 = l
|
|
net.add_module('empty', None)
|
|
net.register_buffer('indices', torch.LongTensor(1))
|
|
net.float()
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.double()
|
|
self.assertIsInstance(l.weight.data, torch.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.DoubleTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to(torch.half)
|
|
self.assertIsInstance(l.weight.data, torch.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
if TEST_CUDA:
|
|
net.float().cuda()
|
|
self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.cpu()
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to("cuda", torch.double, True)
|
|
self.assertIsInstance(l.weight.data, torch.cuda.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.DoubleTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.to(torch.empty(1, device="cuda:0", dtype=torch.half))
|
|
self.assertIsInstance(l.weight.data, torch.cuda.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.to(torch.device("cpu"), non_blocking=True)
|
|
self.assertIsInstance(l.weight.data, torch.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to(torch.float)
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
net.to(torch.DoubleTensor(1))
|
|
self.assertIsInstance(l.weight.data, torch.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.DoubleTensor)
|
|
if TEST_CUDA:
|
|
net.to(device='cuda', dtype=torch.float)
|
|
self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor)
|
|
|
|
def test_non_leaf_parameters(self):
|
|
l1 = nn.Linear(10, 10)
|
|
l2 = nn.Linear(10, 10)
|
|
|
|
def assign_weight():
|
|
l2.weight = l1.weight + 2
|
|
|
|
self.assertRaises(TypeError, assign_weight)
|
|
# This should work though
|
|
l2.weight = Parameter(torch.randn(10, 10))
|
|
|
|
def test_clip_grad_norm(self):
|
|
l = nn.Linear(10, 10)
|
|
max_norm = 2
|
|
|
|
def compute_norm(norm_type):
|
|
norm_type = float(norm_type)
|
|
if norm_type != inf:
|
|
total_norm = 0
|
|
for p in l.parameters():
|
|
total_norm += p.grad.data.abs().pow(norm_type).sum()
|
|
return pow(total_norm, 1. / norm_type)
|
|
else:
|
|
return max(p.grad.data.abs().max() for p in l.parameters())
|
|
|
|
def compare_scaling(grads):
|
|
p_scale = [p.grad.data.div(g).view(-1) for p, g in zip(l.parameters(), grads)]
|
|
scale = torch.cat(p_scale)
|
|
self.assertEqual(scale.std(), 0)
|
|
return scale[0]
|
|
|
|
grads = torch.arange(1., 101).view(10, 10), torch.ones(10).div(1000)
|
|
for norm_type in [0.5, 1.5, 2, 4, 'inf']:
|
|
for p, g in zip(l.parameters(), grads):
|
|
p._grad = g.clone().view_as(p.data)
|
|
norm_before = compute_norm(norm_type)
|
|
norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type)
|
|
norm_after = compute_norm(norm_type)
|
|
self.assertEqual(norm, norm_before)
|
|
self.assertEqual(norm_after, max_norm)
|
|
self.assertLessEqual(norm_after, norm_before)
|
|
compare_scaling(grads)
|
|
|
|
# Small gradients should be left unchanged
|
|
grads = torch.rand(10, 10).div(10000), torch.ones(10).div(500)
|
|
for norm_type in [0.5, 1.5, 2, 4, 'inf']:
|
|
for p, g in zip(l.parameters(), grads):
|
|
p.grad.data.copy_(g)
|
|
norm_before = compute_norm(norm_type)
|
|
norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type)
|
|
norm_after = compute_norm(norm_type)
|
|
self.assertEqual(norm, norm_before)
|
|
self.assertEqual(norm_before, norm_after)
|
|
self.assertLessEqual(norm_after, max_norm)
|
|
scale = compare_scaling(grads)
|
|
self.assertEqual(scale, 1)
|
|
|
|
# Should accept a single Tensor as input
|
|
p1, p2 = torch.randn(10, 10), torch.randn(10, 10)
|
|
g = torch.arange(1., 101).view(10, 10)
|
|
p1._grad = g.clone()
|
|
p2._grad = g.clone()
|
|
for norm_type in [0.5, 1.5, 2, 4, 'inf']:
|
|
clip_grad_norm_(p1, max_norm, norm_type=norm_type)
|
|
clip_grad_norm_([p2], max_norm, norm_type=norm_type)
|
|
self.assertEqual(p1.grad, p2.grad)
|
|
|
|
def test_clip_grad_value(self):
|
|
l = nn.Linear(10, 10)
|
|
clip_value = 2.5
|
|
|
|
grad_w, grad_b = torch.arange(-50., 50).view(10, 10).div_(5), torch.ones(10).mul_(2)
|
|
for grad_list in [[grad_w, grad_b], [grad_w, None]]:
|
|
for p, g in zip(l.parameters(), grad_list):
|
|
p._grad = g.clone().view_as(p.data) if g is not None else g
|
|
|
|
clip_grad_value_(l.parameters(), clip_value)
|
|
for p in filter(lambda p: p.grad is not None, l.parameters()):
|
|
self.assertLessEqual(p.grad.data.max(), clip_value)
|
|
self.assertGreaterEqual(p.grad.data.min(), -clip_value)
|
|
|
|
# Should accept a single Tensor as input
|
|
p1, p2 = torch.randn(10, 10), torch.randn(10, 10)
|
|
g = torch.arange(-50., 50).view(10, 10).div_(5)
|
|
p1._grad = g.clone()
|
|
p2._grad = g.clone()
|
|
clip_grad_value_(p1, clip_value)
|
|
clip_grad_value_([p2], clip_value)
|
|
self.assertEqual(p1.grad, p2.grad)
|
|
|
|
def test_parameters_to_vector(self):
|
|
conv1 = nn.Conv2d(3, 10, 5)
|
|
fc1 = nn.Linear(10, 20)
|
|
model = nn.Sequential(conv1, fc1)
|
|
|
|
vec = parameters_to_vector(model.parameters())
|
|
self.assertEqual(vec.size(0), 980)
|
|
|
|
def test_vector_to_parameters(self):
|
|
conv1 = nn.Conv2d(3, 10, 5)
|
|
fc1 = nn.Linear(10, 20)
|
|
model = nn.Sequential(conv1, fc1)
|
|
|
|
vec = torch.arange(0., 980)
|
|
vector_to_parameters(vec, model.parameters())
|
|
|
|
sample = next(model.parameters())[0, 0, 0]
|
|
self.assertTrue(torch.equal(sample.data, vec.data[:5]))
|
|
|
|
# torch/nn/utils/parametrize
|
|
def test_register_and_remove_parametrization(self):
|
|
r"""Test that it is possible to add a few parametrizations
|
|
on a parameter or a buffer and that removing them restores the initial state
|
|
It also tests that backpropagating through them works as expected
|
|
"""
|
|
# Define a couple matrix parametrizations
|
|
class Skew(nn.Module):
|
|
def forward(self, X):
|
|
X = X.tril(-1)
|
|
return X - X.T
|
|
|
|
class Orthogonal(nn.Module):
|
|
def forward(self, X):
|
|
# Cayley map
|
|
# If X is skew-symmetric it returns an orthogonal matrix
|
|
Id = torch.eye(X.size(0), device=X.device)
|
|
return torch.linalg.solve(Id + X, Id - X)
|
|
|
|
# Define a couple vector parametrizations
|
|
class FirstZero(nn.Module):
|
|
def forward(self, x):
|
|
return torch.cat([x.new_zeros(1), x[1:]])
|
|
|
|
class LastZero(nn.Module):
|
|
def forward(self, x):
|
|
return torch.cat([x[:-1], x.new_zeros(1)])
|
|
|
|
model = nn.Linear(8, 8)
|
|
initial_weight_id = id(model.weight)
|
|
initial_bias_id = id(model.bias)
|
|
initial_model = deepcopy(model)
|
|
|
|
# Test one parametrization
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
self.assertTrue(hasattr(model, "parametrizations"))
|
|
self.assertTrue(parametrize.is_parametrized(model))
|
|
self.assertTrue(parametrize.is_parametrized(model, "weight"))
|
|
self.assertFalse(parametrize.is_parametrized(model, "bias"))
|
|
self.assertNotIn("weight", model._parameters)
|
|
# Result should be skew-symmetric
|
|
A = model.weight
|
|
self.assertTrue(torch.allclose(A, -A.T))
|
|
# Remove and check consistency
|
|
parametrize.remove_parametrizations(model, "weight", leave_parametrized=False)
|
|
self.assertFalse(hasattr(model, "parametrizations"))
|
|
self.assertEqual(model.weight, initial_model.weight)
|
|
self.assertEqual(id(model.weight), initial_weight_id)
|
|
self.assertEqual(model.__class__, nn.Linear)
|
|
|
|
# Test two parametrizations at the same time and removing them
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
parametrize.register_parametrization(model, "weight", Orthogonal())
|
|
# Result should be orthogonal
|
|
X = model.weight
|
|
Id = torch.eye(X.size(0), device=X.device)
|
|
self.assertTrue(torch.allclose(X.T @ X, Id))
|
|
# Structure tests
|
|
self.assertTrue(hasattr(model, "parametrizations"))
|
|
self.assertTrue(parametrize.is_parametrized(model))
|
|
self.assertTrue(parametrize.is_parametrized(model, "weight"))
|
|
self.assertFalse(parametrize.is_parametrized(model, "bias"))
|
|
self.assertIn("weight", model.parametrizations)
|
|
self.assertNotIn("weight", model._parameters)
|
|
# Remove
|
|
parametrize.remove_parametrizations(model, "weight", leave_parametrized=False)
|
|
self.assertEqual(model.weight, initial_model.weight)
|
|
self.assertEqual(id(model.weight), initial_weight_id)
|
|
self.assertFalse(hasattr(model, "parametrizations"))
|
|
self.assertEqual(model.__class__, nn.Linear)
|
|
|
|
# Add everything
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
parametrize.register_parametrization(model, "weight", Orthogonal())
|
|
parametrize.register_parametrization(model, "bias", FirstZero())
|
|
parametrize.register_parametrization(model, "bias", LastZero())
|
|
|
|
# Basic tests
|
|
self.assertTrue(parametrize.is_parametrized(model))
|
|
self.assertTrue(parametrize.is_parametrized(model, "weight"))
|
|
self.assertTrue(parametrize.is_parametrized(model, "bias"))
|
|
self.assertEqual(model.bias[0].item(), 0.)
|
|
self.assertEqual(model.bias[-1].item(), 0.)
|
|
self.assertEqual(len(list(model.parameters())), 2) # Nothing weird has happpened
|
|
# Should not throw
|
|
(model.weight.T @ model.bias).sum().backward()
|
|
with torch.no_grad():
|
|
for p in model.parameters():
|
|
p.add_(- p.grad, alpha=0.01)
|
|
|
|
# Remove first parametrization.
|
|
# Check that the model is still parametrized and so is the second parameter
|
|
parametrize.remove_parametrizations(model, "weight", leave_parametrized=False)
|
|
self.assertTrue(parametrize.is_parametrized(model)) # Still parametrized
|
|
self.assertFalse(parametrize.is_parametrized(model, "weight")) # Parametrization removed
|
|
self.assertTrue(parametrize.is_parametrized(model, "bias")) # Still parametrized
|
|
self.assertEqual(model.bias[0].item(), 0.) # Still parametrized
|
|
self.assertEqual(model.bias[-1].item(), 0.) # Still parametrized
|
|
self.assertNotEqual(model.weight, initial_model.weight) # Has been updated
|
|
self.assertEqual(id(model.weight), initial_weight_id) # Keeps the same id
|
|
self.assertEqual(len(list(model.parameters())), 2) # Nothing weird has happened
|
|
# Should not throw
|
|
(model.weight.T @ model.bias).sum().backward()
|
|
with torch.no_grad():
|
|
for p in model.parameters():
|
|
p.add_(- p.grad, alpha=0.01)
|
|
|
|
# Remove the second parametrization.
|
|
# Check that the module is not parametrized
|
|
parametrize.remove_parametrizations(model, "bias", leave_parametrized=False)
|
|
self.assertFalse(parametrize.is_parametrized(model)) # Not parametrized
|
|
self.assertNotEqual(model.bias, initial_model.bias) # Has been updated
|
|
self.assertNotEqual(model.bias[0].item(), 0.) # Not parametrized
|
|
self.assertNotEqual(model.bias[-1].item(), 0.) # Not parametrized
|
|
self.assertEqual(id(model.bias), initial_bias_id) # Keeps the same id
|
|
self.assertFalse(hasattr(model, "parametrizations")) # Not parametrized the module
|
|
self.assertEqual(model.__class__, nn.Linear) # Resores the previous class
|
|
self.assertEqual(len(list(model.parameters())), 2) # Nothing weird has happeed
|
|
# Should not throw
|
|
(model.weight.T @ model.bias).sum().backward()
|
|
with torch.no_grad():
|
|
for p in model.parameters():
|
|
p.add_(- p.grad, alpha=0.01)
|
|
|
|
# Test leave_parametrized=True
|
|
for _ in range(2):
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
parametrize.register_parametrization(model, "weight", Orthogonal())
|
|
parametrize.remove_parametrizations(model, "weight", leave_parametrized=True)
|
|
# Should not throw
|
|
(model.weight.T @ model.bias).sum().backward()
|
|
with torch.no_grad():
|
|
for p in model.parameters():
|
|
p.add_(- p.grad, alpha=0.01)
|
|
|
|
def test_register_and_remove_buffer_parametrization(self):
|
|
r"""Test that it is possible to add and remove parametrizations on buffers"""
|
|
# Define a couple vector parametrizations
|
|
class FirstZero(nn.Module):
|
|
def forward(self, x):
|
|
return torch.cat([x.new_zeros(1), x[1:]])
|
|
|
|
class LastZero(nn.Module):
|
|
def forward(self, x):
|
|
return torch.cat([x[:-1], x.new_zeros(1)])
|
|
|
|
model = nn.Linear(8, 8)
|
|
|
|
# Instantiate parametrizations on buffers. It should work as expected
|
|
delattr(model, "bias")
|
|
model.register_buffer("bias", torch.ones(8))
|
|
parametrize.register_parametrization(model, "bias", FirstZero())
|
|
parametrize.register_parametrization(model, "bias", LastZero())
|
|
self.assertTrue(parametrize.is_parametrized(model))
|
|
self.assertTrue(parametrize.is_parametrized(model, "bias"))
|
|
self.assertEqual(model.bias[0].item(), 0.)
|
|
self.assertEqual(model.bias[-1].item(), 0.)
|
|
self.assertTrue((model.bias[1:-1] == torch.ones(6)).all())
|
|
self.assertEqual(len(list(model.parameters())), 1)
|
|
|
|
# Remove parametrizations on buffers. It should work as expected
|
|
parametrize.remove_parametrizations(model, "bias", leave_parametrized=True)
|
|
self.assertFalse(parametrize.is_parametrized(model))
|
|
self.assertFalse(parametrize.is_parametrized(model, "bias"))
|
|
self.assertEqual(model.bias[0].item(), 0.)
|
|
self.assertEqual(model.bias[-1].item(), 0.)
|
|
self.assertTrue((model.bias[1:-1] == torch.ones(6)).all())
|
|
self.assertEqual(len(list(model.parameters())), 1)
|
|
|
|
def test_serialization_parametrization(self):
|
|
r"""Test that it is possible to serialize a parametrized model via state_dict"""
|
|
# A stateful parametrization
|
|
class Orthogonal(nn.Module):
|
|
def __init__(self, n):
|
|
super().__init__()
|
|
self.register_buffer("id", torch.eye(n))
|
|
self.register_buffer("B", torch.empty(n, n))
|
|
init.orthogonal_(self.B)
|
|
|
|
def forward(self, X):
|
|
A = X.triu(1)
|
|
A = A - A.T
|
|
return self.B @ torch.linalg.solve(self.id + A, self.id - A)
|
|
|
|
def get_model():
|
|
model = torch.nn.Sequential(
|
|
torch.nn.Linear(5, 5),
|
|
torch.nn.ReLU(),
|
|
torch.nn.Linear(5, 1),
|
|
)
|
|
|
|
parametrize.register_parametrization(model[0], "weight", Orthogonal(5))
|
|
return model
|
|
|
|
model = get_model()
|
|
|
|
prev_weight = model[0].weight
|
|
prev_B = model[0].parametrizations.weight[0].B
|
|
|
|
new_model = get_model()
|
|
with TemporaryFileName() as fname:
|
|
torch.save(model.state_dict(), fname)
|
|
new_model.load_state_dict(torch.load(fname))
|
|
|
|
# Integrity tests
|
|
self.assertTrue(parametrize.is_parametrized(new_model[0], "weight"))
|
|
self.assertEqual(prev_weight, new_model[0].weight)
|
|
self.assertEqual(prev_B, new_model[0].parametrizations.weight[0].B)
|
|
|
|
# Trying to save the whole parametrized model raises
|
|
with self.assertRaisesRegex(RuntimeError, "state_dict"):
|
|
with TemporaryFileName() as fname:
|
|
torch.save(model, fname)
|
|
|
|
def test_initialization_parametrization(self):
|
|
r"""Test that it is possible to initialize a parametrization when it
|
|
implements a `right_inverse` method
|
|
"""
|
|
class Skew(nn.Module):
|
|
def forward(self, X):
|
|
A = X.triu(1)
|
|
return A - A.T
|
|
|
|
def is_skew(self, A):
|
|
return torch.allclose(A, -A.T, atol=1e-6)
|
|
|
|
def right_inverse(self, X):
|
|
if not self.is_skew(X):
|
|
raise ValueError("The matrix is not skew-symmetric.")
|
|
return X.triu(1)
|
|
|
|
# Implements a Cayley map where right_inverse is not quite the inverse of forward
|
|
class Orthogonal(nn.Module):
|
|
def __init__(self, n):
|
|
super().__init__()
|
|
self.register_buffer("B", torch.eye(n))
|
|
|
|
def forward(self, X):
|
|
Id = torch.eye(X.size(0))
|
|
return self.B @ torch.linalg.solve(Id + X, Id - X)
|
|
|
|
def is_orthogonal(self, X):
|
|
Id = torch.eye(X.size(0))
|
|
return torch.allclose(X.T @ X, Id, atol=1e-4)
|
|
|
|
def right_inverse(self, X):
|
|
if not self.is_orthogonal(X):
|
|
raise ValueError("The input is not orthogonal.")
|
|
# cayley(0) == Id, so B @ cayley(0) == B
|
|
self.B = X
|
|
return torch.zeros_like(X)
|
|
|
|
N = 5
|
|
model = nn.Linear(N, N)
|
|
# Register the skew-symmetric onstraint. The result is now skew-symmetric
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
X = torch.rand(N, N)
|
|
# X is not skew-symmetric, so it throws an error
|
|
with self.assertRaises(ValueError):
|
|
model.weight = X
|
|
# Make X skew-symmetric
|
|
X = X - X.T
|
|
model.weight = X
|
|
self.assertEqual(model.parametrizations.weight.original, X.triu(1))
|
|
self.assertEqual(model.weight, X)
|
|
|
|
# Having several parametrizations registered should work in the same way
|
|
parametrize.register_parametrization(model, "weight", Orthogonal(N))
|
|
# Register now the Cayley map. The result is now orthogonal
|
|
X = torch.rand(N, N)
|
|
# X is not orthogonal, so it throws an error
|
|
with self.assertRaises(ValueError):
|
|
model.weight = X
|
|
init.orthogonal_(X)
|
|
model.weight = X
|
|
self.assertEqual(model.weight, X)
|
|
self.assertEqual(model.parametrizations.weight.original, torch.zeros_like(X))
|
|
|
|
def test_errors_parametrization(self):
|
|
# A parametrization shall not change the size of the parameter
|
|
class ChangeSize(nn.Module):
|
|
def forward(self, x):
|
|
return x[:-1]
|
|
|
|
# A simple parametrization that does not implement a right_inverse
|
|
class Double(nn.Module):
|
|
def forward(self, x):
|
|
return 2 * x
|
|
|
|
module = nn.Linear(3, 4)
|
|
# This should not throw when registering
|
|
parametrize.register_parametrization(module, "weight", ChangeSize())
|
|
# It throws in the forward
|
|
with self.assertRaisesRegex(RuntimeError, "may not change the size"):
|
|
module(torch.rand(2))
|
|
# Undo
|
|
parametrize.remove_parametrizations(module, "weight", leave_parametrized=False)
|
|
self.assertFalse(parametrize.is_parametrized(module))
|
|
|
|
# Removing a parametrization from an unparametrized tensor throws
|
|
with self.assertRaisesRegex(ValueError, "does not have a parametrization"):
|
|
parametrize.remove_parametrizations(module, "bias")
|
|
# Nothing odd happens
|
|
self.assertFalse(parametrize.is_parametrized(module))
|
|
|
|
# Register a parametrization on a non-existing parameter breaks
|
|
with self.assertRaisesRegex(ValueError, "does not have a parameter"):
|
|
parametrize.register_parametrization(module, "foo", ChangeSize())
|
|
self.assertFalse(parametrize.is_parametrized(module))
|
|
|
|
# Try to assign to a parametrization that does not implement `right_inverse`
|
|
parametrize.register_parametrization(module, "weight", Double())
|
|
with self.assertRaisesRegex(RuntimeError, "right_inverse"):
|
|
module.weight = torch.rand(4, 3)
|
|
# Undo
|
|
parametrize.remove_parametrizations(module, "weight", leave_parametrized=False)
|
|
self.assertFalse(parametrize.is_parametrized(module))
|
|
|
|
def test_caching_parametrization(self):
|
|
r"""Test the caching system of a parametrization"""
|
|
# Define a couple matrix parametrizations
|
|
class Skew(nn.Module):
|
|
def forward(self, X):
|
|
X = X.tril(-1)
|
|
return X - X.T
|
|
|
|
class Orthogonal(nn.Module):
|
|
def forward(self, X):
|
|
Id = torch.eye(X.size(0), device=X.device)
|
|
return torch.linalg.solve(Id + X, Id - X)
|
|
|
|
model = nn.Linear(5, 5)
|
|
parametrize.register_parametrization(model, "weight", Skew())
|
|
parametrize.register_parametrization(model, "weight", Orthogonal())
|
|
|
|
# Test that the caching system works
|
|
with parametrize.cached():
|
|
X = model.weight
|
|
Y = model.weight
|
|
self.assertEqual(id(X), id(Y))
|
|
|
|
def test_dtype_parametrization(self):
|
|
r"""Test a case that is not allowed when removing a parametrization"""
|
|
class ChangeType(nn.Module):
|
|
def forward(self, X):
|
|
return X.double()
|
|
|
|
module = nn.Linear(4, 4).float()
|
|
input_ = torch.rand(4).double()
|
|
# It is allowed to register a parametrization that changes the dtype
|
|
parametrize.register_parametrization(module, "weight", ChangeType())
|
|
module(input_)
|
|
# We can remove it leaving the original tensor
|
|
parametrize.remove_parametrizations(module, "weight", leave_parametrized=False)
|
|
# But leaving it parametrized breaks
|
|
parametrize.register_parametrization(module, "weight", ChangeType())
|
|
with self.assertRaisesRegex(ValueError, "changes the dtype"):
|
|
parametrize.remove_parametrizations(module, "weight", leave_parametrized=True)
|
|
|
|
def test_parametrization_same_training_mode(self):
|
|
r"""Test training mode updated on parametrization registration"""
|
|
class Identity(nn.Module):
|
|
def forward(self, X):
|
|
return X
|
|
|
|
module = nn.Linear(4, 4)
|
|
module.eval()
|
|
parametrize.register_parametrization(module, "weight", Identity())
|
|
self.assertFalse(module.parametrizations.weight[0].training)
|
|
module.train()
|
|
parametrize.register_parametrization(module, "weight", Identity().eval())
|
|
self.assertTrue(module.parametrizations.weight[0].training)
|
|
self.assertTrue(module.parametrizations.weight[1].training)
|
|
|
|
# torch/nn/utils/prune.py
|
|
@unittest.skipIf(not TEST_NUMPY, "numpy not found")
|
|
def test_validate_pruning_amount_init(self):
|
|
r"""Test the first util function that validates the pruning
|
|
amount requested by the user the moment the pruning method
|
|
is initialized. This test checks that the expected errors are
|
|
raised whenever the amount is invalid.
|
|
The original function runs basic type checking + value range checks.
|
|
It doesn't check the validity of the pruning amount with
|
|
respect to the size of the tensor to prune. That's left to
|
|
`_validate_pruning_amount`, tested below.
|
|
"""
|
|
# neither float not int should raise TypeError
|
|
with self.assertRaises(TypeError):
|
|
prune._validate_pruning_amount_init(amount="I'm a string")
|
|
|
|
# float not in [0, 1] should raise ValueError
|
|
with self.assertRaises(ValueError):
|
|
prune._validate_pruning_amount_init(amount=1.1)
|
|
with self.assertRaises(ValueError):
|
|
prune._validate_pruning_amount_init(amount=20.)
|
|
|
|
# negative int should raise ValueError
|
|
with self.assertRaises(ValueError):
|
|
prune._validate_pruning_amount_init(amount=-10)
|
|
|
|
# all these should pass without errors because they're valid amounts
|
|
prune._validate_pruning_amount_init(amount=0.34)
|
|
prune._validate_pruning_amount_init(amount=1500)
|
|
prune._validate_pruning_amount_init(amount=0)
|
|
prune._validate_pruning_amount_init(amount=0.)
|
|
prune._validate_pruning_amount_init(amount=1)
|
|
prune._validate_pruning_amount_init(amount=1.)
|
|
self.assertTrue(True)
|
|
|
|
@unittest.skipIf(not TEST_NUMPY, "numpy not found")
|
|
def test_validate_pruning_amount(self):
|
|
r"""Tests the second util function that validates the pruning
|
|
amount requested by the user, this time with respect to the size
|
|
of the tensor to prune. The rationale is that if the pruning amount,
|
|
converted to absolute value of units to prune, is larger than
|
|
the number of units in the tensor, then we expect the util function
|
|
to raise a value error.
|
|
"""
|
|
# if amount is int and amount > tensor_size, raise ValueError
|
|
with self.assertRaises(ValueError):
|
|
prune._validate_pruning_amount(amount=20, tensor_size=19)
|
|
|
|
# amount is a float so this should not raise an error
|
|
prune._validate_pruning_amount(amount=0.3, tensor_size=0)
|
|
|
|
# this is okay
|
|
prune._validate_pruning_amount(amount=19, tensor_size=20)
|
|
prune._validate_pruning_amount(amount=0, tensor_size=0)
|
|
prune._validate_pruning_amount(amount=1, tensor_size=1)
|
|
self.assertTrue(True)
|
|
|
|
@unittest.skipIf(not TEST_NUMPY, "numpy not found")
|
|
def test_compute_nparams_to_prune(self):
|
|
r"""Test that requested pruning `amount` gets translated into the
|
|
correct absolute number of units to prune.
|
|
"""
|
|
self.assertEqual(
|
|
prune._compute_nparams_toprune(amount=0, tensor_size=15),
|
|
0
|
|
)
|
|
self.assertEqual(
|
|
prune._compute_nparams_toprune(amount=10, tensor_size=15),
|
|
10
|
|
)
|
|
# if 1 is int, means 1 unit
|
|
self.assertEqual(
|
|
prune._compute_nparams_toprune(amount=1, tensor_size=15),
|
|
1
|
|
)
|
|
# if 1. is float, means 100% of units
|
|
self.assertEqual(
|
|
prune._compute_nparams_toprune(amount=1., tensor_size=15),
|
|
15
|
|
)
|
|
self.assertEqual(
|
|
prune._compute_nparams_toprune(amount=0.4, tensor_size=17),
|
|
7
|
|
)
|
|
|
|
def test_random_pruning_sizes(self):
|
|
r"""Test that the new parameters and buffers created by the pruning
|
|
method have the same size as the input tensor to prune. These, in
|
|
fact, correspond to the pruned version of the tensor itself, its
|
|
mask, and its original copy, so the size must match.
|
|
"""
|
|
# fixturize test
|
|
# TODO: add other modules
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
original_tensor = getattr(m, name)
|
|
|
|
prune.random_unstructured(m, name=name, amount=0.1)
|
|
# mask has the same size as tensor being pruned
|
|
self.assertEqual(
|
|
original_tensor.size(),
|
|
getattr(m, name + '_mask').size()
|
|
)
|
|
# 'orig' tensor has the same size as the original tensor
|
|
self.assertEqual(
|
|
original_tensor.size(),
|
|
getattr(m, name + '_orig').size()
|
|
)
|
|
# new tensor has the same size as the original tensor
|
|
self.assertEqual(
|
|
original_tensor.size(),
|
|
getattr(m, name).size()
|
|
)
|
|
|
|
def test_random_pruning_orig(self):
|
|
r"""Test that original tensor is correctly stored in 'orig'
|
|
after pruning is applied. Important to make sure we don't
|
|
lose info about the original unpruned parameter.
|
|
"""
|
|
# fixturize test
|
|
# TODO: add other modules
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
|
|
# tensor prior to pruning
|
|
original_tensor = getattr(m, name)
|
|
prune.random_unstructured(m, name=name, amount=0.1)
|
|
self.assertEqual(
|
|
original_tensor,
|
|
getattr(m, name + '_orig')
|
|
)
|
|
|
|
def test_random_pruning_new_weight(self):
|
|
r"""Test that module.name now contains a pruned version of
|
|
the original tensor obtained from multiplying it by the mask.
|
|
"""
|
|
# fixturize test
|
|
# TODO: add other modules
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
# tensor prior to pruning
|
|
original_tensor = getattr(m, name)
|
|
prune.random_unstructured(m, name=name, amount=0.1)
|
|
# weight = weight_orig * weight_mask
|
|
self.assertEqual(
|
|
getattr(m, name),
|
|
getattr(m, name + '_orig')
|
|
* getattr(m, name + '_mask').to(
|
|
dtype=original_tensor.dtype
|
|
),
|
|
)
|
|
|
|
def test_identity_pruning(self):
|
|
r"""Test that a mask of 1s does not change forward or backward.
|
|
"""
|
|
input_ = torch.ones(1, 5)
|
|
m = nn.Linear(5, 2)
|
|
y_prepruning = m(input_) # output prior to pruning
|
|
|
|
# compute grad pre-pruning and check it's equal to all ones
|
|
y_prepruning.sum().backward()
|
|
old_grad_weight = m.weight.grad.clone() # don't grab pointer!
|
|
self.assertEqual(old_grad_weight, torch.ones_like(m.weight))
|
|
old_grad_bias = m.bias.grad.clone()
|
|
self.assertEqual(old_grad_bias, torch.ones_like(m.bias))
|
|
|
|
# remove grads
|
|
m.zero_grad()
|
|
|
|
# force the mask to be made of all 1s
|
|
prune.identity(m, name="weight")
|
|
|
|
# with mask of 1s, output should be identical to no mask
|
|
y_postpruning = m(input_)
|
|
self.assertEqual(y_prepruning, y_postpruning)
|
|
|
|
# with mask of 1s, grad should be identical to no mask
|
|
y_postpruning.sum().backward()
|
|
self.assertEqual(old_grad_weight, m.weight_orig.grad)
|
|
self.assertEqual(old_grad_bias, m.bias.grad)
|
|
|
|
# calling forward twice in a row shouldn't change output
|
|
y1 = m(input_)
|
|
y2 = m(input_)
|
|
self.assertEqual(y1, y2)
|
|
|
|
def test_random_pruning_0perc(self):
|
|
r"""Test that a mask of 1s does not change forward or backward.
|
|
"""
|
|
input_ = torch.ones(1, 5)
|
|
m = nn.Linear(5, 2)
|
|
y_prepruning = m(input_) # output prior to pruning
|
|
|
|
# compute grad pre-pruning and check it's equal to all ones
|
|
y_prepruning.sum().backward()
|
|
old_grad_weight = m.weight.grad.clone() # don't grab pointer!
|
|
self.assertEqual(old_grad_weight, torch.ones_like(m.weight))
|
|
old_grad_bias = m.bias.grad.clone()
|
|
self.assertEqual(old_grad_bias, torch.ones_like(m.bias))
|
|
|
|
# remove grads
|
|
m.zero_grad()
|
|
|
|
# force the mask to be made of all 1s
|
|
with mock.patch(
|
|
"torch.nn.utils.prune.RandomUnstructured.compute_mask"
|
|
) as compute_mask:
|
|
compute_mask.return_value = torch.ones_like(m.weight)
|
|
prune.random_unstructured(m, name='weight', amount=0.9) # amount won't count
|
|
|
|
# with mask of 1s, output should be identical to no mask
|
|
y_postpruning = m(input_)
|
|
self.assertEqual(y_prepruning, y_postpruning)
|
|
|
|
# with mask of 1s, grad should be identical to no mask
|
|
y_postpruning.sum().backward()
|
|
self.assertEqual(old_grad_weight, m.weight_orig.grad)
|
|
self.assertEqual(old_grad_bias, m.bias.grad)
|
|
|
|
# calling forward twice in a row shouldn't change output
|
|
y1 = m(input_)
|
|
y2 = m(input_)
|
|
self.assertEqual(y1, y2)
|
|
|
|
def test_random_pruning(self):
|
|
input_ = torch.ones(1, 5)
|
|
m = nn.Linear(5, 2)
|
|
|
|
# define custom mask to assign with mock
|
|
mask = torch.ones_like(m.weight)
|
|
mask[1, 0] = 0
|
|
mask[0, 3] = 0
|
|
|
|
# check grad is zero for masked weights
|
|
with mock.patch(
|
|
"torch.nn.utils.prune.RandomUnstructured.compute_mask"
|
|
) as compute_mask:
|
|
compute_mask.return_value = mask
|
|
prune.random_unstructured(m, name='weight', amount=0.9)
|
|
|
|
y_postpruning = m(input_)
|
|
y_postpruning.sum().backward()
|
|
# weight_orig is the parameter, so it's the tensor that will accumulate the grad
|
|
self.assertEqual(m.weight_orig.grad, mask) # all 1s, except for masked units
|
|
self.assertEqual(m.bias.grad, torch.ones_like(m.bias))
|
|
|
|
# make sure that weight_orig update doesn't modify [1, 0] and [0, 3]
|
|
old_weight_orig = m.weight_orig.clone()
|
|
# update weights
|
|
learning_rate = 1.
|
|
for p in m.parameters():
|
|
p.data.sub_(p.grad.data * learning_rate)
|
|
# since these are pruned, they should not be updated
|
|
self.assertEqual(old_weight_orig[1, 0], m.weight_orig[1, 0])
|
|
self.assertEqual(old_weight_orig[0, 3], m.weight_orig[0, 3])
|
|
|
|
def test_random_pruning_forward(self):
|
|
r"""check forward with mask (by hand).
|
|
"""
|
|
input_ = torch.ones(1, 5)
|
|
m = nn.Linear(5, 2)
|
|
|
|
# define custom mask to assign with mock
|
|
mask = torch.zeros_like(m.weight)
|
|
mask[1, 0] = 1
|
|
mask[0, 3] = 1
|
|
|
|
with mock.patch(
|
|
"torch.nn.utils.prune.RandomUnstructured.compute_mask"
|
|
) as compute_mask:
|
|
compute_mask.return_value = mask
|
|
prune.random_unstructured(m, name='weight', amount=0.9)
|
|
|
|
yhat = m(input_)
|
|
self.assertEqual(yhat[0, 0], m.weight_orig[0, 3] + m.bias[0])
|
|
self.assertEqual(yhat[0, 1], m.weight_orig[1, 0] + m.bias[1])
|
|
|
|
def test_remove_pruning_forward(self):
|
|
r"""Remove pruning and check forward is unchanged from previous
|
|
pruned state.
|
|
"""
|
|
input_ = torch.ones(1, 5)
|
|
m = nn.Linear(5, 2)
|
|
|
|
# define custom mask to assign with mock
|
|
mask = torch.ones_like(m.weight)
|
|
mask[1, 0] = 0
|
|
mask[0, 3] = 0
|
|
|
|
# check grad is zero for masked weights
|
|
with mock.patch(
|
|
"torch.nn.utils.prune.RandomUnstructured.compute_mask"
|
|
) as compute_mask:
|
|
compute_mask.return_value = mask
|
|
prune.random_unstructured(m, name='weight', amount=0.9)
|
|
|
|
y_postpruning = m(input_)
|
|
|
|
prune.remove(m, 'weight')
|
|
|
|
y_postremoval = m(input_)
|
|
self.assertEqual(y_postpruning, y_postremoval)
|
|
|
|
def test_pruning_id_consistency(self):
|
|
r"""Test that pruning doesn't change the id of the parameters, which
|
|
would otherwise introduce issues with pre-existing optimizers that
|
|
point to old parameters.
|
|
"""
|
|
m = nn.Linear(5, 2, bias=False)
|
|
|
|
tensor_id = id(list(m.parameters())[0])
|
|
|
|
prune.random_unstructured(m, name="weight", amount=0.9)
|
|
self.assertEqual(tensor_id, id(list(m.parameters())[0]))
|
|
|
|
prune.remove(m, "weight")
|
|
self.assertEqual(tensor_id, id(list(m.parameters())[0]))
|
|
|
|
def test_random_pruning_pickle(self):
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
prune.random_unstructured(m, name=name, amount=0.1)
|
|
m_new = pickle.loads(pickle.dumps(m))
|
|
self.assertIsInstance(m_new, type(m))
|
|
|
|
def test_multiple_pruning_calls(self):
|
|
# if you call pruning twice, the hook becomes a PruningContainer
|
|
m = nn.Conv3d(2, 2, 2)
|
|
prune.l1_unstructured(m, name='weight', amount=0.1)
|
|
weight_mask0 = m.weight_mask # save it for later sanity check
|
|
|
|
# prune again
|
|
prune.ln_structured(m, name='weight', amount=0.3, n=2, dim=0)
|
|
hook = next(iter(m._forward_pre_hooks.values()))
|
|
self.assertIsInstance(
|
|
hook,
|
|
torch.nn.utils.prune.PruningContainer
|
|
)
|
|
# check that container._tensor_name is correctly set no matter how
|
|
# many pruning methods are in the container
|
|
self.assertEqual(hook._tensor_name, 'weight')
|
|
|
|
# check that the pruning container has the right length
|
|
# equal to the number of pruning iters
|
|
self.assertEqual(len(hook), 2) # m.weight has been pruned twice
|
|
|
|
# check that the entries of the pruning container are of the expected
|
|
# type and in the expected order
|
|
self.assertIsInstance(hook[0], torch.nn.utils.prune.L1Unstructured)
|
|
self.assertIsInstance(hook[1], torch.nn.utils.prune.LnStructured)
|
|
|
|
# check that all entries that are 0 in the 1st mask are 0 in the
|
|
# 2nd mask too
|
|
self.assertTrue(torch.all(m.weight_mask[weight_mask0 == 0] == 0))
|
|
|
|
# prune again
|
|
prune.ln_structured(m, name='weight', amount=0.1, n=float('inf'), dim=1)
|
|
# check that container._tensor_name is correctly set no matter how
|
|
# many pruning methods are in the container
|
|
hook = next(iter(m._forward_pre_hooks.values()))
|
|
self.assertEqual(hook._tensor_name, 'weight')
|
|
|
|
def test_pruning_container(self):
|
|
# create an empty container
|
|
container = prune.PruningContainer()
|
|
container._tensor_name = 'test'
|
|
self.assertEqual(len(container), 0)
|
|
|
|
p = prune.L1Unstructured(amount=2)
|
|
p._tensor_name = 'test'
|
|
|
|
# test adding a pruning method to a container
|
|
container.add_pruning_method(p)
|
|
|
|
# test error raised if tensor name is different
|
|
q = prune.L1Unstructured(amount=2)
|
|
q._tensor_name = 'another_test'
|
|
with self.assertRaises(ValueError):
|
|
container.add_pruning_method(q)
|
|
|
|
# test that adding a non-pruning method object to a pruning container
|
|
# raises a TypeError
|
|
with self.assertRaises(TypeError):
|
|
container.add_pruning_method(10)
|
|
with self.assertRaises(TypeError):
|
|
container.add_pruning_method('ugh')
|
|
|
|
def test_pruning_container_compute_mask(self):
|
|
r"""Test `compute_mask` of pruning container with a known `t` and
|
|
`default_mask`. Indirectly checks that Ln structured pruning is
|
|
acting on the right axis.
|
|
"""
|
|
# create an empty container
|
|
container = prune.PruningContainer()
|
|
container._tensor_name = 'test'
|
|
|
|
# 1) test unstructured pruning
|
|
# create a new pruning method
|
|
p = prune.L1Unstructured(amount=2)
|
|
p._tensor_name = 'test'
|
|
# add the pruning method to the container
|
|
container.add_pruning_method(p)
|
|
|
|
# create tensor to be pruned
|
|
t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32)
|
|
# create prior mask by hand
|
|
default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]])
|
|
# since we are pruning the two lowest magnitude units, the outcome of
|
|
# the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]])
|
|
computed_mask = container.compute_mask(t, default_mask)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(expected_mask, computed_mask)
|
|
|
|
# 2) test structured pruning
|
|
q = prune.LnStructured(amount=1, n=2, dim=0)
|
|
q._tensor_name = 'test'
|
|
container.add_pruning_method(q)
|
|
# since we are pruning the lowest magnitude one of the two rows, the
|
|
# outcome of the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 0, 0, 0], [1, 1, 0, 1]])
|
|
computed_mask = container.compute_mask(t, default_mask)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(expected_mask, computed_mask)
|
|
|
|
# 2) test structured pruning, along another axis
|
|
r = prune.LnStructured(amount=1, n=2, dim=1)
|
|
r._tensor_name = 'test'
|
|
container.add_pruning_method(r)
|
|
# since we are pruning the lowest magnitude of the four columns, the
|
|
# outcome of the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 1, 1, 0], [0, 1, 0, 1]])
|
|
computed_mask = container.compute_mask(t, default_mask)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(expected_mask, computed_mask)
|
|
|
|
def test_l1_unstructured_pruning(self):
|
|
r"""Test that l1 unstructured pruning actually removes the lowest
|
|
entries by l1 norm (by hand). It also checks that applying l1
|
|
unstructured pruning more than once respects the previous mask.
|
|
"""
|
|
m = nn.Linear(4, 2)
|
|
# modify its weight matrix by hand
|
|
m.weight = torch.nn.Parameter(
|
|
torch.tensor(
|
|
[[1, 2, 3, 4], [-4, -3, -2, -1]], dtype=torch.float32
|
|
)
|
|
)
|
|
|
|
prune.l1_unstructured(m, 'weight', amount=2)
|
|
expected_weight = torch.tensor([[0, 2, 3, 4], [-4, -3, -2, 0]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_weight, m.weight)
|
|
|
|
# check that pruning again removes the next two smallest entries
|
|
prune.l1_unstructured(m, 'weight', amount=2)
|
|
expected_weight = torch.tensor([[0, 0, 3, 4], [-4, -3, 0, 0]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_weight, m.weight)
|
|
|
|
def test_l1_unstructured_pruning_with_importance_scores(self):
|
|
r"""Test that l1 unstructured pruning actually removes the lowest
|
|
entries of importance scores and not the parameter by l1 norm (by hand).
|
|
It also checks that applying l1 unstructured pruning more than once
|
|
respects the previous mask.
|
|
"""
|
|
m = nn.Linear(4, 2)
|
|
# modify its weight matrix by hand
|
|
m.weight = torch.nn.Parameter(
|
|
torch.tensor(
|
|
[[1, 2, 3, 4], [-4, -3, -2, -1]], dtype=torch.float32
|
|
)
|
|
)
|
|
importance_scores = torch.tensor(
|
|
[[4, 2, 1, 3], [-3, -1, -2, -4]], dtype=torch.float32
|
|
)
|
|
|
|
prune.l1_unstructured(m, 'weight', amount=2, importance_scores=importance_scores)
|
|
expected_weight = torch.tensor([[1, 2, 0, 4], [-4, 0, -2, -1]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_weight, m.weight)
|
|
|
|
# check that pruning again removes two entries of m.weight that are colocated with
|
|
# the next two smallest absolute values of importance scores.
|
|
prune.l1_unstructured(m, 'weight', amount=2, importance_scores=importance_scores)
|
|
expected_weight = torch.tensor([[1, 0, 0, 4], [-4, 0, 0, -1]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_weight, m.weight)
|
|
|
|
def test_unstructured_pruning_same_magnitude(self):
|
|
r"""Since it may happen that the tensor to prune has entries with the
|
|
same exact magnitude, it is important to check that pruning happens
|
|
consistenly based on the bottom % of weights, and not by threshold,
|
|
which would instead kill off *all* units with magnitude = threshold.
|
|
"""
|
|
AMOUNT = 0.2
|
|
p = prune.L1Unstructured(amount=AMOUNT)
|
|
# create a random tensors with entries in {-2, 0, 2}
|
|
t = 2 * torch.randint(low=-1, high=2, size=(10, 7))
|
|
nparams_toprune = prune._compute_nparams_toprune(AMOUNT, t.nelement())
|
|
|
|
computed_mask = p.compute_mask(t, default_mask=torch.ones_like(t))
|
|
nparams_pruned = torch.sum(computed_mask == 0)
|
|
self.assertEqual(nparams_toprune, nparams_pruned)
|
|
|
|
def test_random_structured_pruning_amount(self):
|
|
AMOUNT = 0.6
|
|
AXIS = 2
|
|
p = prune.RandomStructured(amount=AMOUNT, dim=AXIS)
|
|
t = 2 * torch.randint(low=-1, high=2, size=(5, 4, 2)).to(
|
|
dtype=torch.float32
|
|
)
|
|
nparams_toprune = prune._compute_nparams_toprune(AMOUNT, t.shape[AXIS])
|
|
|
|
computed_mask = p.compute_mask(t, default_mask=torch.ones_like(t))
|
|
# check that 1 column is fully prune, the others are left untouched
|
|
remaining_axes = [_ for _ in range(len(t.shape)) if _ != AXIS]
|
|
per_column_sums = sorted(
|
|
torch.sum(computed_mask == 0, axis=remaining_axes)
|
|
)
|
|
assert per_column_sums == [0, 20]
|
|
|
|
def test_ln_structured_pruning(self):
|
|
r"""Check Ln structured pruning by hand.
|
|
"""
|
|
m = nn.Conv2d(3, 1, 2)
|
|
m.weight.data = torch.tensor(
|
|
[[[[1., 2.], [1., 2.5]],
|
|
[[0.5, 1.], [0.1, 0.1]],
|
|
[[-3., -5.], [0.1, -1.]]]]
|
|
)
|
|
# expected effect of pruning 1 of the 3 channels by L2-norm
|
|
expected_mask_axis1 = torch.ones_like(m.weight)
|
|
expected_mask_axis1[:, 1] = 0.
|
|
|
|
prune.ln_structured(m, 'weight', amount=1, n=2, dim=1)
|
|
self.assertEqual(expected_mask_axis1, m.weight_mask)
|
|
|
|
# expected effect of pruning 1 of the 2 columns along axis -1 by L1-norm
|
|
expected_mask_axis3 = expected_mask_axis1
|
|
expected_mask_axis3[:, :, :, 0] = 0.
|
|
|
|
prune.ln_structured(m, 'weight', amount=1, n=1, dim=-1)
|
|
self.assertEqual(expected_mask_axis3, m.weight_mask)
|
|
|
|
def test_ln_structured_pruning_importance_scores(self):
|
|
r"""Check Ln structured pruning by hand.
|
|
"""
|
|
m = nn.Conv2d(3, 1, 2)
|
|
m.weight.data = torch.tensor(
|
|
[[[[1., 2.], [1., 2.5]],
|
|
[[0.5, 1.], [0.1, 0.1]],
|
|
[[-3., -5.], [0.1, -1.]]]]
|
|
)
|
|
importance_scores = torch.tensor(
|
|
[[[[10., 1.], [10., 1.]],
|
|
[[30., 3.], [30., 3.]],
|
|
[[-20., -2.], [-20., -2.]]]]
|
|
)
|
|
# expected effect of pruning 1 of the 3 channels by L2-norm
|
|
expected_mask_axis1 = torch.ones_like(m.weight)
|
|
expected_mask_axis1[:, 0] = 0.
|
|
|
|
prune.ln_structured(m, 'weight', amount=1, n=2, dim=1, importance_scores=importance_scores)
|
|
self.assertEqual(expected_mask_axis1, m.weight_mask)
|
|
|
|
# expected effect of pruning 1 of the 2 columns along axis -1 by L1-norm
|
|
expected_mask_axis3 = expected_mask_axis1
|
|
expected_mask_axis3[:, :, :, 1] = 0.
|
|
|
|
prune.ln_structured(m, 'weight', amount=1, n=1, dim=-1, importance_scores=importance_scores)
|
|
self.assertEqual(expected_mask_axis3, m.weight_mask)
|
|
|
|
def test_remove_pruning(self):
|
|
r"""`prune.remove` removes the hook and the reparametrization
|
|
and makes the pruning final in the original parameter.
|
|
"""
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
# first prune
|
|
prune.random_unstructured(m, name, amount=0.5)
|
|
self.assertIn(name + "_orig", dict(m.named_parameters()))
|
|
self.assertIn(name + "_mask", dict(m.named_buffers()))
|
|
self.assertNotIn(name, dict(m.named_parameters()))
|
|
self.assertTrue(hasattr(m, name))
|
|
pruned_t = getattr(m, name)
|
|
|
|
# then remove pruning
|
|
prune.remove(m, name)
|
|
self.assertIn(name, dict(m.named_parameters()))
|
|
self.assertNotIn(name + "_orig", dict(m.named_parameters()))
|
|
self.assertNotIn(name + "_mask", dict(m.named_buffers()))
|
|
final_t = getattr(m, name)
|
|
|
|
self.assertEqual(pruned_t, final_t)
|
|
|
|
def test_remove_pruning_exception(self):
|
|
r"""Removing from an unpruned tensor throws an assertion error
|
|
"""
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
# check that the module isn't pruned
|
|
self.assertFalse(prune.is_pruned(m))
|
|
# since it isn't pruned, pruning can't be removed from it
|
|
with self.assertRaises(ValueError):
|
|
prune.remove(m, name)
|
|
|
|
|
|
def test_global_pruning(self):
|
|
r"""Test that global l1 unstructured pruning over 2 parameters removes
|
|
the `amount=4` smallest global weights across the 2 parameters.
|
|
"""
|
|
m = nn.Linear(4, 2)
|
|
n = nn.Linear(3, 1)
|
|
# modify the weight matrices by hand
|
|
m.weight = torch.nn.Parameter(
|
|
torch.tensor([[1, 2, 3, 4], [-4, -3, -2, -1]]).to(
|
|
dtype=torch.float32)
|
|
)
|
|
n.weight = torch.nn.Parameter(
|
|
torch.tensor([[0, 0.1, -2]]).to(
|
|
dtype=torch.float32)
|
|
)
|
|
|
|
params_to_prune = (
|
|
(m, 'weight'),
|
|
(n, 'weight'),
|
|
)
|
|
|
|
# prune the 4 smallest weights globally by L1 magnitude
|
|
prune.global_unstructured(
|
|
params_to_prune,
|
|
pruning_method=prune.L1Unstructured,
|
|
amount=4
|
|
)
|
|
|
|
expected_mweight = torch.tensor([[0, 2, 3, 4], [-4, -3, -2, 0]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_mweight, m.weight)
|
|
|
|
expected_nweight = torch.tensor([[0, 0, -2]]).to(dtype=n.weight.dtype)
|
|
self.assertEqual(expected_nweight, n.weight)
|
|
|
|
def test_global_pruning_importance_scores(self):
|
|
r"""Test that global l1 unstructured pruning over 2 parameters removes
|
|
the `amount=4` smallest global weights across the 2 parameters.
|
|
"""
|
|
m = nn.Linear(4, 2)
|
|
n = nn.Linear(3, 1)
|
|
# modify the weight matrices by hand
|
|
m.weight = torch.nn.Parameter(
|
|
torch.tensor([[1, 2, 3, 4], [-4, -3, -2, -1]]).to(
|
|
dtype=torch.float32)
|
|
)
|
|
m_importance_scores = torch.tensor(
|
|
[[4, 2, 1, 3], [-3, -1, -2, -4]], dtype=torch.float32
|
|
)
|
|
n.weight = torch.nn.Parameter(
|
|
torch.tensor([[0, 0.1, -2]]).to(
|
|
dtype=torch.float32)
|
|
)
|
|
n_importance_scores = torch.tensor([[0, 10., -0.2]]).to(dtype=torch.float32)
|
|
|
|
params_to_prune = (
|
|
(m, 'weight'),
|
|
(n, 'weight'),
|
|
)
|
|
importance_scores = {
|
|
(m, 'weight'): m_importance_scores,
|
|
(n, 'weight'): n_importance_scores,
|
|
}
|
|
|
|
# prune the 4 smallest weights globally by L1 magnitude
|
|
prune.global_unstructured(
|
|
params_to_prune,
|
|
pruning_method=prune.L1Unstructured,
|
|
amount=4,
|
|
importance_scores=importance_scores,
|
|
)
|
|
|
|
expected_m_weight = torch.tensor([[1, 2, 0, 4], [-4, 0, -2, -1]],
|
|
dtype=m.weight.dtype)
|
|
self.assertEqual(expected_m_weight, m.weight)
|
|
|
|
expected_n_weight = torch.tensor([[0, 0.1, 0]]).to(dtype=n.weight.dtype)
|
|
self.assertEqual(expected_n_weight, n.weight)
|
|
|
|
def test_custom_from_mask_pruning(self):
|
|
r"""Test that the CustomFromMask is capable of receiving
|
|
as input at instantiation time a custom mask, and combining it with
|
|
the previous default mask to generate the correct final mask.
|
|
"""
|
|
# new mask
|
|
mask = torch.tensor([[0, 1, 1, 0], [0, 0, 1, 1]])
|
|
# old mask
|
|
default_mask = torch.tensor([[0, 0, 0, 0], [1, 1, 1, 1]])
|
|
|
|
# some tensor (not actually used)
|
|
t = torch.rand_like(mask.to(dtype=torch.float32))
|
|
|
|
p = prune.CustomFromMask(mask=mask)
|
|
|
|
computed_mask = p.compute_mask(t, default_mask)
|
|
expected_mask = torch.tensor([[0, 0, 0, 0], [0, 0, 1, 1]]).to(
|
|
dtype=t.dtype
|
|
)
|
|
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(computed_mask, expected_mask)
|
|
|
|
def test_pruning_rollback(self):
|
|
r"""Test that if something fails when the we try to compute the mask,
|
|
then the model isn't left in some intermediate half-pruned state.
|
|
The try/except statement in `apply` should handle rolling back
|
|
to the previous state before pruning began.
|
|
"""
|
|
modules = [nn.Linear(5, 7), nn.Conv3d(2, 2, 2)]
|
|
names = ['weight', 'bias']
|
|
|
|
for m in modules:
|
|
for name in names:
|
|
with self.subTest(m=m, name=name):
|
|
|
|
with mock.patch(
|
|
"torch.nn.utils.prune.L1Unstructured.compute_mask"
|
|
) as compute_mask:
|
|
compute_mask.side_effect = Exception('HA!')
|
|
with self.assertRaises(Exception):
|
|
prune.l1_unstructured(m, name=name, amount=0.9)
|
|
|
|
self.assertTrue(
|
|
name in dict(m.named_parameters())
|
|
)
|
|
self.assertFalse(
|
|
name + '_mask' in dict(m.named_buffers())
|
|
)
|
|
self.assertFalse(
|
|
name + '_orig' in dict(m.named_parameters())
|
|
)
|
|
|
|
def test_pruning_serialization_model(self):
|
|
# create a model
|
|
model = torch.nn.Sequential(
|
|
torch.nn.Linear(10, 10),
|
|
torch.nn.ReLU(),
|
|
torch.nn.Linear(10, 1),
|
|
)
|
|
# check that everything looks normal before pruning
|
|
self.assertNotIn('0.weight_orig', model.state_dict())
|
|
self.assertNotIn('0.weight_mask', model.state_dict())
|
|
self.assertIn('0.weight', model.state_dict())
|
|
|
|
# prune one of its parameters
|
|
prune.l1_unstructured(module=model[0], name='weight', amount=0.9)
|
|
|
|
# check that the original weight and the new mask are present
|
|
self.assertIn('0.weight_orig', model.state_dict())
|
|
self.assertIn('0.weight_mask', model.state_dict())
|
|
self.assertNotIn('0.weight', model.state_dict())
|
|
self.assertTrue(hasattr(model[0], 'weight'))
|
|
|
|
pruned_weight = model[0].weight
|
|
|
|
with TemporaryFileName() as fname:
|
|
torch.save(model, fname)
|
|
new_model = torch.load(fname)
|
|
|
|
# check that the original weight and the new mask are present
|
|
self.assertIn('0.weight_orig', new_model.state_dict())
|
|
self.assertIn('0.weight_mask', new_model.state_dict())
|
|
self.assertNotIn('0.weight', new_model.state_dict())
|
|
self.assertTrue(hasattr(new_model[0], 'weight'))
|
|
|
|
self.assertEqual(pruned_weight, new_model[0].weight)
|
|
|
|
def test_pruning_serialization_state_dict(self):
|
|
# create a model
|
|
model = torch.nn.Sequential(
|
|
torch.nn.Linear(10, 10),
|
|
torch.nn.ReLU(),
|
|
torch.nn.Linear(10, 1),
|
|
)
|
|
# check that everything looks normal before pruning
|
|
self.assertNotIn('0.weight_orig', model.state_dict())
|
|
self.assertNotIn('0.weight_mask', model.state_dict())
|
|
self.assertIn('0.weight', model.state_dict())
|
|
|
|
# prune one of its parameters
|
|
prune.l1_unstructured(module=model[0], name='weight', amount=0.9)
|
|
|
|
# check that the original weight and the new mask are present
|
|
self.assertIn('0.weight_orig', model.state_dict())
|
|
self.assertIn('0.weight_mask', model.state_dict())
|
|
self.assertNotIn('0.weight', model.state_dict())
|
|
self.assertTrue(hasattr(model[0], 'weight'))
|
|
|
|
pruned_weight = model[0].weight
|
|
|
|
# make pruning permanent and restore parameter names as in base
|
|
# architecture
|
|
prune.remove(module=model[0], name='weight')
|
|
|
|
# check that the original weight and the new mask are no longer present
|
|
self.assertNotIn('0.weight_orig', model.state_dict())
|
|
self.assertNotIn('0.weight_mask', model.state_dict())
|
|
self.assertIn('0.weight', model.state_dict())
|
|
|
|
# save the state dict of model and reload it into new_model
|
|
new_model = torch.nn.Sequential(
|
|
torch.nn.Linear(10, 10),
|
|
torch.nn.ReLU(),
|
|
torch.nn.Linear(10, 1),
|
|
)
|
|
with TemporaryFileName() as fname:
|
|
torch.save(model.state_dict(), fname)
|
|
new_model.load_state_dict(torch.load(fname))
|
|
|
|
# check that the original weight and the new mask are not present in
|
|
# new_model either.
|
|
self.assertNotIn('0.weight_orig', new_model.state_dict())
|
|
self.assertNotIn('0.weight_mask', new_model.state_dict())
|
|
self.assertIn('0.weight', new_model.state_dict())
|
|
|
|
self.assertEqual(pruned_weight, new_model[0].weight)
|
|
|
|
def test_prune(self):
|
|
# create a new pruning method
|
|
p = prune.L1Unstructured(amount=2)
|
|
# create tensor to be pruned
|
|
t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32)
|
|
# create prior mask by hand
|
|
default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]])
|
|
# since we are pruning the two lowest magnitude units, the outcome of
|
|
# the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]])
|
|
pruned_tensor = p.prune(t, default_mask)
|
|
self.assertEqual(t * expected_mask, pruned_tensor)
|
|
|
|
def test_prune_importance_scores(self):
|
|
# create a new pruning method
|
|
p = prune.L1Unstructured(amount=2)
|
|
# create tensor to be pruned
|
|
t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32)
|
|
importance_scores = torch.tensor(
|
|
[[1, 2, 3, 4], [1.5, 1.6, 1.7, 1.8]]
|
|
).to(dtype=torch.float32)
|
|
# create prior mask by hand
|
|
default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]])
|
|
# since we are pruning the two lowest magnitude units, the outcome of
|
|
# the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 1, 1, 0], [0, 1, 0, 1]])
|
|
pruned_tensor = p.prune(t, default_mask, importance_scores=importance_scores)
|
|
self.assertEqual(t * expected_mask, pruned_tensor)
|
|
|
|
def test_prune_importance_scores_mimic_default(self):
|
|
# create a new pruning method
|
|
p = prune.L1Unstructured(amount=2)
|
|
# create tensor to be pruned
|
|
t = torch.tensor([[1, 2, 3, 4], [5, 6, 7, 8]]).to(dtype=torch.float32)
|
|
# create prior mask by hand
|
|
default_mask = torch.tensor([[1, 1, 1, 0], [1, 1, 0, 1]])
|
|
# since we are pruning the two lowest magnitude units, the outcome of
|
|
# the calculation should be this:
|
|
expected_mask = torch.tensor([[0, 0, 1, 0], [1, 1, 0, 1]])
|
|
pruned_tensor_without_importance_scores = p.prune(t, default_mask)
|
|
pruned_tensor_with_importance_scores = p.prune(t, default_mask, importance_scores=t)
|
|
self.assertEqual(pruned_tensor_without_importance_scores, pruned_tensor_with_importance_scores)
|
|
self.assertEqual(t * expected_mask, pruned_tensor_without_importance_scores)
|
|
|
|
def test_rnn_pruning(self):
|
|
l = torch.nn.LSTM(32, 32)
|
|
# This Module has 4 parameters called:
|
|
# 'weight_ih_l0', 'weight_hh_l0', 'bias_ih_l0', 'bias_hh_l0'
|
|
|
|
# Pruning one of them causes one of the weights to become a tensor
|
|
prune.l1_unstructured(l, 'weight_ih_l0', 0.5)
|
|
assert (
|
|
sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights])
|
|
== 3
|
|
)
|
|
|
|
# Removing the pruning reparametrization restores the Parameter
|
|
prune.remove(l, 'weight_ih_l0')
|
|
assert (
|
|
sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights])
|
|
== 4
|
|
)
|
|
|
|
# Make sure that, upon removal of the reparametrization, the
|
|
# `._parameters` and `.named_parameters` contain the right params.
|
|
# Specifically, the original weight ('weight_ih_l0') should be placed
|
|
# back in the parameters, while the reparametrization component
|
|
# ('weight_ih_l0_orig') should be removed.
|
|
assert 'weight_ih_l0' in l._parameters
|
|
assert l._parameters['weight_ih_l0'] is not None
|
|
assert 'weight_ih_l0_orig' not in l._parameters
|
|
assert 'weight_ih_l0' in dict(l.named_parameters())
|
|
assert dict(l.named_parameters())['weight_ih_l0'] is not None
|
|
assert 'weight_ih_l0_orig' not in dict(l.named_parameters())
|
|
|
|
|
|
def test_rnn_weight_norm(self):
|
|
def check_weight_norm(l, name, num_params):
|
|
# This Module has 4 or 5 parameters called:
|
|
# 'weight_ih_l0', 'weight_hh_l0', 'bias_ih_l0', 'bias_hh_l0', weight_hr_l0
|
|
|
|
# Applying weight norm on one of them causes it to become a tensor
|
|
l = torch.nn.utils.weight_norm(l, name=name)
|
|
self.assertEqual(
|
|
sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]),
|
|
num_params - 1,
|
|
)
|
|
|
|
# Removing the weight norm reparametrization restores the Parameter
|
|
l = torch.nn.utils.remove_weight_norm(l, name=name)
|
|
self.assertEqual(
|
|
sum([isinstance(p, torch.nn.Parameter) for p in l._flat_weights]),
|
|
num_params,
|
|
)
|
|
|
|
# Make sure that, upon removal of the reparametrization, the
|
|
# `._parameters` and `.named_parameters` contain the right params.
|
|
# Specifically, the original weight ('weight_ih_l0') should be placed
|
|
# back in the parameters, while the reparametrization components
|
|
# ('weight_ih_l0_v' and 'weight_ih_l0_g') should be removed.
|
|
self.assertTrue(name in l._parameters)
|
|
self.assertIsNotNone(l._parameters[name])
|
|
self.assertTrue(name + '_v' not in l._parameters)
|
|
self.assertTrue(name + '_g' not in l._parameters)
|
|
self.assertTrue(name in dict(l.named_parameters()))
|
|
self.assertIsNotNone(dict(l.named_parameters())[name])
|
|
self.assertTrue(name + '_v' not in dict(l.named_parameters()))
|
|
self.assertTrue(name + '_g' not in dict(l.named_parameters()))
|
|
|
|
check_weight_norm(torch.nn.LSTM(32, 32), 'weight_ih_l0', 4)
|
|
check_weight_norm(torch.nn.LSTM(32, 32, proj_size=16), 'weight_hr_l0', 5)
|
|
|
|
|
|
def test_weight_norm(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
expected_output = m(input)
|
|
|
|
# add weight normalization
|
|
m = torch.nn.utils.weight_norm(m)
|
|
self.assertEqual(m.weight_v.size(), m.weight.size())
|
|
self.assertEqual(m.weight_g.size(), (7, 1))
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
# remove weight norm
|
|
m = torch.nn.utils.remove_weight_norm(m)
|
|
self.assertFalse(hasattr(m, 'weight_g'))
|
|
self.assertFalse(hasattr(m, 'weight_v'))
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
# test with dim=1
|
|
m = torch.nn.utils.weight_norm(m, dim=1)
|
|
self.assertEqual(m.weight_v.size(), m.weight.size())
|
|
self.assertEqual(m.weight_g.size(), (1, 5))
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
# test with dim=None
|
|
m = nn.Linear(5, 7)
|
|
expected_output = m(input)
|
|
m = torch.nn.utils.weight_norm(m, dim=None)
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'register two weight_norm hooks'):
|
|
m = torch.nn.utils.weight_norm(m)
|
|
m = torch.nn.utils.weight_norm(m)
|
|
|
|
def test_parameterlistdict_setting_attributes(self):
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod.train()
|
|
mod.eval()
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with self.assertWarnsRegex(UserWarning,
|
|
r"Setting attributes on ParameterList is not supported"):
|
|
torch.nn.utils.weight_norm(mod, "0")
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod.train()
|
|
mod.eval()
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with self.assertWarnsRegex(UserWarning,
|
|
r"Setting attributes on ParameterDict is not supported"):
|
|
torch.nn.utils.weight_norm(mod, "b")
|
|
|
|
def test_parameterlistdict_pickle(self):
|
|
m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
del m._initialized
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
# Test whether loading from older checkpoints works without triggering warnings
|
|
m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
del m._initialized
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
# Test whether loading from older checkpoints works without triggering warnings
|
|
m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
def test_weight_norm_pickle(self):
|
|
m = torch.nn.utils.weight_norm(nn.Linear(5, 7))
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertIsInstance(m, nn.Linear)
|
|
|
|
def test_spectral_norm(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
|
|
self.assertEqual(m.weight_u.size(), torch.Size([m.weight.size(0)]))
|
|
# weight_orig should be trainable
|
|
self.assertTrue(hasattr(m, 'weight_orig'))
|
|
self.assertTrue('weight_orig' in m._parameters)
|
|
# weight_u should be just a reused buffer
|
|
self.assertTrue(hasattr(m, 'weight_u'))
|
|
self.assertTrue('weight_u' in m._buffers)
|
|
self.assertTrue('weight_v' in m._buffers)
|
|
# weight should be a plain attribute, not counted as a buffer or a param
|
|
self.assertFalse('weight' in m._buffers)
|
|
self.assertFalse('weight' in m._parameters)
|
|
# it should also be sharing storage as `weight_orig`
|
|
self.assertEqual(m.weight_orig.storage(), m.weight.storage())
|
|
self.assertEqual(m.weight_orig.size(), m.weight.size())
|
|
self.assertEqual(m.weight_orig.stride(), m.weight.stride())
|
|
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertFalse(hasattr(m, 'weight_orig'))
|
|
self.assertFalse(hasattr(m, 'weight_u'))
|
|
# weight should be converted back as a parameter
|
|
self.assertTrue(hasattr(m, 'weight'))
|
|
self.assertTrue('weight' in m._parameters)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'register two spectral_norm hooks'):
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
|
|
# test correctness in training/eval modes and cpu/multi-gpu settings
|
|
for apply_dp in (True, False):
|
|
if apply_dp:
|
|
if not TEST_MULTIGPU:
|
|
continue
|
|
device = torch.device('cuda:0')
|
|
|
|
def maybe_wrap(m):
|
|
return torch.nn.DataParallel(m, [0, 1])
|
|
else:
|
|
device = torch.device('cpu')
|
|
|
|
def maybe_wrap(m):
|
|
return m
|
|
|
|
for requires_grad in (True, False):
|
|
m = nn.Linear(3, 4).to(device)
|
|
m.weight.requires_grad_(requires_grad)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
wrapped_m = maybe_wrap(m)
|
|
self.assertTrue(hasattr(m, 'weight_u'))
|
|
u0 = m.weight_u.clone()
|
|
v0 = m.weight_v.clone()
|
|
|
|
# TEST TRAINING BEHAVIOR
|
|
|
|
# assert that u and v are updated
|
|
input = torch.randn(2, 3, device=device)
|
|
out = wrapped_m(input)
|
|
self.assertNotEqual(u0, m.weight_u)
|
|
self.assertNotEqual(v0, m.weight_v)
|
|
|
|
# assert that backprop reaches weight_orig
|
|
# can't use gradcheck because the function changes as we
|
|
# activate through it in training mode
|
|
if requires_grad:
|
|
torch.autograd.grad(out.sum(), m.weight_orig)
|
|
|
|
# test backward works with multiple forwards
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = m.weight_u.clone()
|
|
saved_v = m.weight_v.clone()
|
|
|
|
def fn(input):
|
|
m.weight_u.data.copy_(saved_u)
|
|
m.weight_v.data.copy_(saved_v)
|
|
out0 = wrapped_m(input)
|
|
out1 = wrapped_m(input)
|
|
return out0 + out1
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),), check_batched_grad=False)
|
|
|
|
# test removing
|
|
pre_remove_out = wrapped_m(input)
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
for _ in range(3):
|
|
pre_remove_out = wrapped_m(input)
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
# TEST EVAL BEHAVIOR
|
|
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
wrapped_m(input)
|
|
last_train_out = wrapped_m(input)
|
|
last_train_u = m.weight_u.clone()
|
|
last_train_v = m.weight_v.clone()
|
|
wrapped_m.zero_grad()
|
|
wrapped_m.eval()
|
|
|
|
eval_out0 = wrapped_m(input)
|
|
# assert eval gives same result as last training iteration
|
|
self.assertEqual(eval_out0, last_train_out)
|
|
# assert doing more iteartion in eval don't change things
|
|
self.assertEqual(eval_out0, wrapped_m(input))
|
|
self.assertEqual(last_train_u, m.weight_u)
|
|
self.assertEqual(last_train_v, m.weight_v)
|
|
|
|
# FIXME: the code below is flaky when executed with DataParallel
|
|
# see https://github.com/pytorch/pytorch/issues/13818
|
|
if apply_dp:
|
|
continue
|
|
|
|
# test backward works with multiple forwards in mixed training
|
|
# and eval modes
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = m.weight_u.clone()
|
|
saved_v = m.weight_v.clone()
|
|
|
|
def fn(input):
|
|
m.weight_u.data.copy_(saved_u)
|
|
m.weight_v.data.copy_(saved_v)
|
|
wrapped_m.train()
|
|
out0 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out1 = wrapped_m(input)
|
|
wrapped_m.train()
|
|
out2 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out3 = wrapped_m(input)
|
|
return out0 + out1 + out2 + out3
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),))
|
|
|
|
# assert that backprop reaches weight_orig in eval
|
|
if requires_grad:
|
|
def fn(weight):
|
|
return wrapped_m(input)
|
|
|
|
gradcheck(fn, (m.weight_orig,))
|
|
|
|
def test_new_spectral_norm(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
spectral_norm_m = m.parametrizations.weight[0]
|
|
|
|
self.assertEqual(spectral_norm_m.u.size(), torch.Size([m.weight.size(0)]))
|
|
|
|
# .parametrizations.weight.original should be trainable
|
|
self.assertTrue(hasattr(m.parametrizations.weight, 'original'))
|
|
self.assertTrue('original' in m.parametrizations.weight._parameters)
|
|
|
|
# u should be just a reused buffer
|
|
self.assertTrue(hasattr(spectral_norm_m, 'u'))
|
|
self.assertTrue('u' in spectral_norm_m._buffers)
|
|
self.assertTrue('v' in spectral_norm_m._buffers)
|
|
|
|
# weight should be a plain attribute, not counted as a buffer or a param
|
|
self.assertIsNotNone(m.weight)
|
|
self.assertFalse('weight' in m._buffers)
|
|
self.assertFalse('weight' in m._parameters)
|
|
|
|
# it should also be sharing storage as `weight_orig`
|
|
# self.assertEqual(m.parametrizations.weight.original.storage(), m.weight.storage())
|
|
self.assertEqual(m.parametrizations.weight.original.size(), m.weight.size())
|
|
self.assertEqual(m.parametrizations.weight.original.stride(), m.weight.stride())
|
|
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'weight')
|
|
|
|
# spectral_norm is the only parametrization
|
|
self.assertFalse(hasattr(m, 'parametrizations'))
|
|
self.assertTrue('weight' in m._parameters)
|
|
|
|
# We can register spectral_norm multiple times on the same parameter
|
|
# and on multiple parameters in the same module
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m, 'weight')
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m, 'weight')
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m, 'bias')
|
|
|
|
# If we remove the parametrization on bias, weight is still parametrized
|
|
# Removing a parametrization runs forward in eval mode if leave_parametrized=True
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'bias')
|
|
self.assertTrue('bias' in m._parameters)
|
|
self.assertTrue(hasattr(m, 'parametrizations'))
|
|
self.assertFalse('weight' in m._parameters)
|
|
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'weight')
|
|
# Neither weight and bias are parametrized
|
|
self.assertFalse(hasattr(m, 'parametrizations'))
|
|
self.assertTrue('weight' in m._parameters)
|
|
|
|
# test correctness in training/eval modes and cpu/multi-gpu settings
|
|
for apply_dp in (True, False):
|
|
if apply_dp:
|
|
if not TEST_MULTIGPU:
|
|
continue
|
|
device = torch.device('cuda:0')
|
|
|
|
def maybe_wrap(m):
|
|
return torch.nn.DataParallel(m, [0, 1])
|
|
else:
|
|
device = torch.device('cpu')
|
|
|
|
def maybe_wrap(m):
|
|
return m
|
|
|
|
for requires_grad in (True, False):
|
|
def get_modules():
|
|
m = nn.Linear(3, 4).to(device)
|
|
m.weight.requires_grad_(requires_grad)
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
wrapped_m = maybe_wrap(m)
|
|
spectral_norm_m = m.parametrizations.weight[0]
|
|
return m, wrapped_m, spectral_norm_m
|
|
|
|
input = torch.randn(2, 3, device=device)
|
|
|
|
m, wrapped_m, spectral_norm_m = get_modules()
|
|
|
|
self.assertTrue(hasattr(spectral_norm_m, 'u'))
|
|
u0 = spectral_norm_m.u.clone()
|
|
v0 = spectral_norm_m.v.clone()
|
|
|
|
# TEST TRAINING BEHAVIOR
|
|
|
|
# run forward again and assert that u and v are updated
|
|
out = wrapped_m(input)
|
|
self.assertNotEqual(u0, spectral_norm_m.u)
|
|
self.assertNotEqual(v0, spectral_norm_m.v)
|
|
|
|
# assert that backprop reaches original weight
|
|
# can't use gradcheck because the function changes as we
|
|
# activate through it in training mode
|
|
if requires_grad:
|
|
torch.autograd.grad(out.sum(), m.parametrizations.weight.original)
|
|
|
|
# test backward works with multiple forwards
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = spectral_norm_m.u.clone()
|
|
saved_v = spectral_norm_m.v.clone()
|
|
|
|
def fn(input):
|
|
spectral_norm_m.u.data.copy_(saved_u)
|
|
spectral_norm_m.v.data.copy_(saved_v)
|
|
out0 = wrapped_m(input)
|
|
out1 = wrapped_m(input)
|
|
return out0 + out1
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),), check_batched_grad=False)
|
|
|
|
# test removing
|
|
# spectral norm module needs to be in eval mode if we'd like to
|
|
# avoid doing another power iteration
|
|
m, wrapped_m, _ = get_modules()
|
|
pre_remove_out = wrapped_m(input)
|
|
m.eval()
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'weight')
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
torch.nn.utils.parametrizations.spectral_norm(m)
|
|
pre_remove_out = wrapped_m(input)
|
|
m.train()
|
|
self.assertTrue(m.parametrizations.weight[0].training)
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'weight')
|
|
self.assertNotEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
torch.nn.utils.parametrizations.spectral_norm(m)
|
|
for _ in range(3):
|
|
pre_remove_out = wrapped_m(input)
|
|
m.eval()
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(m, 'weight')
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
# TEST EVAL BEHAVIOR
|
|
m, wrapped_m, spectral_norm_m = get_modules()
|
|
wrapped_m(input)
|
|
last_train_out = wrapped_m(input)
|
|
last_train_u = spectral_norm_m.u.clone()
|
|
last_train_v = spectral_norm_m.v.clone()
|
|
wrapped_m.zero_grad()
|
|
wrapped_m.eval()
|
|
|
|
eval_out0 = wrapped_m(input)
|
|
# assert eval gives same result as last training iteration
|
|
self.assertEqual(eval_out0, last_train_out)
|
|
# assert doing more iteartion in eval don't change things
|
|
self.assertEqual(eval_out0, wrapped_m(input))
|
|
self.assertEqual(last_train_u, spectral_norm_m.u)
|
|
self.assertEqual(last_train_v, spectral_norm_m.v)
|
|
|
|
# FIXME: the code below is flaky when executed with DataParallel
|
|
# see https://github.com/pytorch/pytorch/issues/13818
|
|
if apply_dp:
|
|
continue
|
|
|
|
# test backward works with multiple forwards in mixed training
|
|
# and eval modes
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = spectral_norm_m.u.clone()
|
|
saved_v = spectral_norm_m.v.clone()
|
|
|
|
def fn(input):
|
|
spectral_norm_m.u.data.copy_(saved_u)
|
|
spectral_norm_m.v.data.copy_(saved_v)
|
|
wrapped_m.train()
|
|
out0 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out1 = wrapped_m(input)
|
|
wrapped_m.train()
|
|
out2 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out3 = wrapped_m(input)
|
|
return out0 + out1 + out2 + out3
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),))
|
|
|
|
# assert that backprop reaches weight_orig in eval
|
|
if requires_grad:
|
|
def fn(weight):
|
|
return wrapped_m(input)
|
|
|
|
gradcheck(fn, (m.parametrizations.weight.original,))
|
|
|
|
def test_new_spectral_norm_load_state_dict(self):
|
|
for activate_times in (0, 3):
|
|
inp = torch.randn(2, 3)
|
|
m = nn.Linear(3, 5)
|
|
snm = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
snm.train()
|
|
|
|
for _ in range(activate_times):
|
|
snm(inp)
|
|
|
|
state_dict = deepcopy(snm.state_dict())
|
|
self.assertEqual({
|
|
'parametrizations.weight.original',
|
|
'bias',
|
|
'parametrizations.weight.0.v',
|
|
'parametrizations.weight.0.u'
|
|
}, set(state_dict.keys()))
|
|
|
|
# test that non-strict loading works
|
|
non_strict_state_dict = deepcopy(state_dict)
|
|
non_strict_state_dict['nonsense'] = 'nonsense'
|
|
with self.assertRaisesRegex(RuntimeError, r'Unexpected key\(s\) in state_dict: "nonsense"'):
|
|
snm.load_state_dict(non_strict_state_dict, strict=True)
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['parametrizations.weight.original']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['parametrizations.weight.0.u']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['parametrizations.weight.0.v']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
non_strict_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict._metadata['parametrizations.weight.0'] # remove metadata info
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight'] # remove W buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['bias']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
|
|
# normal state_dict
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(snm, 'weight')
|
|
snm = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
|
|
snm.load_state_dict(state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
out0_eval = snm(inp)
|
|
snm.train()
|
|
out1_train = snm(inp)
|
|
out2_train = snm(inp)
|
|
snm.eval()
|
|
out3_eval = snm(inp)
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.parametrize.remove_parametrizations(snm, 'weight')
|
|
snm = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
|
|
# Test normal loading
|
|
snm.load_state_dict(state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
self.assertEqual(out0_eval, snm(inp))
|
|
snm.train()
|
|
self.assertEqual(out1_train, snm(inp))
|
|
self.assertEqual(out2_train, snm(inp))
|
|
snm.eval()
|
|
self.assertEqual(out3_eval, snm(inp))
|
|
|
|
@skipIfNoLapack
|
|
def test_spectral_norm_load_state_dict(self):
|
|
inp = torch.randn(2, 3)
|
|
for activate_times in (0, 3):
|
|
# Test backward compatibility
|
|
# At version None -> 1: weight becomes not a buffer and v vector becomes a buffer
|
|
m = nn.Linear(3, 5)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
snm.train()
|
|
for _ in range(activate_times):
|
|
snm(inp)
|
|
|
|
version_latest_ref_state_dict = deepcopy(snm.state_dict())
|
|
self.assertEqual({'weight_orig', 'bias', 'weight_u', 'weight_v'}, set(version_latest_ref_state_dict.keys()))
|
|
|
|
# test that non-strict loading works
|
|
non_strict_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
non_strict_state_dict['nonsense'] = 'nonsense'
|
|
with self.assertRaisesRegex(RuntimeError, r'Unexpected key\(s\) in state_dict: "nonsense"'):
|
|
snm.load_state_dict(non_strict_state_dict, strict=True)
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_orig']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_u']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_v']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
non_strict_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict._metadata['']['spectral_norm'] # remove metadata info
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight'] # remove W buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['bias']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
|
|
# craft a version None state_dict
|
|
version_none_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
self.assertIn('spectral_norm', version_none_state_dict._metadata[''])
|
|
del version_none_state_dict._metadata['']['spectral_norm'] # remove metadata info
|
|
del version_none_state_dict['weight_v'] # remove v vector
|
|
version_none_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer
|
|
|
|
# normal state_dict
|
|
for version_latest_with_metadata in [True, False]:
|
|
version_latest_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
|
|
if not version_latest_with_metadata:
|
|
# We want to still load a user-crafted state_dict, one without metadata
|
|
del version_latest_state_dict._metadata['']['spectral_norm']
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
snm.load_state_dict(version_latest_ref_state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
out0_eval = snm(inp)
|
|
snm.train()
|
|
out1_train = snm(inp)
|
|
out2_train = snm(inp)
|
|
snm.eval()
|
|
out3_eval = snm(inp)
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
snm.load_state_dict(version_none_state_dict)
|
|
if activate_times > 0:
|
|
# since in loading version None state dict, we assume that the
|
|
# values in the state dict have gone through at lease one
|
|
# forward, we only test for equivalence when activate_times > 0.
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
self.assertEqual(out0_eval, snm(inp))
|
|
snm.train()
|
|
self.assertEqual(out1_train, snm(inp))
|
|
self.assertEqual(out2_train, snm(inp))
|
|
snm.eval()
|
|
self.assertEqual(out3_eval, snm(inp))
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
# Test normal loading
|
|
snm.load_state_dict(version_latest_state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
self.assertEqual(out0_eval, snm(inp))
|
|
snm.train()
|
|
self.assertEqual(out1_train, snm(inp))
|
|
self.assertEqual(out2_train, snm(inp))
|
|
snm.eval()
|
|
self.assertEqual(out3_eval, snm(inp))
|
|
|
|
def test_spectral_norm_dim(self):
|
|
inp = torch.randn(2, 3, 10, 12)
|
|
m = nn.ConvTranspose2d(3, 4, (5, 6))
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
# this should not run into incompatible shapes
|
|
x = m(inp)
|
|
# check that u refers to the same dimension
|
|
self.assertEqual(m.weight_u.shape, m.weight_orig[0, :, 0, 0].shape)
|
|
|
|
def test_new_spectral_norm_dim(self):
|
|
inp = torch.randn(2, 3, 10, 12)
|
|
m = nn.ConvTranspose2d(3, 4, (5, 6))
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
snm = m.parametrizations.weight[0]
|
|
# this should not run into incompatible shapes
|
|
x = m(inp)
|
|
# check that u refers to the same dimension
|
|
self.assertEqual(snm.u.shape, m.parametrizations.weight.original[0, :, 0, 0].shape)
|
|
|
|
def test_spectral_norm_forward(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
# naive forward
|
|
_weight, _bias, _u = m.weight_orig, m.bias, m.weight_u
|
|
_weight_mat = _weight.view(_weight.size(0), -1)
|
|
_v = torch.mv(_weight_mat.t(), _u)
|
|
_v = F.normalize(_v, dim=0, eps=1e-12)
|
|
_u = torch.mv(_weight_mat, _v)
|
|
_u = F.normalize(_u, dim=0, eps=1e-12)
|
|
_weight.data /= torch.dot(_u, torch.matmul(_weight_mat, _v))
|
|
out_hat = torch.nn.functional.linear(input, _weight, _bias)
|
|
expect_out = m(input)
|
|
self.assertEqual(expect_out, out_hat)
|
|
|
|
def test_new_spectral_norm_forward(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.parametrizations.spectral_norm(m)
|
|
snm = m.parametrizations.weight[0]
|
|
# naive forward
|
|
_weight = m.parametrizations.weight.original
|
|
_bias, _v = m.bias, snm.v
|
|
_weight_mat = _weight.view(_weight.size(0), -1)
|
|
_u = torch.mv(_weight_mat, _v)
|
|
_u = F.normalize(_u, dim=0, eps=1e-12)
|
|
_v = torch.mv(_weight_mat.t(), _u)
|
|
_v = F.normalize(_v, dim=0, eps=1e-12)
|
|
_weight.data /= torch.dot(_u, torch.matmul(_weight_mat, _v))
|
|
out_hat = torch.nn.functional.linear(input, _weight, _bias)
|
|
expect_out = m(input)
|
|
self.assertEqual(expect_out, out_hat)
|
|
|
|
def test_spectral_norm_pickle(self):
|
|
m = torch.nn.utils.spectral_norm(nn.Linear(5, 7))
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertIsInstance(m, nn.Linear)
|
|
|
|
def test_threshold_int(self):
|
|
x = torch.tensor([-3, -2, -1, 0, 1, 2, 3])
|
|
expected = torch.tensor([99, 99, 99, 99, 1, 2, 3])
|
|
self.assertEqual(F.threshold(x, 0, 99), expected)
|
|
|
|
def test_threshold_bfloat16(self):
|
|
x = torch.randn(100)
|
|
for threshold in [0, -0.5, 0.5, float('inf'), float('-inf'), float('nan')]:
|
|
expected = F.threshold(x, threshold, 0).bfloat16().float()
|
|
res_bf16 = F.threshold(x.bfloat16(), threshold, 0).float()
|
|
self.assertEqual(res_bf16, expected)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_embedding_max_norm_unsorted_repeating_indices(self):
|
|
def create_embedding(device):
|
|
# Seed RNG so we get the same Embedding each time
|
|
torch.manual_seed(0)
|
|
return torch.nn.Embedding(
|
|
num_embeddings=20,
|
|
embedding_dim=64,
|
|
max_norm=1.0).to(device)
|
|
|
|
ix = torch.arange(2, device='cpu', dtype=torch.long).repeat(2000)
|
|
out_cpu = create_embedding('cpu')(ix)
|
|
|
|
ix = ix.to('cuda')
|
|
out = create_embedding('cuda')(ix)
|
|
self.assertEqual(out.cpu(), out_cpu)
|
|
|
|
def test_embedding_sparse_basic(self):
|
|
embedding = nn.Embedding(10, 20, sparse=True)
|
|
input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long)
|
|
embedding(input).sum().backward()
|
|
self.assertTrue(embedding.weight.grad.is_sparse)
|
|
self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape)
|
|
|
|
def test_embedding_sparse_empty_tensor(self):
|
|
embedding = nn.Embedding(0, 0, sparse=True)
|
|
input = torch.tensor([], dtype=torch.int64)
|
|
embedding(input).sum().backward()
|
|
self.assertTrue(embedding.weight.grad.is_sparse)
|
|
self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape)
|
|
|
|
embedding = nn.Embedding(10, 0, sparse=True)
|
|
input = torch.LongTensor([[0, 2, 4, 5], [4, 3, 0, 9]])
|
|
embedding(input).sum().backward()
|
|
self.assertTrue(embedding.weight.grad.is_sparse)
|
|
self.assertEqual(embedding.weight.grad.shape, embedding.weight.shape)
|
|
|
|
def test_move_sparse_half_embedding(self):
|
|
embedding = nn.Embedding(10, 3, sparse=True)
|
|
self.assertEqual(embedding.weight.device.type, 'cpu')
|
|
self.assertEqual(embedding.weight.dtype, torch.float64)
|
|
embedding.to(torch.float16)
|
|
self.assertEqual(embedding.weight.dtype, torch.float16)
|
|
self.assertEqual(embedding.embedding_dim, 3)
|
|
self.assertEqual(embedding.num_embeddings, 10)
|
|
|
|
if torch.cuda.is_available():
|
|
embedding.to('cuda')
|
|
self.assertEqual(embedding.weight.device.type, 'cuda')
|
|
embedding.to('cpu')
|
|
self.assertEqual(embedding.weight.device.type, 'cpu')
|
|
|
|
def test_embedding_max_norm(self):
|
|
embedding = nn.Embedding(22, 5, max_norm=1.0)
|
|
input = torch.tensor([2, 8, 8, 6], dtype=torch.long)
|
|
output = embedding(input)
|
|
self.assertEqual(output[1], output[2])
|
|
self.assertTrue(output.data.norm(p=2, dim=1).le(1).all())
|
|
|
|
def test_embedding_from_pretrained(self):
|
|
a = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
embedding = nn.Embedding.from_pretrained(a)
|
|
self.assertEqual(a, embedding.weight.data)
|
|
|
|
input = torch.LongTensor([0, 1])
|
|
output = embedding(input)
|
|
self.assertEqual(a, output)
|
|
|
|
def test_embedding_bag_from_pretrained(self):
|
|
a = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
embedding = nn.EmbeddingBag.from_pretrained(a)
|
|
self.assertEqual(a, embedding.weight)
|
|
|
|
input = torch.tensor([0, 1], dtype=torch.long)
|
|
output = embedding(input, torch.arange(input.size(0)))
|
|
self.assertEqual(a, output)
|
|
|
|
def test_embedding_from_pretrained_padding_idx(self):
|
|
padding_idx = 2
|
|
padding_vec = torch.ones(3) * 7
|
|
embeddings = torch.rand(4, 3, requires_grad=True)
|
|
with torch.no_grad():
|
|
embeddings[padding_idx] = padding_vec
|
|
embedding_nn = nn.Embedding.from_pretrained(embeddings, padding_idx=padding_idx)
|
|
self.assertEqual(embedding_nn.weight[padding_idx], padding_vec)
|
|
|
|
def test_embedding_bag_from_pretrained_padding_idx(self):
|
|
padding_idx = 2
|
|
embeddings = torch.rand(4, 3, requires_grad=True)
|
|
embedding_nn = nn.EmbeddingBag.from_pretrained(embeddings, padding_idx=padding_idx)
|
|
self.assertEqual(embedding_nn.weight, embeddings)
|
|
|
|
def test_embedding_from_pretrained_options(self):
|
|
a = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
opts = {
|
|
"max_norm": 2.,
|
|
"norm_type": .5,
|
|
"scale_grad_by_freq": False,
|
|
"sparse": True
|
|
}
|
|
embedding = nn.Embedding.from_pretrained(a, **opts)
|
|
input = torch.LongTensor([0, 1])
|
|
output = embedding(input)
|
|
# test output and that weight matrix was renormalized
|
|
self.assertEqual(a, output)
|
|
self.assertTrue(a.ne(torch.arange(1, 7, dtype=a.dtype).view(2, 3)).all())
|
|
self.assertTrue(output.data.norm(p=opts["norm_type"], dim=1).le(opts["max_norm"]).all())
|
|
|
|
def test_embedding_functional(self):
|
|
a = torch.tensor([
|
|
[1, 3, 2],
|
|
[0, 2, 1]
|
|
], dtype=torch.long)
|
|
embeddings = torch.rand(4, 3, requires_grad=True)
|
|
|
|
embed_old = torch.nn.Embedding(4, 3)
|
|
embed_old.weight.data = embeddings.data
|
|
res_old = embed_old(a)
|
|
|
|
res_F = F.embedding(a, embeddings)
|
|
self.assertEqual(res_old, res_F)
|
|
|
|
embed_old = torch.nn.Embedding(4, 3)
|
|
embed_old = embed_old.from_pretrained(embeddings, padding_idx=2)
|
|
res_old = embed_old(a)
|
|
res_F = F.embedding(a, embeddings, padding_idx=2)
|
|
|
|
self.assertEqual(res_old, res_F)
|
|
|
|
def test_embedding_bag_functional(self):
|
|
a = torch.tensor([
|
|
[1, 3, 2],
|
|
[0, 2, 1]
|
|
], dtype=torch.long)
|
|
embeddings = torch.rand(4, 3, requires_grad=True)
|
|
|
|
embed_old = torch.nn.EmbeddingBag(4, 3)
|
|
embed_old.weight = torch.nn.Parameter(embeddings)
|
|
res_old = embed_old(a)
|
|
|
|
res_F = F.embedding_bag(a, embeddings)
|
|
self.assertEqual(res_old, res_F)
|
|
|
|
embed_old = torch.nn.EmbeddingBag(4, 3)
|
|
embed_old = embed_old.from_pretrained(embeddings, padding_idx=2)
|
|
res_old = embed_old(a)
|
|
res_F = F.embedding_bag(a, embeddings, padding_idx=2)
|
|
|
|
self.assertEqual(res_old, res_F)
|
|
|
|
# Make sure that error is thrown if padding_idx is out of bounds
|
|
def test_embedding_bag_padding_idx_error(self):
|
|
a = torch.tensor([
|
|
[1, 3, 2],
|
|
[0, 2, 1]
|
|
], dtype=torch.long)
|
|
num_embeddings = 4
|
|
num_features = 3
|
|
embeddings = torch.rand(num_embeddings, num_features, requires_grad=True)
|
|
|
|
functional_err_msg = r'padding_idx must be within the number of embeddings'
|
|
module_err_msg = r'padding_idx must be within num_embeddings'
|
|
|
|
for padding_idx in range(-(num_embeddings + 2), (num_embeddings + 2)):
|
|
if (padding_idx < -num_embeddings) or (padding_idx >= num_embeddings):
|
|
with self.assertRaisesRegex(RuntimeError, functional_err_msg):
|
|
F.embedding_bag(a, embeddings, padding_idx=padding_idx)
|
|
with self.assertRaisesRegex(AssertionError, module_err_msg):
|
|
torch.nn.EmbeddingBag(num_embeddings, num_features, padding_idx=padding_idx)
|
|
else:
|
|
F.embedding_bag(a, embeddings, padding_idx=padding_idx)
|
|
torch.nn.EmbeddingBag(num_embeddings, num_features, padding_idx=padding_idx)
|
|
|
|
@unittest.skipUnless('fbgemm' in torch.backends.quantized.supported_engines,
|
|
'Linear_FP16_weight requires FBGEMM. FBGEMM is only optimized for CPUs'
|
|
' with instruction set support avx2 or newer.')
|
|
def test_fb_fc_packed(self):
|
|
X = np.random.rand(16, 16).astype(np.float32) - 0.5
|
|
W = np.random.rand(16, 16).astype(np.float32) - 0.5
|
|
b = np.random.rand(16).astype(np.float32) - 0.5
|
|
|
|
def fc_op(X, W, b):
|
|
return np.dot(X, W.T) + b
|
|
|
|
x_tensor = torch.tensor(X)
|
|
w_tensor = torch.tensor(W)
|
|
b_tensor = torch.tensor(b)
|
|
packed_w_tensor = torch.fbgemm_pack_gemm_matrix_fp16(w_tensor)
|
|
actual_output = torch.fbgemm_linear_fp16_weight(x_tensor, packed_w_tensor, b_tensor)
|
|
expected_output = fc_op(X, W, b)
|
|
torch.testing.assert_allclose(expected_output, actual_output.cpu(), atol=1e-3, rtol=1e-3)
|
|
|
|
def test_embeddingbag_from_pretrained(self):
|
|
a = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
embeddingbag = nn.EmbeddingBag.from_pretrained(a)
|
|
self.assertEqual(a, embeddingbag.weight.data)
|
|
|
|
input = torch.LongTensor([[0, 1]])
|
|
output = embeddingbag(input)
|
|
self.assertEqual(a.mean(0, keepdim=True), output)
|
|
|
|
def test_embeddingbag_from_pretrained_options(self):
|
|
a = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
opts = {
|
|
"max_norm": 2.,
|
|
"norm_type": .5,
|
|
"scale_grad_by_freq": False,
|
|
"mode": "max",
|
|
"sparse": False
|
|
}
|
|
embeddingbag = nn.EmbeddingBag.from_pretrained(a, **opts)
|
|
|
|
input = torch.LongTensor([[0, 1]])
|
|
output = embeddingbag(input)
|
|
self.assertEqual(a.max(0, keepdim=True)[0], output)
|
|
self.assertTrue(a.ne(torch.arange(1, 7, dtype=a.dtype).view(2, 3)).all())
|
|
self.assertTrue(a.norm(p=opts["norm_type"], dim=1).le(opts["max_norm"]).all())
|
|
|
|
def test_AlphaDropout(self):
|
|
# generate random tensor with zero mean and unit std
|
|
input = torch.randn(5000)
|
|
self._test_alpha_dropout(nn.AlphaDropout, input)
|
|
|
|
def test_FeatureAlphaDropout(self):
|
|
b = random.randint(1, 5)
|
|
w = random.randint(1, 5)
|
|
h = random.randint(1, 5)
|
|
d = random.randint(1, 2)
|
|
num_features = 1000
|
|
input = torch.randn(num_features, b, d, w, h)
|
|
self._test_alpha_dropout(nn.FeatureAlphaDropout, input)
|
|
|
|
def test_pad_scalar_error(self):
|
|
inputs = torch.tensor(0., requires_grad=True)
|
|
self.assertRaises(AssertionError, lambda: F.pad(inputs, (1, 1)))
|
|
self.assertRaises(AssertionError, lambda: F.pad(inputs, (1,)))
|
|
|
|
@unittest.skipIf(not TEST_NUMPY, "numpy not found")
|
|
def test_multihead_attention(self):
|
|
def _scaled_dot_attn_ref(Q, K, V, dims, unseen_mask=None, key_padding_mask=None):
|
|
""" Numpy-based reference implementation of scaled dot attention
|
|
for testing"""
|
|
|
|
QKT = _batchmatmul(
|
|
Q,
|
|
np.transpose(K, axes=[0, 1, 3, 2])
|
|
/ np.sqrt(dims[3], dtype=np.float32), # divide by sqrt(d_head)
|
|
)
|
|
b1, b2, s1, s2 = QKT.shape
|
|
if unseen_mask is not None or key_padding_mask is not None:
|
|
# assert s1 == s2
|
|
for i in range(b1):
|
|
for j in range(b2):
|
|
for m in range(s1):
|
|
for n in range(s2):
|
|
if unseen_mask is not None and unseen_mask[m][n] == 0:
|
|
QKT[i, j, m, n] = -np.inf
|
|
if key_padding_mask is not None and key_padding_mask[i][n]:
|
|
QKT[i, j, m, n] = -np.inf
|
|
|
|
reference = _softmax(QKT)
|
|
ref_attn_weight = reference
|
|
ref_attn_weight = np.sum(ref_attn_weight, axis=1) / b2
|
|
reference = _batchmatmul(reference, V)
|
|
return reference, ref_attn_weight
|
|
|
|
def _batchmatmul(a, b): # batchmatmul over 4 dim matrix
|
|
""" Numpy-based batch matrix multiply over 4 dim matrix"""
|
|
assert a.shape[0] == b.shape[0]
|
|
assert a.shape[1] == b.shape[1]
|
|
retval = np.zeros(
|
|
(a.shape[0], a.shape[1], a.shape[2], b.shape[3]), dtype=np.float32
|
|
)
|
|
for i in range(a.shape[0]):
|
|
for j in range(a.shape[1]):
|
|
retval[i, j, :, :] = np.matmul(a[i, j, :, :], b[i, j, :, :])
|
|
return retval
|
|
|
|
def _softmax(x): # softmax over 4 dim matrix
|
|
""" Numpy-based reference softmax over 4 dim matrix"""
|
|
np.seterr(invalid='ignore')
|
|
output = np.zeros(x.shape, dtype=np.float64)
|
|
for i in range(x.shape[0]):
|
|
for j in range(x.shape[1]):
|
|
for k in range(x.shape[2]):
|
|
x_curr = x[i, j, k, :]
|
|
e_x = np.exp(x_curr - np.amax(x_curr))
|
|
output[i, j, k, :] = e_x / np.sum(e_x)
|
|
return output
|
|
|
|
def _split_heads_ref(X, dims, nheads, d_head):
|
|
X_split = np.reshape(X, dims[:2] + [nheads, d_head])
|
|
X_split_transposed = np.transpose(X_split, [0, 2, 1, 3])
|
|
reference = np.reshape(X_split_transposed, [dims[0], nheads, dims[1], d_head])
|
|
return reference
|
|
|
|
def _combine_heads_ref(X, dims, nheads, d_head):
|
|
X_transposed = np.transpose(X, [0, 2, 1, 3])
|
|
reference = np.reshape(X_transposed, dims[:2] + [nheads * d_head])
|
|
return reference
|
|
|
|
def _fc(X, X_weight, X_bias):
|
|
X_fc_b = X_bias.detach().numpy()
|
|
X_fc_w = X_weight.detach().numpy()
|
|
return np.matmul(X, np.transpose(X_fc_w)) + X_fc_b
|
|
|
|
def _create_src_lengths_mask(batch_size, src_lengths):
|
|
"""
|
|
Generate boolean mask to prevent attention beyond the end of source
|
|
Inputs:
|
|
batch_size : int
|
|
src_lengths : [batch_size] of sentence lengths
|
|
Outputs:
|
|
[batch_size, max_src_len]
|
|
"""
|
|
max_srclen = src_lengths.max()
|
|
src_indices = torch.arange(0, max_srclen).unsqueeze(0).to(src_lengths)
|
|
src_indices = src_indices.expand(batch_size, max_srclen)
|
|
src_lengths = src_lengths.unsqueeze(dim=1).expand(batch_size, max_srclen)
|
|
# returns [batch_size, max_seq_len]
|
|
return (src_indices < src_lengths).int().detach()
|
|
|
|
def _multihead_attn_test_helper(add_key_padding_mask=False, add_bias_kv=False, add_zero_attn=False,
|
|
saved_kv=False, same_embed_dim=False, byte_mask=False):
|
|
for _ in range(100):
|
|
batch_sz, seq_len = [random.randint(2, 10) for r in range(2)]
|
|
d_head = random.randint(3, 10)
|
|
nheads = random.randint(3, 10)
|
|
d_model = d_head * nheads
|
|
if same_embed_dim:
|
|
kv_dim = d_model
|
|
else:
|
|
kv_dim = random.randint(5, 20)
|
|
dims = [batch_sz, seq_len, kv_dim]
|
|
|
|
saved_k = None
|
|
saved_k_tensor = None
|
|
saved_v = None
|
|
saved_v_tensor = None
|
|
if saved_kv:
|
|
saved_k = np.random.rand(batch_sz * nheads, seq_len, d_head)
|
|
saved_k_tensor = torch.from_numpy(saved_k).to(torch.get_default_dtype())
|
|
saved_v = np.random.rand(batch_sz * nheads, seq_len, d_head)
|
|
saved_v_tensor = torch.from_numpy(saved_v).to(torch.get_default_dtype())
|
|
|
|
key_padding_mask = None
|
|
key_padding_mask_tensor = None
|
|
if add_key_padding_mask:
|
|
seq_mask = np.random.randint(0, 2, (1, seq_len))
|
|
key_padding_mask = (np.repeat(seq_mask, batch_sz, axis=0) == 1)
|
|
key_padding_mask_tensor = torch.from_numpy(key_padding_mask)
|
|
if byte_mask:
|
|
key_padding_mask_tensor = key_padding_mask_tensor.byte()
|
|
decoder_state = np.random.rand(batch_sz, d_model)
|
|
K = np.random.rand(*dims)
|
|
V = K
|
|
Q = np.expand_dims(decoder_state, 1)
|
|
attn_mask = np.random.randint(0 , 2, size=(1, seq_len))
|
|
attn_mask_tensor = torch.from_numpy(attn_mask).float()
|
|
if byte_mask:
|
|
attn_mask_tensor = (attn_mask_tensor == 0).byte()
|
|
else:
|
|
attn_mask_tensor.masked_fill_(attn_mask_tensor == 0, float('-inf'))
|
|
attn_mask_tensor.masked_fill_(attn_mask_tensor > 0, float('0.0'))
|
|
attn_mask_tensor = attn_mask_tensor.double()
|
|
|
|
decoder_state_tensor = torch.from_numpy(decoder_state).to(torch.get_default_dtype())
|
|
source_hid_tensor = torch.from_numpy(K).to(torch.get_default_dtype()).transpose(0, 1)
|
|
|
|
multihead_attn_module = MultiheadAttention(d_model, nheads,
|
|
add_bias_kv=add_bias_kv,
|
|
add_zero_attn=add_zero_attn,
|
|
kdim=kv_dim, vdim=kv_dim)
|
|
|
|
if add_bias_kv:
|
|
bias_k = multihead_attn_module.bias_k.detach().numpy()
|
|
bias_v = multihead_attn_module.bias_v.detach().numpy()
|
|
else:
|
|
bias_k = None
|
|
bias_v = None
|
|
|
|
_Q = decoder_state_tensor.unsqueeze(1).transpose(0, 1)
|
|
_V = source_hid_tensor
|
|
_K = source_hid_tensor
|
|
|
|
if multihead_attn_module._qkv_same_embed_dim:
|
|
result, result_weight = torch.nn.functional.multi_head_attention_forward(
|
|
_Q, _K, _V,
|
|
d_model, nheads,
|
|
multihead_attn_module.in_proj_weight, multihead_attn_module.in_proj_bias,
|
|
multihead_attn_module.bias_k, multihead_attn_module.bias_v,
|
|
multihead_attn_module.add_zero_attn, multihead_attn_module.dropout,
|
|
multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias,
|
|
multihead_attn_module.training, key_padding_mask_tensor, True, attn_mask_tensor,
|
|
static_k=saved_k_tensor, static_v=saved_v_tensor)
|
|
else:
|
|
result, result_weight = torch.nn.functional.multi_head_attention_forward(
|
|
_Q, _K, _V,
|
|
d_model, nheads,
|
|
None, multihead_attn_module.in_proj_bias,
|
|
multihead_attn_module.bias_k, multihead_attn_module.bias_v,
|
|
multihead_attn_module.add_zero_attn, multihead_attn_module.dropout,
|
|
multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias,
|
|
multihead_attn_module.training, key_padding_mask_tensor, True, attn_mask_tensor,
|
|
True, multihead_attn_module.q_proj_weight,
|
|
multihead_attn_module.k_proj_weight, multihead_attn_module.v_proj_weight,
|
|
static_k=saved_k_tensor, static_v=saved_v_tensor)
|
|
|
|
result = result.squeeze(0).detach().numpy()
|
|
|
|
if multihead_attn_module._qkv_same_embed_dim:
|
|
q_proj_weight = multihead_attn_module.in_proj_weight[:d_model]
|
|
k_proj_weight = multihead_attn_module.in_proj_weight[d_model:(d_model * 2)]
|
|
v_proj_weight = multihead_attn_module.in_proj_weight[(d_model * 2):]
|
|
else:
|
|
q_proj_weight = multihead_attn_module.q_proj_weight
|
|
k_proj_weight = multihead_attn_module.k_proj_weight
|
|
v_proj_weight = multihead_attn_module.v_proj_weight
|
|
|
|
Q_fc = _fc(Q, q_proj_weight, multihead_attn_module.in_proj_bias[:d_model])
|
|
K_fc = _fc(K, k_proj_weight, multihead_attn_module.in_proj_bias[d_model:(d_model * 2)])
|
|
V_fc = _fc(V, v_proj_weight, multihead_attn_module.in_proj_bias[(d_model * 2):])
|
|
|
|
if add_bias_kv:
|
|
K_fc = np.concatenate((K_fc, np.repeat(bias_k, K_fc.shape[0], axis=0)), axis=1)
|
|
V_fc = np.concatenate((V_fc, np.repeat(bias_v, V_fc.shape[0], axis=0)), axis=1)
|
|
if attn_mask is not None:
|
|
attn_mask = np.concatenate((attn_mask, np.ones([1, 1])), axis=1)
|
|
if key_padding_mask is not None:
|
|
key_padding_mask = np.concatenate((key_padding_mask, np.full((batch_sz, 1), False, dtype=bool)), axis=1)
|
|
dims[1] += 1
|
|
Q_split = _split_heads_ref(
|
|
Q_fc, [batch_sz, 1, d_model], nheads, d_head
|
|
)
|
|
|
|
if saved_k is not None:
|
|
K_split = np.reshape(saved_k, [dims[0], nheads, dims[1], d_head])
|
|
else:
|
|
K_split = _split_heads_ref(K_fc, dims, nheads, d_head)
|
|
|
|
if saved_v is not None:
|
|
V_split = np.reshape(saved_v, [dims[0], nheads, dims[1], d_head])
|
|
else:
|
|
V_split = _split_heads_ref(V_fc, dims, nheads, d_head)
|
|
|
|
if add_zero_attn:
|
|
dims[1] += 1
|
|
K_split = np.concatenate((K_split, np.zeros([K_split.shape[0], K_split.shape[1], 1, K_split.shape[3]])), axis=2)
|
|
V_split = np.concatenate((V_split, np.zeros([V_split.shape[0], V_split.shape[1], 1, V_split.shape[3]])), axis=2)
|
|
|
|
if attn_mask is not None:
|
|
attn_mask = np.concatenate((attn_mask, np.ones([1, 1])), axis=1)
|
|
|
|
if key_padding_mask is not None:
|
|
key_padding_mask = np.concatenate((key_padding_mask, np.full((batch_sz, 1), False, dtype=bool)), axis=1)
|
|
attn_heads, ref_attn_weight = _scaled_dot_attn_ref(
|
|
Q=Q_split,
|
|
K=K_split,
|
|
V=V_split,
|
|
dims=Q_split.shape,
|
|
unseen_mask=attn_mask,
|
|
key_padding_mask=key_padding_mask
|
|
)
|
|
combined_attn_heads = _combine_heads_ref(
|
|
X=attn_heads, dims=[batch_sz, 1], nheads=nheads, d_head=d_head
|
|
)
|
|
|
|
reference = _fc(combined_attn_heads, multihead_attn_module.out_proj.weight, multihead_attn_module.out_proj.bias)
|
|
reference = np.squeeze(reference, axis=1)
|
|
|
|
# result = reference
|
|
self.assertEqual(tuple(result.shape), (batch_sz, d_model))
|
|
np.testing.assert_allclose(result, reference, atol=1e-5)
|
|
|
|
# result_weight = ref_attn_weight
|
|
result_weight = result_weight.detach().numpy()
|
|
self.assertEqual(tuple(result_weight.shape), tuple(ref_attn_weight.shape))
|
|
np.testing.assert_allclose(result_weight, ref_attn_weight, atol=1e-5)
|
|
|
|
def test_multihead_attn_add_bias_kv():
|
|
_multihead_attn_test_helper(add_bias_kv=True)
|
|
|
|
def test_multihead_attn_add_zero_attn():
|
|
_multihead_attn_test_helper(add_zero_attn=True)
|
|
|
|
def test_multihead_attn_no_masking():
|
|
_multihead_attn_test_helper()
|
|
|
|
def test_multihead_attn_key_padding_mask():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True)
|
|
|
|
def test_multihead_attn_saved_kv():
|
|
_multihead_attn_test_helper(saved_kv=True)
|
|
|
|
def test_multihead_attn_add_bias_kv_zero_attn():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True, add_bias_kv=True,
|
|
add_zero_attn=True)
|
|
|
|
def test_multihead_attn_all_arguments1():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True, saved_kv=True)
|
|
|
|
def test_multihead_attn_all_arguments2():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True, add_bias_kv=True,
|
|
add_zero_attn=True, saved_kv=True)
|
|
|
|
def test_multihead_attn_all_arguments3():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True,
|
|
saved_kv=True, same_embed_dim=True)
|
|
|
|
def test_multihead_attn_all_arguments4():
|
|
_multihead_attn_test_helper(add_key_padding_mask=True, add_zero_attn=True,
|
|
saved_kv=True, same_embed_dim=True, byte_mask=True)
|
|
|
|
test_multihead_attn_add_zero_attn() # Test MultiheadAttention with add_zero_attn
|
|
test_multihead_attn_add_bias_kv() # Test MultiheadAttention with add_bias_kv
|
|
test_multihead_attn_no_masking() # Test MultiheadAttention without masking
|
|
test_multihead_attn_key_padding_mask() # Test MultiheadAttention with src lengths
|
|
test_multihead_attn_saved_kv() # Test MultiheadAttention with static kv.
|
|
test_multihead_attn_add_bias_kv_zero_attn() # Test MultiheadAttention with bias_kv and zero_attn.
|
|
test_multihead_attn_all_arguments1() # Test MultiheadAttention with all the argument.
|
|
with self.assertRaisesRegex(AssertionError, "bias cannot be added to static key."):
|
|
test_multihead_attn_all_arguments2() # Test MultiheadAttention with all the argument.
|
|
test_multihead_attn_all_arguments3() # Test MultiheadAttention with all the argument.
|
|
test_multihead_attn_all_arguments4() # Test MultiheadAttention with all the argument.
|
|
|
|
def test_multihead_attn_3d_attn_mask(self):
|
|
embed_dim = 8
|
|
num_heads = 4
|
|
batch_size = 8
|
|
src_len = 3
|
|
tgt_len = 2
|
|
|
|
query = torch.rand(batch_size, tgt_len, embed_dim) # [N, T, D]
|
|
key = torch.rand(batch_size, src_len, embed_dim) # [N, S, D]
|
|
value = key # [N, S, D]
|
|
attn_mask = torch.randint(0, 2, (batch_size, tgt_len, src_len)).float() # [N, T, S]
|
|
attn_mask = attn_mask.masked_fill(attn_mask == 0, float('-inf')).masked_fill(attn_mask == 1, float(0.0))
|
|
|
|
mta_model = torch.nn.MultiheadAttention(embed_dim, num_heads)
|
|
|
|
# Generate 3D results
|
|
attn_mask_3d = torch.repeat_interleave(attn_mask, num_heads, dim=0) # [N * H, T, S]
|
|
output_3d = mta_model(query.transpose(0, 1), key.transpose(0, 1), value.transpose(0, 1), attn_mask=attn_mask_3d)[0]
|
|
output_3d = output_3d.transpose(0, 1) # [N, T, D]
|
|
|
|
for i in range(0, batch_size):
|
|
output_2d = mta_model(query[i].unsqueeze(0).transpose(0, 1),
|
|
key[i].unsqueeze(0).transpose(0, 1),
|
|
value[i].unsqueeze(0).transpose(0, 1),
|
|
attn_mask=attn_mask[i])[0]
|
|
|
|
# output_2d in shape of [T, 1, D]
|
|
self.assertEqual(output_3d[i].unsqueeze(0).transpose(0, 1), output_2d)
|
|
|
|
def test_multihead_attn_no_bias(self):
|
|
embed_dim = 8
|
|
num_heads = 4
|
|
mha = torch.nn.MultiheadAttention(embed_dim, num_heads, bias=False)
|
|
|
|
# Verify that bias=False applies to both in and out projection layers.
|
|
self.assertIsNone(mha.in_proj_bias)
|
|
self.assertIsNone(mha.out_proj.bias)
|
|
|
|
def test_normalize(self):
|
|
inputs = torch.randn(1, 3, 4, 4, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,)))
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=2, dim=-2), (inputs,)))
|
|
|
|
inputs = torch.randn((), requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,)))
|
|
|
|
def test_adaptive_pooling_input_size(self):
|
|
for numel in (2, 3):
|
|
for pool_type in ('Max', 'Avg'):
|
|
cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel)
|
|
module_cls = getattr(nn, cls_name)
|
|
output_size = (2,) * numel
|
|
module = module_cls(output_size)
|
|
|
|
input = torch.randn(output_size)
|
|
self.assertRaises(ValueError, lambda: module(input))
|
|
|
|
def test_adaptive_pooling_size_none(self):
|
|
for numel in (2, 3):
|
|
for pool_type in ('Max', 'Avg'):
|
|
cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel)
|
|
module_cls = getattr(nn, cls_name)
|
|
output_size = (2,) * (numel - 1) + (None,)
|
|
module = module_cls(output_size)
|
|
|
|
input = torch.randn((4,) * (numel + 1))
|
|
output = module(input)
|
|
self.assertEqual(output.size(), (4,) + (2,) * (numel - 1) + (4,))
|
|
|
|
@unittest.skipIf(TEST_WITH_UBSAN, "signed integer overflow error with UBSAN")
|
|
def test_adaptive_pooling_size_overflow(self):
|
|
# 0x0x3fffffffffffffff * 2 * 2 = 0xfffffffffffffffc = -4 as int64_t
|
|
# Tensor::numel() return int64_t, so following check that negative allocs are correctly handled
|
|
self.assertRaises(
|
|
RuntimeError,
|
|
lambda: torch.nn.AdaptiveMaxPool1d(0x3fffffffffffffff)(torch.empty([2, 2, 2])))
|
|
|
|
def test_adaptive_pooling_avg_nhwc(self):
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for device in device_list:
|
|
input = torch.randint(1, 10, (4, 8, 8, 8), dtype=torch.float32).to(device)
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
grad = torch.randint(1, 10, (4, 8, 7, 7), dtype=torch.float32).to(device)
|
|
pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device)
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device)
|
|
|
|
out = pool(input)
|
|
out.backward(grad)
|
|
ref_out = ref_pool(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
def test_adaptive_pooling_avg_nhwc_non_contiguous(self):
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for device in device_list:
|
|
input = torch.randint(1, 10, (4, 8, 8, 8), dtype=torch.float32).to(device)
|
|
input = input.contiguous(memory_format=torch.channels_last)
|
|
input = input[:, ::2, :, :].requires_grad_()
|
|
grad = torch.randint(1, 10, (4, 8, 7, 7), dtype=torch.float32).to(device)
|
|
grad = grad[:, ::2, :, :]
|
|
pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device)
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_pool = torch.nn.AdaptiveAvgPool2d((7, 7)).to(device)
|
|
|
|
out = pool(input)
|
|
out.backward(grad)
|
|
ref_out = ref_pool(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@largeTensorTest('12GB', device='cuda')
|
|
def test_adaptive_pooling_avg_nhwc_launch_config_backward(self):
|
|
input = torch.randint(1, 10, (1, 32, 2 ** 17 + 1, 32), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
grad = torch.randint(1, 10, (1, 32, 10, 32), dtype=torch.float32, device="cuda")
|
|
|
|
pool = torch.nn.AdaptiveAvgPool2d((10, 32)).cuda()
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_pool = torch.nn.AdaptiveAvgPool2d((10, 32)).cuda()
|
|
|
|
out = pool(input)
|
|
out.backward(grad)
|
|
ref_out = ref_pool(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@largeTensorTest('12GB', device='cuda')
|
|
def test_adaptive_pooling_avg_nhwc_launch_config_forward(self):
|
|
input = torch.randint(1, 10, (1, 32, 16, 16), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
pool = torch.nn.AdaptiveAvgPool2d((2 ** 17 + 1, 32)).cuda()
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_pool = torch.nn.AdaptiveAvgPool2d((2 ** 17 + 1, 32)).cuda()
|
|
|
|
out = pool(input)
|
|
ref_out = ref_pool(ref_input)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
# Skip the test for ROCm as per https://github.com/pytorch/pytorch/issues/53190
|
|
@skipIfRocm
|
|
def test_broadcast_double_backwards_gpu(self):
|
|
tensors = (torch.randn(4, 4, device='cuda', requires_grad=True),
|
|
torch.randn(4, 4, device='cuda', requires_grad=True),
|
|
torch.randn(4, 4, device='cuda', requires_grad=True))
|
|
# TODO(#50743): the following segfaults with check_batched_grad=True
|
|
_assertGradAndGradgradChecks(self, lambda *i: Broadcast.apply((0, 1), *i), tensors,
|
|
check_batched_grad=False)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_broadcast_not_requiring_grad(self):
|
|
variables = [
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
torch.randn(1, 2, device='cuda', requires_grad=False),
|
|
torch.randn(1, 2, device='cuda', requires_grad=False),
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
]
|
|
broadcasted_variables = Broadcast.apply((0, 1), *variables)
|
|
for output_idx, broadcasted_var in enumerate(broadcasted_variables):
|
|
input_var = variables[output_idx % len(variables)]
|
|
self.assertEqual(input_var.requires_grad, broadcasted_var.requires_grad)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_broadcast_no_grad(self):
|
|
x = torch.randn(1, 2, dtype=torch.float32, requires_grad=True, device='cuda')
|
|
with torch.no_grad():
|
|
broadcasted = Broadcast.apply((0, 1), x)
|
|
self.assertTrue(x.requires_grad)
|
|
for output in broadcasted:
|
|
self.assertFalse(output.requires_grad)
|
|
|
|
def test_state_dict(self):
|
|
l = nn.Linear(5, 5)
|
|
block = nn.Module()
|
|
block.conv = nn.Conv2d(3, 3, 3, bias=False)
|
|
net = nn.Module()
|
|
net.linear1 = l
|
|
net.linear2 = l
|
|
net.bn = nn.BatchNorm2d(2)
|
|
net.block = block
|
|
net.add_module('empty', None)
|
|
|
|
state_dict = net.state_dict()
|
|
self.assertEqual(len(state_dict), 10)
|
|
self.assertEqual(len(state_dict._metadata), 6)
|
|
self.assertIn('', state_dict._metadata)
|
|
self.assertIn('linear1', state_dict._metadata)
|
|
self.assertIn('linear1.weight', state_dict)
|
|
self.assertIn('linear1.bias', state_dict)
|
|
self.assertIn('linear2', state_dict._metadata)
|
|
self.assertIn('linear2.weight', state_dict)
|
|
self.assertIn('linear2.bias', state_dict)
|
|
self.assertIn('block', state_dict._metadata)
|
|
self.assertIn('block.conv', state_dict._metadata)
|
|
self.assertIn('block.conv.weight', state_dict)
|
|
self.assertIn('block.conv.weight', state_dict)
|
|
self.assertNotIn('block.conv.bias', state_dict)
|
|
self.assertIn('bn', state_dict._metadata)
|
|
self.assertIn('bn.weight', state_dict)
|
|
self.assertIn('bn.bias', state_dict)
|
|
self.assertIn('bn.running_var', state_dict)
|
|
self.assertIn('bn.running_mean', state_dict)
|
|
self.assertIn('bn.num_batches_tracked', state_dict)
|
|
self.assertFalse(any(k.startswith('empty') for k in state_dict.keys()))
|
|
for k, v in state_dict.items():
|
|
param = net
|
|
for component in k.split('.'):
|
|
param = getattr(param, component)
|
|
if isinstance(param, Parameter):
|
|
param = param.data
|
|
self.assertEqual(v.data_ptr(), param.data_ptr())
|
|
|
|
l = nn.Linear(5, 5)
|
|
state_dict = l.state_dict()
|
|
self.assertEqual(len(state_dict), 2)
|
|
self.assertEqual(len(state_dict._metadata), 1)
|
|
self.assertIn('', state_dict._metadata)
|
|
self.assertTrue(state_dict._metadata['']['version'] >= 0)
|
|
self.assertEqual(state_dict['weight'].data_ptr(), l.weight.data_ptr())
|
|
self.assertEqual(state_dict['bias'].data_ptr(), l.bias.data_ptr())
|
|
|
|
def test_load_state_dict(self):
|
|
l = nn.Linear(5, 5)
|
|
block = nn.Module()
|
|
block.conv1 = nn.Conv2d(3, 3, 3, bias=True)
|
|
block.conv2 = nn.Conv2d(3, 3, 3, bias=False)
|
|
net = nn.Module()
|
|
net.linear1 = l
|
|
net.linear2 = l
|
|
net.bn = nn.BatchNorm2d(2)
|
|
net.block = block
|
|
net.add_module('empty', None)
|
|
conv1_bias_dtype = block.conv1.bias.dtype
|
|
|
|
state_dict = net.state_dict()
|
|
state_dict.update({
|
|
'linear1.weight': torch.ones(5, 5),
|
|
'block.conv1.bias': torch.arange(1, 4, dtype=conv1_bias_dtype),
|
|
'bn.running_mean': torch.randn(2),
|
|
})
|
|
# Also test if a DDP state_dict can be loaded from a local model.
|
|
ddp_state_dict = net.state_dict()
|
|
ddp_state_dict.update({
|
|
'module.linear1.weight': torch.ones(5, 5),
|
|
'module.block.conv1.bias': torch.arange(1, 4, dtype=conv1_bias_dtype),
|
|
'module.bn.running_mean': torch.randn(2),
|
|
})
|
|
torch.nn.modules.utils.consume_prefix_in_state_dict_if_present(ddp_state_dict, 'module.')
|
|
for sd in [state_dict, ddp_state_dict]:
|
|
incompatible_keys = net.load_state_dict(sd)
|
|
self.assertEqual(len(incompatible_keys.missing_keys), 0)
|
|
self.assertEqual(len(incompatible_keys.unexpected_keys), 0)
|
|
self.assertNotIn('Incompatible', str(incompatible_keys))
|
|
self.assertEqual(net.linear1.weight, sd['linear1.weight'])
|
|
self.assertEqual(net.block.conv1.bias, sd['block.conv1.bias'])
|
|
self.assertEqual(net.bn.running_mean, sd['bn.running_mean'])
|
|
|
|
state_dict = net.state_dict()
|
|
state_dict.update({'extra': torch.ones(5)})
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict))
|
|
incompatible_keys = net.load_state_dict(state_dict, strict=False)
|
|
self.assertEqual(len(incompatible_keys.missing_keys), 0)
|
|
self.assertEqual(len(incompatible_keys.unexpected_keys), 1)
|
|
self.assertIn('extra', incompatible_keys.unexpected_keys)
|
|
self.assertIn('Incompatible', str(incompatible_keys))
|
|
|
|
state_dict = net.state_dict()
|
|
state_dict.update({'extra.param': torch.ones(5)})
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict))
|
|
incompatible_keys = net.load_state_dict(state_dict, strict=False)
|
|
self.assertEqual(len(incompatible_keys.missing_keys), 0)
|
|
self.assertEqual(len(incompatible_keys.unexpected_keys), 1)
|
|
self.assertIn('extra.param', incompatible_keys.unexpected_keys)
|
|
|
|
state_dict = net.state_dict()
|
|
del state_dict['linear1.weight']
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict))
|
|
incompatible_keys = net.load_state_dict(state_dict, strict=False)
|
|
self.assertEqual(len(incompatible_keys.missing_keys), 1)
|
|
self.assertEqual(len(incompatible_keys.unexpected_keys), 0)
|
|
self.assertIn('linear1.weight', incompatible_keys.missing_keys)
|
|
state_dict.update({'extra.param': torch.ones(5)})
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict))
|
|
incompatible_keys = net.load_state_dict(state_dict, strict=False)
|
|
self.assertEqual(len(incompatible_keys.missing_keys), 1)
|
|
self.assertEqual(len(incompatible_keys.unexpected_keys), 1)
|
|
self.assertIn('linear1.weight', incompatible_keys.missing_keys)
|
|
self.assertIn('extra.param', incompatible_keys.unexpected_keys)
|
|
|
|
state_dict = net.state_dict()
|
|
state_dict.update({'bn.running_mean': torch.rand(14, 4)}) # wrong size
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict))
|
|
self.assertRaises(RuntimeError, lambda: net.load_state_dict(state_dict, strict=False))
|
|
|
|
state_dict = net.state_dict()
|
|
old_state_dict = deepcopy(state_dict)
|
|
state_dict = {
|
|
'linear1.weight': torch.ones(5, 5),
|
|
'block.conv1.bias': torch.arange(1, 4, dtype=conv1_bias_dtype),
|
|
'bn.running_mean': torch.randn(2),
|
|
'nonexistent_key': torch.rand(3)
|
|
}
|
|
net.load_state_dict(state_dict, strict=False)
|
|
self.assertEqual(net.linear1.weight, state_dict['linear1.weight'])
|
|
self.assertEqual(net.block.conv1.bias, state_dict['block.conv1.bias'])
|
|
self.assertEqual(net.bn.running_mean, state_dict['bn.running_mean'])
|
|
new_state_dict = net.state_dict()
|
|
del old_state_dict['linear1.weight']
|
|
del old_state_dict['block.conv1.bias']
|
|
del old_state_dict['bn.running_mean']
|
|
for k, v, in old_state_dict.items():
|
|
self.assertTrue(v.equal(new_state_dict[k]))
|
|
|
|
def test_load_state_dict_BC(self):
|
|
# BatchNormNd
|
|
# Added num_batches_tracked buffer at version 2. For state dict with
|
|
# earlier versions or no versions, it should provide default value of 0.
|
|
bn = nn.BatchNorm2d(3)
|
|
state_dict = bn.state_dict()
|
|
del state_dict['num_batches_tracked']
|
|
state_dict._metadata['']['version'] = 1 # version 1
|
|
bn.load_state_dict(state_dict)
|
|
self.assertEqual(bn.num_batches_tracked.dtype, torch.long)
|
|
self.assertEqual(bn.num_batches_tracked.item(), 0)
|
|
del state_dict._metadata['']['version'] # no version
|
|
bn.load_state_dict(state_dict)
|
|
self.assertEqual(bn.num_batches_tracked.dtype, torch.long)
|
|
self.assertEqual(bn.num_batches_tracked.item(), 0)
|
|
|
|
def test_load_state_dict_ref_cycle(self):
|
|
# load_state_dict shouldn't cause a reference cycle involving Tensors
|
|
import gc
|
|
|
|
m = torch.nn.LSTM(16, 16, bidirectional=True)
|
|
|
|
gc.collect()
|
|
m.load_state_dict(deepcopy(m).state_dict())
|
|
refcycles = gc.collect()
|
|
|
|
self.assertEqual(refcycles, 0)
|
|
|
|
def test_load_state_dict_custom(self):
|
|
|
|
class CustomState(nn.Module):
|
|
def __init__(self):
|
|
super(CustomState, self).__init__()
|
|
self.param = torch.nn.Parameter(torch.ones(1))
|
|
self.sub = torch.nn.Linear(5, 5)
|
|
|
|
def _save_to_state_dict(self, destination, prefix, keep_vars):
|
|
destination[prefix + "serialized"] = self.param.data + 1
|
|
|
|
def _load_from_state_dict(self, state_dict, prefix, local_metadata,
|
|
strict, missing_keys, unexpected_keys,
|
|
error_msgs):
|
|
# skip some of the error handling
|
|
self.param.data.copy_(state_dict[prefix + "serialized"] - 1)
|
|
|
|
# use sequential to verify nesting
|
|
m = nn.Sequential(CustomState())
|
|
with torch.no_grad():
|
|
m[0].param[0] = 10
|
|
m[0].sub.weight[0, 0] = 555
|
|
state_dict = m.state_dict()
|
|
self.assertEqual(state_dict["0.serialized"].item(), 11)
|
|
self.assertIn("0.sub.weight", state_dict)
|
|
self.assertNotIn("0.param", state_dict)
|
|
del m
|
|
mm = nn.Sequential(CustomState())
|
|
self.assertEqual(mm[0].param[0].item(), 1)
|
|
mm.load_state_dict(state_dict)
|
|
self.assertEqual(mm[0].param[0].item(), 10)
|
|
self.assertEqual(mm[0].sub.weight[0, 0].item(), 555)
|
|
|
|
def test_parameter_assignment(self):
|
|
l = nn.Linear(5, 5)
|
|
|
|
def num_params():
|
|
return len(list(l.parameters()))
|
|
|
|
self.assertEqual(num_params(), 2)
|
|
|
|
new_param = Parameter(torch.randn(5, 5))
|
|
l.param_name = new_param
|
|
self.assertEqual(num_params(), 3)
|
|
self.assertObjectIn(new_param, l.parameters())
|
|
|
|
var = torch.randn(5, 5)
|
|
l.var_name = var
|
|
self.assertEqual(num_params(), 3)
|
|
self.assertNotIn(id(var), map(id, l.parameters()))
|
|
|
|
# Make sure Variables are not saved as parameters
|
|
l.variable_attr = torch.empty(5, 5)
|
|
self.assertEqual(num_params(), 3)
|
|
l.param_attr = Parameter(torch.empty(5, 5))
|
|
self.assertEqual(num_params(), 4)
|
|
|
|
# It shouldn't be possible to replace a parameter with a Variable
|
|
def assign_var():
|
|
l.param_attr = torch.empty(5, 5)
|
|
|
|
self.assertRaises(TypeError, assign_var)
|
|
# But replacing it with None should be fine
|
|
l.param_attr = None
|
|
self.assertEqual(num_params(), 3)
|
|
|
|
def test_assignment(self):
|
|
l = nn.Module()
|
|
a = nn.Parameter(torch.randn(2))
|
|
b = nn.Parameter(torch.randn(3))
|
|
c = nn.Parameter(torch.randn(4))
|
|
q = nn.Linear(4, 4)
|
|
r = nn.Linear(5, 5)
|
|
w = nn.Linear(6, 6)
|
|
|
|
def test_assignments(get_list, a, b, c):
|
|
# Check that None can be shadowed
|
|
l.a = None
|
|
self.assertIsNone(l.a)
|
|
self.assertIn('a', l.__dict__)
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [a])
|
|
self.assertNotIn('a', l.__dict__)
|
|
|
|
# Assign second object
|
|
l.b = None
|
|
self.assertIsNone(l.b)
|
|
self.assertIn('b', l.__dict__)
|
|
l.b = b
|
|
self.assertIs(l.b, b)
|
|
self.assertEqual(get_list(), [a, b])
|
|
self.assertNotIn('b', l.__dict__)
|
|
|
|
# Remove and add the object back. Order should be unchanged.
|
|
l.a = None
|
|
self.assertIsNone(l.a)
|
|
self.assertEqual(get_list(), [b])
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [a, b])
|
|
|
|
# Replace object with another one. Order should be unchanged.
|
|
l.a = c
|
|
self.assertIs(l.a, c)
|
|
self.assertEqual(get_list(), [c, b])
|
|
|
|
# Remove and reassign an attribute. It should appear at the end of the list now.
|
|
del l.a
|
|
self.assertFalse(hasattr(l, 'a'))
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [b, a])
|
|
|
|
test_assignments(lambda: list(l.parameters()), a, b, c)
|
|
del l.a, l.b
|
|
self.assertEqual(list(l.parameters()), [])
|
|
|
|
test_assignments(lambda: list(l.children()), q, r, w)
|
|
del l.a, l.b
|
|
self.assertEqual(list(l.children()), [])
|
|
|
|
buf = torch.randn(10)
|
|
l.register_buffer('buf', buf)
|
|
self.assertIs(l.buf, buf)
|
|
l.buf = None
|
|
self.assertIs(l.buf, None)
|
|
self.assertNotIn('buf', l.__dict__) # should be stored in l._buffers
|
|
l.buf = buf
|
|
self.assertIn('buf', l.state_dict())
|
|
self.assertEqual(l.state_dict()['buf'], buf)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_thnn_conv_strided_padded_dilated(self):
|
|
for convfn, dims, transposed in (
|
|
(torch.nn.functional.conv2d, 2, False),
|
|
(torch.nn.functional.conv_transpose2d, 2, True),
|
|
(torch.nn.functional.conv3d, 3, False),
|
|
(torch.nn.functional.conv_transpose3d, 3, True)):
|
|
for stride, padding, dilation in (
|
|
(2, 0, 1), (1, 1, 1), (2, 1, 1), (1, 0, 2)):
|
|
kwargs = {"stride": stride, "padding": padding, "dilation": dilation}
|
|
inp_shape = (1, 2) + dims * (4,)
|
|
weight_shape = (2, 2) + dims * (1,)
|
|
inputs = torch.randn(inp_shape, dtype=torch.double, device="cuda", requires_grad=True)
|
|
weight = torch.randn(weight_shape, dtype=torch.double, device="cuda", requires_grad=True)
|
|
bias = torch.randn(2, dtype=torch.double, device="cuda", requires_grad=True)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res = convfn(inputs, weight, bias, **kwargs)
|
|
res_cpu = convfn(inputs.cpu(), weight.cpu(), bias.cpu(), **kwargs)
|
|
self.assertEqual(res, res_cpu)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
torch.autograd.gradcheck(
|
|
lambda x, w, b: convfn(x, w, b, **kwargs),
|
|
(inputs, weight, bias)
|
|
)
|
|
torch.autograd.gradcheck(
|
|
lambda x, w, b: convfn(x, w, b, **kwargs),
|
|
(inputs.cpu(), weight.cpu(), bias.cpu())
|
|
)
|
|
|
|
def test_Conv2d_inconsistent_types(self):
|
|
inputs = torch.randn(4, 1, 7, 7, dtype=torch.float)
|
|
weights = torch.randn(1, 1, 3, 3, dtype=torch.double)
|
|
# inconsistent types should raise an exception
|
|
self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights))
|
|
# but it should work with the same type
|
|
nn.functional.conv2d(inputs.float(), weights.float())
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_Conv2d_inconsistent_types_on_GPU_without_cudnn(self):
|
|
inputs = torch.randn(4, 1, 7, 7, dtype=torch.float, device="cuda")
|
|
weights = torch.randn(1, 1, 3, 3, dtype=torch.double, device="cuda")
|
|
bias = torch.randn(1, dtype=torch.double, device="cuda")
|
|
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
# inconsistent types should raise an exception
|
|
self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights))
|
|
self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights.float(), bias))
|
|
|
|
# but it should work with the same type
|
|
nn.functional.conv2d(inputs.float(), weights.float(), bias.float())
|
|
|
|
def test_Conv2d_1x1(self):
|
|
in_channels = 2
|
|
out_channels = 2
|
|
mod = torch.nn.Conv2d(2, 2, 1, bias=False).to(dtype=torch.double)
|
|
input = torch.randn(1, in_channels, 5, 5, requires_grad=True, dtype=torch.double)
|
|
for enabled in (False, True):
|
|
with torch.backends.mkldnn.flags(enabled=enabled):
|
|
gradcheck(F.conv2d, (input, mod.weight))
|
|
|
|
def test_Conv2d_OneDNN(self):
|
|
def run_once(group_val=24, dilation=1):
|
|
ifm = torch.ones([1, group_val, 6, 6], dtype=torch.float32)
|
|
weights = torch.ones([group_val, 1, 3, 3], dtype=torch.float32)
|
|
op = torch.nn.Conv2d(
|
|
in_channels=group_val,
|
|
out_channels=group_val,
|
|
kernel_size=[3, 3],
|
|
stride=[2, 2],
|
|
padding=[1, 1],
|
|
dilation=[dilation, dilation],
|
|
groups=group_val,
|
|
bias=False,
|
|
padding_mode='zeros'
|
|
)
|
|
|
|
op.weight.data = weights
|
|
res = op(ifm)
|
|
grad_in = torch.ones(res.shape, dtype=torch.float32)
|
|
res.backward(grad_in)
|
|
return op.weight.grad
|
|
|
|
for gorup_val in (24, 48, 23, 25):
|
|
for dilation in (1, 2):
|
|
with torch.backends.mkldnn.flags(enabled=False):
|
|
without_onednn = run_once(gorup_val, dilation)
|
|
|
|
with torch.backends.mkldnn.flags(enabled=True):
|
|
with_onednn = run_once(gorup_val, dilation)
|
|
|
|
self.assertEqual(without_onednn, with_onednn)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
def test_cudnn_non_contiguous(self):
|
|
x = torch.randn(192, 16, 50).cuda()
|
|
x = x.permute(0, 2, 1).contiguous().permute(0, 2, 1)
|
|
m = torch.nn.Conv1d(
|
|
in_channels=16,
|
|
out_channels=32,
|
|
kernel_size=2,
|
|
bias=True).cuda()
|
|
result = m(x)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
def test_Conv2d_inconsistent_types_on_GPU_with_cudnn(self):
|
|
inputs = torch.randn(4, 1, 7, 7, dtype=torch.float, device="cuda")
|
|
weights = torch.randn(1, 1, 3, 3, dtype=torch.double, device="cuda")
|
|
bias = torch.randn(1, dtype=torch.double, device="cuda")
|
|
|
|
with torch.backends.cudnn.flags(enabled=True):
|
|
# inconsistent types should raise an exception
|
|
self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights))
|
|
self.assertRaises(RuntimeError, lambda: nn.functional.conv2d(inputs, weights.float(), bias))
|
|
|
|
# but it should work with the same type
|
|
nn.functional.conv2d(inputs.float(), weights.float(), bias.float())
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
@repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM))
|
|
def test_Conv2d_deterministic_cudnn(self, dtype=torch.float):
|
|
inputs = torch.randn(2, 3, 5, 5, device="cuda", dtype=dtype, requires_grad=True)
|
|
with cudnn.flags(enabled=True, benchmark=True, deterministic=True):
|
|
conv1 = torch.nn.Conv2d(3, 3, 3).to("cuda", dtype)
|
|
conv2 = torch.nn.Conv2d(3, 3, 3).to("cuda", dtype)
|
|
conv2.bias.data.copy_(conv1.bias.data)
|
|
conv2.weight.data.copy_(conv1.weight.data)
|
|
out1 = conv1(inputs)
|
|
out2 = conv2(inputs)
|
|
self.assertEqual(out1, out2, atol=0.0, rtol=0)
|
|
y = torch.randn(out1.size(), device="cuda", dtype=dtype)
|
|
out1.backward(y)
|
|
out2.backward(y)
|
|
self.assertEqual(conv1.bias.grad.data, conv2.bias.grad.data, atol=0.0, rtol=0)
|
|
self.assertEqual(conv1.weight.grad.data, conv2.weight.grad.data, atol=0.0, rtol=0)
|
|
|
|
def test_Conv2d_missing_argument(self):
|
|
c = nn.Conv2d(3, 3, 3)
|
|
self.assertRaises(TypeError, lambda: c(None))
|
|
|
|
def test_Conv2d_backward_twice(self):
|
|
input = torch.randn(2, 3, 5, 5)
|
|
c = nn.Conv2d(3, 3, 3)
|
|
o1 = c(input)
|
|
o1.sum().backward()
|
|
self.assertRaisesRegex(RuntimeError, 'Specify retain_graph=True',
|
|
lambda: o1.sum().backward())
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM))
|
|
def test_Conv2d_large_workspace(self, dtype=torch.float):
|
|
# These sizes require huge cuDNN workspaces. Make sure we choose a
|
|
# reasonable algorithm that does not run out of memory
|
|
sizes = [
|
|
(1, 256, 109, 175),
|
|
(1, 256, 80, 128),
|
|
(1, 256, 120, 192),
|
|
]
|
|
|
|
def run_test(benchmark):
|
|
with torch.backends.cudnn.flags(benchmark=benchmark):
|
|
conv = torch.nn.Conv2d(256, 256, kernel_size=3, padding=1).to("cuda", dtype)
|
|
for size in sizes:
|
|
x = torch.randn(size, device="cuda", dtype=dtype)
|
|
out = conv(x.detach().clone().requires_grad_())
|
|
out.backward(torch.ones_like(out))
|
|
|
|
run_test(benchmark=False)
|
|
run_test(benchmark=True)
|
|
|
|
def test_conv_modules_raise_error_on_incorrect_input_size(self):
|
|
for dtype in [torch.bfloat16, torch.double, torch.float]:
|
|
modules = [nn.Conv1d(3, 8, 3).to(dtype), nn.ConvTranspose1d(3, 8, 3).to(dtype),
|
|
nn.Conv2d(3, 8, 3).to(dtype), nn.ConvTranspose2d(3, 8, 3).to(dtype),
|
|
nn.Conv3d(3, 8, 3).to(dtype), nn.ConvTranspose3d(3, 8, 3).to(dtype)]
|
|
|
|
invalid_input_dims = [(2, 4), (2, 4),
|
|
(3, 5), (3, 5),
|
|
(4, 6), (4, 6)]
|
|
|
|
for invalid_dims, module in zip(invalid_input_dims, modules):
|
|
for dims in invalid_dims:
|
|
input = torch.empty(torch.Size((3, ) * dims))
|
|
self.assertRaises(RuntimeError, lambda: module(input))
|
|
|
|
def test_conv_shapecheck(self):
|
|
def test(should_raise, module, input_size, dtype):
|
|
input = torch.empty(3, *input_size).to(dtype)
|
|
if should_raise:
|
|
self.assertRaises(RuntimeError, lambda: module(input))
|
|
else:
|
|
# just run it to ensure no exception raised.
|
|
module(input)
|
|
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
# Conv1d
|
|
test(True, nn.Conv1d(1, 1, 3).to(dtype), (1, 2), dtype)
|
|
test(True, nn.Conv1d(1, 1, 3, stride=2).to(dtype), (1, 2), dtype)
|
|
test(False, nn.Conv1d(1, 1, 2).to(dtype), (1, 2), dtype)
|
|
test(False, nn.Conv1d(1, 1, 2, stride=2).to(dtype), (1, 2), dtype)
|
|
test(False, nn.Conv1d(1, 1, 3, stride=2, padding=1).to(dtype), (1, 2), dtype)
|
|
|
|
# Conv2d
|
|
test(True, nn.Conv2d(1, 1, (3, 3)).to(dtype), (1, 2, 2), dtype)
|
|
test(False, nn.Conv2d(1, 1, (3, 3)).to(dtype), (1, 3, 3), dtype)
|
|
test(False, nn.Conv2d(1, 1, (3, 3), padding=1).to(dtype), (1, 2, 2), dtype)
|
|
|
|
# Conv3D
|
|
test(True, nn.Conv3d(1, 1, (3, 3, 3)).to(dtype), (1, 2, 2, 2), dtype)
|
|
test(False, nn.Conv3d(1, 1, (3, 3, 3)).to(dtype), (1, 3, 3, 3), dtype)
|
|
test(False, nn.Conv3d(1, 1, (3, 3, 3), padding=1).to(dtype), (1, 2, 2, 2), dtype)
|
|
|
|
def test_ConvTranspose2d_output_size(self):
|
|
m = nn.ConvTranspose2d(3, 4, 3, 3, 0, 2)
|
|
i = torch.randn(2, 3, 6, 6)
|
|
for h in range(15, 22):
|
|
for w in range(15, 22):
|
|
if 18 <= h <= 20 and 18 <= w <= 20:
|
|
output = m(i, output_size=(h, w))
|
|
self.assertEqual(output.size()[2:], (h, w))
|
|
else:
|
|
self.assertRaises(ValueError, lambda: m(i, (h, w)))
|
|
|
|
def test_ConvTranspose2d_output_size_downsample_upsample(self):
|
|
b, c, hid_c = 2, 3, 2
|
|
for h in range(13, 24):
|
|
for w in range(13, 17):
|
|
for k in range(2, 5):
|
|
for d in range(1, 5):
|
|
for s in range(1, 4):
|
|
for p in range(3):
|
|
conv = nn.Conv2d(
|
|
in_channels=c,
|
|
out_channels=hid_c,
|
|
kernel_size=k,
|
|
stride=s,
|
|
padding=p,
|
|
dilation=d,
|
|
)
|
|
|
|
t_conv = nn.ConvTranspose2d(
|
|
in_channels=hid_c,
|
|
out_channels=c,
|
|
kernel_size=k,
|
|
stride=s,
|
|
padding=p,
|
|
dilation=d,
|
|
)
|
|
|
|
i = torch.randn(b, c, h, w)
|
|
|
|
out = t_conv(conv(i), output_size=i.shape)
|
|
|
|
self.assertEqual(out.size()[2:], i.size()[2:])
|
|
|
|
def test_ConvTranspose3d_correct_output_size(self):
|
|
# Check that ConvTranspose3d can take a 5d output_size.
|
|
m = nn.ConvTranspose3d(2, 2, 2)
|
|
i = torch.rand(1, 2, 1, 1, 1)
|
|
out = m(i, output_size=(1, 2, 2, 2, 2))
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_ConvTranspose2d_half_cublas_gemm(self):
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
inputs = torch.randn(1, 1, 16, 16, device='cuda', dtype=torch.half)
|
|
deconv = nn.ConvTranspose2d(
|
|
1, 1, 3, stride=2, padding=1, output_padding=1).cuda().half()
|
|
output = deconv(inputs)
|
|
output.mean().backward()
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@repeat_test_for_types([torch.half, torch.float])
|
|
def test_ConvTranspose2d_large_output_padding(self, dtype=torch.half):
|
|
net1 = torch.nn.ConvTranspose2d(128, 64, kernel_size=3, stride=2, padding=1, output_padding=1)\
|
|
.to(device='cuda', dtype=dtype)
|
|
net2 = torch.nn.ConvTranspose2d(64, 32, kernel_size=3, stride=2, padding=1, output_padding=1)\
|
|
.to(device='cuda', dtype=dtype)
|
|
net3 = torch.nn.ConvTranspose2d(32, 3, kernel_size=3, stride=2, padding=1, output_padding=1)\
|
|
.to(device='cuda', dtype=dtype)
|
|
x = torch.rand(1, 128, 6, 6, device='cuda', dtype=dtype, requires_grad=True)
|
|
x = net1(x)
|
|
x = net2(x)
|
|
x = net3(x)
|
|
x.backward(torch.randn_like(x))
|
|
torch.cuda.synchronize()
|
|
|
|
# For https://github.com/pytorch/pytorch/pull/1273
|
|
# Almost identical to the above `test_Conv2d_naive_groups`
|
|
@skipIfRocm
|
|
def test_Conv2d_groups_nobias(self):
|
|
dev_dtypes = [("cpu", torch.float)]
|
|
if TEST_CUDA:
|
|
dev_dtypes += [("cuda", torch.float), ("cuda", torch.half)]
|
|
if AMPERE_OR_ROCM:
|
|
dev_dtypes += [("cuda", torch.bfloat16)]
|
|
for device, dtype in dev_dtypes:
|
|
m = nn.Conv2d(4, 4, kernel_size=3, groups=2, bias=False).to(device, dtype)
|
|
i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True)
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 4, 4, 4, device=device, dtype=dtype)
|
|
output.backward(grad_output)
|
|
|
|
m1 = nn.Conv2d(2, 2, kernel_size=3, bias=False).to(device, dtype)
|
|
m1.weight.data.copy_(m.weight.data[:2])
|
|
i1 = i.data[:, :2].contiguous().requires_grad_(True)
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :2].contiguous())
|
|
|
|
m2 = nn.Conv2d(2, 2, kernel_size=3, bias=False).to(device, dtype)
|
|
m2.weight.data.copy_(m.weight.data[2:])
|
|
i2 = i.data[:, 2:].contiguous().requires_grad_(True)
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, 2:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1))
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0),
|
|
atol=1e-1 if dtype == torch.half else dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
# Almost identical to the above `test_Conv2d_naive_groups`
|
|
# Covering special case when group > 1, input-channel / group < 16 and output-channel is multiple of 16
|
|
# See also https://github.com/pytorch/pytorch/pull/18463#issuecomment-476563686
|
|
# and https://github.com/pytorch/pytorch/pull/18463#issuecomment-477001024
|
|
@skipIfRocm
|
|
def test_Conv2d_groups_nobias_v2(self):
|
|
torch.manual_seed(123)
|
|
dev_dtypes = [("cpu", torch.float)]
|
|
if TEST_CUDA:
|
|
dev_dtypes += [("cuda", torch.float), ("cuda", torch.half)]
|
|
if AMPERE_OR_ROCM:
|
|
dev_dtypes += [("cuda", torch.bfloat16)]
|
|
for device, dtype in dev_dtypes:
|
|
m = nn.Conv2d(4, 16, kernel_size=3, groups=2, bias=False).to(device, dtype)
|
|
i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True)
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 16, 4, 4, device=device, dtype=dtype)
|
|
output.backward(grad_output)
|
|
|
|
m1 = nn.Conv2d(2, 8, kernel_size=3, bias=False).to(device, dtype)
|
|
m1.weight.data.copy_(m.weight.data[:8])
|
|
i1 = i.data[:, :2].contiguous().requires_grad_(True)
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :8].contiguous())
|
|
|
|
m2 = nn.Conv2d(2, 8, kernel_size=3, bias=False).to(device, dtype)
|
|
m2.weight.data.copy_(m.weight.data[8:])
|
|
i2 = i.data[:, 2:].contiguous().requires_grad_(True)
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, 8:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1))
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0),
|
|
atol=1e-1 if dtype == torch.half else dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
# CPU-only test for group conv3d fast implementation using bmm
|
|
# See: https://github.com/pytorch/pytorch/pull/36355
|
|
def test_Conv3d_groups_nobias(self):
|
|
torch.manual_seed(123)
|
|
m = nn.Conv3d(4, 16, kernel_size=3, groups=2, bias=False).to("cpu", torch.float)
|
|
i = torch.randn(2, 4, 6, 6, 6, device="cpu", dtype=torch.float, requires_grad=True)
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 16, 4, 4, 4, device="cpu", dtype=torch.float)
|
|
output.backward(grad_output)
|
|
|
|
m1 = nn.Conv3d(2, 8, kernel_size=3, bias=False).to("cpu", torch.float)
|
|
m1.weight.data.copy_(m.weight.data[:8])
|
|
i1 = i.data[:, :2].contiguous().requires_grad_(True)
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :8].contiguous())
|
|
|
|
m2 = nn.Conv3d(2, 8, kernel_size=3, bias=False).to("cpu", torch.float)
|
|
m2.weight.data.copy_(m.weight.data[8:])
|
|
i2 = i.data[:, 2:].contiguous().requires_grad_(True)
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, 8:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1))
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[torch.float], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[torch.float], rtol=dtype2prec_DONTUSE[torch.float])
|
|
|
|
def test_Conv3d_groups_wbias(self):
|
|
torch.manual_seed(123)
|
|
m = nn.Conv3d(4, 16, kernel_size=3, groups=2, bias=True).to("cpu", torch.float)
|
|
i = torch.randn(2, 4, 6, 6, 6, device="cpu", dtype=torch.float, requires_grad=True)
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 16, 4, 4, 4, device="cpu", dtype=torch.float)
|
|
output.backward(grad_output)
|
|
|
|
m1 = nn.Conv3d(2, 8, kernel_size=3, bias=True).to("cpu", torch.float)
|
|
m1.weight.data.copy_(m.weight.data[:8])
|
|
m1.bias.data.copy_(m.bias.data[:8])
|
|
i1 = i.data[:, :2].contiguous().requires_grad_(True)
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :8].contiguous())
|
|
|
|
m2 = nn.Conv3d(2, 8, kernel_size=3, bias=True).to("cpu", torch.float)
|
|
m2.weight.data.copy_(m.weight.data[8:])
|
|
m2.bias.data.copy_(m.bias.data[8:])
|
|
i2 = i.data[:, 2:].contiguous().requires_grad_(True)
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, 8:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1))
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[torch.float],
|
|
rtol=dtype2prec_DONTUSE[torch.float])
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[torch.float],
|
|
rtol=dtype2prec_DONTUSE[torch.float])
|
|
self.assertEqual(m.bias.grad.data,
|
|
torch.cat([m1.bias.grad.data, m2.bias.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[torch.float], rtol=dtype2prec_DONTUSE[torch.float])
|
|
|
|
# Very similar to test_Conv2d_naive_groups but with special care to handle
|
|
# the number of groups == number of input channels
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@repeat_test_for_types(ALL_TENSORTYPES)
|
|
@tf32_on_and_off(0.01)
|
|
def test_Conv2d_depthwise_naive_groups_cuda(self, dtype=torch.float):
|
|
for depth_multiplier in [1, 2]:
|
|
m = nn.Conv2d(2, 2 * depth_multiplier, kernel_size=3, groups=2).to("cuda", dtype)
|
|
i = torch.randn(2, 2, 6, 6, device="cuda", dtype=dtype).div_(2).requires_grad_()
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 2 * depth_multiplier, 4, 4, device="cuda", dtype=dtype) / 2
|
|
output.backward(grad_output)
|
|
|
|
offset = 1 * depth_multiplier
|
|
|
|
m1 = nn.Conv2d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype)
|
|
m1.weight.data = m.weight.data[:offset].clone()
|
|
m1.bias.data = m.bias.data[:offset].clone()
|
|
i1 = i.detach()[:, :1].clone().requires_grad_()
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :offset].contiguous())
|
|
|
|
m2 = nn.Conv2d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype)
|
|
m2.weight.data.copy_(m.weight.data[offset:])
|
|
m2.bias.data.copy_(m.bias.data[offset:])
|
|
i2 = i.detach()[:, 1:].clone().requires_grad_()
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, offset:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.bias.grad.data,
|
|
torch.cat([m1.bias.grad.data,
|
|
m2.bias.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data,
|
|
m2.weight.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@repeat_test_for_types(ALL_TENSORTYPES)
|
|
@tf32_on_and_off(0.001)
|
|
def test_Conv3d_depthwise_naive_groups_cuda(self, dtype=torch.float):
|
|
for depth_multiplier in [1, 2]:
|
|
m = nn.Conv3d(2, 2 * depth_multiplier, kernel_size=3, groups=2).to("cuda", dtype)
|
|
i = torch.randn(2, 2, 6, 6, 6, device="cuda", dtype=dtype).div_(2).requires_grad_()
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 2 * depth_multiplier, 4, 4, 4, device="cuda", dtype=dtype) / 2
|
|
output.backward(grad_output)
|
|
|
|
offset = 1 * depth_multiplier
|
|
|
|
m1 = nn.Conv3d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype)
|
|
m1.weight.data = m.weight.data[:offset].clone()
|
|
m1.bias.data = m.bias.data[:offset].clone()
|
|
i1 = i.detach()[:, :1].clone().requires_grad_()
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :offset].contiguous())
|
|
|
|
m2 = nn.Conv3d(1, 1 * depth_multiplier, kernel_size=3).to("cuda", dtype)
|
|
m2.weight.data.copy_(m.weight.data[offset:])
|
|
m2.bias.data.copy_(m.bias.data[offset:])
|
|
i2 = i.detach()[:, 1:].clone().requires_grad_()
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, offset:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.bias.grad.data,
|
|
torch.cat([m1.bias.grad.data,
|
|
m2.bias.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data,
|
|
m2.weight.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
def test_MaxUnpool2d_output_size(self):
|
|
m = nn.MaxPool2d(3, stride=2, return_indices=True)
|
|
mu = nn.MaxUnpool2d(3, stride=2)
|
|
big_t = torch.rand(1, 1, 6, 6)
|
|
big_t[0][0][4][4] = 100
|
|
output_big, indices_big = m(big_t)
|
|
self.assertRaises(RuntimeError, lambda: mu(output_big, indices_big))
|
|
|
|
small_t = torch.rand(1, 1, 5, 5)
|
|
for i in range(0, 4, 2):
|
|
for j in range(0, 4, 2):
|
|
small_t[:, :, i, j] = 100
|
|
output_small, indices_small = m(small_t)
|
|
for h in range(3, 10):
|
|
for w in range(3, 10):
|
|
if 4 <= h <= 6 and 4 <= w <= 6:
|
|
size = (h, w)
|
|
if h == 6:
|
|
size = (1, 1) + size
|
|
|
|
mu(output_small, indices_small, output_size=size)
|
|
else:
|
|
self.assertRaises(ValueError, lambda: mu(output_small, indices_small, (h, w)))
|
|
|
|
def test_container_copy(self):
|
|
class Model(nn.Module):
|
|
def __init__(self):
|
|
super(Model, self).__init__()
|
|
self.linear = nn.Linear(4, 5)
|
|
|
|
def forward(self, input):
|
|
return self.linear(input)
|
|
|
|
input = torch.randn(2, 4)
|
|
|
|
model = Model()
|
|
model_cp = deepcopy(model)
|
|
self.assertEqual(model(input).data, model_cp(input).data)
|
|
|
|
model_cp.linear.weight.data[:] = 2
|
|
self.assertNotEqual(model(input).data, model_cp(input).data)
|
|
|
|
def test_RNN_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
for module in (nn.RNNCell, nn.GRUCell):
|
|
for bias in (True, False):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 20)
|
|
cell = module(10, 20, bias=bias)
|
|
for _ in range(6):
|
|
hx = cell(input, hx)
|
|
|
|
hx.sum().backward()
|
|
|
|
def test_RNN_cell_forward_input_size(self):
|
|
input = torch.randn(3, 11)
|
|
hx = torch.randn(3, 20)
|
|
for module in (nn.RNNCell, nn.GRUCell):
|
|
cell = module(10, 20)
|
|
self.assertRaises(Exception, lambda: cell(input, hx))
|
|
|
|
def test_RNN_cell_forward_hidden_size(self):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 21)
|
|
cell_shared_param = (10, 20)
|
|
for cell in (nn.RNNCell(*cell_shared_param, nonlinearity="relu"),
|
|
nn.RNNCell(*cell_shared_param, nonlinearity="tanh"),
|
|
nn.GRUCell(*cell_shared_param)):
|
|
self.assertRaises(Exception, lambda: cell(input, hx))
|
|
|
|
|
|
def _test_loss_equal_input_target_shape(self, cast):
|
|
# Tests losses whose inputs should have the same size.
|
|
losses = {
|
|
'mse_loss': lambda x, y: F.mse_loss(x, y),
|
|
'l1_loss': lambda x, y: F.l1_loss(x, y),
|
|
'smooth_l1_loss': lambda x, y: F.smooth_l1_loss(x, y),
|
|
'huber_loss': lambda x, y: F.huber_loss(x, y),
|
|
'kl_div': lambda x, y: F.kl_div(x, y),
|
|
'poisson_nll_loss': lambda x, y: F.poisson_nll_loss(x, y),
|
|
}
|
|
|
|
input = cast(torch.randn(3, 5))
|
|
target = cast(torch.randn(5, 3))
|
|
for _name, fn in losses.items():
|
|
self.assertRaises(Exception, lambda: fn(input, target))
|
|
|
|
def test_loss_equal_input_target_shape(self):
|
|
self._test_loss_equal_input_target_shape(lambda x: x)
|
|
|
|
def test_mse_loss_size_warning(self):
|
|
i = torch.randn((10, 1), requires_grad=True)
|
|
t = torch.randn((10,))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Trigger Warning
|
|
F.mse_loss(i, t)
|
|
# Check warning occurs
|
|
self.assertEqual(len(w), 1)
|
|
self.assertIn('Please ensure they have the same size.', str(w[0]))
|
|
|
|
def test_poisson_nll_loss_reduction_modes(self):
|
|
input = torch.tensor([0.5, 1.5, 2.5])
|
|
target = torch.tensor([1., 2., 3.])
|
|
component_wise_loss = torch.exp(input) - target * input
|
|
self.assertEqual(component_wise_loss,
|
|
F.poisson_nll_loss(input, target, reduction='none'))
|
|
self.assertEqual(torch.sum(component_wise_loss),
|
|
F.poisson_nll_loss(input, target, reduction='sum'))
|
|
self.assertEqual(torch.mean(component_wise_loss),
|
|
F.poisson_nll_loss(input, target, reduction='mean'))
|
|
with self.assertRaisesRegex(ValueError, 'is not valid'):
|
|
F.poisson_nll_loss(input, target, reduction='total')
|
|
|
|
def test_gaussian_nll_loss_reduction_modes(self):
|
|
input = torch.tensor([[0.5, 1.5, 2.5], [2., 4., 6.]])
|
|
target = torch.tensor([[1., 2., 3.], [4., 5., 6.]])
|
|
var = torch.tensor([[0.5, 1., 1.5], [1., 1.5, 2.]])
|
|
component_wise_loss = 0.5 * (torch.log(var) + (input - target)**2 / var)
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target, var, reduction='none'))
|
|
self.assertEqual(torch.sum(component_wise_loss),
|
|
F.gaussian_nll_loss(input, target, var, reduction='sum'))
|
|
self.assertEqual(torch.mean(component_wise_loss),
|
|
F.gaussian_nll_loss(input, target, var, reduction='mean'))
|
|
with self.assertRaisesRegex(ValueError, 'is not valid'):
|
|
F.gaussian_nll_loss(input, target, var, reduction='total')
|
|
|
|
def test_gaussian_nll_loss_broadcasting(self):
|
|
input = torch.tensor([[0.5, 1.5, 2.5], [2., 4., 6.]])
|
|
target_full = torch.tensor([[1., 2., 3.], [1., 2., 3.]])
|
|
target_part = torch.tensor([[1., 2., 3.]])
|
|
var_full = torch.tensor([[0.5, 0.5, 0.5], [1.5, 1.5, 1.5]])
|
|
var_part1 = torch.tensor([[0.5], [1.5]])
|
|
var_part2 = torch.tensor([0.5, 1.5])
|
|
component_wise_loss = 0.5 * (torch.log(var_full) + (input - target_full)**2 / var_full)
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_full, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_full, var_part1, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_full, var_part2, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_part1, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_part2, reduction='none'))
|
|
|
|
def test_gaussian_nll_loss_args(self):
|
|
input = torch.randn(3, 5)
|
|
with self.assertRaisesRegex(ValueError, 'var is of incorrect size'):
|
|
target = torch.randn(3, 5)
|
|
var = torch.ones(3, 3)
|
|
torch.nn.functional.gaussian_nll_loss(input, target, var)
|
|
with self.assertRaisesRegex(ValueError, 'var has negative entry/entries'):
|
|
var = -1 * torch.ones(3, 5)
|
|
torch.nn.functional.gaussian_nll_loss(input, target, var)
|
|
|
|
def test_KLDivLoss_batch_mean(self):
|
|
input_shape = (2, 5)
|
|
log_prob1 = F.log_softmax(torch.randn(input_shape), 1)
|
|
prob2 = F.softmax(torch.randn(input_shape), 1)
|
|
|
|
loss = nn.KLDivLoss(reduction='batchmean')
|
|
l = loss(log_prob1, prob2)
|
|
|
|
loss_none_reduce = nn.KLDivLoss(reduction='sum')(log_prob1, prob2)
|
|
expected = loss_none_reduce / input_shape[0]
|
|
|
|
self.assertEqual(l, expected)
|
|
|
|
def test_KLDivLoss_batch_mean_log_target(self):
|
|
input_shape = (2, 5)
|
|
log_prob1 = F.log_softmax(torch.randn(input_shape), 1)
|
|
log_prob2 = F.log_softmax(torch.randn(input_shape), 1)
|
|
|
|
loss = nn.KLDivLoss(reduction='batchmean', log_target=True)
|
|
l = loss(log_prob1, log_prob2)
|
|
|
|
loss_none_reduce = nn.KLDivLoss(reduction='sum', log_target=True)(log_prob1, log_prob2)
|
|
expected = loss_none_reduce / input_shape[0]
|
|
|
|
self.assertEqual(l, expected)
|
|
|
|
def test_CTCLoss_typechecks(self):
|
|
target_lengths = torch.tensor([30, 25, 20])
|
|
input_lengths = torch.tensor([50, 50, 50])
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
_input_lengths = input_lengths.to(dtype=torch.float)
|
|
torch.nn.functional.ctc_loss(log_probs, targets, _input_lengths, target_lengths)
|
|
with self.assertRaises(RuntimeError):
|
|
target_lengths = target_lengths.to(dtype=torch.float)
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_lengthchecks_cuda(self):
|
|
target_lengths = [30, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (3, 29), dtype=torch.long, device='cuda')
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
def test_CTCLoss_lengthchecks_cpu(self):
|
|
target_lengths = [30, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (3, 29), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_long_targets(self):
|
|
input_length = 4000
|
|
vocab_size = 3
|
|
batch_size = 4
|
|
target_length = 1200
|
|
|
|
log_probs = torch.randn(input_length, batch_size, vocab_size).log_softmax(2).requires_grad_()
|
|
targets = torch.randint(low=1, high=vocab_size - 1, size=(batch_size, target_length), dtype=torch.long)
|
|
input_lengths = batch_size * [input_length]
|
|
target_lengths = batch_size * [target_length]
|
|
|
|
res_cpu = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
grad_out = torch.randn_like(res_cpu)
|
|
grad_cpu, = torch.autograd.grad(res_cpu, log_probs, grad_out)
|
|
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res_gpu = torch.nn.functional.ctc_loss(log_probs.cuda(), targets.cuda(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
grad_gpu, = torch.autograd.grad(res_gpu, log_probs, grad_out.cuda())
|
|
self.assertEqual(res_cpu, res_gpu, atol=1e-4, rtol=0)
|
|
self.assertEqual(grad_cpu, grad_gpu, atol=1e-4, rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_critical_target_len(self):
|
|
# cudnn has an unexpected problem with target length 256, see issue #53505
|
|
N = 1
|
|
S = 256
|
|
C = 10
|
|
T = 500
|
|
target = torch.randint(low=1, high=C, size=(S,), dtype=torch.int)
|
|
input_lengths = torch.full(size=(N,), fill_value=T, dtype=torch.int)
|
|
target_lengths = torch.tensor(S, dtype=torch.int)
|
|
inp = torch.randn(T, N, C, dtype=torch.float, device='cuda').log_softmax(2).requires_grad_()
|
|
with cudnn.flags(enabled=True):
|
|
res_gpu = torch.nn.functional.ctc_loss(inp, target, input_lengths, target_lengths, reduction='none')
|
|
res_cpu = torch.nn.functional.ctc_loss(inp.cpu(), target, input_lengths, target_lengths, reduction='none')
|
|
self.assertEqual(res_cpu, res_gpu, atol=1e-3, rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_zero_infinity(self):
|
|
target_lengths = [60, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int, device='cuda')
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2).requires_grad_()
|
|
res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res2 = torch.nn.functional.ctc_loss(log_probs, targets.cuda().long(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
res_cpu = torch.nn.functional.ctc_loss(log_probs.cpu(), targets.cpu(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
|
|
self.assertEqual(res2, res, atol=1e-4, rtol=0)
|
|
self.assertEqual(res_cpu, res.cpu(), atol=1e-4, rtol=0)
|
|
g1, = torch.autograd.grad(res, log_probs)
|
|
g2, = torch.autograd.grad(res2, log_probs)
|
|
g3, = torch.autograd.grad(res_cpu, log_probs)
|
|
self.assertEqual(g2, g3, atol=1e-4, rtol=0)
|
|
self.assertEqual(g1, g2, atol=1e-4, rtol=0)
|
|
self.assertTrue((g1 == g1).all().item()) # check that we don't have NaN
|
|
|
|
def test_RNN_cell_no_broadcasting(self):
|
|
def test(cell_module, input, hx, input_size, hidden_size):
|
|
cell = cell_module(input_size, hidden_size)
|
|
self.assertRaises(RuntimeError, lambda: cell(input, hx))
|
|
|
|
def test_all(hidden_size, bad_hx, good_hx, input_size, input):
|
|
test(nn.RNNCell, input, bad_hx, input_size, hidden_size)
|
|
test(nn.GRUCell, input, bad_hx, input_size, hidden_size)
|
|
test(nn.LSTMCell, input, (bad_hx, good_hx), input_size, hidden_size)
|
|
test(nn.LSTMCell, input, (good_hx, bad_hx), input_size, hidden_size)
|
|
|
|
hidden_size = 20
|
|
input_size = 10
|
|
input = torch.randn(3, input_size)
|
|
bad_hx = torch.randn(1, hidden_size)
|
|
good_hx = torch.randn(3, hidden_size)
|
|
|
|
# Test hidden/input batch size broadcasting
|
|
test_all(hidden_size, bad_hx, good_hx, input_size, input)
|
|
|
|
# Test hx's hidden_size vs module's hidden_size broadcasting
|
|
bad_hx = torch.randn(3, 1)
|
|
test_all(hidden_size, bad_hx, good_hx, input_size, input)
|
|
|
|
# Test input's input_size vs module's input_size broadcasting
|
|
bad_input = torch.randn(3, 1)
|
|
test_all(hidden_size, good_hx, good_hx, input_size, bad_input)
|
|
|
|
def test_invalid_dropout_p(self):
|
|
v = torch.ones(1)
|
|
self.assertRaises(ValueError, lambda: nn.Dropout(-0.1))
|
|
self.assertRaises(ValueError, lambda: nn.Dropout(1.1))
|
|
self.assertRaises(ValueError, lambda: nn.Dropout2d(-0.1))
|
|
self.assertRaises(ValueError, lambda: nn.Dropout2d(1.1))
|
|
self.assertRaises(ValueError, lambda: nn.Dropout3d(-0.1))
|
|
self.assertRaises(ValueError, lambda: nn.Dropout3d(1.1))
|
|
self.assertRaises(ValueError, lambda: F.dropout(v, -0.1))
|
|
self.assertRaises(ValueError, lambda: F.dropout(v, 1.1))
|
|
|
|
def test_pad_sequence(self):
|
|
def pad(tensor, length):
|
|
return torch.cat(
|
|
[tensor.data, tensor.data.new(
|
|
length - tensor.size(0), *tensor.size()[1:]).zero_()])
|
|
|
|
# single dimensional
|
|
a = torch.tensor([1, 2, 3])
|
|
b = torch.tensor([4, 5])
|
|
c = torch.tensor([6])
|
|
|
|
# batch_first = true
|
|
expected = torch.tensor([[4, 5, 0], [1, 2, 3], [6, 0, 0]])
|
|
padded = rnn_utils.pad_sequence([b, a, c], True)
|
|
self.assertEqual(padded, expected)
|
|
|
|
# batch_first = false
|
|
padded = rnn_utils.pad_sequence([b, a, c])
|
|
self.assertEqual(padded, expected.transpose(0, 1))
|
|
|
|
# pad with non-zero value
|
|
expected = torch.tensor([[4, 5, 1], [1, 2, 3], [6, 1, 1]])
|
|
padded = rnn_utils.pad_sequence([b, a, c], True, 1)
|
|
self.assertEqual(padded, expected)
|
|
|
|
# Test pad sorted sequence
|
|
expected = torch.tensor([[1, 2, 3], [4, 5, 0], [6, 0, 0]])
|
|
padded = rnn_utils.pad_sequence([a, b, c], True)
|
|
self.assertEqual(padded, expected)
|
|
|
|
# more dimensions
|
|
maxlen = 9
|
|
for num_dim in (0, 1, 2, 3):
|
|
sequences = []
|
|
trailing_dims = [4] * num_dim
|
|
for i in range(1, maxlen + 1):
|
|
seq_len = i * i
|
|
sequences.append(torch.rand(seq_len, 5, *trailing_dims))
|
|
random.shuffle(sequences)
|
|
expected = []
|
|
for seq in sequences:
|
|
expected.append(pad(seq, maxlen * maxlen))
|
|
# batch first = true
|
|
expected = torch.stack(expected)
|
|
padded = rnn_utils.pad_sequence(sequences, True)
|
|
self.assertEqual(padded, expected)
|
|
|
|
# batch first = false
|
|
padded = rnn_utils.pad_sequence(sequences)
|
|
self.assertEqual(padded, expected.transpose(0, 1))
|
|
|
|
def test_pack_sequence(self):
|
|
def _compatibility_test(sequences, lengths, batch_first, enforce_sorted=False):
|
|
padded = rnn_utils.pad_sequence(sequences, batch_first)
|
|
packed = rnn_utils.pack_sequence(sequences, enforce_sorted)
|
|
unpacked = rnn_utils.pad_packed_sequence(packed, batch_first)
|
|
self.assertEqual(padded, unpacked[0])
|
|
pack_padded = rnn_utils.pack_padded_sequence(
|
|
padded, lengths, batch_first, enforce_sorted)
|
|
self.assertEqual(packed, pack_padded)
|
|
|
|
# single dimensional
|
|
a = torch.tensor([1, 2, 3])
|
|
b = torch.tensor([4, 5])
|
|
c = torch.tensor([6])
|
|
packed = rnn_utils.pack_sequence([a, b, c], enforce_sorted=False)
|
|
expected = torch.tensor([1, 4, 6, 2, 5, 3])
|
|
self.assertEqual(packed.batch_sizes, [3, 2, 1])
|
|
self.assertEqual(packed.data.data, expected)
|
|
self.assertEqual(packed.sorted_indices, [0, 1, 2])
|
|
self.assertEqual(packed.unsorted_indices, [0, 1, 2])
|
|
|
|
packed_unsorted = rnn_utils.pack_sequence([b, c, a], enforce_sorted=False)
|
|
self.assertEqual(packed_unsorted.batch_sizes, [3, 2, 1])
|
|
self.assertEqual(packed_unsorted.data.data, expected)
|
|
self.assertEqual(packed_unsorted.sorted_indices, [2, 0, 1])
|
|
self.assertEqual(packed_unsorted.unsorted_indices, [1, 2, 0])
|
|
|
|
# single dimensional, enforce_sorted = True
|
|
packed_enforce_sorted = rnn_utils.pack_sequence([a, b, c], enforce_sorted=True)
|
|
self.assertEqual(packed_enforce_sorted.batch_sizes, [3, 2, 1])
|
|
self.assertEqual(packed_enforce_sorted.data.data, expected)
|
|
self.assertTrue(packed_enforce_sorted.sorted_indices is None)
|
|
self.assertTrue(packed_enforce_sorted.unsorted_indices is None)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'must be sorted in decreasing order'):
|
|
rnn_utils.pack_sequence([b, c, a], enforce_sorted=True)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'You can pass `enforce_sorted=False`'):
|
|
rnn_utils.pack_sequence([b, c, a], enforce_sorted=True)
|
|
|
|
# more dimensions
|
|
maxlen = 9
|
|
for num_dim in (0, 1, 2, 3):
|
|
sequences = []
|
|
lengths = []
|
|
trailing_dims = [4] * num_dim
|
|
for i in range(maxlen, 0, -1):
|
|
seq_len = i * i
|
|
lengths.append(seq_len)
|
|
sequences.append(torch.rand(seq_len, 5, *trailing_dims))
|
|
unsorted_sequences = [s.clone() for s in sequences]
|
|
random.shuffle(unsorted_sequences)
|
|
unsorted_sequences_lengths = [t.size(0) for t in unsorted_sequences]
|
|
|
|
# compatibility with other utilities
|
|
for batch_first in (True, False):
|
|
for enforce_sorted in (True, False):
|
|
_compatibility_test(sequences, lengths, batch_first, enforce_sorted)
|
|
_compatibility_test(unsorted_sequences, unsorted_sequences_lengths,
|
|
batch_first)
|
|
|
|
def test_pack_padded_sequence(self):
|
|
def generate_test_case(sorted_lengths, should_shuffle):
|
|
def pad(tensor, length):
|
|
return torch.cat([tensor, tensor.new(length - tensor.size(0), *tensor.size()[1:]).zero_()])
|
|
|
|
max_length = sorted_lengths[0]
|
|
batch_sizes = [sum(map(bool, filter(lambda x: x >= i, sorted_lengths)))
|
|
for i in range(1, max_length + 1)]
|
|
offset = 0
|
|
padded = torch.cat([pad(i * 100 + torch.arange(1., 5 * l + 1).view(l, 1, 5), max_length)
|
|
for i, l in enumerate(sorted_lengths, 1)], 1)
|
|
expected_data = [[torch.arange(1., 6) + (i + 1) * 100 + 5 * n for i in range(batch_size)]
|
|
for n, batch_size in enumerate(batch_sizes)]
|
|
expected_data = list(itertools.chain.from_iterable(expected_data))
|
|
expected_data = torch.stack(expected_data, dim=0)
|
|
|
|
if should_shuffle:
|
|
# Shuffle the padded sequence to create an unsorted sequence
|
|
permutation = list(range(len(sorted_lengths)))
|
|
random.shuffle(permutation)
|
|
|
|
unsorted_indices = torch.tensor(permutation)
|
|
padded = padded.index_select(1, unsorted_indices)
|
|
lengths = torch.tensor(sorted_lengths).index_select(0, unsorted_indices)
|
|
else:
|
|
unsorted_indices = None
|
|
lengths = sorted_lengths
|
|
|
|
return padded.requires_grad_(), lengths, expected_data, batch_sizes, unsorted_indices
|
|
|
|
test_cases = [
|
|
# sorted_lengths, should_shuffle
|
|
[[10, 8, 4, 2, 2, 2, 1], False],
|
|
[[11, 10, 8, 6, 4, 3, 1], False],
|
|
[[11, 10, 8, 6, 4, 3, 1], True],
|
|
]
|
|
|
|
for test_case, batch_first in itertools.product(test_cases, (True, False)):
|
|
sorted_lengths, should_shuffle = test_case
|
|
padded, lengths, expected_data, batch_sizes, unsorted_indices = generate_test_case(
|
|
sorted_lengths, should_shuffle)
|
|
|
|
src = padded
|
|
if batch_first:
|
|
src = src.transpose(0, 1)
|
|
|
|
# check output
|
|
packed = rnn_utils.pack_padded_sequence(src, lengths, batch_first=batch_first,
|
|
enforce_sorted=not should_shuffle)
|
|
self.assertEqual(packed.data.data, expected_data)
|
|
self.assertEqual(packed.batch_sizes, batch_sizes)
|
|
self.assertEqual(packed.unsorted_indices, unsorted_indices)
|
|
|
|
# test inverse
|
|
unpacked, unpacked_len = rnn_utils.pad_packed_sequence(packed, batch_first=batch_first)
|
|
self.assertEqual(unpacked, src)
|
|
self.assertEqual(unpacked_len, lengths)
|
|
|
|
# check grad
|
|
if padded.grad is not None:
|
|
padded.grad.data.zero_()
|
|
grad_output = unpacked.data.clone().normal_()
|
|
unpacked.backward(grad_output)
|
|
if batch_first:
|
|
grad_output.transpose_(0, 1)
|
|
for i, l in enumerate(lengths):
|
|
self.assertEqual(padded.grad.data[:l, i], grad_output[:l, i])
|
|
if l < 10:
|
|
self.assertEqual(padded.grad.data[l:, i].abs().sum(), 0)
|
|
|
|
# test error messages
|
|
with self.assertRaisesRegex(RuntimeError, 'You can pass `enforce_sorted=False`'):
|
|
packed = rnn_utils.pack_padded_sequence(torch.randn(3, 3), [1, 3, 2])
|
|
with self.assertRaisesRegex(RuntimeError, 'empty tensor'):
|
|
packed = rnn_utils.pack_padded_sequence(torch.randn(0, 0), [])
|
|
|
|
def test_LSTM_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
for bias in (True, False):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 20)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20, bias=bias)
|
|
for _ in range(6):
|
|
hx, cx = lstm(input, (hx, cx))
|
|
|
|
(hx + cx).sum().backward()
|
|
|
|
def test_LSTM_cell_forward_input_size(self):
|
|
input = torch.randn(3, 11)
|
|
hx = torch.randn(3, 20)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20)
|
|
self.assertRaises(Exception, lambda: lstm(input, (hx, cx)))
|
|
|
|
def test_LSTM_cell_forward_hidden_size(self):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 21)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20)
|
|
self.assertRaises(Exception, lambda: lstm(input, (hx, cx)))
|
|
self.assertRaises(Exception, lambda: lstm(input, (cx, hx)))
|
|
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_pack_sequence_batch_sizes_throw(self):
|
|
with self.assertRaisesRegex(ValueError, r"batch_sizes should always be on CPU"):
|
|
m = nn.LSTM(3, 4, bidirectional=True, num_layers=2).to('cuda')
|
|
a = torch.rand(5, 3, device='cuda')
|
|
b = torch.tensor([1, 1, 1, 1, 1], device='cuda')
|
|
input = nn.utils.rnn.PackedSequence(a, b)
|
|
|
|
def test_Transformer_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
d_model = 512
|
|
nhead = 16
|
|
num_encoder_layers = 4
|
|
num_decoder_layers = 3
|
|
dim_feedforward = 256
|
|
dropout = 0.3
|
|
bsz = 8
|
|
seq_length = 35
|
|
tgt_length = 15
|
|
for batch_first, src_size, tgt_size in zip((True, False),
|
|
[(bsz, seq_length, d_model),
|
|
(seq_length, bsz, d_model)],
|
|
[(bsz, tgt_length, d_model),
|
|
(tgt_length, bsz, d_model)]):
|
|
transformer = nn.Transformer(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, batch_first=batch_first)
|
|
src = torch.randn(src_size)
|
|
src_mask = transformer.generate_square_subsequent_mask(seq_length).double()
|
|
tgt = torch.randn(tgt_size)
|
|
tgt_mask = transformer.generate_square_subsequent_mask(tgt_length).double()
|
|
memory_mask = torch.randn(tgt_length, seq_length).double()
|
|
src_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5
|
|
tgt_key_padding_mask = torch.rand(bsz, tgt_length) >= 0.5
|
|
memory_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5
|
|
|
|
output = transformer(src, tgt,
|
|
src_mask=src_mask,
|
|
tgt_mask=tgt_mask,
|
|
memory_mask=memory_mask,
|
|
src_key_padding_mask=src_key_padding_mask,
|
|
tgt_key_padding_mask=tgt_key_padding_mask,
|
|
memory_key_padding_mask=memory_key_padding_mask)
|
|
output.sum().backward()
|
|
|
|
def test_transformerencoderlayer(self):
|
|
# this is a deterministic test for TransformerEncoderLayer
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
|
|
for batch_first in (False, True):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
encoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
result = model(encoder_input)
|
|
ref_output = torch.tensor([[[2.258703, 0.127985, -0.697881, 0.170862]]])
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
# 0 values are NOT masked. This shouldn't mask anything.
|
|
mask = torch.tensor([[0]]) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
result = result.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
# 1 values are masked. Since there is only 1 input embedding this
|
|
# will result in nan.
|
|
mask = torch.tensor([[1]]) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
result = result.detach().numpy()
|
|
self.assertTrue(np.isnan(result).all())
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.272644, 0.119035, -0.691669, 0.153486]],
|
|
[[2.272644, 0.119035, -0.691669, 0.153486]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
# all 0 which is no masking
|
|
mask = torch.tensor([[0, 0]]) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
result = result.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
mask = torch.tensor([[1, 0]]) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.301516, 0.092249, -0.679101, 0.103088]],
|
|
[[2.301516, 0.092249, -0.679101, 0.103088]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.428589, 0.020835, -0.602055, -0.085249],
|
|
[2.427987, 0.021213, -0.602496, -0.084103]],
|
|
[[2.424689, 0.019155, -0.604793, -0.085672],
|
|
[2.413863, 0.022211, -0.612486, -0.072490]],
|
|
[[2.433774, 0.021598, -0.598343, -0.087548],
|
|
[2.425104, 0.019748, -0.604515, -0.084839]],
|
|
[[2.436185, 0.022682, -0.596625, -0.087261],
|
|
[2.433556, 0.021891, -0.598509, -0.086832]],
|
|
[[2.416246, 0.017512, -0.610712, -0.082961],
|
|
[2.422901, 0.024187, -0.606178, -0.074929]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
# all 0
|
|
mask = torch.zeros([2, 5]) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
result = result.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
mask[0, 1] = 1
|
|
mask[1, 3] = 1
|
|
mask[1, 4] = 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429026, 0.020793, -0.601741, -0.085642],
|
|
[2.428811, 0.021445, -0.601912, -0.084252]],
|
|
[[2.425009, 0.019155, -0.604566, -0.085899],
|
|
[2.415408, 0.02249 , -0.611415, -0.073]],
|
|
[[2.434199, 0.021682, -0.598039, -0.087699],
|
|
[2.42598, 0.019941, -0.603896, -0.085091]],
|
|
[[2.436457, 0.022736, -0.59643 , -0.08736],
|
|
[2.434021, 0.022093, -0.598179, -0.08679]],
|
|
[[2.416531, 0.017498, -0.610513, -0.083181],
|
|
[2.4242, 0.024653, -0.605266, -0.074959]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
def test_transformerencoderlayer_gelu(self):
|
|
# this is a deterministic test for TransformerEncoderLayer with gelu activation
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
activation = "gelu"
|
|
|
|
for batch_first in (True, False):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout, activation,
|
|
batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
encoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
result = model(encoder_input)
|
|
ref_output = torch.tensor([[[2.249815, 0.131006, -0.702199, 0.177868]]])
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.264103, 0.121417, -0.696012, 0.159724]],
|
|
[[2.264103, 0.121417, -0.696012, 0.159724]]]))
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42163188, 0.03227153, -0.60714219, -0.05908082],
|
|
[2.42151276, 0.03302179, -0.60722523, -0.05762651]],
|
|
[[2.41926761, 0.02974034, -0.60879519, -0.0621269],
|
|
[2.41626395, 0.03539356, -0.61087842, -0.04978623]],
|
|
[[2.42382808, 0.03218872, -0.6055963, -0.06073591],
|
|
[2.41983477, 0.03085259, -0.60840145, -0.06046414]],
|
|
[[2.42500749, 0.03328855, -0.60476388, -0.0595334],
|
|
[2.4237977, 0.03290575, -0.60561789, -0.05940082]],
|
|
[[2.41383916, 0.02686345, -0.61256377, -0.06380707],
|
|
[2.42000277, 0.03800944, -0.60824798, -0.04754947]]]))
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
def test_transformerdecoderlayer(self):
|
|
# this is a deterministic test for TransformerDecoderLayer
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
seq_length = 5
|
|
tgt_length = 3
|
|
|
|
for batch_first in (False, True):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]])
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.314351, 0.094805, -0.671322, 0.101977]]])
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
memory_input = torch.tensor([[[1., 2., 3., 4.]]])
|
|
result = model(decoder_input, memory_input)
|
|
result = result.detach().numpy()
|
|
ref_output = perm_fn(torch.tensor([[[2.422245, 0.051716, -0.606338, -0.024756]],
|
|
[[2.422245, 0.051716, -0.606338, -0.024756]]]))
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.343536, 0.085561, -0.654954, 0.074991]],
|
|
[[2.343536, 0.085561, -0.654954, 0.074991]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]))
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 3) == 1
|
|
result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask[0, 2] = 1
|
|
key_padding_mask[1, 1] = 1
|
|
key_padding_mask[1, 2] = 1
|
|
result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430025, 0.027643, -0.601164, -0.073476],
|
|
[2.4323, 0.029375, -0.599553, -0.071881]],
|
|
[[2.428523, 0.026838, -0.602226, -0.07391],
|
|
[2.432634, 0.029842, -0.599318, -0.071253]],
|
|
[[2.432278, 0.028152, -0.599555, -0.074139],
|
|
[2.432659, 0.029244, -0.599294, -0.072382]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 5) == 1
|
|
result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask[0, 4] = 1
|
|
key_padding_mask[1, 3] = 1
|
|
key_padding_mask[1, 4] = 1
|
|
result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429757, 0.027358, -0.601351, -0.073816],
|
|
[2.432692, 0.028583, -0.599263, -0.073634]],
|
|
[[2.428247, 0.02662, -0.602419, -0.074123],
|
|
[2.432657, 0.029055, -0.599293, -0.072732]],
|
|
[[2.431515, 0.027687, -0.600096, -0.074459],
|
|
[2.433075, 0.028543, -0.598987, -0.073985]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
def test_transformerdecoderlayer_gelu(self):
|
|
# this is a deterministic test for TransformerDecoderLayer with gelu activation
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
seq_length = 5
|
|
tgt_length = 3
|
|
activation = "gelu"
|
|
|
|
for batch_first in (True, False):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout, activation,
|
|
batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]])
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]])
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.415448, 0.054389, -0.610932, -0.0156613]],
|
|
[[2.415448, 0.054389, -0.610932, -0.0156613]]]))
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.338531, 0.087709, -0.65776, 0.080646]],
|
|
[[2.338531, 0.087709, -0.65776, 0.080646]]]))
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]))
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42049104, 0.03443088, -0.60793706, -0.05436271],
|
|
[2.42210631, 0.03546578, -0.60679895, -0.05357488]],
|
|
[[2.41907674, 0.0336104, -0.60892977, -0.05490462],
|
|
[2.42216881, 0.03586554, -0.6067524, -0.05289126]],
|
|
[[2.42205716, 0.03488046, -0.60683681, -0.05460596],
|
|
[2.42240309, 0.0354595, -0.60659063, -0.05378816]]]))
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output)
|
|
|
|
def test_transformerencoder(self):
|
|
def get_a_test_layer(use_cuda, activation, batch_first=False):
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
layer = nn.TransformerEncoderLayer(
|
|
d_model,
|
|
nhead,
|
|
dim_feedforward=dim_feedforward,
|
|
dropout=dropout,
|
|
activation=activation,
|
|
batch_first=batch_first).to(device)
|
|
|
|
with torch.no_grad():
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(layer.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
return layer
|
|
|
|
# this is a deterministic test for TransformerEncoder
|
|
activation = "relu"
|
|
use_cuda = torch.cuda.is_available()
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
for batch_first in (True, False):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
encoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation,
|
|
batch_first=batch_first)
|
|
|
|
model = nn.TransformerEncoder(encoder_layer, 1).to(device)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.428589, 0.020835, -0.602055, -0.085249],
|
|
[2.427987, 0.021213, -0.602496, -0.084103]],
|
|
[[2.424689, 0.019155, -0.604793, -0.085672],
|
|
[2.413863, 0.022211, -0.612486, -0.072490]],
|
|
[[2.433774, 0.021598, -0.598343, -0.087548],
|
|
[2.425104, 0.019748, -0.604515, -0.084839]],
|
|
[[2.436185, 0.022682, -0.596625, -0.087261],
|
|
[2.433556, 0.021891, -0.598509, -0.086832]],
|
|
[[2.416246, 0.017512, -0.610712, -0.082961],
|
|
[2.422901, 0.024187, -0.606178, -0.074929]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# all 0
|
|
mask = torch.zeros([2, 5]).to(device) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
mask[0, 1] = 1
|
|
mask[1, 3] = 1
|
|
mask[1, 4] = 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429026, 0.020793, -0.601741, -0.085642],
|
|
[2.428811, 0.021445, -0.601912, -0.084252]],
|
|
[[2.425009, 0.019155, -0.604566, -0.085899],
|
|
[2.415408, 0.02249, -0.611415, -0.073]],
|
|
[[2.434199, 0.021682, -0.598039, -0.087699],
|
|
[2.42598, 0.019941, -0.603896, -0.085091]],
|
|
[[2.436457, 0.022736, -0.59643, -0.08736],
|
|
[2.434021, 0.022093, -0.598179, -0.08679]],
|
|
[[2.416531, 0.017498, -0.610513, -0.083181],
|
|
[2.4242, 0.024653, -0.605266, -0.074959]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# test case 2, multiple layers no norm
|
|
model = nn.TransformerEncoder(encoder_layer, 2).to(device)
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.419051, 0.017446, -0.608738, -0.085003],
|
|
[2.419102, 0.017452, -0.608703, -0.085026]],
|
|
[[2.419043, 0.017445, -0.608744, -0.084999],
|
|
[2.419052, 0.017446, -0.608738, -0.085004]],
|
|
[[2.419067, 0.017448, -0.608727, -0.085010],
|
|
[2.419098, 0.017452, -0.608706, -0.085024]],
|
|
[[2.419072, 0.017449, -0.608724, -0.085012],
|
|
[2.419119, 0.017455, -0.608691, -0.085034]],
|
|
[[2.419019, 0.017442, -0.608761, -0.084989],
|
|
[2.419075, 0.017449, -0.608722, -0.085014]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
model = nn.TransformerEncoder(encoder_layer, 6).to(device)
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.419101, 0.017453, -0.608703, -0.085025],
|
|
[2.419101, 0.017453, -0.608704, -0.085025]],
|
|
[[2.419101, 0.017453, -0.608703, -0.085025],
|
|
[2.419101, 0.017453, -0.608704, -0.085025]],
|
|
[[2.419101, 0.017453, -0.608703, -0.085025],
|
|
[2.419101, 0.017453, -0.608704, -0.085025]],
|
|
[[2.419101, 0.017453, -0.608703, -0.085025],
|
|
[2.419101, 0.017453, -0.608704, -0.085025]],
|
|
[[2.419101, 0.017453, -0.608703, -0.085025],
|
|
[2.419101, 0.017453, -0.608704, -0.085025]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# test case 3, multiple layers with norm
|
|
# d_model = 4
|
|
norm = nn.LayerNorm(4)
|
|
model = nn.TransformerEncoder(encoder_layer, 2, norm=norm).to(device)
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[1.695949, -0.357635, -0.893077, -0.445238],
|
|
[1.695955, -0.357639, -0.893050, -0.445266]],
|
|
[[1.695948, -0.357634, -0.893082, -0.445233],
|
|
[1.695950, -0.357635, -0.893077, -0.445238]],
|
|
[[1.695951, -0.357636, -0.893069, -0.445246],
|
|
[1.695955, -0.357639, -0.893052, -0.445264]],
|
|
[[1.695952, -0.357636, -0.893066, -0.445249],
|
|
[1.695957, -0.357641, -0.893041, -0.445276]],
|
|
[[1.695946, -0.357632, -0.893095, -0.445220],
|
|
[1.695952, -0.357637, -0.893065, -0.445251]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
model = nn.TransformerEncoder(encoder_layer, 6, norm=norm).to(device)
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[1.695955, -0.357639, -0.893051, -0.445265],
|
|
[1.695955, -0.357639, -0.893051, -0.445265]],
|
|
[[1.695955, -0.357639, -0.893051, -0.445265],
|
|
[1.695955, -0.357639, -0.893051, -0.445265]],
|
|
[[1.695955, -0.357639, -0.893051, -0.445265],
|
|
[1.695955, -0.357639, -0.893051, -0.445265]],
|
|
[[1.695955, -0.357639, -0.893051, -0.445265],
|
|
[1.695955, -0.357639, -0.893051, -0.445265]],
|
|
[[1.695955, -0.357639, -0.893051, -0.445265],
|
|
[1.695955, -0.357639, -0.893051, -0.445265]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
|
|
def test_transformerdecoder(self):
|
|
def get_a_test_layer(use_cuda, activation, batch_first=False):
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
layer = nn.TransformerDecoderLayer(
|
|
d_model,
|
|
nhead,
|
|
dim_feedforward=dim_feedforward,
|
|
dropout=dropout,
|
|
activation=activation,
|
|
batch_first=batch_first).to(device)
|
|
|
|
with torch.no_grad():
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(layer.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
return layer
|
|
|
|
# this is a deterministic test for TransformerDecoder
|
|
for batch_first in (False, True):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
activation = "relu"
|
|
use_cuda = torch.cuda.is_available()
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation,
|
|
batch_first=batch_first)
|
|
|
|
model = nn.TransformerDecoder(decoder_layer, 1).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[2.314351, 0.094805, -0.671322, 0.101977]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.422245, 0.051716, -0.606338, -0.024756]],
|
|
[[2.422245, 0.051716, -0.606338, -0.024756]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.343536, 0.085561, -0.654954, 0.074991]],
|
|
[[2.343536, 0.085561, -0.654954, 0.074991]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 3).to(device) == 1
|
|
result = model(decoder_input, memory_input,
|
|
tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask[0, 2] = 1
|
|
key_padding_mask[1, 1] = 1
|
|
key_padding_mask[1, 2] = 1
|
|
result = model(decoder_input, memory_input,
|
|
tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430025, 0.027643, -0.601164, -0.073476],
|
|
[2.4323, 0.029375, -0.599553, -0.071881]],
|
|
[[2.428523, 0.026838, -0.602226, -0.07391],
|
|
[2.432634, 0.029842, -0.599318, -0.071253]],
|
|
[[2.432278, 0.028152, -0.599555, -0.074139],
|
|
[2.432659, 0.029244, -0.599294, -0.072382]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 5).to(device) == 1
|
|
result = model(decoder_input, memory_input,
|
|
memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask[0, 4] = 1
|
|
key_padding_mask[1, 3] = 1
|
|
key_padding_mask[1, 4] = 1
|
|
result = model(decoder_input,
|
|
memory_input,
|
|
memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429757, 0.027358, -0.601351, -0.073816],
|
|
[2.432692, 0.028583, -0.599263, -0.073634]],
|
|
[[2.428247, 0.02662, -0.602419, -0.074123],
|
|
[2.432657, 0.029055, -0.599293, -0.072732]],
|
|
[[2.431515, 0.027687, -0.600096, -0.074459],
|
|
[2.433075, 0.028543, -0.598987, -0.073985]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# multiple layers no norm
|
|
model = nn.TransformerDecoder(decoder_layer, 2).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[2.31316, 0.0950293, -0.671995, 0.102802]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# multiple layers no norm
|
|
model = nn.TransformerDecoder(decoder_layer, 6).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]],
|
|
[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]],
|
|
[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# multiple layers with norm
|
|
# d_model = 4
|
|
norm = nn.LayerNorm(4)
|
|
model = nn.TransformerDecoder(decoder_layer, 2, norm=norm).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[1.66166, -0.326986, -1.01466, -0.320017]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# multiple layers with norm
|
|
model = nn.TransformerDecoder(decoder_layer, 6, norm=norm).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]],
|
|
[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]],
|
|
[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# gelu activation test cases
|
|
activation = "gelu"
|
|
use_cuda = torch.cuda.is_available()
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation,
|
|
batch_first=batch_first)
|
|
|
|
model = nn.TransformerDecoder(decoder_layer, 1).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.415448, 0.054389, -0.610932, -0.0156613]],
|
|
[[2.415448, 0.054389, -0.610932, -0.0156613]]])).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.338531, 0.087709, -0.65776, 0.080646]],
|
|
[[2.338531, 0.087709, -0.65776, 0.080646]]])).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42049104, 0.03443088, -0.60793706, -0.05436271],
|
|
[2.42210631, 0.03546578, -0.60679895, -0.05357488]],
|
|
[[2.41907674, 0.0336104, -0.60892977, -0.05490462],
|
|
[2.42216881, 0.03586554, -0.6067524, -0.05289126]],
|
|
[[2.42205716, 0.03488046, -0.60683681, -0.05460596],
|
|
[2.42240309, 0.0354595, -0.60659063, -0.05378816]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_allclose(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and TEST_MULTIGPU), 'CUDNN or multi-gpu not available')
|
|
def test_cudnn_rnn_dropout_states_device(self):
|
|
rnn = nn.RNN(10, 20, num_layers=2, dropout=.5)
|
|
device = 1
|
|
input = torch.randn(5, 4, 10).cuda(device)
|
|
rnn.cuda(device)
|
|
hx = torch.randn(2, 4, 20).cuda(device)
|
|
output = rnn(input, hx)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
@skipIfRocm
|
|
def test_cudnn_weight_format(self):
|
|
rnns = [
|
|
nn.LSTM(10, 20, batch_first=True),
|
|
nn.LSTM(10, 20, batch_first=True, proj_size=10),
|
|
nn.GRU(10, 20, batch_first=True),
|
|
nn.RNN(10, 20, batch_first=True)
|
|
]
|
|
first_warn = True
|
|
for rnn in rnns:
|
|
rnn.cuda()
|
|
input = torch.randn(5, 4, 10, requires_grad=True, device="cuda")
|
|
hx = torch.randn(1, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars = [input, hx] + list(rnn.parameters())
|
|
if isinstance(rnn, nn.LSTM):
|
|
# LSTM with projections has different hx size
|
|
if rnn.proj_size > 0:
|
|
hx = torch.randn(1, 5, 10, requires_grad=True, device="cuda")
|
|
all_vars[1] = hx
|
|
cx = torch.randn(1, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars[2:2] = [cx]
|
|
hx = (hx, cx)
|
|
|
|
output = rnn(input, hx)
|
|
output[0].sum().backward()
|
|
grads = [v.grad.data.clone() for v in all_vars]
|
|
for v in all_vars:
|
|
v.grad.data.zero_()
|
|
|
|
# Weights will no longer view onto the same chunk of memory
|
|
weight = all_vars[4]
|
|
weight_data = weight.data.clone()
|
|
with torch.no_grad():
|
|
weight.set_(weight_data)
|
|
|
|
for _ in range(2):
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output_noncontig = rnn(input, hx)
|
|
if first_warn:
|
|
self.assertEqual(len(w), 1)
|
|
self.assertIn('weights are not part of single contiguous chunk of memory', w[0].message.args[0])
|
|
first_warn = False
|
|
warnings.resetwarnings()
|
|
output_noncontig[0].sum().backward()
|
|
grads_noncontig = [v.grad.data.clone() for v in all_vars]
|
|
for v in all_vars:
|
|
v.grad.data.zero_()
|
|
self.assertEqual(output, output_noncontig)
|
|
self.assertEqual(grads_noncontig, grads)
|
|
|
|
# Make sure these still share storage
|
|
weight_data[:] = 4
|
|
self.assertEqual(weight_data, all_vars[4].data)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
def test_cudnn_weight_tying(self):
|
|
rnns = [
|
|
nn.LSTM(10, 20, batch_first=True, bidirectional=True),
|
|
nn.LSTM(10, 20, batch_first=True, bidirectional=True, proj_size=10),
|
|
nn.GRU(10, 20, batch_first=True, bidirectional=True),
|
|
nn.RNN(10, 20, batch_first=True, bidirectional=True)
|
|
]
|
|
for rnn in rnns:
|
|
rnn.bias_ih_l0_reverse = rnn.bias_ih_l0
|
|
rnn.cuda()
|
|
input = torch.randn(5, 4, 10, requires_grad=True, device="cuda")
|
|
hx = torch.randn(2, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars = [input, hx] + list(rnn.parameters())
|
|
opt = torch.optim.SGD(rnn.parameters(), lr=0.1)
|
|
opt.zero_grad()
|
|
if isinstance(rnn, nn.LSTM):
|
|
# LSTM with projections has different hx size
|
|
if rnn.proj_size > 0:
|
|
hx = torch.randn(2, 5, 10, requires_grad=True, device="cuda")
|
|
all_vars[1] = hx
|
|
cx = torch.randn(2, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars[2:2] = [cx]
|
|
hx = (hx, cx)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output = rnn(input, hx)
|
|
output[0].sum().backward()
|
|
|
|
opt.step()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output_cuda = rnn(input, hx)
|
|
rnn.cpu()
|
|
hx = (hx[0].cpu(), hx[1].cpu()) if isinstance(rnn, nn.LSTM) else hx.cpu()
|
|
output_cpu = rnn(input.cpu(), hx)
|
|
self.assertEqual(output_cuda, output_cpu)
|
|
|
|
def test_transformer_args_check(self):
|
|
model_name = 'Transformer'
|
|
d_model = 128
|
|
nhead = 4
|
|
num_encoder_layers = 2
|
|
num_decoder_layers = 3
|
|
dim_feedforward = 65
|
|
dropout = 0.3
|
|
bsz = 3
|
|
seq_len = 35
|
|
tgt_len = 15
|
|
activations = ["relu", "gelu"]
|
|
|
|
wrong_bsz = 7
|
|
wrong_d_model = 63
|
|
wrong_nhead = 5
|
|
wrong_activation = "abc"
|
|
|
|
def test(encoder_input_shape, decoder_input_shape,
|
|
src_mask_len=None, tgt_mask_len=None, memory_mask_size=None,
|
|
src_key_padding_mask_size=None, tgt_key_padding_mask_size=None,
|
|
memory_key_padding_mask_size=None):
|
|
encoder_input = torch.randn(encoder_input_shape)
|
|
decoder_input = torch.randn(decoder_input_shape)
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers,
|
|
num_decoder_layers, dim_feedforward, dropout)
|
|
|
|
if src_mask_len is not None:
|
|
src_mask = model.generate_square_subsequent_mask(src_mask_len)
|
|
else:
|
|
src_mask = None
|
|
|
|
if tgt_mask_len is not None:
|
|
tgt_mask = model.generate_square_subsequent_mask(tgt_mask_len)
|
|
else:
|
|
tgt_mask = None
|
|
|
|
if memory_mask_size is not None:
|
|
memory_task = torch.rand(memory_mask_size)
|
|
else:
|
|
memory_task = None
|
|
|
|
if src_key_padding_mask_size is not None:
|
|
src_key_padding_mask = torch.rand(src_key_padding_mask_size) >= 0.5
|
|
else:
|
|
src_key_padding_mask = None
|
|
|
|
if tgt_key_padding_mask_size is not None:
|
|
tgt_key_padding_mask = torch.rand(tgt_key_padding_mask_size) >= 0.5
|
|
else:
|
|
tgt_key_padding_mask = None
|
|
|
|
if memory_key_padding_mask_size is not None:
|
|
memory_key_padding_mask = torch.rand(memory_key_padding_mask_size) >= 0.5
|
|
else:
|
|
memory_key_padding_mask = None
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
model(encoder_input, decoder_input,
|
|
src_mask=src_mask,
|
|
tgt_mask=tgt_mask,
|
|
memory_mask=memory_task,
|
|
src_key_padding_mask=src_key_padding_mask,
|
|
tgt_key_padding_mask=tgt_key_padding_mask,
|
|
memory_key_padding_mask=memory_key_padding_mask)
|
|
|
|
|
|
correct_encoder_input_shape = (seq_len, bsz, d_model)
|
|
correct_decoder_input_shape = (tgt_len, bsz, d_model)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
# Incorrect encoder_input batch size
|
|
encoder_input_shape = update_shape(correct_encoder_input_shape, 1, wrong_bsz)
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect decoder_input batch size
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = update_shape(correct_decoder_input_shape, 1, wrong_bsz)
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect encoder_input input size
|
|
encoder_input_shape = update_shape(correct_encoder_input_shape, 2, wrong_d_model)
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect decoder_input input size
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = update_shape(correct_decoder_input_shape, 2, wrong_d_model)
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect nhead
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
model = getattr(nn, model_name)(d_model, wrong_nhead, num_encoder_layers,
|
|
num_decoder_layers, dim_feedforward, dropout)
|
|
|
|
# Incorrect src_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_src_mask_size = seq_len + 1
|
|
test(encoder_input_shape, decoder_input_shape, src_mask_len=wrong_src_mask_size)
|
|
|
|
# Incorrect tgt_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_tgt_mask_size = tgt_len + 1
|
|
test(encoder_input_shape, decoder_input_shape, tgt_mask_len=wrong_tgt_mask_size)
|
|
|
|
# Incorrect memory_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_tgt_mask_size = tgt_len + 1
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
memory_mask_size=(wrong_tgt_mask_size, wrong_src_mask_size))
|
|
|
|
# Incorrect src_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
src_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size))
|
|
|
|
# Incorrect tgt_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
tgt_key_padding_mask_size=(wrong_bsz, wrong_tgt_mask_size))
|
|
|
|
# Incorrect memory_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
memory_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size))
|
|
|
|
# Correct activations
|
|
for activation in activations:
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, activation)
|
|
# Incorrect activation
|
|
with self.assertRaises(RuntimeError):
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, wrong_activation)
|
|
|
|
def test_transformer_layer_args_check(self):
|
|
model_names = ['TransformerEncoderLayer', 'TransformerDecoderLayer']
|
|
d_model = 128
|
|
nhead = 4
|
|
dim_feedforward = 65
|
|
dropout = 0.3
|
|
bsz = 3
|
|
seq_len = 35
|
|
tgt_len = 15
|
|
activations = ["relu", "gelu"]
|
|
|
|
wrong_activation = "abc"
|
|
|
|
encoder_input_shape = (seq_len, bsz, d_model)
|
|
decoder_input_shape = (tgt_len, bsz, d_model)
|
|
|
|
encoder_input = torch.randn(encoder_input_shape)
|
|
decoder_input = torch.randn(decoder_input_shape)
|
|
|
|
for model_name in model_names:
|
|
for activation in activations:
|
|
model = getattr(nn, model_name)(d_model, nhead, dim_feedforward,
|
|
dropout, activation)
|
|
# Incorrect activation
|
|
for model_name in model_names:
|
|
with self.assertRaises(RuntimeError):
|
|
model = getattr(nn, model_name)(d_model, nhead, dim_feedforward,
|
|
dropout, wrong_activation)
|
|
|
|
def test_rnn_args_check(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
bad_size = 7 # prime number so that no size can divide it.
|
|
|
|
def test(input_shape, hidden_shape, mode):
|
|
for input, hidden in get_inputs(input_shape, hidden_shape, mode):
|
|
model = getattr(nn, mode)(input_size, hidden_size, num_layers)
|
|
self.assertRaises(RuntimeError, lambda: model(input, hidden))
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
def get_inputs(input_shape, hidden_shape, mode):
|
|
'''returns list( tuple(input, hidden) )
|
|
where input, hidden are inputs to a model'''
|
|
input = torch.randn(input_shape)
|
|
hidden = torch.randn(hidden_shape)
|
|
if mode != 'LSTM':
|
|
return [(input, hidden)]
|
|
if hidden_shape == correct_hidden_shape:
|
|
return [(input, (hidden, hidden))]
|
|
good_hidden = torch.randn(correct_hidden_shape)
|
|
return [
|
|
(input, (hidden, good_hidden)),
|
|
(input, (good_hidden, hidden)),
|
|
]
|
|
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
for mode in rnn_modes:
|
|
# Incorrect input batch size
|
|
input_shape = update_shape(correct_input_shape, 1, bad_size)
|
|
hidden_shape = correct_hidden_shape
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden batch size
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 1, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect input size
|
|
input_shape = update_shape(correct_input_shape, 2, bad_size)
|
|
hidden_shape = correct_hidden_shape
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 2, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden[0]
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 0, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
def test_projections_lstm_args_check(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
proj_size = 2
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
bad_size = 7 # prime number so that no size can divide it.
|
|
|
|
def test(input_shape, hidden_h_shape, hidden_c_shape):
|
|
for input, hidden in get_inputs(input_shape, hidden_h_shape, hidden_c_shape):
|
|
model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size)
|
|
self.assertRaises(RuntimeError, lambda: model(input, hidden))
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size)
|
|
correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
def get_inputs(input_shape, hidden_h_shape, hidden_c_shape):
|
|
'''returns list( tuple(input, hidden) )
|
|
where input, hidden are inputs to a model'''
|
|
input = torch.randn(input_shape)
|
|
hidden_h = torch.randn(hidden_h_shape)
|
|
hidden_c = torch.randn(hidden_c_shape)
|
|
return [(input, (hidden_h, hidden_c))]
|
|
|
|
# Incorrect input batch size
|
|
input_shape = update_shape(correct_input_shape, 1, bad_size)
|
|
test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape)
|
|
|
|
# Incorrect hidden batch size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 1, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 1, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect input size
|
|
input_shape = update_shape(correct_input_shape, 2, bad_size)
|
|
test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape)
|
|
|
|
# Incorrect hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 2, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 2, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect hidden[0]
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect proj size = hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, hidden_size)
|
|
hidden_c_shape = correct_hidden_c_shape
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect proj size != hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size)
|
|
hidden_c_shape = correct_hidden_c_shape
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect cell size != hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = correct_hidden_h_shape
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_rnn_check_device(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
|
|
for mode in rnn_modes:
|
|
model = getattr(nn, mode)(input_size, hidden_size, num_layers)
|
|
input = torch.randn(correct_input_shape)
|
|
hidden = torch.randn(correct_hidden_shape)
|
|
|
|
# input and weights are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and parameter tensors are not at the same device"):
|
|
model(input.to('cuda:0'))
|
|
|
|
# input and hiddens are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"Input and hidden tensors are not at the same device"):
|
|
if mode == 'LSTM':
|
|
model(input, (hidden.to('cuda:0'), hidden.to('cuda:0')))
|
|
else:
|
|
model(input, (hidden.to('cuda:0')))
|
|
|
|
# hidden tensors are not at the same CUDA device
|
|
if mode == 'LSTM':
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and hidden tensors are not at the same device"):
|
|
model(input.to('cuda:0'), (hidden.to('cuda:0'), hidden.to('cuda:1')))
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_projections_lstm_check_device(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
proj_size = 2
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size)
|
|
correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size)
|
|
input = torch.randn(correct_input_shape)
|
|
hidden_h = torch.randn(correct_hidden_h_shape)
|
|
hidden_c = torch.randn(correct_hidden_c_shape)
|
|
|
|
# input and weights are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and parameter tensors are not at the same device"):
|
|
model(input.to('cuda:0'))
|
|
|
|
# input and hiddens are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"Input and hidden tensors are not at the same device"):
|
|
model(input, (hidden_h.to('cuda:0'), hidden_c.to('cuda:0')))
|
|
|
|
# hidden tensors are not at the same CUDA device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and hidden tensors are not at the same device"):
|
|
model(input.to('cuda:0'), (hidden_h.to('cuda:0'), hidden_c.to('cuda:1')))
|
|
|
|
def test_rnn_initial_hidden_state(self):
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
for mode in rnn_modes:
|
|
rnn = getattr(nn, mode)(30, 20, 2)
|
|
input = torch.randn(10, 32, 30)
|
|
hidden = torch.zeros(2, 32, 20)
|
|
|
|
if mode == 'LSTM':
|
|
hidden = (hidden, hidden)
|
|
output1, hidden1 = rnn(input, hidden)
|
|
output2, hidden2 = rnn(input)
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hidden1, hidden2)
|
|
|
|
def test_projections_lstm_initial_hidden_state(self):
|
|
for bidir in [False, True]:
|
|
rnn = nn.LSTM(30, 20, 2, bidirectional=bidir, proj_size=10)
|
|
num_dirs = 2 if bidir else 1
|
|
input = torch.randn(10, 32, 30)
|
|
hidden_h = torch.zeros(2 * num_dirs, 32, 10)
|
|
hidden_c = torch.zeros(2 * num_dirs, 32, 20)
|
|
hidden = (hidden_h, hidden_c)
|
|
output1, hidden1 = rnn(input, hidden)
|
|
output2, hidden2 = rnn(input)
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hidden1, hidden2)
|
|
|
|
def test_projections_errors_on_gru_and_rnn(self):
|
|
error_msg = "proj_size argument is only supported for LSTM, not RNN or GRU"
|
|
for mode in ['RNN', 'GRU']:
|
|
with self.assertRaisesRegex(ValueError, error_msg):
|
|
rnn = getattr(nn, mode)(30, 20, 2, proj_size=10)
|
|
|
|
def _test_RNN_cpu_vs_cudnn(self, dropout, dtype=torch.double):
|
|
|
|
def forward_backward(cuda, rnn, input_val, grad_output, weights_val, hx_val, grad_hy,
|
|
cx_val=None, grad_cy=None):
|
|
is_lstm = isinstance(rnn, nn.LSTM)
|
|
|
|
for x_layer, y_layer in zip(rnn.all_weights, weights_val):
|
|
for x, y in zip(x_layer, y_layer):
|
|
x.data.copy_(y.data)
|
|
|
|
if isinstance(input_val, rnn_utils.PackedSequence):
|
|
input = rnn_utils.PackedSequence(
|
|
input_val.data.data.requires_grad_(True), input_val.batch_sizes)
|
|
input_var = input.data
|
|
else:
|
|
input = input_val.clone().requires_grad_(True)
|
|
input_var = input
|
|
if is_lstm:
|
|
if cx_val is None:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
hx_val.add(1).requires_grad_(True))
|
|
else:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
cx_val.add(1).requires_grad_(True))
|
|
else:
|
|
hx = hx_val.clone().requires_grad_(True)
|
|
|
|
if cuda:
|
|
rnn.cuda()
|
|
input_var.data = input_var.data.cuda()
|
|
if is_lstm:
|
|
hx[0].data = hx[0].data.cuda()
|
|
hx[1].data = hx[1].data.cuda()
|
|
else:
|
|
hx.data = hx.data.cuda()
|
|
grad_hy = grad_hy.cuda()
|
|
if grad_cy is not None:
|
|
grad_cy = grad_cy.cuda()
|
|
grad_output = grad_output.cuda()
|
|
|
|
output, hy = rnn(input, hx)
|
|
|
|
if isinstance(output, rnn_utils.PackedSequence):
|
|
output = output.data
|
|
|
|
if is_lstm:
|
|
if grad_cy is None:
|
|
torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_hy + 1])
|
|
else:
|
|
torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_cy + 1])
|
|
else:
|
|
torch.autograd.backward([output, hy], [grad_output, grad_hy])
|
|
|
|
return {'output': output.data,
|
|
'hy': hy[0].data if is_lstm else hy.data,
|
|
'weights': rnn.all_weights,
|
|
'grad_input': input_var.grad.data,
|
|
'grad_hx': hx[0].grad.data if is_lstm else hx.grad.data,
|
|
'cy': hy[1].data if is_lstm else None,
|
|
'grad_cx': hx[1].grad.data if is_lstm else None}
|
|
|
|
input_size = 10
|
|
hidden_size = 6
|
|
proj_size = 3
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
|
|
def make_noncontig(tensor):
|
|
ndim = tensor.dim()
|
|
return torch.stack([tensor.clone().zero_(), tensor], ndim).select(ndim, 1)
|
|
|
|
def compare_cpu_gpu(outputs_cpu, outputs_gpu):
|
|
self.assertEqual(list(outputs_cpu.keys()), list(outputs_gpu.keys()))
|
|
for key in outputs_cpu.keys():
|
|
if key != 'weights':
|
|
self.assertEqual(outputs_cpu[key], outputs_gpu[key], atol=5e-5, rtol=0, msg=key)
|
|
|
|
# check grad weights separately, as nested dict
|
|
for cpu_layer_weight, gpu_layer_weight in zip(outputs_cpu['weights'], outputs_gpu['weights']):
|
|
for (cpu_weight, gpu_weight) in zip(cpu_layer_weight, gpu_layer_weight):
|
|
self.assertEqual(cpu_weight.grad.data, gpu_weight.grad.data, atol=5e-5, rtol=0)
|
|
|
|
for module in (nn.RNN, nn.LSTM, nn.GRU):
|
|
for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \
|
|
in product((True, False), repeat=6):
|
|
|
|
num_directions = 2 if bidirectional else 1
|
|
if batch_first:
|
|
input_val = torch.randn(batch, seq_length, input_size, dtype=dtype)
|
|
grad_output = torch.randn(batch, seq_length, hidden_size * num_directions, dtype=dtype)
|
|
else:
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, hidden_size * num_directions, dtype=dtype)
|
|
|
|
hx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
if not contig:
|
|
grad_output = make_noncontig(grad_output)
|
|
grad_hy = make_noncontig(grad_hy)
|
|
input_var = make_noncontig(input_val)
|
|
hx_val = make_noncontig(hx_val)
|
|
|
|
if variable_len:
|
|
lengths = [7, 5, 5, 2, 1, 1]
|
|
if lens_as_tensor:
|
|
lengths = torch.tensor(lengths, dtype=torch.long)
|
|
input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first)
|
|
grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data
|
|
|
|
rnn = module(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first).to(dtype)
|
|
|
|
outputs_cpu = forward_backward(
|
|
False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
rnn_gpu = module(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first).to(dtype)
|
|
|
|
outputs_gpu = forward_backward(
|
|
True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
for nonlinearity in ('tanh', 'relu'):
|
|
hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(
|
|
seq_length, batch, hidden_size * num_directions, dtype=dtype)
|
|
grad_hy = torch.randn(
|
|
num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
rnn = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype)
|
|
outputs_cpu = forward_backward(False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
rnn_gpu = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype)
|
|
outputs_gpu = forward_backward(True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
# checking LSTM with projections
|
|
for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \
|
|
in product((True, False), repeat=6):
|
|
num_directions = 2 if bidirectional else 1
|
|
if batch_first:
|
|
input_val = torch.randn(batch, seq_length, input_size, dtype=dtype)
|
|
grad_output = torch.randn(batch, seq_length, proj_size * num_directions, dtype=dtype)
|
|
else:
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, proj_size * num_directions, dtype=dtype)
|
|
|
|
hx_val = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype)
|
|
cx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype)
|
|
grad_cy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
if not contig:
|
|
grad_output = make_noncontig(grad_output)
|
|
grad_hy = make_noncontig(grad_hy)
|
|
grad_cy = make_noncontig(grad_cy)
|
|
input_var = make_noncontig(input_val)
|
|
hx_val = make_noncontig(hx_val)
|
|
cx_val = make_noncontig(cx_val)
|
|
|
|
if variable_len:
|
|
lengths = [7, 5, 5, 2, 1, 1]
|
|
if lens_as_tensor:
|
|
lengths = torch.tensor(lengths, dtype=torch.long)
|
|
input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first)
|
|
grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data
|
|
|
|
rnn = nn.LSTM(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first,
|
|
proj_size=proj_size).to(dtype)
|
|
|
|
outputs_cpu = forward_backward(
|
|
False, rnn, input_val, grad_output, rnn.all_weights,
|
|
hx_val, grad_hy, cx_val, grad_cy)
|
|
|
|
rnn_gpu = nn.LSTM(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first,
|
|
proj_size=proj_size).to(dtype)
|
|
|
|
outputs_gpu = forward_backward(
|
|
True, rnn_gpu, input_val, grad_output, rnn.all_weights,
|
|
hx_val, grad_hy, cx_val, grad_cy)
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_cpu_vs_cudnn_no_dropout(self):
|
|
dtype = torch.double
|
|
self._test_RNN_cpu_vs_cudnn(0, dtype)
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1")
|
|
def test_RNN_cpu_vs_cudnn_with_dropout(self):
|
|
# Because of dropout randomness, can only compare dropout=0 and dropout=1
|
|
self._test_RNN_cpu_vs_cudnn(1)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_cudnn_weight_norm(self):
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
|
|
# runs on CPU to acquire expected output
|
|
def check_weight_norm(m, name):
|
|
input = torch.randn(seq_length, batch, input_size)
|
|
expected_output = m(input)
|
|
|
|
# adds weight normalization
|
|
m = torch.nn.utils.weight_norm(m, name=name)
|
|
|
|
# moves to CUDA
|
|
m = m.cuda()
|
|
input = input.cuda()
|
|
|
|
# otherwise, subsequent warnings will be hidden, and further tests rely on them
|
|
warnings.simplefilter("always")
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
# remove weight norm
|
|
m = torch.nn.utils.remove_weight_norm(m, name=name)
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers), 'weight_hh_l0')
|
|
check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers, proj_size=3), 'weight_hr_l0')
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_partial_flat_weights(self):
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
|
|
m = nn.LSTM(input_size, hidden_size, num_layers)
|
|
inp = torch.randn(3, 2, 10)
|
|
out_expected = m(inp)
|
|
# deletes an attribute of original LSTM
|
|
weight_orig = m.weight_hh_l0
|
|
del m.weight_hh_l0
|
|
self.assertFalse(hasattr(m, "weight_hh_l0"))
|
|
# verifies that moving to CUDA with only some attributes defined
|
|
# does not throw an error
|
|
m.cuda()
|
|
# recompute the weight and make sure that module can be used
|
|
m.weight_hh_l0 = weight_orig.cuda()
|
|
inp = inp.cuda()
|
|
# otherwise, subsequent warnings will be hidden, and further tests rely on them
|
|
warnings.simplefilter("always")
|
|
self.assertEqual(m(inp)[0].cpu(), out_expected[0])
|
|
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1")
|
|
def test_RNN_dropout(self):
|
|
# checking the assumption that cuDNN sticks dropout in between
|
|
# RNN layers
|
|
for p in (0, 0.276, 0.731, 1):
|
|
for train in (True, False):
|
|
for cuda in (True, False):
|
|
rnn = nn.RNN(10, 1000, 2, bias=False, dropout=p, nonlinearity='relu')
|
|
if cuda:
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
rnn.weight_ih_l0.data.fill_(1)
|
|
rnn.weight_hh_l0.data.fill_(1)
|
|
rnn.weight_ih_l1.data.fill_(1)
|
|
rnn.weight_hh_l1.data.fill_(1)
|
|
input = torch.ones(1, 1, 10)
|
|
hx = torch.zeros(2, 1, 1000)
|
|
if cuda:
|
|
input = input.cuda()
|
|
hx = hx.cuda()
|
|
|
|
output, hy = rnn(input, hx)
|
|
self.assertEqual(output.data.min(), output.data.max())
|
|
output_val = output.data[0][0][0]
|
|
if p == 0 or not train:
|
|
self.assertEqual(output_val, 10000)
|
|
elif p == 1:
|
|
self.assertEqual(output_val, 0)
|
|
else:
|
|
self.assertGreater(output_val, 8000)
|
|
self.assertLess(output_val, 12000)
|
|
denorm_mod = (output_val * (1 - p)) % 10
|
|
self.assertLess(min(denorm_mod, 10 - denorm_mod), 1e-2)
|
|
|
|
self.assertEqual(hy[0].data.min(), hy[0].data.max())
|
|
self.assertEqual(hy[1].data.min(), hy[1].data.max())
|
|
self.assertEqual(hy.data[0][0][0], 10)
|
|
self.assertEqual(hy.data[1][0][0], output_val)
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1")
|
|
def test_RNN_dropout_state(self):
|
|
for p in (0, 0.1234):
|
|
for train in (True, False):
|
|
for cuda in (True, False):
|
|
rnn = nn.RNN(100, 100, 2, bias=False, dropout=p, nonlinearity='relu')
|
|
if cuda:
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
input = torch.rand(1, 1, 100)
|
|
hx = torch.rand(2, 1, 100)
|
|
if cuda:
|
|
input = input.cuda()
|
|
hx = hx.cuda()
|
|
|
|
output1, hy1 = rnn(input, hx)
|
|
output2, hy2 = rnn(input, hx)
|
|
|
|
buf = io.BytesIO()
|
|
rnn_pickle = torch.save(rnn, buf)
|
|
buf.seek(0)
|
|
rnn2 = torch.load(buf)
|
|
rnn2.flatten_parameters()
|
|
output3, hy3 = rnn2(input, hx)
|
|
|
|
if p == 0 or not train:
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(output1, output3)
|
|
self.assertEqual(hy1, hy2)
|
|
self.assertEqual(hy1, hy3)
|
|
else:
|
|
self.assertNotEqual(output1, output2)
|
|
self.assertNotEqual(output1, output3)
|
|
self.assertNotEqual(hy1, hy2)
|
|
self.assertNotEqual(hy1, hy3)
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and (TEST_CUDNN_VERSION if TEST_CUDNN_VERSION else 0) >= 5103), "needs cudnn >= 5.1")
|
|
def test_RNN_change_dropout(self):
|
|
for train, cuda in product((True, False), repeat=2):
|
|
rnn = nn.RNN(100, 100, 2, dropout=0, nonlinearity='relu')
|
|
input = torch.rand(3, 2, 100)
|
|
if cuda:
|
|
input.data = input.data.cuda()
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
|
|
prev_output = None
|
|
for p in (0, 0.5, 0, 0.7, 0.2, 1, 0.2, 0):
|
|
rnn.dropout = p
|
|
output1, hy1 = rnn(input)
|
|
output2, hy2 = rnn(input)
|
|
|
|
if p == 0 or p == 1 or not train:
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hy1, hy2)
|
|
else:
|
|
self.assertNotEqual(output1, output2)
|
|
self.assertNotEqual(hy1, hy2)
|
|
|
|
if prev_output is not None:
|
|
if not train:
|
|
self.assertEqual(output1.data, prev_output)
|
|
self.assertEqual(output2.data, prev_output)
|
|
else:
|
|
self.assertNotEqual(output1.data, prev_output)
|
|
self.assertNotEqual(output2.data, prev_output)
|
|
prev_output = output1.data
|
|
|
|
def test_inplace_thnn(self):
|
|
modules = [nn.ReLU, nn.ELU, nn.SELU, nn.CELU, nn.RReLU]
|
|
for mod in modules:
|
|
r = mod(inplace=True)
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
output = r(input + 0)
|
|
grad_output = torch.randn(5, 5)
|
|
grad_output_clone = grad_output.clone()
|
|
output.backward(grad_output)
|
|
self.assertEqual(grad_output, grad_output_clone)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@repeat_test_for_types(get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM))
|
|
def test_noncontig_conv_grad_cuda(self, dtype=torch.float):
|
|
# FIXME: remove after adding non-contiguous grad tests for all modules
|
|
module = nn.Conv2d(3, 5, kernel_size=3, padding=1).to("cuda", dtype)
|
|
input = torch.randn(2, 3, 10, 10, dtype=dtype, device="cuda", requires_grad=True)
|
|
output = module(input)
|
|
|
|
grad = torch.randn(2, 2, 5, 10, 10, dtype=dtype, device="cuda")[:, 1]
|
|
assert not grad.is_contiguous()
|
|
output.backward(grad, retain_graph=True)
|
|
self.assertIsNotNone(input.grad)
|
|
result = input.grad.data.clone()
|
|
input.grad.data.zero_()
|
|
|
|
output.backward(grad.contiguous())
|
|
self.assertEqual(result, input.grad.data, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
def test_pixel_shuffle_unshuffle(self):
|
|
def _test_pixel_shuffle_unshuffle_helper(num_input_dims, valid_channels_dim=True,
|
|
upscale_factor=None):
|
|
# Function to imperatively ensure pixels are shuffled to the correct locations.
|
|
# Used to validate the batch operations in pixel_shuffle.
|
|
def _verify_pixel_shuffle(input, output, upscale_factor):
|
|
for c in range(output.size(-3)):
|
|
for h in range(output.size(-2)):
|
|
for w in range(output.size(-1)):
|
|
height_idx = h // upscale_factor
|
|
weight_idx = w // upscale_factor
|
|
channel_idx = (upscale_factor * (h % upscale_factor)) + (w % upscale_factor) + \
|
|
(c * upscale_factor ** 2)
|
|
self.assertEqual(output[..., c, h, w], input[..., channel_idx, height_idx, weight_idx])
|
|
|
|
upscale_factor = random.randint(2, 5) if upscale_factor is None else upscale_factor
|
|
# If valid_channels_dim=False, add 1 to make channels dim indivisible by upscale_factor ** 2.
|
|
channels = random.randint(1, 4) * upscale_factor ** 2 + (0 if valid_channels_dim else 1)
|
|
height = random.randint(5, 10)
|
|
width = random.randint(5, 10)
|
|
|
|
if num_input_dims == 1:
|
|
input = torch.rand(channels, requires_grad=True)
|
|
elif num_input_dims == 2:
|
|
input = torch.rand(height, width, requires_grad=True)
|
|
else:
|
|
batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)]
|
|
input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True)
|
|
ps = nn.PixelShuffle(upscale_factor)
|
|
pus = nn.PixelUnshuffle(downscale_factor=upscale_factor)
|
|
|
|
if num_input_dims >= 3 and valid_channels_dim and upscale_factor > 0:
|
|
output = ps(input)
|
|
_verify_pixel_shuffle(input, output, upscale_factor)
|
|
output.backward(output.data)
|
|
self.assertEqual(input.data, input.grad.data)
|
|
|
|
# Ensure unshuffle properly inverts shuffle.
|
|
unshuffle_output = pus(output)
|
|
self.assertEqual(input, unshuffle_output)
|
|
else:
|
|
self.assertRaises(RuntimeError, lambda: ps(input))
|
|
|
|
def _test_pixel_unshuffle_error_case_helper(num_input_dims, valid_height_dim=True, valid_width_dim=True,
|
|
downscale_factor=None):
|
|
downscale_factor = random.randint(2, 5) if downscale_factor is None else downscale_factor
|
|
channels = random.randint(1, 4)
|
|
# If valid_height_dim=False, add 1 to make height dim indivisible by downscale_factor.
|
|
height = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_height_dim else 1)
|
|
# If valid_width_dim=False, add 1 to make width dim indivisible by downscale_factor.
|
|
width = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_width_dim else 1)
|
|
|
|
if num_input_dims == 1:
|
|
input = torch.rand(channels, requires_grad=True)
|
|
elif num_input_dims == 2:
|
|
input = torch.rand(height, width, requires_grad=True)
|
|
else:
|
|
batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)]
|
|
input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True)
|
|
|
|
pus = nn.PixelUnshuffle(downscale_factor)
|
|
self.assertRaises(RuntimeError, lambda: pus(input))
|
|
|
|
def _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims):
|
|
# For 1D - 2D, this is an error case.
|
|
# For 3D - 5D, this is a success case for pixel_shuffle + pixel_unshuffle.
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims)
|
|
|
|
# Error cases for pixel_shuffle.
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, valid_channels_dim=False)
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=0)
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=-2)
|
|
|
|
# Error cases for pixel_unshuffle.
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_height_dim=False)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_width_dim=False)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=0)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=-2)
|
|
|
|
def test_pixel_shuffle_unshuffle_1D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=1)
|
|
|
|
def test_pixel_shuffle_unshuffle_2D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=2)
|
|
|
|
def test_pixel_shuffle_unshuffle_3D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=3)
|
|
|
|
def test_pixel_shuffle_unshuffle_4D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=4)
|
|
|
|
def test_pixel_shuffle_unshuffle_5D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=5)
|
|
|
|
test_pixel_shuffle_unshuffle_1D()
|
|
test_pixel_shuffle_unshuffle_2D()
|
|
test_pixel_shuffle_unshuffle_3D()
|
|
test_pixel_shuffle_unshuffle_4D()
|
|
test_pixel_shuffle_unshuffle_5D()
|
|
|
|
def test_elu_inplace_view(self):
|
|
v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
view = x.narrow(0, 1, 2)
|
|
res = F.elu(view, inplace=True)
|
|
self.assertIs(res, view)
|
|
return x
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
def test_relu_inplace_view(self):
|
|
v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
view = x.narrow(0, 1, 2)
|
|
res = F.relu(view, inplace=True)
|
|
self.assertIs(res, view)
|
|
return x
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_PReLU_backward_requires_grad_false(self):
|
|
m = nn.PReLU().to('cuda')
|
|
x = torch.randn(2, 3, 4, 5, requires_grad=False, device='cuda')
|
|
y = m(x)
|
|
y.mean().backward()
|
|
self.assertEqual(x.grad, None)
|
|
|
|
@unittest.skipIf(
|
|
not TEST_NUMPY or not TEST_SCIPY, "Numpy or Scipy not found")
|
|
def test_gelu(self):
|
|
def _test_gelu(n, m, dtype, contiguous, atol=None, rtol=None):
|
|
numpy_dtype = {
|
|
torch.bfloat16: torch.float, torch.float: torch.float, torch.double: torch.double
|
|
}[dtype]
|
|
devices = ['cpu'] if dtype != torch.bfloat16 else [] + \
|
|
['cuda'] if TEST_CUDA else []
|
|
|
|
def _gelu_ref(X):
|
|
return X * stats.norm.cdf(X)
|
|
|
|
for d in devices:
|
|
if contiguous:
|
|
X = torch.rand(n, m, dtype=dtype, requires_grad=True, device=d)
|
|
else:
|
|
X = torch.rand(n, m, dtype=dtype, requires_grad=True, device=d)[:, ::2]
|
|
res = F.gelu(X)
|
|
ref = _gelu_ref(X.to(numpy_dtype).cpu().detach().numpy())
|
|
self.assertEqual(res, ref, rtol=rtol, atol=atol)
|
|
if dtype == torch.float64:
|
|
gradcheck(F.gelu, [X], eps=1e-4)
|
|
|
|
for n in range(1, 10):
|
|
for m in range(1, 10):
|
|
_test_gelu(n, m, torch.bfloat16, True, 1e-2, 0)
|
|
_test_gelu(n, m, torch.bfloat16, False, 1e-2, 0)
|
|
_test_gelu(n, m, torch.float32, True)
|
|
_test_gelu(n, m, torch.float32, False)
|
|
_test_gelu(n, m, torch.float64, True)
|
|
_test_gelu(n, m, torch.float64, False)
|
|
|
|
|
|
def test_bce_loss_always_nonnegative(self):
|
|
target = torch.ones(5)
|
|
input = torch.ones(5)
|
|
self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0)
|
|
|
|
target = torch.zeros(5)
|
|
input = torch.zeros(5)
|
|
self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0)
|
|
|
|
def test_bce_with_logits_raises_if_target_and_input_are_different_size(self):
|
|
target = torch.rand(5)
|
|
input = torch.rand(5, 1)
|
|
with self.assertRaises(ValueError):
|
|
nn.BCEWithLogitsLoss()(input, target)
|
|
|
|
target = torch.rand(5, 1)
|
|
input = torch.rand(5)
|
|
with self.assertRaises(ValueError):
|
|
nn.BCEWithLogitsLoss()(input, target)
|
|
|
|
def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss(self):
|
|
sigmoid = nn.Sigmoid()
|
|
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target))
|
|
|
|
weight = torch.rand(4)
|
|
self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target))
|
|
|
|
target = torch.zeros(4, 1, dtype=torch.float)
|
|
output = torch.empty(4, 1, dtype=torch.float).fill_(-100)
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target))
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss(reduction='none')(output, target),
|
|
nn.BCELoss(reduction='none')(sigmoid(output), target))
|
|
|
|
weight = torch.rand(1, dtype=torch.float)
|
|
self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target))
|
|
|
|
def test_bce_loss_input_range(self):
|
|
bceloss = nn.BCELoss()
|
|
|
|
target = torch.rand(25, 25)
|
|
output_valid = torch.rand(25, 25)
|
|
output_too_negative = output_valid - 1.0
|
|
output_too_positive = output_valid + 1.0
|
|
|
|
loss_valid = bceloss(output_valid, target)
|
|
with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'):
|
|
loss_too_negative = bceloss(output_too_negative, target)
|
|
with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'):
|
|
loss_too_positive = bceloss(output_too_positive, target)
|
|
|
|
def test_bce_loss_size_mismatch(self):
|
|
bceloss = nn.BCELoss()
|
|
a = torch.rand(25)
|
|
b = torch.rand(25, 1)
|
|
with self.assertRaisesRegex(ValueError, r'Using a target size \('):
|
|
bceloss(a, b)
|
|
|
|
def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss_large_tensors_with_grad(self):
|
|
x_size = 1024
|
|
y_size = 256
|
|
target = torch.rand(x_size, y_size)
|
|
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
output_sig = torch.rand(x_size, y_size) - 0.5
|
|
output_logits = output_sig.clone().detach()
|
|
|
|
output_sig.requires_grad = True
|
|
output_logits.requires_grad = True
|
|
weight = torch.rand(y_size)
|
|
|
|
loss_sig = nn.BCELoss(weight, reduction=reduction)(
|
|
torch.sigmoid(output_sig), target
|
|
)
|
|
loss_logits = nn.BCEWithLogitsLoss(weight, reduction=reduction)(
|
|
output_logits, target
|
|
)
|
|
|
|
self.assertEqual(loss_logits, loss_sig)
|
|
|
|
if reduction == 'none':
|
|
grad = torch.rand(x_size, y_size)
|
|
loss_sig.backward(grad)
|
|
loss_logits.backward(grad)
|
|
else:
|
|
loss_sig.backward()
|
|
loss_logits.backward()
|
|
|
|
self.assertEqual(output_sig.grad, output_logits.grad)
|
|
|
|
def test_bce_with_logits_has_correct_grad_at_zero(self):
|
|
output = torch.zeros(3, 1, requires_grad=True)
|
|
target = torch.zeros(3, 1)
|
|
nn.BCEWithLogitsLoss(reduction='sum')(output, target).backward()
|
|
expected_grad = torch.empty(3, 1).fill_(0.5)
|
|
self.assertEqual(output.grad, expected_grad)
|
|
|
|
def test_bce_with_logits_broadcasts_weights(self):
|
|
target = torch.rand(16, 4)
|
|
output = torch.rand(16, 4) - 0.5
|
|
|
|
weight = torch.rand(4)
|
|
out1 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
weight = torch.rand(16, 1)
|
|
out1 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
def test_bce_with_logits_ones_in_pos_weights_are_the_same_as_none(self):
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
pos_weight = torch.ones(64, 4)
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target),
|
|
nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target))
|
|
|
|
def test_bce_with_logits_broadcasts_pos_weights(self):
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
pos_weight = torch.rand(4)
|
|
out1 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target)
|
|
|
|
pos_weight1 = pos_weight.expand(1, 4)
|
|
out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight1)(output, target)
|
|
|
|
pos_weight2 = pos_weight.expand(64, 4)
|
|
out3 = nn.BCEWithLogitsLoss(pos_weight=pos_weight2)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
self.assertEqual(out1, out3)
|
|
|
|
def test_bce_with_logits_with_pos_weight_has_correct_grad_at_zero(self):
|
|
output = torch.zeros(3, 1, requires_grad=True)
|
|
target = torch.zeros(3, 1)
|
|
pos_weight = torch.ones(3, 1)
|
|
nn.BCEWithLogitsLoss(pos_weight=pos_weight, reduction='sum')(output, target).backward()
|
|
expected_grad = torch.empty(3, 1).fill_(0.5)
|
|
grad = output.grad
|
|
self.assertEqual(grad, expected_grad)
|
|
|
|
def test_bce_with_logits_stability(self):
|
|
output = torch.tensor([0., -120.])
|
|
target = torch.tensor([0., 1.])
|
|
pos_weight = torch.tensor([1., 1.])
|
|
|
|
out1 = nn.BCEWithLogitsLoss()(output, target)
|
|
self.assertTrue(torch.isfinite(out1).all().item())
|
|
|
|
out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target)
|
|
self.assertTrue(torch.isfinite(out2).all().item())
|
|
|
|
def test_bce_loss_broadcasts_weights(self):
|
|
sigmoid = nn.Sigmoid()
|
|
target = torch.rand(16, 4)
|
|
output = torch.rand(16, 4) - 0.5
|
|
|
|
weight = torch.rand(4)
|
|
out1 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
weight = torch.rand(16, 1)
|
|
out1 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
def test_elu_inplace_gradgrad(self):
|
|
v = torch.randn(8, requires_grad=True)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
return F.elu(x, inplace=True)
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
def test_hardtanh_inplace_gradgrad(self):
|
|
v = torch.randn(8, requires_grad=True)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
return F.hardtanh(x, inplace=True)
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
# test hardtanh backward froo large tensor
|
|
def test_hardtanh_backward(self):
|
|
x = torch.randn(128, 10000, requires_grad=True)
|
|
grad = torch.randn(128, 10000)
|
|
z = torch.zeros(128, 10000)
|
|
y = F.hardtanh(x)
|
|
y.backward(grad)
|
|
# ref backward path for hardtanh
|
|
mask = (x > -1) & (x < 1)
|
|
x_grad_ref = torch.where(mask, grad, z)
|
|
self.assertEqual(x.grad, x_grad_ref)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
@skipIfRocm
|
|
def test_batchnorm_cudnn_nhwc(self):
|
|
def run_test(input, grad_output):
|
|
c = input.size(1)
|
|
mod = nn.BatchNorm2d(c).cuda().float()
|
|
mod.weight.data.uniform_()
|
|
mod.bias.data.uniform_()
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_mod = nn.BatchNorm2d(c).cuda().float()
|
|
ref_mod.load_state_dict(mod.state_dict())
|
|
out = mod(input)
|
|
out.backward(grad_output)
|
|
ref_out = ref_mod(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(mod.weight.grad, ref_mod.weight.grad)
|
|
self.assertEqual(mod.bias.grad, ref_mod.bias.grad)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
input = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_()
|
|
|
|
grad = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda")
|
|
grad = grad.contiguous(memory_format=torch.channels_last)
|
|
run_test(input, grad)
|
|
# see #42588, grad is channels_last contiguous, but grad.suggest_memory_format (rightly) return "contiguous"
|
|
# not channels_last
|
|
input = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_()
|
|
grad = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda")
|
|
grad = grad.permute(0, 2, 1, 3)
|
|
run_test(input, grad)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_batchnorm_cudnn_half(self):
|
|
# THNN
|
|
input = torch.randint(1, 10, (2, 3, 2, 2), dtype=torch.half, device="cuda", requires_grad=True)
|
|
m = nn.BatchNorm2d(3).half().cuda()
|
|
thnn_output = m(input)
|
|
thnn_output.sum().backward()
|
|
thnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(thnn_output, input)
|
|
# cuDNN
|
|
if TEST_CUDNN:
|
|
input.grad = None
|
|
m = m.float()
|
|
cudnn_output = m(input)
|
|
cudnn_output.sum().backward()
|
|
cudnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(cudnn_output, input)
|
|
self.assertEqual(cudnn_output, thnn_output)
|
|
self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_batchnorm_nonaffine_cuda_half_input(self):
|
|
input = torch.randn(16, 3, 24, 24, dtype=torch.half, device="cuda")
|
|
m = nn.BatchNorm2d(3, affine=False).cuda().float() # keep running stats in FP32
|
|
output = m(input)
|
|
self.assertEqualTypeString(output, input)
|
|
m.eval()
|
|
output = m(input)
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@repeat_test_for_types([torch.float, torch.half])
|
|
def test_batchnorm_large_batch(self, dtype=torch.float):
|
|
bn = nn.BatchNorm2d(1).to('cuda', dtype)
|
|
data = torch.rand(880801, 1, 1, 1, device="cuda", dtype=dtype)
|
|
out = bn(data).sum().backward()
|
|
|
|
def test_batchnorm_raises_error_if_less_than_one_value_per_channel(self):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.BatchNorm1d(10)(x)
|
|
|
|
def test_batchnorm_raises_error_if_running_mean_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, torch.rand(size), running_var)
|
|
|
|
def test_batchnorm_raises_error_if_running_var_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, torch.rand(size))
|
|
|
|
def test_batchnorm_raises_error_if_weight_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, running_var, weight=Parameter(torch.rand(size)))
|
|
|
|
def test_batchnorm_raises_error_if_bias_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, running_var, bias=Parameter(torch.rand(size)))
|
|
|
|
def test_batchnorm_buffer_update_when_stats_are_not_tracked(self):
|
|
input_size = (32, 4)
|
|
# Instantiate BN with buffers that are not None
|
|
bn = nn.BatchNorm1d(input_size[1], track_running_stats=True)
|
|
# Use buffers for normalization but don't update them
|
|
bn.track_running_stats = False
|
|
# Store initial values
|
|
num_batches = bn.num_batches_tracked.clone()
|
|
running_mean = bn.running_mean.clone()
|
|
running_var = bn.running_var.clone()
|
|
# Forward random tensor
|
|
_ = bn(torch.rand(input_size))
|
|
# Ensure none of the buffers has been updated
|
|
self.assertTrue(torch.equal(num_batches, bn.num_batches_tracked))
|
|
self.assertTrue(torch.equal(running_mean, bn.running_mean))
|
|
self.assertTrue(torch.equal(running_var, bn.running_var))
|
|
|
|
def test_pairwise_distance(self):
|
|
input1 = torch.randn(4, 4, requires_grad=True)
|
|
input2 = torch.randn(4, 4, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x, y: F.pairwise_distance(x, y), (input1, input2)))
|
|
|
|
def test_pdist(self):
|
|
for device, trans in itertools.product(device_(), [False, True]):
|
|
inp = torch.randn(4, 5, dtype=torch.double, device=device, requires_grad=True)
|
|
if trans:
|
|
inp = inp.transpose(0, 1)
|
|
for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]:
|
|
self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,)))
|
|
|
|
def test_pdist_zeros(self):
|
|
"""Test that grad is still valid when dist is 0"""
|
|
for device in device_():
|
|
inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True).repeat([2, 1])
|
|
for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]:
|
|
self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,)))
|
|
|
|
def test_pdist_empty_row(self):
|
|
for device in device_():
|
|
inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True)
|
|
self.assertTrue(gradcheck(F.pdist, (inp,)))
|
|
|
|
def test_pdist_empty_col(self):
|
|
for device in device_():
|
|
inp = torch.randn(4, 0, dtype=torch.double, device=device, requires_grad=True)
|
|
self.assertTrue(gradcheck(F.pdist, (inp,)))
|
|
|
|
@unittest.expectedFailure
|
|
def test_pdist_cpu_gradgrad_unimplemented(self):
|
|
inp = torch.randn(4, 5, requires_grad=True)
|
|
gradgradcheck(F.pdist, (inp,))
|
|
|
|
@unittest.expectedFailure
|
|
def test_pdist_cuda_gradgrad_unimplemented(self):
|
|
inp = torch.randn(4, 5, device='cuda', requires_grad=True)
|
|
gradgradcheck(F.pdist, (inp,))
|
|
|
|
def test_cosine_embedding_loss_with_diff_type(self):
|
|
for device in device_():
|
|
input1 = torch.tensor([[2, 3, 4], [6, 2, 4]], dtype=torch.double, device=device)
|
|
input2 = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([1, -1], dtype=torch.int, device=device)
|
|
expected = torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
for dt1 in torch.testing.get_all_math_dtypes(device):
|
|
for dt2 in torch.testing.get_all_math_dtypes(device):
|
|
for dt3 in torch.testing.get_all_math_dtypes(device):
|
|
# dt3 is used as dtype for target = [1, -1], so let's skip unsigned type
|
|
if dt3 == torch.uint8:
|
|
continue
|
|
if dt1.is_complex or dt2.is_complex or dt3.is_complex:
|
|
continue
|
|
input1 = input1.to(dt1)
|
|
input2 = input2.to(dt2)
|
|
target = target.to(dt3)
|
|
result = torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_kl_div_with_diff_type(self):
|
|
for device in device_():
|
|
input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device)
|
|
expected = torch.nn.functional.kl_div(input, target)
|
|
for input_dtype in torch.testing.get_all_math_dtypes(device):
|
|
if input_dtype.is_complex:
|
|
continue
|
|
for target_dtype in [torch.float32, torch.float64, torch.float16]:
|
|
if (torch.device(device).type == 'cpu' and target_dtype == torch.float16):
|
|
continue
|
|
input = input.to(input_dtype)
|
|
target = target.to(target_dtype)
|
|
result = torch.nn.functional.kl_div(input, target)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_kl_div_with_diff_type_log_target(self):
|
|
for device in device_():
|
|
input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device).log()
|
|
expected = torch.nn.functional.kl_div(input, target, log_target=True)
|
|
for input_dtype in torch.testing.get_all_math_dtypes(device):
|
|
if input_dtype.is_complex:
|
|
continue
|
|
for target_dtype in [torch.float32, torch.float64, torch.float16]:
|
|
if (torch.device(device).type == 'cpu' and target_dtype == torch.float16):
|
|
continue
|
|
input = input.to(input_dtype)
|
|
target = target.to(target_dtype)
|
|
result = torch.nn.functional.kl_div(input, target, log_target=True)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_kl_div_log_softmax_target(self):
|
|
for device in device_():
|
|
a = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device)
|
|
b = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device)
|
|
self.assertEqual(
|
|
F.kl_div(F.log_softmax(a, 1), F.log_softmax(b, 1), reduction='none', log_target=True),
|
|
torch.zeros_like(a)
|
|
)
|
|
|
|
def test_cosine_embedding_loss_no_reduce(self):
|
|
input1 = torch.randn(15, 10, requires_grad=True)
|
|
input2 = torch.randn(15, 10, requires_grad=True)
|
|
target = torch.randn(15).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss(
|
|
x, y, z, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.cosine_embedding_loss(input1, input2, target, reduction='none'),
|
|
loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target, reduction='none'))
|
|
|
|
def test_cosine_embedding_loss_margin_no_reduce(self):
|
|
input1 = torch.randn(15, 10, requires_grad=True)
|
|
input2 = torch.randn(15, 10, requires_grad=True)
|
|
target = torch.randn(15).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss(
|
|
x, y, z, margin=0.5, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.cosine_embedding_loss(input1, input2, target, margin=0.5, reduction='none'),
|
|
loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target,
|
|
margin=0.5, reduction='none'))
|
|
|
|
def test_cosine_embedding_loss_invalid_target_shape(self):
|
|
input1 = torch.randn(15, 10)
|
|
input2 = torch.randn(15, 10)
|
|
target = torch.randn(15, 1).sign()
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "1D target tensor expected"):
|
|
F.cosine_embedding_loss(input1, input2, target)
|
|
|
|
def test_margin_ranking_loss_no_reduce(self):
|
|
input1 = torch.randn(15).mul_(10).requires_grad_()
|
|
input2 = torch.randn(15).mul_(10).requires_grad_()
|
|
target = torch.randn(15).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss(
|
|
x, y, z, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.margin_ranking_loss(input1, input2, target, reduction='none'),
|
|
loss_reference_fns['MarginRankingLoss'](input1, input2, target, reduction='none'))
|
|
|
|
def test_margin_ranking_loss_margin_no_reduce(self):
|
|
input1 = torch.randn(15).mul_(10).requires_grad_()
|
|
input2 = torch.randn(15).mul_(10).requires_grad_()
|
|
target = torch.randn(15).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss(
|
|
x, y, z, margin=0.5, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.margin_ranking_loss(input1, input2, target, margin=0.5, reduction='none'),
|
|
loss_reference_fns['MarginRankingLoss'](input1, input2, target, margin=0.5, reduction='none'))
|
|
|
|
def test_triplet_margin_loss(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True)
|
|
input2 = torch.randn(5, 10, requires_grad=True)
|
|
input3 = torch.randn(5, 10, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3))
|
|
|
|
def test_triplet_margin_loss_swap(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True)
|
|
input2 = torch.randn(5, 10, requires_grad=True)
|
|
input3 = torch.randn(5, 10, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, swap=True), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True))
|
|
|
|
def test_triplet_margin_loss_no_reduce(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True)
|
|
input2 = torch.randn(5, 10, requires_grad=True)
|
|
input3 = torch.randn(5, 10, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, reduction='none'), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, reduction='none'),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, reduction='none'))
|
|
|
|
def test_triplet_margin_loss_swap_no_reduce(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True)
|
|
input2 = torch.randn(5, 10, requires_grad=True)
|
|
input3 = torch.randn(5, 10, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, swap=True, reduction='none'), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True, reduction='none'),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True, reduction='none'))
|
|
|
|
def test_pointwise_loss_target_grad_none_reduction(self):
|
|
i = torch.randn(5, 10)
|
|
t = torch.randn(5, 10, requires_grad=True)
|
|
self.assertEqual(F.mse_loss(i, t, reduction='none').size(), t.size())
|
|
self.assertEqual(F.l1_loss(i, t, reduction='none').size(), t.size())
|
|
|
|
def test_pointwise_loss_broadcast(self):
|
|
losses = {
|
|
'mse_loss': lambda x, y, r: F.mse_loss(x, y, reduction=r),
|
|
'l1_loss': lambda x, y, r: F.l1_loss(x, y, reduction=r),
|
|
'smooth_l1_loss': lambda x, y, r: F.smooth_l1_loss(x, y, reduction=r),
|
|
'huber_loss': lambda x, y, r: F.huber_loss(x, y, reduction=r),
|
|
}
|
|
|
|
input = torch.randn(2, 1, requires_grad=True)
|
|
for _name, fn in losses.items():
|
|
for requires_grad in [True, False]:
|
|
# When target.requires_grad=True, its impl is in Python, while the other is in TH.
|
|
target = torch.randn(2, 10, requires_grad=requires_grad)
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
l = fn(input, target, reduction)
|
|
if reduction == 'none':
|
|
self.assertEqual(l.size(), target.size())
|
|
self.assertTrue(gradcheck(fn, (input, target, reduction)))
|
|
|
|
# https://github.com/pytorch/pytorch/issues/27692 reports
|
|
# that l1_loss get a wrong result for big batch size
|
|
def test_l1_loss_correct(self):
|
|
for dtype in [torch.float, torch.cfloat]:
|
|
for N in range(1, 50, 10):
|
|
input = torch.rand(N, 3, 1024, 1024, dtype=dtype)
|
|
self.assertEqual(
|
|
torch.nn.L1Loss()(input, torch.zeros_like(input)),
|
|
input.abs().mean())
|
|
|
|
def test_smoothl1loss_negative_beta_not_supported(self):
|
|
with self.assertRaises(RuntimeError):
|
|
F.smooth_l1_loss(torch.randn(2, 2), torch.randn(2, 2), beta=-1.0)
|
|
|
|
def test_huber_loss_invalid_delta(self):
|
|
def _test_huber_loss_delta_error_helper(delta):
|
|
input, target = torch.randn(2, 2), torch.randn(2, 2)
|
|
loss = torch.nn.HuberLoss(delta=delta)
|
|
with self.assertRaises(RuntimeError):
|
|
loss(input, target)
|
|
|
|
def test_huber_loss_negative_delta():
|
|
_test_huber_loss_delta_error_helper(delta=-0.5)
|
|
|
|
def test_huber_loss_zero_delta():
|
|
_test_huber_loss_delta_error_helper(delta=0.0)
|
|
|
|
test_huber_loss_negative_delta()
|
|
test_huber_loss_zero_delta()
|
|
|
|
def test_cosine_similarity(self):
|
|
input1 = torch.randn(4, 4, requires_grad=True)
|
|
input2 = torch.randn(4, 4, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y), (input1, input2)))
|
|
|
|
input1 = torch.randn(4, 5, 6, requires_grad=True)
|
|
input2 = torch.randn(4, 5, 6, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=0), (input1, input2)))
|
|
self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=-1), (input1, input2)))
|
|
|
|
input1 = torch.randn((), requires_grad=True)
|
|
input2 = torch.randn((), requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=0), (input1, input2)))
|
|
self.assertTrue(gradcheck(lambda x, y: F.cosine_similarity(x, y, dim=-1), (input1, input2)))
|
|
|
|
# Check cosine_similarity input/output shapes
|
|
input_size = (1, 3, 2, 1)
|
|
expected_size = (1, 2, 1)
|
|
input1 = torch.randn(input_size, requires_grad=True)
|
|
input2 = torch.randn(input_size, requires_grad=True)
|
|
self.assertEqual(F.cosine_similarity(input1, input2, dim=1).size(), expected_size)
|
|
|
|
# Check numerical precision, issue #18057
|
|
vv1 = torch.tensor(list([float(i) for i in range(84)])).unsqueeze(0)
|
|
vv2 = torch.tensor(list([float(i) for i in range(84)])).unsqueeze(0)
|
|
out = F.cosine_similarity(vv1, vv2)
|
|
self.assertLessEqual(out, 1.0)
|
|
|
|
# Check dividing by 0.
|
|
input1 = torch.randn(10).requires_grad_()
|
|
input2 = torch.zeros_like(input1).requires_grad_()
|
|
torch.cosine_similarity(input1, input2, 0).sum().backward()
|
|
self.assertEqual(input1.grad, torch.zeros_like(input1))
|
|
self.assertEqual(input2.grad, input1 * 1e8)
|
|
|
|
# Check error when inputs are not the same shape
|
|
input1 = torch.randn(2, 2, 1)
|
|
input2 = torch.randn(2, 1, 3)
|
|
with self.assertRaises(RuntimeError):
|
|
F.cosine_similarity(input1, input2)
|
|
|
|
def test_grid_sample_error_checking(self):
|
|
input = torch.empty(1, 1, 2, 2)
|
|
grid = torch.empty(1, 1, 1, 2)
|
|
|
|
# assert no error
|
|
F.grid_sample(input, grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "but got: 'garbage'"):
|
|
F.grid_sample(input, grid, mode='garbage', align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "but got: 'garbage'"):
|
|
F.grid_sample(input, grid, padding_mode='garbage', align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected input and grid to have same dtype"):
|
|
F.grid_sample(input.float(), grid.double(), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected 4D or 5D input"):
|
|
F.grid_sample(input[0], grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "grid with same number of dimensions"):
|
|
F.grid_sample(input, torch.empty(1, 1, 1, 1, 3), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid and input to have same batch size"):
|
|
F.grid_sample(input, torch.empty(2, 1, 1, 2), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid to have size 2 in last dimension"):
|
|
F.grid_sample(input, torch.empty(1, 1, 1, 3), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected input to have non-empty spatial dimensions"):
|
|
F.grid_sample(torch.empty(1, 1, 0, 2), grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "bicubic interpolation only supports 4D input"):
|
|
F.grid_sample(torch.empty(1, 1, 2, 2, 2), torch.empty(1, 1, 1, 1, 3), mode='bicubic')
|
|
|
|
if TEST_CUDA:
|
|
with self.assertRaisesRegex(RuntimeError, "expected input and grid to be on same device"):
|
|
F.grid_sample(input.cuda(), grid, align_corners=False)
|
|
|
|
def test_affine_grid_error_checking(self):
|
|
# 2D affine
|
|
theta = torch.empty(1, 2, 3, dtype=torch.double)
|
|
size = torch.Size([1, 1, 2, 2])
|
|
|
|
# assert no error
|
|
F.affine_grid(theta, size, align_corners=False)
|
|
|
|
# check for warning for empty span along dimension
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Should not trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=False)
|
|
# Check no warning occurs
|
|
self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
# Should trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=True)
|
|
# Check warning occurs
|
|
self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected theta to have floating point type"):
|
|
F.affine_grid(theta.int(), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta[0], size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.unsqueeze(0), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False)
|
|
|
|
# 3D affine
|
|
theta = torch.empty(1, 3, 4, dtype=torch.double)
|
|
size = torch.Size([1, 1, 2, 2, 2])
|
|
|
|
# assert no error
|
|
F.affine_grid(theta, size, align_corners=False)
|
|
|
|
# check for warning for empty span along dimension
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Should not trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=False)
|
|
# Check no warning occurs
|
|
self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
# Should trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=True)
|
|
# Check warning occurs
|
|
self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta[0], size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.unsqueeze(0), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"):
|
|
F.affine_grid(theta, torch.Size([1, 2, 2]), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"):
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 2, 2, 2]), align_corners=False)
|
|
|
|
@skipIfRocm
|
|
def test_grid_sample(self):
|
|
def test(N, C, H, W, mode, padding_mode, align_corners):
|
|
def test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners):
|
|
for grid_dim_contig_order in [(0, 1, 2, 3), (0, 3, 1, 2), (3, 0, 1, 2), (0, 2, 1, 3)]:
|
|
# grid_dim_contig_order specifies the dimension order that can
|
|
# make grid to be contiguous.
|
|
# i.e., grid.permute(grid_dim_contig_order) is contiguous.
|
|
# e.g., with grid_dim_contig_order=[0, 3, 1, 2], grid should be
|
|
# initialized with contiguous tensor of shape [N, 2, H, W]
|
|
# and permuted to [N, H, W, 2] afterwards.
|
|
grid_shape = [N, H, W, 2]
|
|
grid_init_shape = [grid_shape[d] for d in grid_dim_contig_order]
|
|
grid_fwd_permute = [None, None, None, None]
|
|
for i, d in enumerate(grid_dim_contig_order):
|
|
grid_fwd_permute[d] = i
|
|
|
|
def get_grid(device='cpu', data=None):
|
|
if data is not None:
|
|
assert list(data.shape) == grid_shape
|
|
data = data.permute(grid_dim_contig_order).to(device)
|
|
else:
|
|
data = torch.randn(grid_init_shape, device=device)
|
|
grid = data.permute(grid_fwd_permute)
|
|
assert grid.permute(grid_dim_contig_order).is_contiguous()
|
|
return grid
|
|
|
|
input_cpu = torch.randn(C, N, IH, IW).transpose(0, 1).requires_grad_()
|
|
grid_cpu = get_grid().requires_grad_()
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertTrue(out_cpu.size() == torch.Size([N, C, H, W]))
|
|
|
|
gradients = torch.randn_like(out_cpu)
|
|
out_cpu.backward(gradients)
|
|
|
|
|
|
# Compare against unvectorized CPU fallback
|
|
|
|
# NOTE [ grid_sample CPU fallback ]
|
|
# grid_sample uses AVX for 2d images, but that requires 32-bit indexing for
|
|
# 32-bit floats. So we also have a fallback that is used only for float tensors
|
|
# requiring 64-bit indexing. That requires too much memory to run on CI, so we
|
|
# also export the fallback and test it here to ensure feature parity with
|
|
# the vectorized version.
|
|
input_fallback = input_cpu.float().detach_().requires_grad_()
|
|
grid_fallback = grid_cpu.float().detach_().requires_grad_()
|
|
out_fallback = torch._grid_sampler_2d_cpu_fallback(
|
|
input_fallback, grid_fallback,
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners)
|
|
self.assertEqual(out_fallback, out_cpu.float(), atol=1e-5, rtol=5e-5)
|
|
|
|
out_fallback.backward(gradients.float())
|
|
self.assertEqual(input_fallback.grad, input_cpu.grad.float(), atol=1e-4, rtol=5e-5)
|
|
self.assertEqual(grid_fallback.grad, grid_cpu.grad.float(), atol=1e-4, rtol=5e-5)
|
|
|
|
if TEST_CUDA:
|
|
input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_()
|
|
grid_cuda = get_grid('cuda', grid_cpu.detach()).requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(input_cpu.grad, input_cuda.grad)
|
|
self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0)
|
|
|
|
# check that zero-dimensional input strides don't error out
|
|
base_input = torch.randn(N, C, 1, IW)
|
|
input_cpu = base_input.expand_as(input_cuda).requires_grad_()
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
|
|
input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
# test same size output
|
|
test_shape(N, C, H, W, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test larger output
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(IH + 1, 12)
|
|
W = random.randint(IW + 1, 12)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test smaller output
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(2, IH)
|
|
W = random.randint(2, IW)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test 1x1 inpput
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = 1
|
|
IW = 1
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty grid
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, C, IH, IW, 0, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty channel
|
|
N = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, 0, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty batch
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(0, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
for mode in ('bilinear', 'nearest', 'bicubic'):
|
|
for padding_mode in ('zeros', 'border', 'reflection'):
|
|
for align_corners in (True, False):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 11).view(1, 1, 2, 5)
|
|
grid = torch.tensor(
|
|
[[[-0.9, -4.1], [0, 0.2000], [1, -1], [-0.333, 1e-6], [0.5, 1.0]],
|
|
[[-1.0, -0.5], [0, 0.3333], [1, -1], [-0.200, 1e-6], [1.5, 0.5]]]).view(1, 2, 5, 2)
|
|
if mode == 'bilinear':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[0.0000, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 0.0000]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.0000, 6.5000000000, 1.2500, 4.6675000191, 4.6250],
|
|
[0.5000, 7.1665000916, 1.2500, 5.0000000000, 0.0000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1.2000, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 8.7500]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1.0000, 6.5000000000, 5.0000, 4.6675000191, 9.2500],
|
|
[1.0000, 7.1665000916, 5.0000, 5.0000000000, 10.0000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[3.4500, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 7.7500]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[3.0000004768, 6.5000000000, 5.0000, 4.6675000191, 9.2500],
|
|
[1.0000000000, 7.1665000916, 5.0000, 5.0000000000, 9.2500]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode))
|
|
elif mode == 'nearest':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[0., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 0.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0., 8., 5., 7., 0.],
|
|
[1., 8., 5., 8., 0.]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 10.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 10.]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 9.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 9.]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode))
|
|
elif mode == 'bicubic':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[-0.10424726, 7.1400003, 5.0000, 5.7842274, 9.0000],
|
|
[2.4492188, 7.4814040, 5.0000, 6.0277520, 0.0000]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.00000, 7.6287503, 1.0625, 5.5977230, 5.3270264],
|
|
[0.40625, 8.0288770, 1.0625, 5.9375067, -0.3515625]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1.1520010, 6.0599990, 5.0000, 4.870930, 9.0000000],
|
|
[2.1328125, 6.4258375, 5.0000, 5.076003, 8.8671875]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.894531, 6.6050020, 4.625, 4.7138715, 9.800781],
|
|
[0.906250, 7.2822485, 4.625, 5.0000052, 10.00000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[3.1822524, 6.239998, 5.0000, 4.8709273, 9.00000],
|
|
[1.7812500, 6.703594, 5.0000, 5.0760007, 8.21875]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[2.7993753, 6.6050020, 4.25, 4.7138715, 10.269531],
|
|
[0.8125000, 7.2822485, 4.25, 5.0000052, 9.332031]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError("missing groundtruth test for padding mode '{}'".format(padding_mode))
|
|
|
|
else:
|
|
raise AssertionError("missing groundtruth test for interpolation mode '{}'".format(mode))
|
|
output = F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(output, groundtruth, atol=1e-5, rtol=0,
|
|
msg="groundtruth comparison failed for mode={}, "
|
|
"padding_mode={}".format(mode, padding_mode))
|
|
|
|
# See NOTE [ grid_sample CPU fallback ]
|
|
output = torch._grid_sampler_2d_cpu_fallback(
|
|
input.float(), grid.float(),
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners)
|
|
self.assertEqual(output, groundtruth.float(), atol=1e-5, rtol=0)
|
|
|
|
# explicit check for gradient edge cases
|
|
input = torch.arange(0., 5).expand((1, 1, 5, 5)).requires_grad_()
|
|
grid = torch.tensor(
|
|
[[[1.0, 1.0], [1.0, -1.0], [0.8, 0.8], [0.8, -0.8]],
|
|
[[-1.0, -1.0], [-1.0, 1.0], [-0.8, -0.8], [-0.8, 0.8]]]).view(1, 2, 4, 2).requires_grad_()
|
|
if mode == 'bilinear':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-8., -8.], [-8., 0.], [2., 0.], [2., 0.]],
|
|
[[2., 0.], [2., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-5., -5.], [-5., 5.], [-10., -10.], [-10., 10.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]],
|
|
[[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]],
|
|
[[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
raise AssertionError("missing gradient groundtruth test for padding mode '{}'".format(padding_mode))
|
|
elif mode == 'nearest':
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif mode == 'bicubic':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-4.5, -6.], [-4.5, 6.], [2.725679, 0.740878], [2.725679, -0.740878]],
|
|
[[1.5, 0.], [1.5, 0.], [1.927921, -0.05688], [1.927921, 0.05688]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-5.859375, -5.888672], [-5.859375, 5.888672], [-5.6250, -7.5000], [-5.6250, 7.5000]],
|
|
[[-0.234375, -0.263672], [-0.234375, 0.263672], [1.8750, 0.], [1.8750, 0.]]]]
|
|
).view(1, 2, 4, 2)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]],
|
|
[[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]],
|
|
[[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]],
|
|
[[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]],
|
|
[[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
raise AssertionError("missing gradient groundtruth test for padding mode '{}'".format(padding_mode))
|
|
else:
|
|
raise AssertionError("missing gradient groundtruth test for interpolation mode '{}'".format(mode))
|
|
F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners).sum().backward()
|
|
self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0,
|
|
msg="gradient groundtruth comparison failed for mode={}, "
|
|
"padding_mode={}".format(mode, padding_mode))
|
|
|
|
# See NOTE [ grid_sample CPU fallback ]
|
|
grid.grad.zero_()
|
|
torch._grid_sampler_2d_cpu_fallback(
|
|
input.float(), grid.float(),
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners).sum().backward()
|
|
self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0)
|
|
|
|
# do gradcheck
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 6)
|
|
H = random.randint(2, 8)
|
|
W = random.randint(2, 8)
|
|
input = torch.randn(N, C, H, W, requires_grad=True)
|
|
grid = torch.randn(N, H, W, 2, requires_grad=True)
|
|
self.assertTrue(gradcheck(
|
|
lambda inp, grid: F.grid_sample(inp, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners),
|
|
(input, grid)))
|
|
|
|
test(N, C, H, W, mode, padding_mode, align_corners=align_corners)
|
|
if TEST_CUDNN:
|
|
with cudnn.flags(enabled=False):
|
|
test(N, C, H, W, mode, padding_mode, align_corners=align_corners)
|
|
|
|
def test_grid_sample_3d(self):
|
|
def test(N, C, D, H, W, mode, padding_mode, align_corners):
|
|
def test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners):
|
|
input_cpu = torch.randn(C, N, ID, IH, IW).transpose(0, 1).requires_grad_()
|
|
grid_cpu = torch.randn(D, N, H, W, 3).transpose(0, 1).requires_grad_()
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertTrue(out_cpu.size() == torch.Size([N, C, D, H, W]))
|
|
|
|
gradients = torch.randn_like(out_cpu)
|
|
out_cpu.backward(gradients)
|
|
|
|
if TEST_CUDA:
|
|
input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_()
|
|
grid_cuda = grid_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(input_cpu.grad, input_cuda.grad)
|
|
self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0)
|
|
|
|
# check that zero-dimensional input strides don't error out
|
|
base_input = torch.randn(N, C, 1, IH, IW)
|
|
input_cpu = base_input.expand_as(input_cuda).requires_grad_()
|
|
grid_cpu = torch.randn(N, D, H, W, 3, requires_grad=True)
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
|
|
input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_()
|
|
grid_cuda = grid_cpu.detach().cuda().requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
# test same size output
|
|
test_shape(N, C, D, H, W, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test larger output
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(ID + 1, 10)
|
|
H = random.randint(IH + 1, 10)
|
|
W = random.randint(IW + 1, 10)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test smaller output
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(2, ID)
|
|
H = random.randint(2, IH)
|
|
W = random.randint(2, IW)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test 1x1 inpput
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 7)
|
|
ID = 1
|
|
IH = 1
|
|
IW = 1
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty grid
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, C, ID, IH, IW, D, 0, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty channel
|
|
N = random.randint(2, 7)
|
|
ID = random.randint(2, 5)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, 0, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty batch
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(0, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
for mode in ('bilinear', 'nearest'):
|
|
for padding_mode in ('zeros', 'border', 'reflection'):
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(2, 5)
|
|
C = random.randint(2, 4)
|
|
D = random.randint(2, 5)
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
input = torch.randn(N, C, D, H, W, requires_grad=True)
|
|
grid = torch.randn(N, D, H, W, 3, requires_grad=True)
|
|
self.assertTrue(gradcheck(
|
|
lambda inp, grid: F.grid_sample(inp, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners),
|
|
(input, grid)))
|
|
|
|
test(N, C, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
def test_affine_grid(self):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 7).view(1, 2, 3)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=True)
|
|
groundtruth = torch.tensor(
|
|
[[[0., -3.], [2., 5.]], [[4., 7.], [6., 15.]]]).view(1, 2, 2, 2)
|
|
self.assertEqual(output, groundtruth)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=False)
|
|
groundtruth = torch.tensor(
|
|
[[[1.5, 1.5], [2.5, 5.5]], [[3.5, 6.5], [4.5, 10.5]]]).view(1, 2, 2, 2)
|
|
self.assertEqual(output, groundtruth)
|
|
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, H, W])
|
|
inp = torch.randn(N, 2, 3, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
self.assertTrue(gradcheck(
|
|
lambda inp: F.affine_grid(inp, sz, align_corners=align_corners),
|
|
(inp,)))
|
|
|
|
# test CPU against CUDA
|
|
if TEST_CUDA:
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, H, W])
|
|
for align_corners in (True, False):
|
|
input_cpu = torch.randn(N, 2, 3, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners)
|
|
gradients = torch.randn(out_cpu.size())
|
|
out_cpu.backward(gradients)
|
|
input_gpu = input_cpu.detach().cuda().requires_grad_()
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners)
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
self.assertEqual(input_cpu.grad, input_gpu.grad)
|
|
|
|
def test_affine_grid_3d(self):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 13).view(1, 3, 4)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=True)
|
|
groundtruth = torch.tensor(
|
|
[[[[[-2., -10., -18.], [0., 0., 0.]], [[2., 2., 2.], [4., 12., 20.]]],
|
|
[[[4., 4., 4.], [6., 14., 22.]], [[8., 16., 24.], [10., 26., 42.]]]]]).view(1, 2, 2, 2, 3)
|
|
self.assertEqual(output, groundtruth)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=False)
|
|
groundtruth = torch.tensor(
|
|
[[[[[1., -1., -3.], [2., 4., 6.]], [[3., 5., 7.], [4., 10., 16.]]],
|
|
[[[4., 6., 8.], [5., 11., 17.]], [[6., 12., 18.], [7., 17., 27.]]]]]).view(1, 2, 2, 2, 3)
|
|
self.assertEqual(output, groundtruth)
|
|
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
D = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, D, H, W])
|
|
inp = torch.randn(N, 3, 4, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
self.assertTrue(gradcheck(
|
|
lambda inp: F.affine_grid(inp, sz, align_corners=align_corners),
|
|
(inp,)))
|
|
|
|
# test CPU against CUDA
|
|
if TEST_CUDA:
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
D = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, D, H, W])
|
|
for align_corners in (True, False):
|
|
input_cpu = torch.randn(N, 3, 4, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners)
|
|
gradients = torch.randn(out_cpu.size())
|
|
out_cpu.backward(gradients)
|
|
input_gpu = input_cpu.detach().cuda().requires_grad_()
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners)
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
self.assertEqual(input_cpu.grad, input_gpu.grad)
|
|
|
|
def test_channel_shuffle(self):
|
|
# 3D tensor
|
|
x = torch.tensor(
|
|
[[[1, 2],
|
|
[5, 6],
|
|
[9, 10],
|
|
[13, 14],
|
|
]]
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[1, 2],
|
|
[9, 10],
|
|
[5, 6],
|
|
[13, 14],
|
|
]]
|
|
)
|
|
# ChannelsFirst
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast not supported for 3dim
|
|
|
|
# 4D tensor
|
|
x = torch.tensor(
|
|
[[[[1, 2],
|
|
[3, 4]],
|
|
[[5, 6],
|
|
[7, 8]],
|
|
[[9, 10],
|
|
[11, 12]],
|
|
[[13, 14],
|
|
[15, 16]],
|
|
]]
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[[1, 2],
|
|
[3, 4]],
|
|
[[9, 10],
|
|
[11, 12]],
|
|
[[5, 6],
|
|
[7, 8]],
|
|
[[13, 14],
|
|
[15, 16]],
|
|
]]
|
|
)
|
|
# ChannelsFirst NCHW
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast NHWC
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last), 2)
|
|
self.assertEqual(len(w), 0)
|
|
y = y.contiguous(memory_format=torch.contiguous_format)
|
|
self.assertEqual(y, y_ref)
|
|
|
|
# 5D tensor
|
|
x = torch.tensor(
|
|
[[[[[1, 2],
|
|
[3, 4]]],
|
|
[[[5, 6],
|
|
[7, 8]]],
|
|
[[[9, 10],
|
|
[11, 12]]],
|
|
[[[13, 14],
|
|
[15, 16]]],
|
|
]]
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[[[1, 2],
|
|
[3, 4]]],
|
|
[[[9, 10],
|
|
[11, 12]]],
|
|
[[[5, 6],
|
|
[7, 8]]],
|
|
[[[13, 14],
|
|
[15, 16]]],
|
|
]]
|
|
)
|
|
# ChannelsFirst NCHW
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast NHWC
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last_3d), 2)
|
|
self.assertEqual(len(w), 0)
|
|
y = y.contiguous(memory_format=torch.contiguous_format)
|
|
self.assertEqual(y, y_ref)
|
|
|
|
def test_upsamplingNearest1d(self):
|
|
m = nn.Upsample(size=4, mode='nearest')
|
|
in_t = torch.ones(1, 1, 2)
|
|
in_uint8_t = torch.ones(1, 1, 2, dtype=torch.uint8)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
out_uint8_t = m(in_uint8_t)
|
|
self.assertEqual(torch.ones(1, 1, 4), out_t.data)
|
|
self.assertEqual(torch.ones(1, 1, 4, dtype=torch.uint8), out_uint8_t.data)
|
|
|
|
input = torch.randn(1, 1, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input])
|
|
|
|
def test_upsamplingLinear1d(self):
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='linear', align_corners=align_corners)
|
|
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs)
|
|
in_t = torch.ones(1, 1, 2)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
self.assertEqual(torch.ones(1, 1, out_size), out_t.data)
|
|
|
|
input = torch.randn(1, 1, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), (input,))
|
|
|
|
def test_upsamplingLinear1d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='linear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9)
|
|
in_t_9[:, :, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5])
|
|
self.assertEqual(out_t_9[:, :, :15], out_t_5)
|
|
|
|
def test_upsamplingNearest2d(self):
|
|
for memory_format in [torch.contiguous_format, torch.channels_last]:
|
|
m = nn.Upsample(size=4, mode='nearest')
|
|
in_t = torch.ones(1, 2, 2, 2).contiguous(memory_format=memory_format)
|
|
in_uint8_t = torch.ones(1, 2, 2, 2, dtype=torch.uint8).contiguous(memory_format=memory_format)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
out_uint8_t = m(in_uint8_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4), out_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4, dtype=torch.uint8), out_uint8_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
# test forward when input's height is not same as width
|
|
m = nn.Upsample(size=(4, 2), mode='nearest')
|
|
in_t = torch.ones(1, 2, 2, 1).contiguous(memory_format=memory_format)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 2), out_t)
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
# test backward when input's height is not same as width
|
|
input = torch.ones(1, 2, 2, 1, requires_grad=True).contiguous(memory_format=memory_format)
|
|
gradcheck(lambda x: F.interpolate(x, size=(4, 2), mode='nearest'), [input])
|
|
gradgradcheck(lambda x: F.interpolate(x, size=(4, 2), mode='nearest'), [input])
|
|
|
|
input = torch.randn(1, 2, 2, 2, requires_grad=True).contiguous(memory_format=memory_format)
|
|
self.assertEqual(
|
|
F.interpolate(input, 4, mode='nearest'),
|
|
F.interpolate(input, scale_factor=2, mode='nearest'))
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input])
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input])
|
|
|
|
# Assert that cpu and cuda handle channels_last memory format in the same way
|
|
# https://github.com/pytorch/pytorch/issues/54590
|
|
if torch.cuda.is_available():
|
|
a = torch.ones(2, 2, 3, 4, requires_grad=True).contiguous(memory_format=torch.channels_last)
|
|
# make the data asymmetric; ensure that cuda/cpu handle channels_last appropriately.
|
|
a[1][1][2][2] = a[1][1][2][3] = 0
|
|
|
|
out_cpu = torch.nn.functional.interpolate(a, scale_factor=2, mode='nearest')
|
|
out_cuda = torch.nn.functional.interpolate(a.to('cuda'), scale_factor=2, mode='nearest')
|
|
self.assertEqual(out_cpu, out_cuda.to('cpu'))
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a])
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a])
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a.to('cuda')])
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a.to('cuda')])
|
|
|
|
def test_upsamplingBilinear2d(self):
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='bilinear', align_corners=align_corners)
|
|
|
|
for memory_format in [torch.contiguous_format, torch.channels_last]:
|
|
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs)
|
|
in_t = torch.ones(1, 2, 2, 2).contiguous(memory_format=memory_format)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
self.assertEqual(torch.ones(1, 2, out_size, out_size), out_t.data)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
input = torch.randn(1, 2, 2, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
def test_upsamplingBicubic2d(self):
|
|
# test output against known input: align_corners=False result must match opencv
|
|
in_t = torch.arange(8.).view(1, 2, 2, 2)
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.31641, 0.01562, 0.56250, 0.89453],
|
|
[0.34766, 0.67969, 1.22656, 1.55859],
|
|
[1.44141, 1.77344, 2.32031, 2.65234],
|
|
[2.10547, 2.43750, 2.98438, 3.31641]],
|
|
|
|
[[3.68359, 4.01562, 4.56250, 4.89453],
|
|
[4.34766, 4.67969, 5.22656, 5.55859],
|
|
[5.44141, 5.77344, 6.32031, 6.65234],
|
|
[6.10547, 6.43750, 6.98438, 7.31641]]]])
|
|
out_t = F.interpolate(in_t, scale_factor=2, mode='bicubic', align_corners=False)
|
|
torch.set_printoptions(precision=5)
|
|
self.assertEqual(out_t, expected_out_t, atol=1e-5, rtol=0)
|
|
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='bicubic', align_corners=align_corners)
|
|
# test float scale factor up & downsampling
|
|
for device in device_list:
|
|
for scale_factor in [0.5, 1, 1.5, 2]:
|
|
in_t = torch.ones(2, 2, 2, 2).to(device)
|
|
out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
self.assertEqual(torch.ones(2, 2, out_size, out_size), out_t.data,
|
|
atol=1e-5, rtol=0)
|
|
|
|
input = torch.randn(2, 2, 2, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
def test_upsampling_not_recompute_scale_factor(self):
|
|
# test output against known input: result must match opencv
|
|
in_t = torch.arange(8.).view(1, 2, 2, 2)
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.32725, -0.08843, 0.37933, 0.79744],
|
|
[0.15039, 0.38921, 0.85697, 1.27508],
|
|
[1.08591, 1.32473, 1.79249, 2.21060],
|
|
[1.92213, 2.16095, 2.62871, 3.04682]],
|
|
|
|
[[3.67275, 3.91157, 4.37933, 4.79744],
|
|
[4.15039, 4.38921, 4.85697, 5.27508],
|
|
[5.08591, 5.32473, 5.79249, 6.21060],
|
|
[5.92213, 6.16095, 6.62871, 7.04682]]]])
|
|
if IS_PPC:
|
|
# Both OpenCV and PyTorch give a slightly different result on PPC
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.32725, -0.08843, 0.37933, 0.79744],
|
|
[0.15039, 0.38921, 0.85697, 1.27508],
|
|
[1.08591, 1.32473, 1.79249, 2.21060],
|
|
[1.92212, 2.16094, 2.62870, 3.04681]],
|
|
|
|
[[3.67275, 3.91157, 4.37933, 4.79743],
|
|
[4.15039, 4.38921, 4.85697, 5.27508],
|
|
[5.08591, 5.32473, 5.79249, 6.21059],
|
|
[5.92212, 6.16094, 6.62870, 7.04680]]]])
|
|
out_t = F.interpolate(in_t, scale_factor=2.3, mode='bicubic', align_corners=False, recompute_scale_factor=False)
|
|
torch.set_printoptions(precision=5)
|
|
self.assertEqual(out_t, expected_out_t, atol=1e-4, rtol=0)
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='bicubic', align_corners=align_corners)
|
|
# test float scale factor up & downsampling
|
|
for device in device_list:
|
|
for scale_factor in [0.6, 1.6, 2.3]:
|
|
in_t = torch.ones(2, 2, 2, 2).to(device)
|
|
out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
self.assertEqual(torch.ones(2, 2, out_size, out_size), out_t.data, atol=1e-5, rtol=0)
|
|
|
|
input = torch.randn(2, 2, 2, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
def test_upsamplingBilinear2d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='bilinear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9, 9)
|
|
in_t_9[:, :, :4, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5, :5])
|
|
self.assertEqual(out_t_9[:, :, :15, :15], out_t_5)
|
|
|
|
def test_upsamplingNearest3d(self):
|
|
for memory_format in [torch.contiguous_format, torch.channels_last_3d]:
|
|
m = nn.Upsample(size=4, mode='nearest')
|
|
in_t = torch.ones(1, 2, 2, 2, 2).contiguous(memory_format=memory_format)
|
|
in_uint8_t = torch.ones(1, 2, 2, 2, 2, dtype=torch.uint8).contiguous(memory_format=memory_format)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
out_uint8_t = m(in_uint8_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4, 4), out_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4, 4, dtype=torch.uint8), out_uint8_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
input = torch.randn(1, 2, 2, 2, 2, requires_grad=True).contiguous(memory_format=memory_format)
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [input])
|
|
|
|
# Assert that cpu and cuda handle channels_last memory format in the same way
|
|
# https://github.com/pytorch/pytorch/issues/54590
|
|
if torch.cuda.is_available():
|
|
a = torch.ones(2, 2, 2, 3, 4, requires_grad=True).contiguous(memory_format=torch.channels_last_3d)
|
|
# make the data asymmetric; ensure that cuda/cpu handle channels_last appropriately.
|
|
a[1][1][1][2][2] = a[1][1][1][2][3] = 0
|
|
|
|
out_cpu = torch.nn.functional.interpolate(a, scale_factor=2, mode='nearest')
|
|
out_cuda = torch.nn.functional.interpolate(a.to('cuda'), scale_factor=2, mode='nearest')
|
|
self.assertEqual(out_cpu, out_cuda.to('cpu'))
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a])
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a])
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a.to('cuda')])
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode='nearest'), [a.to('cuda')])
|
|
|
|
def test_upsamplingTrilinear3d(self):
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='trilinear', align_corners=align_corners)
|
|
|
|
for memory_format in [torch.contiguous_format, torch.channels_last_3d]:
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs)
|
|
in_t = torch.ones(1, 2, 2, 2, 2).contiguous(memory_format=memory_format)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
self.assertEqual(torch.ones(1, 2, out_size, out_size, out_size), out_t.data)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
input = torch.randn(1, 2, 2, 2, 2, requires_grad=True)
|
|
self.assertEqual(
|
|
F.interpolate(input, (out_size, out_size, out_size), **kwargs),
|
|
F.interpolate(input, scale_factor=scale_factor, **kwargs))
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
def test_upsamplingTrilinear3d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='trilinear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9, 9, 9)
|
|
in_t_9[:, :, :4, :4, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5, :5, :5])
|
|
self.assertEqual(out_t_9[:, :, :15, :15, :15], out_t_5)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_interpolate_illegal_memory_access(self):
|
|
in_s = 45
|
|
out_s = 14
|
|
|
|
input = torch.ones((1, 1, in_s), device='cuda', requires_grad=True)
|
|
# note we allocated grad_output to be larger so out of bound access
|
|
# woudl be visible in grad_input
|
|
grad = torch.ones((1, 1, out_s * 2), device='cuda', requires_grad=True)
|
|
grad = grad[:, :, :out_s]
|
|
|
|
input_ref = input.detach().cpu().requires_grad_()
|
|
grad_ref = grad.cpu()
|
|
|
|
out = F.interpolate(input, size=(out_s,), mode='nearest')
|
|
out.backward(grad)
|
|
|
|
out_ref = F.interpolate(input_ref, size=(out_s,), mode='nearest')
|
|
out_ref.backward(grad_ref)
|
|
|
|
self.assertEqual(out_ref, out)
|
|
self.assertEqual(input_ref.grad, input.grad)
|
|
|
|
def test_interpolate(self):
|
|
def _test_interpolate_helper(in_t, scale_factor, layer):
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
dim = len(in_t.shape) - 2
|
|
out_shape = [1, 1] + [out_size] * dim
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = layer(in_t)
|
|
self.assertEqual(torch.ones(out_shape), out_t)
|
|
|
|
self.assertEqual(
|
|
F.interpolate(in_t, (out_size,) * dim, **kwargs),
|
|
F.interpolate(in_t, scale_factor=scale_factor, **kwargs))
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t], nondet_tol=GRADCHECK_NONDET_TOL)
|
|
gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t], nondet_tol=GRADCHECK_NONDET_TOL)
|
|
|
|
def _make_input(dim, device):
|
|
size = [1, 1]
|
|
size += [2] * dim
|
|
return torch.ones(size, requires_grad=True, device=device)
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for device in device_list:
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
for mode in ['nearest', 'area']:
|
|
kwargs = dict(mode=mode)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
for input in [_make_input(1, device), _make_input(2, device), _make_input(3, device)]:
|
|
_test_interpolate_helper(input, scale_factor, m)
|
|
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='linear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(1, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='bilinear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(2, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='bicubic', align_corners=align_corners)
|
|
|
|
def m(t):
|
|
return F.interpolate(t, scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(2, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='trilinear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(3, device), scale_factor, m)
|
|
|
|
def test_linear_broadcasting(self):
|
|
m = nn.Linear(5, 8)
|
|
inp = torch.randn(2, 3, 5)
|
|
expected = m(inp.view(6, 5)).view(2, 3, 8)
|
|
self.assertEqual(expected, m(inp))
|
|
|
|
def test_bilinear(self):
|
|
module = nn.Bilinear(10, 10, 8)
|
|
input1 = torch.randn(4, 10, requires_grad=True)
|
|
input2 = torch.randn(4, 10, requires_grad=True)
|
|
grad_output = torch.randn(4, 8)
|
|
|
|
res = module(input1, input2)
|
|
expected = (torch.einsum("bi,kij,bj->bk", input1, module.weight, input2) +
|
|
module.bias)
|
|
self.assertEqual(res, expected)
|
|
grads = torch.autograd.grad(res, [module.weight, module.bias, input1, input2], grad_output)
|
|
grads_expected = torch.autograd.grad(expected, [module.weight, module.bias, input1, input2], grad_output)
|
|
for g, ge in zip(grads, grads_expected):
|
|
self.assertEqual(g, ge)
|
|
|
|
def test_bilinear_no_bias(self):
|
|
module = nn.Bilinear(10, 10, 8)
|
|
module_no_bias = nn.Bilinear(10, 10, 8, False)
|
|
|
|
module.bias.data.zero_()
|
|
module.weight.data.copy_(module_no_bias.weight)
|
|
|
|
input1 = torch.randn(4, 10, requires_grad=True)
|
|
input2 = torch.randn(4, 10, requires_grad=True)
|
|
grad_output = torch.randn(4, 8)
|
|
|
|
def run(net):
|
|
input1.grad = input2.grad = None
|
|
output = net(input1, input2)
|
|
output.backward(grad_output)
|
|
|
|
return output.data, input1.grad.data, input2.grad.data
|
|
|
|
out, g1, g2 = run(module)
|
|
out_nb, g1_nb, g2_nb = run(module_no_bias)
|
|
|
|
self.assertEqual(out, out_nb)
|
|
self.assertEqual(g1, g1_nb)
|
|
self.assertEqual(g2, g2_nb)
|
|
|
|
_assertGradAndGradgradChecks(self,
|
|
lambda x1, x2: F.bilinear(x1, x2, module_no_bias.weight, module_no_bias.bias),
|
|
(input1, input2))
|
|
|
|
def test_bilinear_broadcasting(self):
|
|
m = nn.Bilinear(5, 6, 8)
|
|
input1 = torch.randn(2, 3, 5)
|
|
input2 = torch.randn(2, 3, 6)
|
|
expected = m(input1.view(6, 5), input2.view(6, 6)).view(2, 3, 8)
|
|
self.assertEqual(expected, m(input1, input2))
|
|
|
|
def test_conv_tbc(self):
|
|
inp = torch.randn(9, 4, 5, requires_grad=True)
|
|
weight = torch.randn(3, 5, 6, requires_grad=True)
|
|
bias = torch.randn(6, requires_grad=True)
|
|
|
|
gradcheck(lambda i, w, b, pad: F.conv_tbc(i, w, b, pad), (inp, weight, bias, 3))
|
|
|
|
def run_conv_double_back_test(self, kern, stride, padding, chan_in, chan_out, batch_size,
|
|
inp_size, dilation, no_weight, groups=1, use_cuda=False,
|
|
use_bias=True, dtype=torch.double):
|
|
if use_cuda:
|
|
device = torch.device("cuda")
|
|
else:
|
|
device = torch.device("cpu")
|
|
|
|
x = torch.randn(batch_size, chan_in, inp_size, inp_size, device=device,
|
|
dtype=dtype, requires_grad=True)
|
|
weight = torch.randn(chan_out, chan_in // groups, kern, kern, device=device,
|
|
dtype=dtype, requires_grad=not no_weight)
|
|
if use_bias:
|
|
bias = torch.randn(chan_out, device=device, dtype=dtype, requires_grad=True)
|
|
else:
|
|
bias = None
|
|
|
|
def func(*inputs):
|
|
if use_bias:
|
|
lx, lweight, lbias = inputs
|
|
else:
|
|
lx, lweight = inputs
|
|
lbias = None
|
|
# We disable cudnn during forward to avoid finite difference imprecision issues
|
|
with cudnn.flags(enabled=False):
|
|
out = F.conv2d(lx, lweight, lbias, stride, padding, dilation, groups)
|
|
return out
|
|
|
|
if use_bias:
|
|
inputs = x, weight, bias
|
|
else:
|
|
inputs = x, weight
|
|
|
|
dummy_out = func(*inputs)
|
|
grad_y = torch.randn_like(dummy_out, device=device, dtype=dtype, requires_grad=True)
|
|
|
|
# Issue #15353: test mkldnn double backward, don't run gradgradcheck due
|
|
# to imprecision issues
|
|
if dtype == torch.float:
|
|
g, = torch.autograd.grad(dummy_out.sum(), x, create_graph=True)
|
|
return g.requires_grad
|
|
|
|
return gradgradcheck(func, inputs, (grad_y,))
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
@skipIfRocm
|
|
def test_grouped_conv_cudnn_nhwc_support(self):
|
|
# in order to catch the hols in grouped convolution in nhwc support for earlier cudnn version
|
|
input = torch.randn((16, 16, 8, 8), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last)
|
|
weight = torch.randn((8, 4, 3, 3), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last)
|
|
out = torch.cudnn_convolution(input, weight, None, (1, 1), (1, 1), (1, 1), 4, False, False)
|
|
input = torch.randn((16, 8, 8, 8), dtype=torch.float16, device="cuda").to(memory_format=torch.channels_last)
|
|
out = torch.cudnn_convolution_transpose(input, weight, None, (1, 1), (0, 0), (1, 1), (1, 1), 4, False, False)
|
|
|
|
@unittest.expectedFailure
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_conv_cudnn_memory_layout_dominance(self):
|
|
# desired behavior here is to have the memory_layout of conv.weight to
|
|
# dominante the layout of output.
|
|
# which is not the same as current behavior, we'll fix this in
|
|
# following up PRs and remove the `expectedFailure` tag
|
|
input = torch.randint(1, 10, (2, 8, 4, 4), dtype=torch.float32, device="cuda", requires_grad=True)
|
|
conv = nn.Conv2d(8, 4, 3).cuda().float()
|
|
|
|
out = conv(input)
|
|
self.assertTrue(out.is_contiguous())
|
|
|
|
input = input.contiguous(memory_format=torch.channels_last)
|
|
out = conv(input)
|
|
self.assertTrue(out.is_contiguous())
|
|
|
|
conv.weight.data = conv.weight.contiguous(memory_format=torch.channels_last)
|
|
out = conv(input)
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
input = input.contiguous()
|
|
out = conv(input)
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
def test_conv_double_backward(self):
|
|
batch_size = 2
|
|
for kern, inp_size, dilations in [(3, 6, [1, 2]), (3, 7, [1]), (4, 9, [1])]:
|
|
for stride, padding, chan_in, chan_out, dilation in \
|
|
product([1, 2], [0, 1, 2], [2], [3], dilations):
|
|
for no_weight in (True, False):
|
|
for dtype in (torch.float, torch.double):
|
|
result = self.run_conv_double_back_test(kern, stride,
|
|
padding, chan_in, chan_out,
|
|
batch_size, inp_size, dilation,
|
|
no_weight, dtype=dtype)
|
|
self.assertTrue(result,
|
|
"Conv double backward test failed with parameters:" +
|
|
"\nkern: " + str(kern) +
|
|
"\nstride: " + str(stride) +
|
|
"\npadding: " + str(padding) +
|
|
"\nchan_in: " + str(chan_in) +
|
|
"\nchan_out: " + str(chan_out) +
|
|
"\nbatch_size: " + str(batch_size) +
|
|
"\ninp_size: " + str(inp_size) +
|
|
"\ndilation: " + str(dilation) +
|
|
"\ndtype: " + str(dtype))
|
|
|
|
def test_conv_double_backward_no_bias(self):
|
|
kern = 3
|
|
stride = 2
|
|
chan_in, chan_out = 2, 4
|
|
batch_size = 2
|
|
inp_size = 5
|
|
padding = 1
|
|
dilation = 1
|
|
no_weight = False
|
|
use_bias = True
|
|
result = self.run_conv_double_back_test(kern, stride,
|
|
padding, chan_in, chan_out,
|
|
batch_size, inp_size, dilation,
|
|
no_weight, use_bias=use_bias)
|
|
self.assertTrue(result,
|
|
"Conv double backward test failed with parameters:" +
|
|
"\nkern: " + str(kern) +
|
|
"\nstride: " + str(stride) +
|
|
"\npadding: " + str(padding) +
|
|
"\nchan_in: " + str(chan_in) +
|
|
"\nchan_out: " + str(chan_out) +
|
|
"\nbatch_size: " + str(batch_size) +
|
|
"\ninp_size: " + str(inp_size) +
|
|
"\ndilation: " + str(dilation))
|
|
|
|
def test_conv_double_backward_groups(self):
|
|
kern = 3
|
|
stride = 1
|
|
padding = 2
|
|
chan_in, chan_out = 2, 4
|
|
batch_size = 2
|
|
inp_size = 6
|
|
dilation = 1
|
|
no_weight = False
|
|
groups = 2
|
|
result = self.run_conv_double_back_test(kern, stride,
|
|
padding, chan_in * groups, chan_out * groups,
|
|
batch_size, inp_size, dilation,
|
|
no_weight, groups=groups)
|
|
self.assertTrue(result,
|
|
"Conv double backward test failed with parameters:" +
|
|
"\nkern: " + str(kern) +
|
|
"\nstride: " + str(stride) +
|
|
"\npadding: " + str(padding) +
|
|
"\nchan_in: " + str(chan_in) +
|
|
"\nchan_out: " + str(chan_out) +
|
|
"\nbatch_size: " + str(batch_size) +
|
|
"\ninp_size: " + str(inp_size) +
|
|
"\ndilation: " + str(dilation) +
|
|
"\ngroups: " + str(groups))
|
|
|
|
def test_conv_double_backward_stride(self):
|
|
batch_size = 2
|
|
|
|
# Cannot provide ggW when stride is > 1
|
|
for kern, inp_size, dilations in [(3, 5, [1, 2]), (3, 7, [1])]:
|
|
for stride, padding, chan_in, chan_out, dilation in product([2], [0, 1], [1], [2], dilations):
|
|
no_weight = False
|
|
self.run_conv_double_back_test(kern, stride,
|
|
padding, chan_in, chan_out,
|
|
batch_size, inp_size, dilation,
|
|
no_weight)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_cudnn_noncontiguous_weight(self):
|
|
# Noncontiguous weights must be contiguous() before being
|
|
# passed to cuDNN
|
|
input = torch.tensor([1, 1, 1], dtype=torch.double, device="cuda").view(1, 1, 3)
|
|
weights1 = torch.tensor([1], dtype=torch.double, device="cuda").expand(1, 1, 2)
|
|
weights2 = torch.tensor([1], dtype=torch.double, device="cuda").expand(1, 1, 2).contiguous()
|
|
self.assertEqual(F.conv1d(input, weights1, bias=None, stride=2, dilation=2),
|
|
F.conv1d(input, weights2, bias=None, stride=2, dilation=2))
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@repeat_test_for_types(DOUBLE_TENSORTYPES)
|
|
def test_conv_double_backward_cuda(self, dtype=torch.double):
|
|
# Double backward only runs with DoubleTensor due to precison reason
|
|
batch_size = 1
|
|
for kern, inp_size, dilations in [(3, 5, [1, 2]), (4, 9, [1])]:
|
|
for stride, padding, chan_in, chan_out, dilation in product([1], [2], [2], [3], dilations):
|
|
no_weight = stride == 2
|
|
result = self.run_conv_double_back_test(kern, stride,
|
|
padding, chan_in, chan_out,
|
|
batch_size, inp_size, dilation,
|
|
no_weight, use_cuda=True, dtype=dtype)
|
|
self.assertTrue(result,
|
|
"Conv double backward test failed with parameters:" +
|
|
"\nkern: " + str(kern) +
|
|
"\nstride: " + str(stride) +
|
|
"\npadding: " + str(padding) +
|
|
"\nchan_in: " + str(chan_in) +
|
|
"\nchan_out: " + str(chan_out) +
|
|
"\nbatch_size: " + str(batch_size) +
|
|
"\ninp_size: " + str(inp_size) +
|
|
"\ndilation: " + str(dilation))
|
|
|
|
def run_grad_conv_test(self, func_forward, func_backward, dim=1, gradient='input'):
|
|
for kern, inp_size in [(3, 6), (3, 7), (4, 9)]:
|
|
for batch, stride, padding, chan_in, chan_out, dilation in \
|
|
product([1, 2], [1, 2], [0, 1, 2], [2], [3], [1]):
|
|
|
|
for has_bias in [True, False]:
|
|
input_shape = [batch, chan_in]
|
|
weight_shape = [chan_out, chan_in]
|
|
for _ in range(dim):
|
|
input_shape.append(inp_size)
|
|
weight_shape.append(kern)
|
|
|
|
input = torch.randn(input_shape, requires_grad=True)
|
|
weight = torch.randn(weight_shape, requires_grad=True)
|
|
if has_bias:
|
|
bias = torch.randn([chan_out], requires_grad=True)
|
|
output = func_forward(input, weight, stride=stride, padding=padding, dilation=dilation, bias=bias)
|
|
|
|
gradient_o = torch.randn(output.shape)
|
|
gradient_w = torch.autograd.grad(output, input if (gradient == 'input') else weight, gradient_o)
|
|
|
|
self.assertEqual(gradient_w[0],
|
|
func_backward(
|
|
input_shape if (gradient == 'input') else input,
|
|
weight_shape if (gradient == 'weight') else weight,
|
|
gradient_o,
|
|
stride=stride,
|
|
padding=padding,
|
|
dilation=dilation))
|
|
|
|
def test_grad_conv1d_input(self):
|
|
self.run_grad_conv_test(F.conv1d, F.grad.conv1d_input, 1, 'input')
|
|
|
|
def test_grad_conv1d_weight(self):
|
|
self.run_grad_conv_test(F.conv1d, F.grad.conv1d_weight, 1, 'weight')
|
|
|
|
def test_grad_conv2d_input(self):
|
|
self.run_grad_conv_test(F.conv2d, F.grad.conv2d_input, 2, 'input')
|
|
|
|
def test_grad_conv2d_weight(self):
|
|
self.run_grad_conv_test(F.conv2d, F.grad.conv2d_weight, 2, 'weight')
|
|
|
|
def test_grad_conv3d_input(self):
|
|
self.run_grad_conv_test(F.conv3d, F.grad.conv3d_input, 3, 'input')
|
|
|
|
def test_grad_conv3d_weight(self):
|
|
self.run_grad_conv_test(F.conv3d, F.grad.conv3d_weight, 3, 'weight')
|
|
|
|
@unittest.skipIf(not torch._nnpack_available(), "NNPACK unavailable")
|
|
def test_nnpack_conv(self):
|
|
for kern, inp_size in [(3, 6), (3, 7), (4, 9)]:
|
|
for batch, stride, padding, chan_in, chan_out in \
|
|
product([1, 2, 3, 4], [1, 2], [0, 1, 2], [2], [3]):
|
|
|
|
for has_bias in [True, False]:
|
|
input_shape = [batch, chan_in]
|
|
weight_shape = [chan_out, chan_in]
|
|
for _ in range(2):
|
|
input_shape.append(inp_size)
|
|
weight_shape.append(kern)
|
|
|
|
input = torch.randn(input_shape, requires_grad=True, dtype=torch.float)
|
|
weight = torch.randn(weight_shape, requires_grad=True, dtype=torch.float)
|
|
if has_bias:
|
|
bias = torch.randn([chan_out], requires_grad=True, dtype=torch.float)
|
|
output = torch._nnpack_spatial_convolution(input, weight, stride=stride, padding=padding, bias=bias)
|
|
output_expected = torch.nn.functional.conv2d(input, weight, stride=stride, padding=padding, bias=bias)
|
|
self.assertEqual(output, output_expected, atol=3e-4, rtol=0)
|
|
|
|
gradient_o = torch.randn(output.shape, dtype=torch.float)
|
|
|
|
grads = torch.autograd.grad(output, [input, weight], gradient_o)
|
|
grads_expected = torch.autograd.grad(output_expected, [input, weight], gradient_o)
|
|
for gr, gr_expected in zip(grads, grads_expected):
|
|
self.assertEqual(gr, gr_expected, atol=3e-4, rtol=0)
|
|
|
|
def test_fold_invalid_arg(self):
|
|
# input wrong dimension
|
|
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3))
|
|
with self.assertRaisesRegex(NotImplementedError, r"Only 3D input Tensors are supported"):
|
|
fold(torch.randn(1, 5))
|
|
|
|
# input.size(1) not divisible by \prod(kernel_size)
|
|
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3))
|
|
with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"):
|
|
fold(torch.randn(1, 5, 9))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"):
|
|
fold(torch.randn(1, 19, 9))
|
|
|
|
# input.size(2) not matching the total number of sliding blocks
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3))
|
|
fold(torch.randn(1, 6, 10))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2))
|
|
fold(torch.randn(1, 6, 5))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2), dilation=(1, 2), padding=(2, 0))
|
|
fold(torch.randn(1, 6, 5)) # should be 4 * 1 = 4 sliding blocks
|
|
|
|
def test_unfold_invalid_arg(self):
|
|
# input wrong dimension
|
|
|
|
unfold = nn.Unfold(kernel_size=(2, 3))
|
|
with self.assertRaisesRegex(NotImplementedError, r"Only 4D input Tensors are supported"):
|
|
unfold(torch.randn(1, 5, 2))
|
|
|
|
# calculated output shape is too small
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"):
|
|
unfold = nn.Unfold(kernel_size=(2, 3))
|
|
unfold(torch.randn(1, 2, 2, 2))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"):
|
|
unfold = nn.Unfold(kernel_size=(5, 3), padding=(1, 1))
|
|
unfold(torch.randn(1, 2, 2, 3))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"too small \(non-positive\)"):
|
|
unfold = nn.Unfold(kernel_size=(1, 3), padding=(1, 1), dilation=(1, 2))
|
|
unfold(torch.randn(1, 2, 2, 2))
|
|
|
|
def test_conv_padding_mode(self):
|
|
with self.assertRaisesRegex(ValueError, "padding_mode must be one of"):
|
|
nn.Conv2d(3, 3, 3, padding_mode="xyz")
|
|
|
|
with self.assertRaisesRegex(ValueError, "padding_mode must be one of"):
|
|
nn.Conv2d(3, 3, 3, padding_mode=3)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Only \"zeros\" "):
|
|
nn.ConvTranspose2d(3, 3, 3, padding_mode="reflect")
|
|
|
|
def test_softmin(self):
|
|
x = torch.randn(2, 16)
|
|
self.assertEqual(F.softmin(x, 1), F.softmax(-x, 1))
|
|
self.assertEqual(F.softmin(x, 0), F.softmax(-x, 0))
|
|
|
|
def test_log_softmax_cpu(self, dtype=torch.bfloat16):
|
|
inputf = torch.rand(32, 100, device="cpu", dtype=torch.float, requires_grad=True)
|
|
input = inputf.to(dtype).detach().requires_grad_(True)
|
|
outf = F.log_softmax(inputf, dim=-1)
|
|
out = F.log_softmax(input, dim=-1)
|
|
self.assertEqual(out.dtype, dtype)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(out, outf, atol=0.1, rtol=0)
|
|
|
|
out.sum().backward()
|
|
outf.sum().backward()
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0.1, rtol=0)
|
|
|
|
def test_adaptive_log_softmax(self):
|
|
# args validation
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 15], div_value=2.)
|
|
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 10], div_value=2.)
|
|
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 25], div_value=2.)
|
|
|
|
with self.assertRaisesRegex(ValueError, "cutoffs should be a sequence of unique,"):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 20], div_value=2.)
|
|
|
|
# not raise
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 19], div_value=2.)
|
|
|
|
# input shapes
|
|
with self.assertRaisesRegex(RuntimeError, r"Input and target should have the same size"):
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 5, 10])
|
|
asfm(x, y)
|
|
|
|
# out-of-bound targets
|
|
with self.assertRaisesRegex(RuntimeError, r"Target values should be in"):
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 20])
|
|
asfm(x, y)
|
|
|
|
# cluster sizes
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 17])
|
|
|
|
self.assertEqual(asfm.head.weight.size(), (5 + 3, 16)) # 5 targets in head, 3 clusters, dimensionality 16
|
|
self.assertEqual(asfm.tail[0][1].weight.size(), (5, 8)) # 5 targets in this cluster, dimensionality 8
|
|
self.assertEqual(asfm.tail[1][1].weight.size(), (5, 4))
|
|
self.assertEqual(asfm.tail[2][1].weight.size(), (5, 2))
|
|
|
|
self.assertEqual(asfm(x, y).output.size(), (2, ))
|
|
|
|
# log_probs actually returns log_proba
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 4, [2], div_value=2.)
|
|
x = torch.randn(4, 8)
|
|
logprob_out = asfm.log_prob(x)
|
|
|
|
self.assertEqual(torch.exp(logprob_out).data.sum(1), torch.ones(4))
|
|
|
|
# forward returns the same thing as log_probs
|
|
for v in [0, 1, 2, 3]:
|
|
y = torch.full((4,), v, dtype=torch.long)
|
|
out, loss = asfm(x, y)
|
|
|
|
self.assertEqual(out, logprob_out.gather(1, y.unsqueeze(1)).squeeze())
|
|
self.assertEqual(loss, F.nll_loss(logprob_out, y))
|
|
|
|
# predict
|
|
x = torch.randn(64, 8).abs_()
|
|
|
|
# argmax in shortlist
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
asfm.head.weight.data[asfm.shortlist_size:, :].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
# argmax outside of shortlist
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
asfm.head.weight.data[:asfm.shortlist_size, :].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
# half of the argmax in shortlist, half in clusters
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
|
|
x[:32, :asfm.shortlist_size].zero_()
|
|
x[32:, asfm.shortlist_size:].zero_()
|
|
|
|
asfm.head.weight.data[:asfm.shortlist_size, asfm.shortlist_size:].zero_()
|
|
asfm.head.weight.data[asfm.shortlist_size:, :asfm.shortlist_size].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
def test_cross_entropy_loss(self, dtype=torch.bfloat16):
|
|
loss_cpu = nn.CrossEntropyLoss().cpu()
|
|
inputf = torch.randn(15, 10, device="cpu", dtype=torch.float, requires_grad=True)
|
|
input = inputf.to(dtype).detach().requires_grad_(True)
|
|
target = torch.empty(15, dtype=torch.long).random_(10)
|
|
|
|
outf = loss_cpu(inputf, target)
|
|
out = loss_cpu(input, target)
|
|
self.assertEqual(out.dtype, dtype)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(out, outf, atol=1e-1, rtol=0)
|
|
|
|
outf.backward()
|
|
out.backward()
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(input.grad, inputf.grad, atol=1e-1, rtol=0)
|
|
|
|
def test_cross_entropy_loss_precision(self):
|
|
# Regression test for #55657
|
|
loss_cpu = nn.CrossEntropyLoss().cpu()
|
|
inputf = torch.randn(128, 2, 768, 768, device="cpu", dtype=torch.float)
|
|
inputd = inputf.double()
|
|
target = torch.randint(2, (128, 768, 768), dtype=torch.long)
|
|
|
|
outf = loss_cpu(inputf, target)
|
|
outd = loss_cpu(inputd, target)
|
|
self.assertEqual(outf, outd, exact_dtype=False)
|
|
|
|
@unittest.skipIf(not torch.cuda.is_available(), "CUDA not available")
|
|
def test_convert_sync_batchnorm(self):
|
|
module = torch.nn.Sequential(
|
|
torch.nn.BatchNorm1d(100),
|
|
torch.nn.InstanceNorm1d(100)
|
|
).cuda()
|
|
|
|
# necessary to have an anchor point for comparison, in case the
|
|
# convert_sync_batchnorm updates in place
|
|
comp_module = torch.nn.Sequential(
|
|
torch.nn.BatchNorm1d(100),
|
|
torch.nn.InstanceNorm1d(100)
|
|
).cuda()
|
|
comp_module.load_state_dict(module.state_dict())
|
|
|
|
sync_bn_module = torch.nn.SyncBatchNorm.convert_sync_batchnorm(module)
|
|
children = list(sync_bn_module.children())
|
|
self.assertEqual(children[0].__class__, torch.nn.SyncBatchNorm)
|
|
self.assertEqual(children[1].__class__, torch.nn.InstanceNorm1d)
|
|
|
|
for layer, converted_layer in zip(comp_module.children(), sync_bn_module.children()):
|
|
for key in layer.state_dict().keys():
|
|
self.assertEqual(layer.state_dict()[key].device, converted_layer.state_dict()[key].device)
|
|
self.assertEqual(layer.state_dict()[key], converted_layer.state_dict()[key])
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA not available")
|
|
def test_sync_batchnorm_accuracy_cuda(self):
|
|
# The target of this test is to test the functionality and accuracy of
|
|
# those single-GPU cuda kernels used in SyncBatchNorm
|
|
# They are:
|
|
# fwd: torch.batch_norm_stats, torch.batch_norm_gather_stats_with_counts, torch.batch_norm_elemt
|
|
# bwd: torch.batch_norm_backward_reduce, torch.batch_norm_backward_elemt
|
|
|
|
def _batch_norm_stats(data):
|
|
mean1, _ = torch.batch_norm_stats(data, 1e-5)
|
|
mean2, _ = torch.batch_norm_stats(data.to(memory_format=torch.channels_last), 1e-5)
|
|
mean_ref = torch.mean(data, (0, 2, 3), keepdim=False)
|
|
|
|
self.assertEqual(mean_ref, mean1)
|
|
self.assertEqual(mean_ref, mean2)
|
|
|
|
data = torch.randn(1, 96, 112, 112, dtype=torch.float, device='cuda')
|
|
_batch_norm_stats(data)
|
|
|
|
def test_functional_grad_conv(self):
|
|
# Conv 1D
|
|
input = torch.randn(1, 1, 5, requires_grad=True)
|
|
weight = torch.randn(1, 1, 3, requires_grad=True)
|
|
output = F.conv1d(input, weight, dilation=2)
|
|
grad_output = torch.randn(output.shape)
|
|
|
|
grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0]
|
|
grad_input_functional = torch.nn.grad.conv1d_input(input.shape, weight, grad_output, dilation=2)
|
|
self.assertEqual(grad_input_functional, grad_input_autograd)
|
|
|
|
# Conv 2D
|
|
input = torch.randn(1, 1, 5, 5, requires_grad=True)
|
|
weight = torch.randn(1, 1, 3, 3, requires_grad=True)
|
|
output = F.conv2d(input, weight, dilation=2)
|
|
grad_output = torch.randn(output.shape)
|
|
|
|
grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0]
|
|
grad_input_functional = torch.nn.grad.conv2d_input(input.shape, weight, grad_output, dilation=2)
|
|
self.assertEqual(grad_input_functional, grad_input_autograd)
|
|
|
|
# Conv 3D
|
|
input = torch.randn(1, 1, 5, 5, 5, requires_grad=True)
|
|
weight = torch.randn(1, 1, 3, 3, 3, requires_grad=True)
|
|
output = F.conv3d(input, weight, dilation=2)
|
|
grad_output = torch.randn(output.shape)
|
|
|
|
grad_input_autograd = torch.autograd.grad(output, input, grad_output)[0]
|
|
grad_input_functional = torch.nn.grad.conv3d_input(input.shape, weight, grad_output, dilation=2)
|
|
self.assertEqual(grad_input_functional, grad_input_autograd)
|
|
|
|
# Warning for _grad_input_padding
|
|
with warnings.catch_warnings(record=True) as w:
|
|
torch.nn.grad._grad_input_padding(torch.rand(1, 2, 3), [1, 2, 5], (1,), (0,), (3,))
|
|
self.assertEqual(len(w), 1)
|
|
|
|
def test_flatten(self):
|
|
tensor_input = torch.randn(2, 1, 2, 3)
|
|
|
|
# Flatten Tensor
|
|
|
|
flatten = nn.Flatten(start_dim=1, end_dim=-1)
|
|
tensor_output = flatten(tensor_input)
|
|
self.assertEqual(tensor_output.size(), torch.Size([2, 6]))
|
|
|
|
def test_unflatten(self):
|
|
tensor_input = torch.randn(2, 50)
|
|
|
|
# Unflatten Tensor (unflattened_size as a tuple of ints and list of ints)
|
|
|
|
for us in ((2, 5, 5), [2, 5, 5]):
|
|
unflatten = nn.Unflatten(dim=1, unflattened_size=us)
|
|
tensor_output = unflatten(tensor_input)
|
|
self.assertEqual(tensor_output.size(), torch.Size([2, 2, 5, 5]))
|
|
|
|
# Unflatten NamedTensor
|
|
|
|
unflatten = nn.Unflatten(dim='features', unflattened_size=(('C', 2), ('H', 5), ('W', 5)))
|
|
named_tensor_input = tensor_input.refine_names('N', 'features')
|
|
named_tensor_output = unflatten(named_tensor_input)
|
|
self.assertEqual(named_tensor_output.size(), torch.Size([2, 2, 5, 5]))
|
|
|
|
def test_unflatten_invalid_arg(self):
|
|
# Wrong type for unflattened_size (tuple of floats)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of ints, but found element of type float at pos 2"):
|
|
nn.Unflatten(dim=1, unflattened_size=(2, 5, 5.0))
|
|
|
|
# Wrong type for unflattened_size (list of lists and list of tuples)
|
|
for us in ([['C', 2], ['W', 5], ['H', 5]], [('C', 2), ('W', 5), ('H', 5)]):
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be a tuple of tuples, but found type list"):
|
|
nn.Unflatten(dim='features', unflattened_size=us)
|
|
|
|
# Wrong type for unflattened_size (tuple of lists)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of tuples, but found element of type list at pos 0"):
|
|
nn.Unflatten(dim='features', unflattened_size=(['C', 2], ['W', 5], ['H', 5]))
|
|
|
|
# Wrong type for unflattened_size (tuple of dicts)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of tuples, but found element of type dict at pos 0"):
|
|
nn.Unflatten(dim='features', unflattened_size=({'C': 2}, {'W': 5}, {'H': 5}))
|
|
|
|
def test_layer_norm_grads_with_create_graph_flag(self):
|
|
atol = 1e-5
|
|
rtol = 1e-3
|
|
|
|
x = torch.randn((4, 4, 16), requires_grad=True)
|
|
layer_norm = nn.LayerNorm((16,), 1e-5, True)
|
|
with torch.no_grad():
|
|
layer_norm.weight = torch.nn.Parameter(0.1 * torch.ones_like(layer_norm.weight))
|
|
|
|
grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0]
|
|
grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0]
|
|
|
|
self.assertTrue(torch.allclose(grads1, grads2, rtol, atol))
|
|
|
|
if TEST_CUDA:
|
|
x = x.to('cuda')
|
|
layer_norm = layer_norm.to('cuda')
|
|
|
|
grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0]
|
|
grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0]
|
|
|
|
self.assertTrue(torch.allclose(grads1, grads2, rtol, atol))
|
|
|
|
def test_padding_list(self):
|
|
# Padding can be a list, or tuple (regression test for gh-54452)
|
|
x = torch.randn(4, 8, 32, 32)
|
|
net = torch.nn.ConvTranspose2d(8, 16, kernel_size=3, padding=[3, 3])
|
|
y = net(x)
|
|
|
|
net = torch.nn.ConvTranspose2d(8, 16, kernel_size=3, padding=(3, 3))
|
|
y = net(x)
|
|
|
|
|
|
class TestNNInit(TestCase):
|
|
def setUp(self):
|
|
super(TestNNInit, self).setUp()
|
|
random.seed(123)
|
|
|
|
def _is_normal(self, tensor, mean, std):
|
|
samples = tensor.view(-1).tolist()
|
|
p_value = stats.kstest(samples, 'norm', args=(mean, std))[1]
|
|
return p_value > 0.0001
|
|
|
|
def _is_trunc_normal(self, tensor, mean, std, a, b):
|
|
# scipy's trunc norm is suited for data drawn from N(0, 1),
|
|
# so we need to transform our data to test it using scipy.
|
|
z_samples = (tensor.view(-1) - mean) / std
|
|
z_samples = z_samples.tolist()
|
|
a0 = (a - mean) / std
|
|
b0 = (b - mean) / std
|
|
p_value = stats.kstest(z_samples, 'truncnorm', args=(a0, b0))[1]
|
|
return p_value > 0.0001
|
|
|
|
def _is_uniform(self, tensor, a, b):
|
|
samples = tensor.view(-1).tolist()
|
|
p_value = stats.kstest(samples, 'uniform', args=(a, (b - a)))[1]
|
|
return p_value > 0.0001
|
|
|
|
def _create_random_nd_tensor(self, dims, size_min, size_max):
|
|
size = [random.randint(size_min, size_max) for _ in range(dims)]
|
|
tensor = torch.zeros(size)
|
|
return tensor
|
|
|
|
def _random_float(self, a, b):
|
|
return (b - a) * random.random() + a
|
|
|
|
def test_calculate_gain_linear(self):
|
|
for fn in ['linear', 'conv1d', 'conv2d', 'conv3d', 'conv_transpose2d', 'conv_transpose2d', 'conv_transpose3d']:
|
|
gain = init.calculate_gain(fn)
|
|
self.assertEqual(gain, 1)
|
|
|
|
def test_calculate_gain_nonlinear(self):
|
|
for fn in ['sigmoid', 'tanh', 'relu', 'leaky_relu']:
|
|
gain = init.calculate_gain(fn)
|
|
if fn == 'sigmoid':
|
|
self.assertEqual(gain, 1)
|
|
elif fn == 'tanh': # 5 / 3
|
|
self.assertEqual(gain, 1.6666666666666667)
|
|
elif fn == 'relu': # sqrt(2)
|
|
self.assertEqual(gain, 1.4142135623730951)
|
|
elif fn == 'leaky_relu': # sqrt(2 / 1 + slope^2))
|
|
self.assertEqual(gain, 1.4141428569978354)
|
|
elif fn == 'selu':
|
|
self.assertEqual(gain, 0.75)
|
|
|
|
def test_calculate_gain_leaky_relu(self):
|
|
for param in [None, 0, 0.01, 10]:
|
|
gain = init.calculate_gain('leaky_relu', param)
|
|
if param is None: # Default slope is 0.01
|
|
self.assertEqual(gain, 1.4141428569978354)
|
|
elif param == 0: # No slope = same gain as normal ReLU
|
|
self.assertEqual(gain, 1.4142135623730951)
|
|
elif param == 0.01:
|
|
self.assertEqual(gain, 1.4141428569978354)
|
|
elif param == 10:
|
|
self.assertEqual(gain, 0.14071950894605836)
|
|
|
|
def test_calculate_gain_leaky_relu_only_accepts_numbers(self):
|
|
for param in [True, [1], {'a': 'b'}]:
|
|
with self.assertRaises(ValueError):
|
|
init.calculate_gain('leaky_relu', param)
|
|
|
|
def test_calculate_gain_only_accepts_valid_nonlinearities(self):
|
|
for n in [2, 5, 25]:
|
|
# Generate random strings of lengths that definitely aren't supported
|
|
random_string = ''.join([random.choice(string.ascii_lowercase) for i in range(n)])
|
|
with self.assertRaises(ValueError):
|
|
init.calculate_gain(random_string)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_uniform(self):
|
|
for dims in [1, 2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50)
|
|
a = self._random_float(-3, 3)
|
|
b = a + self._random_float(1, 5)
|
|
init.uniform_(input_tensor, a=a, b=b)
|
|
assert self._is_uniform(input_tensor, a, b)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_normal(self):
|
|
for dims in [1, 2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50)
|
|
mean = self._random_float(-3, 3)
|
|
std = self._random_float(1, 5)
|
|
init.normal_(input_tensor, mean=mean, std=std)
|
|
|
|
assert self._is_normal(input_tensor, mean, std)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_trunc_normal(self):
|
|
for dims in [1, 2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=30, size_max=50)
|
|
mean = self._random_float(-3, 3)
|
|
std = self._random_float(.01, 1)
|
|
a = self._random_float(mean - 2 * std, mean)
|
|
b = self._random_float(mean, mean + 2 * std)
|
|
init.trunc_normal_(input_tensor, mean=mean, std=std, a=a, b=b)
|
|
|
|
assert self._is_trunc_normal(input_tensor, mean, std, a, b)
|
|
|
|
def test_constant(self):
|
|
for dims in [1, 2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=5)
|
|
val = self._random_float(1, 10)
|
|
init.constant_(input_tensor, val)
|
|
|
|
self.assertEqual(input_tensor, input_tensor.clone().fill_(val))
|
|
|
|
def test_ones_and_zeros(self):
|
|
for init_fn_, val in zip([init.ones_, init.zeros_], [1, 0]):
|
|
for dims in [1, 2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=5)
|
|
init_fn_(input_tensor)
|
|
|
|
self.assertEqual(input_tensor, input_tensor.clone().fill_(val))
|
|
|
|
def test_eye(self):
|
|
input_tensor = self._create_random_nd_tensor(2, size_min=1, size_max=5)
|
|
init.eye_(input_tensor)
|
|
|
|
# Check every single element
|
|
for i in range(input_tensor.size(0)):
|
|
for j in range(input_tensor.size(1)):
|
|
if i == j:
|
|
assert input_tensor[i][j] == 1
|
|
else:
|
|
assert input_tensor[i][j] == 0
|
|
|
|
def test_eye_only_works_on_2d_inputs(self):
|
|
for dims in [1, 3]:
|
|
with self.assertRaises(ValueError):
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3)
|
|
init.eye_(tensor)
|
|
|
|
def test_max_unpool(self):
|
|
# Test 1D
|
|
output, indices = F.max_pool1d(torch.randn([1, 1, 4]), 2, stride=2, return_indices=True)
|
|
self.assertEqual(F.max_unpool1d(output, indices, 2), F.max_unpool1d(output, indices, 2, stride=2))
|
|
|
|
# Test list / tuple passed as argument to max_unpool1d
|
|
input = torch.randn([1, 1, 5])
|
|
output, indices = F.max_pool1d(input, 2, stride=2, return_indices=True)
|
|
self.assertEqual(F.max_unpool1d(output, indices, 2, stride=2, output_size=input.shape),
|
|
F.max_unpool1d(output, indices, 2, stride=2, output_size=input.size()))
|
|
|
|
# Test 2D
|
|
output, indices = F.max_pool2d(torch.randn([1, 1, 4, 4]), 2, stride=2, return_indices=True)
|
|
self.assertEqual(F.max_unpool2d(output, indices, 2), F.max_unpool2d(output, indices, 2, stride=2))
|
|
|
|
# Test 3D
|
|
output, indices = F.max_pool3d(torch.randn([4, 4, 4, 4, 4]), 2, stride=2, return_indices=True)
|
|
self.assertEqual(F.max_unpool3d(output, indices, 2), F.max_unpool3d(output, indices, 2, stride=2))
|
|
|
|
def test_dirac_properties(self):
|
|
for dims in [3, 4, 5]:
|
|
for groups in [1, 2, 3]:
|
|
# prepare random tensor with random sizes, but fits groups
|
|
a, c, d, e = (random.randint(1, 5) for _ in range(4))
|
|
b = random.randint(1, 5 * groups) # same range as a*groups but all range allowed
|
|
# make sure first dim divides by groups
|
|
input_tensor = torch.randn((a * groups, b, c, d, e)[:dims])
|
|
|
|
init.dirac_(input_tensor, groups)
|
|
|
|
c_out, c_in = input_tensor.size(0) // groups, input_tensor.size(1)
|
|
min_d = min(c_out, c_in)
|
|
# Check number of nonzeros is equivalent to smallest dim (for each group)
|
|
assert torch.nonzero(input_tensor).size(0) == min_d * groups
|
|
# Check sum of values (can have precision issues, hence assertEqual) is also equivalent
|
|
self.assertEqual(input_tensor.sum(), min_d * groups)
|
|
|
|
|
|
def test_dirac_identity(self):
|
|
for groups in [1, 3]:
|
|
batch, in_c, out_c, size, kernel_size = 8, 3, 9, 5, 3 # in_c, out_c must divide by groups
|
|
eff_out_c = out_c // groups
|
|
|
|
# Test 1D
|
|
input_var = torch.randn(batch, in_c, size)
|
|
filter_var = torch.zeros(eff_out_c, in_c, kernel_size)
|
|
filter_var = torch.cat([filter_var] * groups)
|
|
init.dirac_(filter_var, groups)
|
|
output_var = F.conv1d(input_var, filter_var)
|
|
input_tensor, output_tensor = input_var.data, output_var.data # Variables do not support nonzero
|
|
for g in range(groups):
|
|
# Assert in_c outputs are preserved (per each group)
|
|
self.assertEqual(input_tensor[:, :, 1:-1],
|
|
output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :])
|
|
# Assert extra outputs are 0
|
|
assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :]).numel() == 0
|
|
|
|
# Test 2D
|
|
input_var = torch.randn(batch, in_c, size, size)
|
|
filter_var = torch.zeros(eff_out_c, in_c, kernel_size, kernel_size)
|
|
filter_var = torch.cat([filter_var] * groups)
|
|
init.dirac_(filter_var, groups)
|
|
output_var = F.conv2d(input_var, filter_var)
|
|
input_tensor, output_tensor = input_var.data, output_var.data # Variables do not support nonzero
|
|
for g in range(groups):
|
|
# Assert in_c outputs are preserved (per each group)
|
|
self.assertEqual(input_tensor[:, :, 1:-1, 1:-1],
|
|
output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :, :])
|
|
# Assert extra outputs are 0
|
|
assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :, :]).numel() == 0
|
|
|
|
# Test 3D
|
|
input_var = torch.randn(batch, in_c, size, size, size)
|
|
filter_var = torch.zeros(eff_out_c, in_c, kernel_size, kernel_size, kernel_size)
|
|
filter_var = torch.cat([filter_var] * groups)
|
|
init.dirac_(filter_var, groups)
|
|
output_var = F.conv3d(input_var, filter_var)
|
|
input_tensor, output_tensor = input_var.data, output_var.data
|
|
for g in range(groups):
|
|
# Assert in_c outputs are preserved (per each group)
|
|
self.assertEqual(input_tensor[:, :, 1:-1, 1:-1, 1:-1],
|
|
output_tensor[:, eff_out_c * g:eff_out_c * g + in_c, :, :, :])
|
|
# Assert extra outputs are 0
|
|
assert torch.nonzero(output_tensor[:, eff_out_c * g + in_c:eff_out_c * (g + 1), :, :, :]).numel() == 0
|
|
|
|
def test_dirac_only_works_on_3_4_5d_inputs(self):
|
|
for dims in [1, 2, 6]:
|
|
with self.assertRaises(ValueError):
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3)
|
|
init.dirac_(tensor)
|
|
|
|
def test_xavier_uniform_errors_on_inputs_smaller_than_2d(self):
|
|
for dims in [0, 1]:
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1)
|
|
with self.assertRaises(ValueError):
|
|
init.xavier_uniform_(tensor)
|
|
|
|
def test_xavier_normal_errors_on_inputs_smaller_than_2d(self):
|
|
for dims in [0, 1]:
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1)
|
|
with self.assertRaises(ValueError):
|
|
init.xavier_normal_(tensor)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_xavier_uniform(self):
|
|
for use_gain in [True, False]:
|
|
for dims in [2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25)
|
|
gain = 1
|
|
|
|
if use_gain:
|
|
gain = self._random_float(0.1, 2)
|
|
init.xavier_uniform_(input_tensor, gain=gain)
|
|
else:
|
|
init.xavier_uniform_(input_tensor)
|
|
|
|
fan_in = input_tensor.size(1)
|
|
fan_out = input_tensor.size(0)
|
|
if input_tensor.dim() > 2:
|
|
fan_in *= input_tensor[0, 0].numel()
|
|
fan_out *= input_tensor[0, 0].numel()
|
|
|
|
expected_std = gain * math.sqrt(2.0 / (fan_in + fan_out))
|
|
bounds = expected_std * math.sqrt(3)
|
|
assert self._is_uniform(input_tensor, -bounds, bounds)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_xavier_normal(self):
|
|
for use_gain in [True, False]:
|
|
for dims in [2, 4]:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25)
|
|
gain = 1
|
|
|
|
if use_gain:
|
|
gain = self._random_float(0.1, 2)
|
|
init.xavier_normal_(input_tensor, gain=gain)
|
|
else:
|
|
init.xavier_normal_(input_tensor)
|
|
|
|
fan_in = input_tensor.size(1)
|
|
fan_out = input_tensor.size(0)
|
|
if input_tensor.dim() > 2:
|
|
fan_in *= input_tensor[0, 0].numel()
|
|
fan_out *= input_tensor[0, 0].numel()
|
|
|
|
expected_std = gain * math.sqrt(2.0 / (fan_in + fan_out))
|
|
assert self._is_normal(input_tensor, 0, expected_std)
|
|
|
|
def test_kaiming_uniform_errors_on_inputs_smaller_than_2d(self):
|
|
for dims in [0, 1]:
|
|
with self.assertRaises(ValueError):
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1)
|
|
init.kaiming_uniform_(tensor)
|
|
|
|
def test_kaiming_normal_errors_on_inputs_smaller_than_2d(self):
|
|
for dims in [0, 1]:
|
|
with self.assertRaises(ValueError):
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=1)
|
|
init.kaiming_normal_(tensor)
|
|
|
|
def test_kaiming_uniform_warning_on_0element_tensor(self):
|
|
tensor = torch.empty(0, 1)
|
|
with self.assertWarnsRegex(UserWarning, "Initializing zero-element tensors is a no-op"):
|
|
_ = init.kaiming_uniform_(tensor)
|
|
|
|
def test_kaiming_normal_warning_on_0element_tensor(self):
|
|
tensor = torch.empty(0, 1)
|
|
with self.assertWarnsRegex(UserWarning, "Initializing zero-element tensors is a no-op"):
|
|
_ = init.kaiming_normal_(tensor)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_kaiming_uniform(self):
|
|
for use_a in [True, False]:
|
|
for dims in [2, 4]:
|
|
for mode in ['fan_in', 'fan_out']:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25)
|
|
if use_a:
|
|
a = self._random_float(0.1, 2)
|
|
init.kaiming_uniform_(input_tensor, a=a, mode=mode)
|
|
else:
|
|
a = 0
|
|
init.kaiming_uniform_(input_tensor, mode=mode)
|
|
|
|
fan_in = input_tensor.size(1)
|
|
fan_out = input_tensor.size(0)
|
|
if input_tensor.dim() > 2:
|
|
fan_in *= input_tensor[0, 0].numel()
|
|
fan_out *= input_tensor[0, 0].numel()
|
|
|
|
if mode == 'fan_in':
|
|
n = fan_in
|
|
else:
|
|
n = fan_out
|
|
|
|
expected_std = math.sqrt(2.0 / ((1 + a**2) * n))
|
|
bounds = expected_std * math.sqrt(3.0)
|
|
assert self._is_uniform(input_tensor, -bounds, bounds)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_kaiming_normal(self):
|
|
for use_a in [True, False]:
|
|
for dims in [2, 4]:
|
|
for mode in ['fan_in', 'fan_out']:
|
|
input_tensor = self._create_random_nd_tensor(dims, size_min=20, size_max=25)
|
|
if use_a:
|
|
a = self._random_float(0.1, 2)
|
|
init.kaiming_normal_(input_tensor, a=a, mode=mode)
|
|
else:
|
|
a = 0
|
|
init.kaiming_normal_(input_tensor, mode=mode)
|
|
|
|
fan_in = input_tensor.size(1)
|
|
fan_out = input_tensor.size(0)
|
|
if input_tensor.dim() > 2:
|
|
fan_in *= input_tensor[0, 0].numel()
|
|
fan_out *= input_tensor[0, 0].numel()
|
|
|
|
if mode == 'fan_in':
|
|
n = fan_in
|
|
else:
|
|
n = fan_out
|
|
|
|
expected_std = math.sqrt(2.0 / ((1 + a**2) * n))
|
|
assert self._is_normal(input_tensor, 0, expected_std)
|
|
|
|
def test_sparse_only_works_on_2d_inputs(self):
|
|
for dims in [1, 3]:
|
|
with self.assertRaises(ValueError):
|
|
sparsity = self._random_float(0.1, 0.9)
|
|
tensor = self._create_random_nd_tensor(dims, size_min=1, size_max=3)
|
|
init.sparse_(tensor, sparsity)
|
|
|
|
@unittest.skipIf(not TEST_SCIPY, "Scipy not found.")
|
|
def test_sparse_default_std(self):
|
|
for use_random_std in [True, False]:
|
|
input_tensor = self._create_random_nd_tensor(2, size_min=30, size_max=35)
|
|
rows, cols = input_tensor.size(0), input_tensor.size(1)
|
|
sparsity = self._random_float(0.1, 0.2)
|
|
|
|
std = 0.01 # default std
|
|
if use_random_std:
|
|
std = self._random_float(0.01, 0.2)
|
|
init.sparse_(input_tensor, sparsity=sparsity, std=std)
|
|
else:
|
|
init.sparse_(input_tensor, sparsity=sparsity)
|
|
|
|
for col_idx in range(input_tensor.size(1)):
|
|
column = input_tensor[:, col_idx]
|
|
assert column[column == 0].nelement() >= math.ceil(sparsity * rows)
|
|
|
|
assert self._is_normal(input_tensor[input_tensor != 0], 0, std)
|
|
|
|
@skipIfNoLapack
|
|
def test_orthogonal(self):
|
|
for use_gain in [True, False]:
|
|
for tensor_size in [[3, 4], [4, 3], [20, 2, 3, 4], [2, 3, 4, 5]]:
|
|
input_tensor = torch.zeros(tensor_size)
|
|
gain = 1.0
|
|
|
|
if use_gain:
|
|
gain = self._random_float(0.1, 2)
|
|
init.orthogonal_(input_tensor, gain=gain)
|
|
else:
|
|
init.orthogonal_(input_tensor)
|
|
|
|
rows, cols = tensor_size[0], reduce(mul, tensor_size[1:])
|
|
flattened_tensor = input_tensor.view(rows, cols)
|
|
if rows > cols:
|
|
self.assertEqual(torch.mm(flattened_tensor.t(), flattened_tensor),
|
|
torch.eye(cols) * gain ** 2, atol=1e-6, rtol=0)
|
|
else:
|
|
self.assertEqual(torch.mm(flattened_tensor, flattened_tensor.t()),
|
|
torch.eye(rows) * gain ** 2, atol=1e-6, rtol=0)
|
|
|
|
def test_deprecation(self):
|
|
x = torch.randn(3, 3)
|
|
|
|
def fn():
|
|
init.normal(x)
|
|
|
|
with self.assertWarnsRegex(UserWarning, 'deprecated', msg='methods not suffixed with underscore should be deprecated'):
|
|
fn()
|
|
|
|
class TestFusionEval(TestCase):
|
|
@given(X=hu.tensor(shapes=((5, 3, 5, 5),)),
|
|
running_mean=hu.tensor(shapes=(6,)),
|
|
running_var=hu.tensor(shapes=(6,)))
|
|
def test_fuse_module_eval_numerics(self, X, running_mean, running_var):
|
|
inputs, _ = X
|
|
|
|
iC, oC = inputs.shape[1], len(running_mean[0])
|
|
inputs = torch.from_numpy(inputs).to(torch.double)
|
|
kernel_size = (3, 3)
|
|
|
|
conv_ref = torch.nn.Conv2d(iC, oC, bias=True, kernel_size=kernel_size)
|
|
bn_ref = torch.nn.BatchNorm2d(oC)
|
|
bn_ref.running_mean = torch.from_numpy(running_mean[0]).to(torch.double)
|
|
bn_ref.running_var = torch.from_numpy(running_var[0]).to(torch.double)
|
|
|
|
conv_ref.eval()
|
|
bn_ref.eval()
|
|
|
|
Y_ref = bn_ref(conv_ref(inputs))
|
|
conv_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref,
|
|
bn_ref)
|
|
Y_hat = conv_bn_fused(inputs)
|
|
|
|
self.assertEqual(Y_ref, Y_hat, msg="Conv+BN fusion results are off")
|
|
|
|
na_bn_ref = torch.nn.BatchNorm2d(oC, affine=False)
|
|
na_bn_ref.running_mean = torch.from_numpy(running_mean[0]).to(torch.double)
|
|
na_bn_ref.running_var = torch.from_numpy(running_var[0]).to(torch.double)
|
|
na_bn_ref.eval()
|
|
|
|
Y_ref = na_bn_ref(conv_ref(inputs))
|
|
conv_na_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref,
|
|
na_bn_ref)
|
|
Y_hat = conv_na_bn_fused(inputs)
|
|
|
|
self.assertEqual(Y_ref, Y_hat, msg="Conv+BN(non-affine) fusion results are off")
|
|
|
|
|
|
class TestConstantPadNd(TestCase):
|
|
def test_constant_pad_nd(self):
|
|
a = torch.tensor([[1, 2], [3, 4]])
|
|
res = torch.constant_pad_nd(a, [1, 2, 1, 0], 9)
|
|
expected = torch.tensor([
|
|
[9, 9, 9, 9, 9],
|
|
[9, 1, 2, 9, 9],
|
|
[9, 3, 4, 9, 9]
|
|
])
|
|
self.assertEqual(res, expected)
|
|
|
|
def test_preserves_memory_format(self):
|
|
nchw_tensor = torch.rand((1, 2, 5, 3))
|
|
nchw_padded = torch.constant_pad_nd(nchw_tensor, [1, 2], 0.5)
|
|
self.assertTrue(nchw_padded.is_contiguous(memory_format=torch.contiguous_format))
|
|
|
|
nhwc_tensor = nchw_tensor.contiguous(memory_format=torch.channels_last)
|
|
nhwc_padded = torch.constant_pad_nd(nhwc_tensor, [1, 2], 0.5)
|
|
self.assertTrue(nhwc_padded.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
|
|
class TestAddRelu(TestCase):
|
|
def test_add_relu(self):
|
|
a = torch.rand((7, 11))
|
|
b = torch.rand((7, 11))
|
|
a = a.float()
|
|
b = b.float()
|
|
a = a * -10
|
|
a = a + 5
|
|
add_res = a + b
|
|
relu_res = torch.relu(add_res)
|
|
add_relu_res = torch._VF._add_relu(a, b)
|
|
|
|
self.assertTrue(torch.allclose(add_relu_res, relu_res))
|
|
|
|
|
|
def add_test(test, decorator=None):
|
|
def add(test_name, fn):
|
|
if hasattr(TestNN, test_name):
|
|
raise RuntimeError('Found two tests with the same name: ' + test_name)
|
|
if decorator is not None:
|
|
fn = decorator(fn)
|
|
setattr(TestNN, test_name, fn)
|
|
|
|
test_name = test.get_name()
|
|
if not hasattr(test, 'test_cpu') or test.test_cpu:
|
|
add(test_name, lambda self, test=test: test(self))
|
|
cuda_test_name = test_name + '_cuda'
|
|
# With dtype enable, it's good enough to test against three floating types
|
|
kwargs = {}
|
|
if 'extra_args' in get_function_arglist(test.test_cuda):
|
|
kwargs['extra_args'] = test.extra_args
|
|
|
|
if 'dtype' in get_function_arglist(test.test_cuda):
|
|
if tf32_is_not_fp32() and test.with_tf32:
|
|
|
|
def with_tf32_off(self, test=test, kwargs=kwargs):
|
|
with tf32_off():
|
|
test.test_cuda(self, dtype=torch.float, **kwargs)
|
|
|
|
add(cuda_test_name + '_fp32', with_tf32_off)
|
|
|
|
def with_tf32_on(self, test=test, kwargs=kwargs):
|
|
with tf32_on(self, test.tf32_precision):
|
|
test.test_cuda(self, dtype=torch.float, **kwargs)
|
|
|
|
add(cuda_test_name + '_tf32', with_tf32_on)
|
|
else:
|
|
add(cuda_test_name + '_float', lambda self,
|
|
test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.float, **kwargs))
|
|
add(cuda_test_name + '_double', lambda self,
|
|
test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.double, **kwargs))
|
|
|
|
def test_half(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.half, **kwargs)
|
|
if getattr(test, 'check_half', True):
|
|
add(cuda_test_name + '_half', test_half)
|
|
|
|
def test_bfloat16(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.bfloat16, **kwargs)
|
|
if getattr(test, 'check_bfloat16', True):
|
|
add(cuda_test_name + '_bfloat16', test_bfloat16)
|
|
|
|
def test_cfloat(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.cfloat, **kwargs)
|
|
|
|
def test_cdouble(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.cdouble, **kwargs)
|
|
if getattr(test, 'check_complex', False):
|
|
add(cuda_test_name + '_cfloat', test_cfloat)
|
|
add(cuda_test_name + '_cdouble', test_cdouble)
|
|
|
|
else:
|
|
if tf32_is_not_fp32() and test.with_tf32:
|
|
|
|
def with_tf32_off(self, test=test, kwargs=kwargs):
|
|
with tf32_off():
|
|
test.test_cuda(self, **kwargs)
|
|
|
|
add(cuda_test_name + '_fp32', with_tf32_off)
|
|
|
|
def with_tf32_on(self, test=test, kwargs=kwargs):
|
|
with tf32_on(self, test.tf32_precision):
|
|
test.test_cuda(self, **kwargs)
|
|
|
|
add(cuda_test_name + '_tf32', with_tf32_on)
|
|
else:
|
|
add(cuda_test_name, lambda self, test=test, kwargs=kwargs: test.test_cuda(self, **kwargs))
|
|
|
|
for test_params in module_tests + new_module_tests:
|
|
# TODO: CUDA is not implemented yet
|
|
if 'constructor' not in test_params:
|
|
name = test_params.pop('module_name')
|
|
test_params['constructor'] = getattr(nn, name)
|
|
decorator = test_params.pop('decorator', None)
|
|
test = NewModuleTest(**test_params)
|
|
add_test(test, decorator)
|
|
if 'check_eval' in test_params:
|
|
# create a new test that is identical but that sets module.training to False
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'eval' if desc is None else desc + '_eval'
|
|
|
|
def gen_eval_constructor(constructor):
|
|
def eval_constructor(*args, **kwargs):
|
|
cons = constructor(*args, **kwargs)
|
|
cons.training = False
|
|
return cons
|
|
eval_constructor.__name__ = constructor.__name__
|
|
return eval_constructor
|
|
|
|
test_params['constructor'] = gen_eval_constructor(test_params['constructor'])
|
|
test = NewModuleTest(**test_params)
|
|
add_test(test, decorator)
|
|
if 'check_with_long_tensor' in test_params:
|
|
fullname = test_params.get('fullname', None)
|
|
if fullname:
|
|
test_params['fullname'] = fullname + '_with_long_tensor'
|
|
else:
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'with_long_tensor' if desc is None else desc + '_with_long_tensor'
|
|
|
|
def double_equivalent_of_long_tensor(size):
|
|
return torch.randint(-1000, 1000, size=size).double()
|
|
|
|
def apply_to_cons(t):
|
|
if t.is_floating_point():
|
|
if isinstance(t, Parameter):
|
|
return Parameter(double_equivalent_of_long_tensor(t.size()))
|
|
elif isinstance(t, torch.Tensor):
|
|
return double_equivalent_of_long_tensor(t.size())
|
|
else:
|
|
return t
|
|
|
|
def gen_long_tensor_constructor(constructor):
|
|
def long_tensor_constructor(*args, **kwargs):
|
|
cons = constructor(*args, **kwargs)
|
|
cons._apply(apply_to_cons)
|
|
return cons
|
|
long_tensor_constructor.__name__ = constructor.__name__
|
|
return long_tensor_constructor
|
|
|
|
def gen_long_tensor_input(input_size):
|
|
def input_func():
|
|
return double_equivalent_of_long_tensor(input_size)
|
|
return input_func
|
|
|
|
def reference_fn(i, p, m):
|
|
# For bad reasons this would create LongTensors that requires gradients
|
|
# Remove requires_grad to avoid this
|
|
for p in m.parameters():
|
|
p.requires_grad_(False)
|
|
m._apply(lambda t: t.long())
|
|
input = i.long()
|
|
out = m.forward(input)
|
|
return out
|
|
|
|
test_params['constructor'] = gen_long_tensor_constructor(test_params['constructor'])
|
|
test_params['input_fn'] = gen_long_tensor_input(test_params['input_size'])
|
|
test_params['reference_fn'] = reference_fn
|
|
test_params['check_forward_only'] = True
|
|
# Currently we don't support conv2d/conv3d for LongTensor in CUDA
|
|
test_params['test_cuda'] = False
|
|
test = NewModuleTest(**test_params)
|
|
|
|
add_test(test, decorator)
|
|
|
|
for test_params in criterion_tests:
|
|
name = test_params.pop('module_name')
|
|
test_params['constructor'] = getattr(nn, name)
|
|
test = CriterionTest(**test_params)
|
|
decorator = test_params.pop('decorator', None)
|
|
add_test(test, decorator)
|
|
if 'check_sum_reduction' in test_params:
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'sum_reduction' if desc is None else desc + '_sum_reduction'
|
|
|
|
def gen_sum_reduction_constructor(constructor):
|
|
def sum_reduction_constructor(*args, **kwargs):
|
|
cons = constructor(*args, reduction='sum', **kwargs)
|
|
return cons
|
|
sum_reduction_constructor.__name__ = constructor.__name__
|
|
return sum_reduction_constructor
|
|
|
|
test_params['constructor'] = gen_sum_reduction_constructor(test_params['constructor'])
|
|
test = CriterionTest(**test_params)
|
|
add_test(test, decorator)
|
|
|
|
|
|
class UnpoolingNet(nn.Module):
|
|
def __init__(self, pool, unpool):
|
|
super(UnpoolingNet, self).__init__()
|
|
self.pool = pool
|
|
self.unpool = unpool
|
|
|
|
def forward(self, input):
|
|
return self.unpool(*self.pool(input))
|
|
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool1d(2, return_indices=True),
|
|
nn.MaxUnpool1d(2)),
|
|
input_size=(1, 1, 4),
|
|
fullname='MaxUnpool1d_net',))
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool2d(2, return_indices=True),
|
|
nn.MaxUnpool2d(2)),
|
|
input_size=(1, 1, 2, 4),
|
|
fullname='MaxUnpool2d_net',))
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool3d(2, return_indices=True),
|
|
nn.MaxUnpool3d(2)),
|
|
input_size=(1, 1, 2, 4, 6),
|
|
fullname='MaxUnpool3d_net',
|
|
check_gradgrad=False,))
|
|
|
|
|
|
class _AdaptiveLogSoftmaxWithLoss(nn.AdaptiveLogSoftmaxWithLoss):
|
|
def __call__(self, input):
|
|
t = torch.tensor([0, 1, 4, 8]).to(input.device)
|
|
return nn.AdaptiveLogSoftmaxWithLoss.__call__(self, input, t).output
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: _AdaptiveLogSoftmaxWithLoss(16, 10, [2, 6]),
|
|
input_size=(4, 16),
|
|
fullname='AdaptiveLogSoftmax',
|
|
with_tf32=True,
|
|
tf32_precision=0.005))
|
|
|
|
|
|
# The following are helpers for TestNN.test_affine_*
|
|
if torch.cuda.is_available():
|
|
def device_():
|
|
return ['cpu', 'cuda']
|
|
else:
|
|
def device_():
|
|
return ['cpu']
|
|
|
|
|
|
def angle_rad_():
|
|
return [r * math.pi * 2 for r in [0.0, 0.5, 0.25, 0.125, random.random()]]
|
|
|
|
|
|
def axis_vector_():
|
|
t = (random.random(), random.random(), random.random())
|
|
l = sum(x ** 2 for x in t) ** 0.5
|
|
|
|
return [(1.0, 0.0, 0.0), (0.0, 1.0, 0.0), (0.0, 0.0, 1.0), tuple(x / l for x in t)]
|
|
|
|
|
|
def input_size2d_():
|
|
return [[1, 1, 3, 5], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 3, 4]]
|
|
|
|
|
|
def output_size2d_():
|
|
return [[1, 1, 5, 3], [1, 1, 3, 5], [1, 1, 4, 3], [1, 1, 5, 5], [1, 1, 6, 6]]
|
|
|
|
|
|
def input_size2dsq_():
|
|
return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 6, 6]]
|
|
|
|
|
|
def output_size2dsq_():
|
|
return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 5, 5], [1, 1, 6, 6]]
|
|
|
|
|
|
def input_size3d_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 2, 3, 4], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 3, 4, 5]]
|
|
|
|
|
|
def input_size3dsq_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def output_size3dsq_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def output_size3d_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 3, 4, 5], [1, 1, 4, 3, 2], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad):
|
|
input_center = [(x - 1) / 2.0 for x in input_size]
|
|
output_center = [(x - 1) / 2.0 for x in output_size]
|
|
|
|
s = math.sin(angle_rad)
|
|
c = math.cos(angle_rad)
|
|
|
|
intrans_ary = np.array([
|
|
[1, 0, input_center[2]],
|
|
[0, 1, input_center[3]],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
inscale_ary = np.array([
|
|
[input_center[2], 0, 0],
|
|
[0, input_center[3], 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
rotation_ary = np.array([
|
|
[c, -s, 0],
|
|
[s, c, 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outscale_ary = np.array([
|
|
[1.0 / output_center[2], 0, 0],
|
|
[0, 1.0 / output_center[3], 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outtrans_ary = np.array([
|
|
[1, 0, -output_center[2]],
|
|
[0, 1, -output_center[3]],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
reorder_ary = np.array([
|
|
[0, 1, 0],
|
|
[1, 0, 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
transform_ary = np.dot(np.dot(np.dot(np.dot(
|
|
intrans_ary,
|
|
inscale_ary),
|
|
rotation_ary.T),
|
|
outscale_ary),
|
|
outtrans_ary)
|
|
grid_ary = np.dot(np.dot(np.dot(reorder_ary, rotation_ary.T), outscale_ary), outtrans_ary)
|
|
|
|
transform_tensor = torch.from_numpy((rotation_ary)).to(device, torch.float32)
|
|
transform_tensor = transform_tensor[:2].unsqueeze(0)
|
|
|
|
return transform_tensor, transform_ary, grid_ary
|
|
|
|
|
|
def _buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector):
|
|
input_center = [(x - 1) / 2.0 for x in input_size]
|
|
output_center = [(x - 1) / 2.0 for x in output_size]
|
|
|
|
s = math.sin(angle_rad)
|
|
c = math.cos(angle_rad)
|
|
c1 = 1 - c
|
|
|
|
intrans_ary = np.array([
|
|
[1, 0, 0, input_center[2]],
|
|
[0, 1, 0, input_center[3]],
|
|
[0, 0, 1, input_center[4]],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
inscale_ary = np.array([
|
|
[input_center[2], 0, 0, 0],
|
|
[0, input_center[3], 0, 0],
|
|
[0, 0, input_center[4], 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
l, m, n = axis_vector
|
|
scipyRotation_ary = np.array([
|
|
[l * l * c1 + c, m * l * c1 - n * s, n * l * c1 + m * s, 0],
|
|
[l * m * c1 + n * s, m * m * c1 + c, n * m * c1 - l * s, 0],
|
|
[l * n * c1 - m * s, m * n * c1 + l * s, n * n * c1 + c, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
z, y, x = axis_vector
|
|
torchRotation_ary = np.array([
|
|
[x * x * c1 + c, y * x * c1 - z * s, z * x * c1 + y * s, 0],
|
|
[x * y * c1 + z * s, y * y * c1 + c, z * y * c1 - x * s, 0],
|
|
[x * z * c1 - y * s, y * z * c1 + x * s, z * z * c1 + c, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outscale_ary = np.array([
|
|
[1.0 / output_center[2], 0, 0, 0],
|
|
[0, 1.0 / output_center[3], 0, 0],
|
|
[0, 0, 1.0 / output_center[4], 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outtrans_ary = np.array([
|
|
[1, 0, 0, -output_center[2]],
|
|
[0, 1, 0, -output_center[3]],
|
|
[0, 0, 1, -output_center[4]],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
reorder_ary = np.array([
|
|
[0, 0, 1, 0],
|
|
[0, 1, 0, 0],
|
|
[1, 0, 0, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
transform_ary = np.dot(np.dot(np.dot(np.dot(
|
|
intrans_ary,
|
|
inscale_ary),
|
|
np.linalg.inv(scipyRotation_ary)),
|
|
outscale_ary),
|
|
outtrans_ary)
|
|
grid_ary = np.dot(np.dot(np.dot(reorder_ary, np.linalg.inv(scipyRotation_ary)), outscale_ary), outtrans_ary)
|
|
|
|
transform_tensor = torch.from_numpy((torchRotation_ary)).to(device, torch.float32)
|
|
transform_tensor = transform_tensor[:3].unsqueeze(0)
|
|
|
|
return transform_tensor, transform_ary, grid_ary
|
|
# end TestNN.test_affine_* helpers
|
|
|
|
|
|
class TestNNDeviceType(NNTestCase):
|
|
def _test_dropout(self, cls, device, input, memory_format=torch.contiguous_format):
|
|
p = 0.2
|
|
input = input.to(device).fill_(1 - p)
|
|
|
|
module = cls(p)
|
|
input_var = input.clone(memory_format=memory_format).requires_grad_()
|
|
output = module(input_var)
|
|
self.assertTrue(output.is_contiguous(memory_format=memory_format))
|
|
self.assertLess(abs(output.data.mean() - (1 - p)), 0.05)
|
|
output.backward(input)
|
|
self.assertTrue(input_var.grad.is_contiguous(memory_format=memory_format))
|
|
self.assertLess(abs(input_var.grad.data.mean() - (1 - p)), 0.05)
|
|
|
|
module = cls(p, True)
|
|
input_var = input.clone(memory_format=memory_format).requires_grad_()
|
|
output = module(input_var + 0)
|
|
self.assertTrue(output.is_contiguous(memory_format=memory_format))
|
|
self.assertLess(abs(output.data.mean() - (1 - p)), 0.05)
|
|
output.backward(input)
|
|
self.assertTrue(input_var.grad.is_contiguous(memory_format=memory_format))
|
|
self.assertLess(abs(input_var.grad.data.mean() - (1 - p)), 0.05)
|
|
|
|
# check eval mode doesn't change anything
|
|
for inplace in [True, False]:
|
|
module = cls(p, inplace).eval()
|
|
self.assertEqual(input, module(input))
|
|
|
|
# Check that these don't raise errors
|
|
module.__repr__()
|
|
str(module)
|
|
|
|
def _test_dropout_discontiguous(self, cls, device, memory_format=torch.contiguous_format):
|
|
# In this test, we verify that dropout preserves the layout and data for different memory formats.
|
|
# We check whether, we get same values for the output of dropout, when the probability
|
|
# of dropout is 0 or very close to 0.
|
|
# Reference: https://github.com/pytorch/pytorch/issues/47176
|
|
close_to_zero_p = 1e-10 # Should be almost zero but not zero, as for p=0 different path is taken
|
|
for p in [0, close_to_zero_p]:
|
|
inp = torch.ones(2, 3, 3, 3, device=device)
|
|
inp_discontiguous = torch.empty(2, 3, 3, 6, device=device, memory_format=memory_format)[..., ::2]
|
|
inp_discontiguous.copy_(inp)
|
|
mod = cls(p=p)
|
|
out = mod(inp_discontiguous)
|
|
if p != 0: # Zero will keep strides as is based on input.
|
|
# When prob == 0, input stride (54, 18, 6, 2) -> output stride (54, 18, 6, 2)
|
|
# When prob != 0, input stride (54, 18, 6, 2) -> output stride (27, 9, 3, 1)
|
|
self.assertTrue(out.is_contiguous(memory_format=memory_format))
|
|
self.assertEqual(inp_discontiguous, out)
|
|
|
|
def _test_dropout_stride_mean_preserve(self, cls, device):
|
|
def invert_perm(p):
|
|
d = {x: i for i, x in enumerate(p)}
|
|
return (d[0], d[1], d[2], d[3])
|
|
|
|
inp = torch.ones(2, 3, 4, 5, device=device)
|
|
shifts = [(0, 0), (1, 0), (0, 1), (1, 1)]
|
|
for perm in itertools.permutations((0, 1, 2, 3), r=4):
|
|
for shift in shifts:
|
|
for p in [1e-10, 0.3, 0.5, 0.7]:
|
|
mod = cls(p=p)
|
|
permuted_inp = inp.permute(perm).contiguous().permute(invert_perm(perm))
|
|
permuted_inp = permuted_inp[shift[0]:, shift[1]:, :, :]
|
|
out = mod(permuted_inp)
|
|
|
|
self.assertTrue(out.permute(perm).is_contiguous())
|
|
self.assertEqual(inp.mean(), out.mean(), rtol=0.5, atol=0.5)
|
|
if p == 1e-10:
|
|
self.assertEqual(permuted_inp, out)
|
|
else:
|
|
self.assertNotEqual(permuted_inp, out)
|
|
|
|
def _test_InstanceNorm_general(self, cls, input, device, dtype=torch.float):
|
|
# default case track_running_stats=False
|
|
b, c = input.size(0), input.size(1)
|
|
input_var = input.to(device=device, dtype=dtype).requires_grad_()
|
|
|
|
IN = cls(c, eps=0).to(device, dtype)
|
|
|
|
output = IN(input_var)
|
|
out_reshaped = output.view(b * c, -1)
|
|
|
|
mean = out_reshaped.mean(1)
|
|
var = out_reshaped.var(1, unbiased=False)
|
|
|
|
self.assertEqual(torch.abs(mean.data).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), 1, atol=1e-5, rtol=0)
|
|
|
|
# check that eval mode doesn't change behavior
|
|
grad_out = torch.randn_like(output)
|
|
res1 = output.data.clone()
|
|
output.backward(grad_out)
|
|
grad1 = input_var.grad.data.clone()
|
|
|
|
IN.eval()
|
|
output = IN(input_var)
|
|
input_var.grad = None
|
|
output.backward(grad_out)
|
|
res2 = output.data
|
|
grad2 = input_var.grad.data
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
# If track_running_stats=True and momentum=1, running_mean/var should be
|
|
# equal to mean/var of the input (with unbias correction)
|
|
IN = cls(c, momentum=1, eps=0, track_running_stats=True).to(device, dtype)
|
|
|
|
output = IN(input_var)
|
|
|
|
input_reshaped = input_var.transpose(1, 0).reshape(c, -1)
|
|
mean = input_reshaped.mean(1)
|
|
|
|
input_reshaped = input_var.transpose(1, 0).reshape(c, b, -1)
|
|
var = input_reshaped.var(2, unbiased=True)[:, :]
|
|
|
|
self.assertEqual(torch.abs(mean.data - IN.running_mean).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var.data.mean(1) - IN.running_var).mean(), 0, atol=1e-5, rtol=0)
|
|
|
|
# in eval mode, adding X * std to a channel in input should make the
|
|
# corresponding channel in output have mean X
|
|
IN.eval()
|
|
delta = IN.running_var.sqrt() * torch.arange(c, device=device, dtype=dtype)
|
|
delta = delta.view(-1, *[1 for _ in range(2, input.dim())])
|
|
output = IN(input_var + delta)
|
|
self.assertEqual(output.transpose(0, 1).reshape(c, -1).mean(1), torch.arange(c, dtype=dtype))
|
|
|
|
def _test_InstanceNorm_cuda_half(self, cls, input, device):
|
|
# THNN
|
|
input = input.to(device=device, dtype=torch.half).random_(1, 10).requires_grad_(True)
|
|
m = cls(input.size(1), affine=True, track_running_stats=True).to(device, torch.half)
|
|
thnn_output = m(input)
|
|
thnn_output.sum().backward()
|
|
thnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(thnn_output, input)
|
|
# cuDNN
|
|
if TEST_CUDNN:
|
|
input.grad = None
|
|
m = m.float()
|
|
cudnn_output = m(input)
|
|
cudnn_output.sum().backward()
|
|
cudnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(cudnn_output, input)
|
|
self.assertEqual(cudnn_output, thnn_output, atol=1e-4, rtol=0)
|
|
self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0)
|
|
|
|
def _test_LayerNorm_general(self, device, dtype=torch.float):
|
|
for i in range(2, 6):
|
|
shape = torch.randint(3, 6, (i,), dtype=torch.long).tolist()
|
|
x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
normalized_ndim = random.randint(1, i - 1) # inclusive
|
|
normalized_shape = shape[-normalized_ndim:]
|
|
unnormalized_shape = shape[:-normalized_ndim]
|
|
|
|
# test that LN normalizes to mean 0 and stddev 1
|
|
ln = nn.LayerNorm(normalized_shape, eps=0).to(device, dtype)
|
|
ln.weight.data.fill_(1)
|
|
ln.bias.data.fill_(0)
|
|
output = ln(x)
|
|
out_reshaped = output.view(*(unnormalized_shape + [-1]))
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
|
|
delta = 1e-1 if dtype == torch.bfloat16 else 1e-5
|
|
self.assertEqual(torch.abs(mean.data).mean(), 0, atol=delta, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), 1, atol=delta, rtol=0)
|
|
|
|
# test that LN applies weight and bias correctly
|
|
scale, bias = torch.empty(2).uniform_(0.2, 2).tolist()
|
|
ln.weight.data.fill_(scale)
|
|
ln.bias.data.fill_(bias)
|
|
output = ln(x)
|
|
out_reshaped = output.view(*(unnormalized_shape + [-1]))
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
self.assertEqual(torch.abs(mean.data).mean(), bias, atol=delta, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), scale ** 2, atol=delta, rtol=0)
|
|
|
|
bad_norm_shape_input_shape = {
|
|
(): (),
|
|
(2, 3): (3,),
|
|
(2,): (1, 2, 3),
|
|
(10,): (2, 3),
|
|
10: (2, 3),
|
|
}
|
|
for norm_shape, input_shape in bad_norm_shape_input_shape.items():
|
|
ln = nn.LayerNorm(norm_shape)
|
|
input = torch.empty(input_shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
self.assertRaises(RuntimeError, lambda: ln(input))
|
|
|
|
def _test_LayerNorm_cuda_half(self, device):
|
|
input = torch.empty(2, 3, 3, 2, device=device, dtype=torch.half).random_(1, 10).requires_grad_(True)
|
|
m = nn.LayerNorm([3, 2]).to(device, torch.half)
|
|
output = m(input)
|
|
output.sum().backward()
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
def _test_GroupNorm_general(self, device, dtype=torch.float):
|
|
good_shape_g = {
|
|
(1, 2, 3, 4): 2,
|
|
(2, 3, 10): 3,
|
|
(3, 1, 1, 1, 2): 1,
|
|
(2, 6, 4, 2, 2): 3,
|
|
(1, 256, 1, 1): 32,
|
|
}
|
|
for shape_g, grad in product(good_shape_g.items(), [True, False]):
|
|
shape, g = shape_g
|
|
x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
x.requires_grad_(grad)
|
|
b = shape[0]
|
|
c = shape[1]
|
|
|
|
# test that GN normalizes to mean 0 and stddev 1
|
|
gn = nn.GroupNorm(g, c, eps=0).to(device, dtype)
|
|
gn.weight.data.fill_(1)
|
|
gn.bias.data.fill_(0)
|
|
output = gn(x)
|
|
out_reshaped = output.view(b, g, -1)
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
# TODO: fix numerical issue. See #44863
|
|
self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-3, rtol=1e-3)
|
|
self.assertEqual(torch.abs(var).mean(), 1, atol=1e-3, rtol=1e-3)
|
|
|
|
output.backward(torch.randn_like(output))
|
|
if output.is_cuda:
|
|
torch.cuda.synchronize()
|
|
|
|
# test that GN applies weight and bias correctly
|
|
scale = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2)
|
|
bias = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2)
|
|
gn.weight.data.copy_(scale)
|
|
gn.bias.data.copy_(bias)
|
|
output = gn(x)
|
|
out_reshaped = output.view(b, c, -1)
|
|
out_normed = (out_reshaped - bias.view(c, 1)) / scale.view(c, 1)
|
|
out_normed_reshaped = out_normed.view(b, g, -1)
|
|
mean = out_normed_reshaped.mean(-1)
|
|
var = out_normed_reshaped.var(-1, unbiased=False)
|
|
# TODO: fix numerical issue. See #44863
|
|
self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-3, rtol=1e-3)
|
|
self.assertEqual(torch.abs(var).mean(), 1, atol=1e-3, rtol=1e-3)
|
|
|
|
bad_shape_g = {
|
|
(1, 2, 3, 4): 3,
|
|
(2, 3, 10): 2,
|
|
(3, 1, 1, 1, 2): 10,
|
|
(2, 6, 4, 2, 2): 4,
|
|
}
|
|
for shape, g in bad_shape_g.items():
|
|
gn = nn.GroupNorm(g, shape[1])
|
|
input = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
self.assertRaises(RuntimeError, lambda: gn(input))
|
|
|
|
def _test_GroupNorm_cuda_half(self):
|
|
input = torch.zeros(2, 4, 3, 2, requires_grad=True).cuda().half().random_(1, 10)
|
|
m = nn.GroupNorm(2, 4).to("cuda", torch.half)
|
|
output = m(input)
|
|
output.sum().backward()
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
def _test_module_empty_input(self, module, inp, check_size=True):
|
|
inp.requires_grad_(True)
|
|
out = module(inp)
|
|
gO = torch.rand_like(out)
|
|
out.backward(gO)
|
|
if check_size:
|
|
self.assertEqual(out.size(), inp.size())
|
|
for p in module.parameters():
|
|
if p.requires_grad:
|
|
self.assertEqual(p.grad, torch.zeros_like(p.grad))
|
|
self.assertEqual(inp.grad, torch.zeros_like(inp))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@tf32_on_and_off()
|
|
def test_affine_2d_rotate0(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
input_size = [1, 1, 3, 3]
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = [1, 1, 5, 5]
|
|
angle_rad = 0.
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary.mean(), gridsample_ary.mean())
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@tf32_on_and_off(0.001)
|
|
def test_affine_2d_rotate90(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for input_size2dsq, output_size2dsq in \
|
|
itertools.product(input_size2dsq_(), output_size2dsq_()):
|
|
input_size = input_size2dsq
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = output_size2dsq
|
|
angle_rad = 0.25 * math.pi * 2
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=True))
|
|
|
|
if input_size2dsq == output_size2dsq:
|
|
self.assertEqual(scipy_ary.mean(), input_ary.mean())
|
|
self.assertEqual(scipy_ary[0, 0], input_ary[0, 0, 0, -1])
|
|
self.assertEqual(scipy_ary[0, -1], input_ary[0, 0, -1, -1])
|
|
self.assertEqual(scipy_ary[-1, -1], input_ary[0, 0, -1, 0])
|
|
self.assertEqual(scipy_ary[-1, 0], input_ary[0, 0, 0, 0])
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary.mean(), gridsample_ary.mean())
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@tf32_on_and_off(0.005)
|
|
def test_affine_2d_rotate45(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
input_size = [1, 1, 3, 3]
|
|
input_ary = np.array(np.zeros(input_size), dtype=np.float32)
|
|
input_ary[0, 0, 0, :] = 0.5
|
|
input_ary[0, 0, 2, 2] = 1.0
|
|
output_size = [1, 1, 3, 3]
|
|
angle_rad = 0.125 * math.pi * 2
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@tf32_on_and_off(0.005)
|
|
def test_affine_2d_rotateRandom(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for angle_rad, input_size2d, output_size2d in \
|
|
itertools.product(angle_rad_(), input_size2d_(), output_size2d_()):
|
|
|
|
input_size = input_size2d
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32).round(3)
|
|
output_size = output_size2d
|
|
|
|
input_ary[0, 0, 0, 0] = 2
|
|
input_ary[0, 0, 0, -1] = 4
|
|
input_ary[0, 0, -1, 0] = 6
|
|
input_ary[0, 0, -1, -1] = 8
|
|
|
|
transform_tensor, transform_ary, grid_ary = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
affine_tensor = affine_tensor.to('cpu')
|
|
|
|
for r in range(affine_tensor.size(1)):
|
|
for c in range(affine_tensor.size(2)):
|
|
grid_out = np.dot(grid_ary, [r, c, 1])
|
|
self.assertEqual(affine_tensor[0, r, c], grid_out[:2])
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@tf32_on_and_off(0.005)
|
|
def test_affine_3d_rotateRandom(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for angle_rad, axis_vector, input_size3d, output_size3d in \
|
|
itertools.product(angle_rad_(), axis_vector_(), input_size3d_(), output_size3d_()):
|
|
input_size = input_size3d
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = output_size3d
|
|
|
|
input_ary[0, 0, 0, 0, 0] = 2
|
|
input_ary[0, 0, 0, 0, -1] = 3
|
|
input_ary[0, 0, 0, -1, 0] = 4
|
|
input_ary[0, 0, 0, -1, -1] = 5
|
|
input_ary[0, 0, -1, 0, 0] = 6
|
|
input_ary[0, 0, -1, 0, -1] = 7
|
|
input_ary[0, 0, -1, -1, 0] = 8
|
|
input_ary[0, 0, -1, -1, -1] = 9
|
|
|
|
transform_tensor, transform_ary, grid_ary = \
|
|
_buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
affine_tensor = affine_tensor.to('cpu')
|
|
|
|
for i in range(affine_tensor.size(1)):
|
|
for r in range(affine_tensor.size(2)):
|
|
for c in range(affine_tensor.size(3)):
|
|
grid_out = np.dot(grid_ary, [i, r, c, 1])
|
|
self.assertEqual(affine_tensor[0, i, r, c], grid_out[:3])
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
def test_conv1d_same_padding(self, device):
|
|
# Test padding='same' outputs the correct shape
|
|
test_args = [
|
|
# in_size
|
|
range(50, 55),
|
|
# kernel_size
|
|
[1, 2, 3, 8],
|
|
# dilation
|
|
range(1, 4),
|
|
# stride
|
|
[1],
|
|
]
|
|
for in_size, k_size, dilation, stride in itertools.product(*test_args):
|
|
x = torch.rand(1, 1, in_size, device=device)
|
|
y = torch.rand(1, 1, k_size, device=device)
|
|
z = F.conv1d(x, y, padding='same', dilation=dilation, stride=stride)
|
|
self.assertEqual(z.size(2), int(math.ceil(in_size / stride)))
|
|
|
|
# Compare F.conv1d padding='same' output against manual padding
|
|
# Without strides/dilation
|
|
x = torch.rand(1, 1, 12, device=device)
|
|
y = torch.rand(1, 1, 3, device=device)
|
|
expect = F.conv1d(x, y, padding=1)
|
|
actual = F.conv1d(x, y, padding='same')
|
|
self.assertEqual(expect, actual)
|
|
|
|
# With dilation
|
|
x = torch.rand(1, 1, 12, device=device)
|
|
y = torch.rand(1, 1, 4, device=device)
|
|
expect = F.conv1d(x, y, padding=3, dilation=2)
|
|
actual = F.conv1d(x, y, padding='same', dilation=2)
|
|
self.assertEqual(expect, actual)
|
|
|
|
# Dilation with asymmetric padding
|
|
expect = F.conv1d(x, y, padding=5, dilation=3)[..., 1:]
|
|
actual = F.conv1d(x, y, padding='same', dilation=3)
|
|
self.assertEqual(expect, actual)
|
|
|
|
|
|
def test_conv2d_same_padding(self, device):
|
|
# Compare F.conv2d padding='same' output against manual padding
|
|
# Without strides/dilation
|
|
x = torch.rand(1, 1, 10, 11, device=device)
|
|
y = torch.rand(1, 1, 4, 5, device=device)
|
|
expect = F.conv2d(x, y, padding=(2, 2))[..., 1:, :]
|
|
actual = F.conv2d(x, y, padding='same')
|
|
self.assertEqual(expect, actual)
|
|
|
|
# With dilation
|
|
y = torch.rand(1, 1, 3, 4, device=device)
|
|
expect = F.conv2d(x, y, padding=(2, 3), dilation=2)
|
|
actual = F.conv2d(x, y, padding='same', dilation=2)
|
|
self.assertEqual(expect, actual)
|
|
|
|
# Dilation with asymmetric padding
|
|
y = torch.rand(1, 1, 4, 4, device=device)
|
|
expect = F.conv2d(x, y, padding=5, dilation=3)[..., 1:, 1:]
|
|
actual = F.conv2d(x, y, padding='same', dilation=3)
|
|
self.assertEqual(expect, actual)
|
|
|
|
def test_conv3d_same_padding(self, device):
|
|
# Compare F.conv3d padding='same' output against manual padding
|
|
# Without strides/dilation
|
|
x = torch.rand(1, 1, 10, 11, 12, device=device)
|
|
y = torch.rand(1, 1, 1, 2, 5, device=device)
|
|
expect = F.conv3d(x, y, padding=(0, 1, 2))[..., :, 1:, :]
|
|
actual = F.conv3d(x, y, padding='same')
|
|
self.assertEqual(expect, actual)
|
|
|
|
# With dilation
|
|
expect = F.conv3d(x, y, padding=(0, 1, 4), dilation=2)
|
|
actual = F.conv3d(x, y, padding='same', dilation=2)
|
|
self.assertEqual(expect, actual)
|
|
|
|
# Dilation with asymmetric padding
|
|
y = torch.rand(1, 1, 4, 4, 4, device=device)
|
|
expect = F.conv3d(x, y, padding=5, dilation=3)[..., 1:, 1:, 1:]
|
|
actual = F.conv3d(x, y, padding='same', dilation=3)
|
|
self.assertEqual(expect, actual)
|
|
|
|
def test_conv1d_valid_padding(self, device):
|
|
# Test F.conv1d padding='valid' is the same as no padding
|
|
x = torch.rand(1, 1, 10, device=device)
|
|
y = torch.rand(1, 1, 4, device=device)
|
|
expect = F.conv1d(x, y)
|
|
actual = F.conv1d(x, y, padding='valid')
|
|
self.assertEqual(expect, actual)
|
|
|
|
def test_conv2d_valid_padding(self, device):
|
|
# Test F.conv2d padding='valid' is the same as no padding
|
|
x = torch.rand(1, 1, 1, 10, device=device)
|
|
y = torch.rand(1, 1, 1, 4, device=device)
|
|
expect = F.conv2d(x, y)
|
|
actual = F.conv2d(x, y, padding='valid')
|
|
self.assertEqual(expect, actual)
|
|
|
|
def test_conv3d_valid_padding(self, device):
|
|
# Test F.conv3d padding='valid' is the same as no padding
|
|
x = torch.rand(1, 1, 1, 1, 10, device=device)
|
|
y = torch.rand(1, 1, 1, 1, 4, device=device)
|
|
expect = F.conv3d(x, y)
|
|
actual = F.conv3d(x, y, padding='valid')
|
|
self.assertEqual(expect, actual)
|
|
|
|
def test_conv1d_same_padding_backward(self, device):
|
|
# Test F.conv1d gradients work with padding='same'
|
|
x = torch.rand(1, 1, 12, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 4, device=device, requires_grad=True)
|
|
|
|
# Symmetric padding
|
|
z = F.conv1d(x, y, padding=3, dilation=2)
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv1d(x, y, padding='same', dilation=2)
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
x.grad, y.grad = None, None
|
|
|
|
# Asymmetric padding
|
|
z = F.conv1d(x, y, padding=2)[..., 1:]
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv1d(x, y, padding='same')
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
|
|
def test_conv2d_same_padding_backward(self, device):
|
|
# Test F.conv2d gradients work with padding='same'
|
|
x = torch.rand(1, 1, 10, 11, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 4, 5, device=device, requires_grad=True)
|
|
|
|
# Symmetric padding
|
|
z = F.conv2d(x, y, padding=(3, 4), dilation=2)
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv2d(x, y, padding='same', dilation=2)
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
x.grad, y.grad = None, None
|
|
|
|
# Asymmetric padding
|
|
y = torch.rand(1, 1, 4, 4, device=device, requires_grad=True)
|
|
z = F.conv2d(x, y, padding=2)[..., 1:, 1:]
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv1d(x, y, padding='same')
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
|
|
def test_conv3d_same_padding_backward(self, device):
|
|
# Test F.conv3d gradients work with padding='same'
|
|
x = torch.rand(1, 1, 1, 11, 12, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 1, 2, 5, device=device, requires_grad=True)
|
|
|
|
# Symmetric padding
|
|
z = F.conv3d(x, y, padding=(0, 1, 4), dilation=2)
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv3d(x, y, padding='same', dilation=2)
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
x.grad, y.grad = None, None
|
|
|
|
# Asymmetric padding
|
|
y = torch.rand(1, 1, 1, 4, 4, device=device, requires_grad=True)
|
|
z = F.conv3d(x, y, padding=2)[..., 1:, 1:]
|
|
z.sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
z = F.conv3d(x, y, padding='same')
|
|
z.sum().backward()
|
|
self.assertEqual(gx_expect, x.grad)
|
|
self.assertEqual(gy_expect, y.grad)
|
|
|
|
def test_conv1d_valid_padding_backward(self, device):
|
|
# Test F.conv1d gradients work with padding='valid'
|
|
x = torch.rand(1, 1, 10, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 4, device=device, requires_grad=True)
|
|
F.conv1d(x, y, padding=0).sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
F.conv1d(x, y, padding='valid').sum().backward()
|
|
gx_actual, gy_actual = x.grad, y.grad
|
|
self.assertEqual(gx_expect, gx_actual)
|
|
self.assertEqual(gy_expect, gy_actual)
|
|
|
|
def test_conv2d_valid_padding_backward(self, device):
|
|
# Test F.conv2d gradients work with padding='valid'
|
|
x = torch.rand(1, 1, 1, 10, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 1, 4, device=device, requires_grad=True)
|
|
F.conv2d(x, y, padding=0).sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
F.conv2d(x, y, padding='valid').sum().backward()
|
|
gx_actual, gy_actual = x.grad, y.grad
|
|
self.assertEqual(gx_expect, gx_actual)
|
|
self.assertEqual(gy_expect, gy_actual)
|
|
|
|
def test_conv3d_valid_padding_backward(self, device):
|
|
# Test F.conv3d gradients work with padding='valid'
|
|
x = torch.rand(1, 1, 1, 1, 10, device=device, requires_grad=True)
|
|
y = torch.rand(1, 1, 1, 1, 4, device=device, requires_grad=True)
|
|
F.conv3d(x, y, padding=0).sum().backward()
|
|
gx_expect, gy_expect = x.grad, y.grad
|
|
x.grad, y.grad = None, None
|
|
|
|
F.conv3d(x, y, padding='valid').sum().backward()
|
|
gx_actual, gy_actual = x.grad, y.grad
|
|
self.assertEqual(gx_expect, gx_actual)
|
|
self.assertEqual(gy_expect, gy_actual)
|
|
|
|
def test_Dropout(self, device):
|
|
input = torch.empty(1000)
|
|
self._test_dropout(nn.Dropout, device, input)
|
|
|
|
self._test_dropout_discontiguous(nn.Dropout, device)
|
|
self._test_dropout_discontiguous(nn.Dropout, device, memory_format=torch.channels_last)
|
|
|
|
self._test_dropout_stride_mean_preserve(nn.Dropout, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
input = input.bfloat16()
|
|
self._test_dropout(nn.Dropout, device, input)
|
|
|
|
def test_Dropout2d(self, device):
|
|
b = random.randint(1, 5)
|
|
w = random.randint(1, 5)
|
|
h = random.randint(1, 5)
|
|
num_features = 1000
|
|
input = torch.empty(num_features, b, w, h)
|
|
self._test_dropout(nn.Dropout2d, device, input)
|
|
self._test_dropout(nn.Dropout2d, device, input, memory_format=torch.channels_last)
|
|
|
|
self._test_dropout_discontiguous(nn.Dropout2d, device)
|
|
self._test_dropout_discontiguous(nn.Dropout2d, device, memory_format=torch.channels_last)
|
|
|
|
def test_Dropout3d(self, device):
|
|
b = random.randint(1, 5)
|
|
w = random.randint(1, 5)
|
|
h = random.randint(1, 5)
|
|
d = random.randint(1, 2)
|
|
num_features = 1000
|
|
input = torch.empty(num_features, b, d, w, h)
|
|
self._test_dropout(nn.Dropout3d, device, input)
|
|
|
|
self._test_dropout_discontiguous(nn.Dropout3d, device)
|
|
self._test_dropout_discontiguous(nn.Dropout3d, device, memory_format=torch.channels_last)
|
|
|
|
def test_InstanceNorm1d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
d = random.randint(8, 10)
|
|
|
|
input = torch.rand(b, c, d)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm1d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm1d, input, device)
|
|
|
|
def test_InstanceNorm2d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
w = random.randint(3, 6)
|
|
h = random.randint(6, 8)
|
|
|
|
input = torch.rand(b, c, h, w)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm2d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm2d, input, device)
|
|
|
|
def test_InstanceNorm3d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
w = random.randint(2, 5)
|
|
h = random.randint(2, 5)
|
|
d = random.randint(2, 5)
|
|
|
|
input = torch.rand(b, c, h, w, d)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm3d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm3d, input, device)
|
|
|
|
def test_instancenorm_raises_error_if_less_than_one_value_per_channel(self, device):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.InstanceNorm1d(10)(x).to(device)
|
|
|
|
def test_instancenorm_raises_error_for_single_spatial_element_during_training(self, device):
|
|
BATCH_SIZE = 10
|
|
NUM_CHANNELS = 3
|
|
norms = [torch.nn.InstanceNorm1d, torch.nn.InstanceNorm2d, torch.nn.InstanceNorm3d]
|
|
for i, norm in enumerate(norms):
|
|
m = norm(NUM_CHANNELS, track_running_stats=True)
|
|
m.to(device)
|
|
|
|
# Create an appropriately-sized input with a single spatial element.
|
|
input = torch.randn(BATCH_SIZE, NUM_CHANNELS, *[1 for _ in range(i + 1)],
|
|
device=device)
|
|
with self.assertRaises(ValueError):
|
|
m(input)
|
|
|
|
# Single spatial element should be fine in eval.
|
|
m.eval()
|
|
m(input)
|
|
|
|
def test_LayerNorm_general(self, device):
|
|
self._test_LayerNorm_general(device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_LayerNorm_general(device, dtype=torch.bfloat16)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_LayerNorm_cuda_half(device)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_GroupNorm_general(self, device):
|
|
self._test_GroupNorm_general(device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_GroupNorm_cuda_half()
|
|
|
|
def test_GroupNorm_raises_error_if_one_value_per_group(self, device):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.GroupNorm(10, 10)(x).to(device)
|
|
|
|
def test_GroupNorm_empty(self, device):
|
|
mod = torch.nn.GroupNorm(2, 4).to(device)
|
|
inp = torch.randn(0, 4, 2, 2, device=device)
|
|
self._test_module_empty_input(mod, inp)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_module_empty_input(mod, inp)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float64, torch.complex128)
|
|
def test_pad(self, device, dtype):
|
|
inputs = torch.randn(1, 3, 4, 4, device=device, dtype=dtype, requires_grad=True)
|
|
_assertGradAndGradgradChecks(self, lambda x: F.pad(x, (1, 1, 1, 1)), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL)
|
|
_assertGradAndGradgradChecks(self, lambda x: F.pad(x, (-1, 1, -2, 1)), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL)
|
|
_assertGradAndGradgradChecks(self, lambda x: F.pad(x, (-1, 1, -2, 1), value=2), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL)
|
|
self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='replicate'), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL))
|
|
self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='reflect'), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL))
|
|
self.assertTrue(gradcheck(lambda x: F.pad(x, (-1, 1, -2, 1), mode='circular'), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL))
|
|
|
|
inputs = torch.randn(1, 2, 3, 4, 4, device=device, dtype=dtype, requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x: F.pad(x, (1, 1, 1, 1, 1, 1), mode='replicate'), (inputs,),
|
|
nondet_tol=GRADCHECK_NONDET_TOL))
|
|
|
|
# Assert assertion errors are raised for invalid circular padding values
|
|
inputs = torch.randn(1, 1, 4, device=device, dtype=dtype, requires_grad=True)
|
|
# Should raise error when trying to wrap around more than once
|
|
self.assertRaises(AssertionError, lambda: F.pad(inputs, (5, 4), mode='circular'))
|
|
self.assertRaises(AssertionError, lambda: F.pad(inputs, (3, 6), mode='circular'))
|
|
# Should raise error when negative padding results in negative output shape
|
|
self.assertRaises(AssertionError, lambda: F.pad(inputs, (-3, -2), mode='circular'))
|
|
|
|
# assert that relfection padding errors when pad >= input size
|
|
expected_err_msg = r"Padding size should be less than the corresponding input dimension"
|
|
inputs = torch.randn(1, 1, 2, 3, device=device, dtype=dtype)
|
|
self.assertRaisesRegex(RuntimeError, expected_err_msg,
|
|
lambda: F.pad(inputs, (1, 1, 3, 0), mode='reflect'))
|
|
inputs = torch.randn(1, 1, 2, device=device, dtype=dtype)
|
|
self.assertRaisesRegex(RuntimeError, expected_err_msg,
|
|
lambda: F.pad(inputs, (2, 1), mode='reflect'))
|
|
|
|
inputs = torch.rand(1, 3, 4, 4, device=device, dtype=dtype)
|
|
# assert that pad doesn't return a view into the input tensor
|
|
for mode in 'constant', 'reflect', 'replicate', 'circular':
|
|
out = F.pad(inputs, (0, 0, 0, 0), mode=mode)
|
|
out.fill_(4)
|
|
self.assertTrue(torch.all(torch.abs(inputs) < 2))
|
|
|
|
out = F.pad(inputs, (0, 0, -1, -1), mode=mode)
|
|
out.fill_(4)
|
|
self.assertTrue(torch.all(torch.abs(inputs) < 2))
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float64, torch.complex128)
|
|
def test_ReplicationPad_empty(self, device, dtype):
|
|
for mod, inp in [
|
|
(torch.nn.ReplicationPad1d(3), torch.randn(0, 3, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReplicationPad2d(3), torch.randn(0, 3, 10, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReplicationPad3d(3), torch.randn(0, 3, 10, 10, 10, device=device, dtype=dtype))]:
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(NotImplementedError, 'Only 3D'):
|
|
mod = torch.nn.ReplicationPad1d(2)
|
|
inp = torch.randn(3, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 2D or 3D'):
|
|
mod = torch.nn.ReplicationPad1d(2)
|
|
inp = torch.randn(3, 0, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'):
|
|
mod = torch.nn.ReplicationPad2d((2, 2, 2, 2))
|
|
inp = torch.randn(43, 0, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 4D or 5D'):
|
|
mod = torch.nn.ReplicationPad3d((2, 2, 2, 2, 2, 2))
|
|
inp = torch.randn(3, 0, 10, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
def test_ReplicationPad1d_large(self, device):
|
|
shapes = ([2, 65736, 4], [65736, 2, 4])
|
|
pl, pr = 3, 4
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad1d((pl, pr))
|
|
|
|
# forward
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pl : -pr], x)
|
|
|
|
left_padding = out[:, :, : pl]
|
|
self.assertEqual(left_padding, x[:, :, :1].expand_as(left_padding))
|
|
right_padding = out[:, :, -pr :]
|
|
self.assertEqual(right_padding, x[:, :, -1:].expand_as(right_padding))
|
|
|
|
# backward
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1 : -1], g[:, :, pl + 1 : -pr - 1])
|
|
|
|
self.assertEqual(x.grad[:, :, 0], g[:, :, : pl + 1].sum(-1))
|
|
self.assertEqual(x.grad[:, :, -1], g[:, :, -pr - 1:].sum(-1))
|
|
|
|
def test_ReplicationPad2d_large(self, device):
|
|
shapes = ([2, 65736, 4, 4], [65736, 2, 4, 4])
|
|
pl, pr, pt, pb = 3, 4, 5, 6
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad2d((pl, pr, pt, pb))
|
|
|
|
# forward center, edge
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pt : -pb, pl : -pr], x)
|
|
|
|
left_padding = out[:, :, pt : -pb, : pl]
|
|
self.assertEqual(left_padding, x[:, :, :, :1].expand_as(left_padding))
|
|
right_padding = out[:, :, pt : -pb, -pr :]
|
|
self.assertEqual(right_padding, x[:, :, :, -1:].expand_as(right_padding))
|
|
top_padding = out[:, :, : pt, pl : -pr]
|
|
self.assertEqual(top_padding, x[:, :, :1, :].expand_as(top_padding))
|
|
bottom_padding = out[:, :, -pb : , pl : -pr]
|
|
self.assertEqual(bottom_padding, x[:, :, -1:, :].expand_as(bottom_padding))
|
|
|
|
# forward corner
|
|
tl_padding = out[:, :, : pt + 1, : pl + 1]
|
|
self.assertEqual(tl_padding, x[:, :, :1, :1].expand_as(tl_padding))
|
|
tr_padding = out[:, :, : pt + 1, -pr - 1:]
|
|
self.assertEqual(tr_padding, x[:, :, :1, -1:].expand_as(tr_padding))
|
|
bl_padding = out[:, :, -pb - 1:, : pl + 1]
|
|
self.assertEqual(bl_padding, x[:, :, -1:, :1].expand_as(bl_padding))
|
|
br_padding = out[:, :, -pb - 1:, -pr - 1:]
|
|
self.assertEqual(br_padding, x[:, :, -1:, -1:].expand_as(br_padding))
|
|
|
|
# backward center, edge
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1:-1, 1:-1], g[:, :, pt + 1 : -pb - 1, pl + 1 : -pr - 1])
|
|
|
|
self.assertEqual(x.grad[:, :, 1:-1, 0], g[:, :, pt + 1 : -pb - 1, : pl + 1].sum(-1))
|
|
self.assertEqual(x.grad[:, :, 1:-1, -1], g[:, :, pt + 1 : -pb - 1, -pr - 1 :].sum(-1))
|
|
self.assertEqual(x.grad[:, :, 0, 1:-1], g[:, :, : pt + 1, pl + 1 : -pr - 1].sum(-2))
|
|
self.assertEqual(x.grad[:, :, -1, 1:-1], g[:, :, -pb - 1 :, pl + 1 : -pr - 1].sum(-2))
|
|
|
|
# backward corner
|
|
self.assertEqual(x.grad[:, :, 0, 0], g[:, :, : pt + 1, : pl + 1].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, 0, -1], g[:, :, : pt + 1, -pr - 1 :].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, -1, 0], g[:, :, -pb - 1 :, : pl + 1].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, -1, -1], g[:, :, -pb - 1 :, -pr - 1 :].sum((-2, -1)))
|
|
|
|
@largeTensorTest("6GB")
|
|
def test_ReplicationPad3d_large(self, device):
|
|
shapes = ([1, 65736, 2, 2, 2], [65736, 1, 2, 2, 2])
|
|
pl, pr, pt, pbt, pf, pbk = 3, 4, 5, 6, 7, 8
|
|
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad3d((pl, pr, pt, pbt, pf, pbk))
|
|
|
|
# forward center
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pf : -pbk, pt : -pbt, pl : -pr], x)
|
|
|
|
# backward center
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1:-1, 1:-1, 1:-1], g[:, :, pf + 1 : -pbk - 1, pt + 1 : -pbt - 1, pl + 1 : -pr - 1])
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float32, torch.complex64)
|
|
def test_ReflectionPad_empty(self, device, dtype):
|
|
for mod, inp in [
|
|
(torch.nn.ReflectionPad1d(2), torch.randn(0, 3, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReflectionPad2d(2), torch.randn(0, 3, 10, 10, device=device, dtype=dtype))]:
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, '2D or 3D'):
|
|
mod = torch.nn.ReflectionPad1d(2)
|
|
inp = torch.randn(3, 0, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, '3D or 4D'):
|
|
mod = torch.nn.ReflectionPad2d(2)
|
|
inp = torch.randn(3, 0, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
@onlyCUDA # Test if CPU and GPU results match
|
|
def test_ReflectionPad2d_large(self, device):
|
|
shapes = ([2, 65736, 6, 6], [65736, 2, 6, 6])
|
|
pad = (1, 2, 3, 4)
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
ref_x = x.detach().cpu().requires_grad_()
|
|
|
|
out = F.pad(x, pad, mode='reflect')
|
|
ref_out = F.pad(ref_x, pad, mode='reflect')
|
|
|
|
self.assertEqual(out, ref_out)
|
|
|
|
g = torch.randn_like(out)
|
|
ref_g = g.cpu()
|
|
|
|
out.backward(g)
|
|
ref_out.backward(ref_g)
|
|
|
|
self.assertEqual(x.grad, ref_x.grad)
|
|
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float, torch.double)
|
|
def test_MarginLoss_empty(self, device, dtype):
|
|
for mod, x, y in [
|
|
(torch.nn.MultiMarginLoss().to(device),
|
|
torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype),
|
|
torch.ones(0, device=device).type(torch.long)),
|
|
(torch.nn.MultiLabelMarginLoss().to(device),
|
|
torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype),
|
|
torch.ones(0, 10, device=device).type(torch.long))]:
|
|
|
|
out = mod(x, y)
|
|
out.sum().backward()
|
|
|
|
self.assertEqual(x, torch.zeros_like(x))
|
|
self.assertEqual(x.grad, torch.zeros_like(x))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected'):
|
|
x = torch.randn(0, requires_grad=True, device=device, dtype=dtype)
|
|
y = torch.ones(10, device=device).type(torch.long)
|
|
mod(x, y)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected'):
|
|
x = torch.randn(10, 0, requires_grad=True, device=device, dtype=dtype)
|
|
y = torch.ones(10, 0, device=device).type(torch.long)
|
|
mod(x, y)
|
|
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_Unfold_empty(self, device):
|
|
inp = torch.randn(0, 3, 3, 4, device=device)
|
|
unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device)
|
|
self._test_module_empty_input(unfold, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'):
|
|
inp = torch.randn(3, 0, 3, 4, device=device)
|
|
unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device)
|
|
unfold(inp)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.float, torch.double)
|
|
@tf32_on_and_off(0.005)
|
|
def test_rnn_fused(self, device, dtype):
|
|
|
|
def copy_rnn(rnn1, rnn2):
|
|
for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights):
|
|
for x, y in zip(x_layer, y_layer):
|
|
x.data.copy_(y.data)
|
|
|
|
def check_rnn_grads(rnn1, rnn2):
|
|
for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights):
|
|
for x, y in zip(x_layer, y_layer):
|
|
self.assertEqual(x.grad, y.grad, atol=5e-5, rtol=0)
|
|
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, hidden_size, dtype=dtype)
|
|
hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
with torch.backends.cudnn.flags(enabled=False, allow_tf32=None):
|
|
for module in (nn.GRU, nn.LSTM):
|
|
for bias in (True, False):
|
|
rnn = module(input_size, hidden_size, num_layers, bias=bias).to(dtype)
|
|
rnn_device = module(input_size, hidden_size, num_layers, bias=bias).to(device, dtype)
|
|
copy_rnn(rnn, rnn_device)
|
|
|
|
is_lstm = isinstance(rnn, nn.LSTM)
|
|
if is_lstm:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
hx_val.clone().add(1).requires_grad_(True))
|
|
hx_device = (hx_val.clone().to(device).requires_grad_(True),
|
|
hx_val.clone().to(device).add(1).requires_grad_(True))
|
|
else:
|
|
hx = hx_val.clone().requires_grad_(True)
|
|
hx_device = hx_val.clone().to(device).requires_grad_(True)
|
|
|
|
inp = input_val.clone().requires_grad_(True)
|
|
inp_cu = input_val.clone().to(device).requires_grad_(True)
|
|
output1, hy1 = rnn(inp, hx)
|
|
output2, hy2 = rnn_device(inp_cu, hx_device)
|
|
if is_lstm:
|
|
torch.autograd.backward(
|
|
[output1, hy1[0], hy1[1]], [grad_output, grad_hy, grad_hy + 1]
|
|
)
|
|
torch.autograd.backward(
|
|
[output2, hy2[0], hy2[1]],
|
|
[grad_output.to(device), grad_hy.to(device), (grad_hy + 1).to(device)]
|
|
)
|
|
else:
|
|
torch.autograd.backward([output1, hy1], [grad_output, grad_hy])
|
|
torch.autograd.backward([output2, hy2], [grad_output.to(device), grad_hy.to(device)])
|
|
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hy1, hy2)
|
|
|
|
check_rnn_grads(rnn, rnn_device)
|
|
self.assertEqual(inp.grad, inp_cu.grad)
|
|
if is_lstm:
|
|
self.assertEqual(hx[0].grad, hx_device[0].grad)
|
|
self.assertEqual(hx[1].grad, hx_device[1].grad)
|
|
else:
|
|
self.assertEqual(hx.grad, hx_device.grad)
|
|
|
|
def test_BatchNorm_empty(self, device):
|
|
mod = torch.nn.BatchNorm2d(3).to(device)
|
|
inp = torch.randn(0, 3, 2, 2, device=device)
|
|
self._test_module_empty_input(mod, inp)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_module_empty_input(mod, inp)
|
|
|
|
self.assertEqual(mod.running_mean, torch.tensor([0., 0, 0], device=device))
|
|
self.assertEqual(mod.running_var, torch.tensor([1., 1, 1], device=device))
|
|
self.assertEqual(mod.weight.grad, torch.tensor([0., 0, 0], device=device))
|
|
self.assertEqual(mod.bias.grad, torch.tensor([0., 0, 0], device=device))
|
|
|
|
def test_group_conv_empty(self, device):
|
|
mod = torch.nn.Conv2d(4, 4, stride=2, kernel_size=3, padding=1, groups=4).to(device)
|
|
inp = torch.randn(0, 4, 4, 4, device=device)
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
|
|
def test_group_convTranspose_empty(self, device):
|
|
mod = torch.nn.ConvTranspose2d(4, 4, stride=2, kernel_size=3, padding=1, groups=4).to(device)
|
|
inp = torch.randn(0, 4, 4, 4, device=device)
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
|
|
def test_convTranspose_empty(self, device):
|
|
mod = torch.nn.ConvTranspose2d(4, 4, stride=2, kernel_size=3, padding=1).to(device)
|
|
inp = torch.randn(0, 4, 4, 4, device=device)
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_module_empty_input(mod, inp, check_size=False)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_AvgPool2d_empty(self, device):
|
|
avgpool = torch.nn.AvgPool2d(3, stride=2).to(device)
|
|
inp = torch.randn(0, 16, 20, 32, device=device)
|
|
self._test_module_empty_input(avgpool, inp, check_size=False)
|
|
|
|
clast_inp = torch.randn(0, 16, 20, 32, device=device).contiguous(memory_format=torch.channels_last)
|
|
self._test_module_empty_input(avgpool, clast_inp, check_size=False)
|
|
|
|
# test with empty non-batch input
|
|
with self.assertRaisesRegex(RuntimeError, '3D or 4D'):
|
|
inp = torch.randn(16, 0, 20, 32, device=device)
|
|
avgpool(inp)
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest('16GB')
|
|
def test_prelu_backward_32bit_indexing(self, device):
|
|
m = torch.nn.PReLU().cuda().half()
|
|
input_ = torch.ones((1024, 1024, 1024, 2), dtype=torch.half, device=device)
|
|
output = m(input_)
|
|
output.backward(input_)
|
|
|
|
def test_linear_empty(self, device):
|
|
mod = torch.nn.Linear(7, 7).to(device)
|
|
inp = torch.randn(0, 7, device=device)
|
|
self._test_module_empty_input(mod, inp)
|
|
|
|
def test_one_hot(self, device):
|
|
if self.device_type != 'cuda': # cuda throws device assert for invalid data
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, -1, 0], device=device), -1)
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 3)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device))
|
|
expected = torch.tensor([[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1],
|
|
[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -1)
|
|
expected = torch.tensor([[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1],
|
|
[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 6)
|
|
expected = torch.tensor([[0, 0, 0, 1, 0, 0],
|
|
[0, 0, 0, 0, 1, 0],
|
|
[0, 1, 0, 0, 0, 0],
|
|
[1, 0, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([[3, 4], [1, 0]], device=device))
|
|
expected = torch.tensor([[[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1]],
|
|
[[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor(4, device=device))
|
|
expected = torch.tensor([0, 0, 0, 0, 1], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device), 100)
|
|
expected = torch.empty([4, 0, 100], dtype=torch.long)
|
|
self.assertEqual(t, expected)
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device))
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -2)
|
|
|
|
def test_nn_scalars(self, device):
|
|
# One off tests to ensure scalars from nn.yaml are properly applied
|
|
def verify_scalars(input, output):
|
|
if input.dim() == 0:
|
|
self.assertEqual((), output.shape)
|
|
else:
|
|
self.assertNotEqual((), output.shape)
|
|
output.sum().backward()
|
|
self.assertEqual(input.shape, input.grad.shape)
|
|
|
|
for input_shape in [(5, 6), ()]:
|
|
for module in [torch.nn.ELU, torch.nn.Hardtanh, torch.nn.LeakyReLU, torch.nn.LogSigmoid,
|
|
torch.nn.RReLU, torch.nn.Softshrink, torch.nn.Softplus, torch.nn.Sigmoid,
|
|
torch.nn.Tanh]:
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
m = module()
|
|
output = m(input)
|
|
verify_scalars(input, output)
|
|
|
|
def test_nn_scalars_reductions(self, device):
|
|
# One off tests to ensure scalars from nn.yaml are properly applied
|
|
def verify_reduction_scalars(input, reduction, output):
|
|
if reduction != 'none' or input.dim() == 0:
|
|
self.assertEqual((), output.shape)
|
|
else:
|
|
self.assertNotEqual((), output.shape)
|
|
output.sum().backward()
|
|
self.assertEqual(input.shape, input.grad.shape)
|
|
|
|
for input_shape in [(5, 6), ()]:
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
for module in [torch.nn.BCELoss, torch.nn.L1Loss, torch.nn.MSELoss,
|
|
torch.nn.SmoothL1Loss, torch.nn.SoftMarginLoss]:
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
target = torch.empty(input_shape, device=device).random_(2)
|
|
sigmoid = nn.Sigmoid()
|
|
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
m = module(reduction=reduction)
|
|
output = m(sigmoid(input), target)
|
|
verify_reduction_scalars(input, reduction, output)
|
|
|
|
# verify that bogus reduction strings are errors
|
|
@onlyOnCPUAndCUDA
|
|
def test_invalid_reduction_strings(self, device):
|
|
input = torch.randn(3, 5, requires_grad=True, device=device)
|
|
cinput = torch.randn(3, 5, requires_grad=True, device=device, dtype=torch.cfloat)
|
|
target = torch.tensor([1, 0, 4], device=device)
|
|
var = torch.ones(size=input.size(), requires_grad=True, device=device)
|
|
|
|
for reduction in ['none', 'invalid']:
|
|
def v(fn):
|
|
if reduction == 'invalid':
|
|
self.assertRaises(ValueError, lambda: fn())
|
|
else:
|
|
fn()
|
|
|
|
v(lambda: F.nll_loss(input, target, reduction=reduction))
|
|
v(lambda: F.cross_entropy(input, target, reduction=reduction))
|
|
v(lambda: F.multi_margin_loss(input, target, reduction=reduction))
|
|
|
|
v(lambda: F.kl_div(input, input, reduction=reduction))
|
|
v(lambda: F.huber_loss(input, input, reduction=reduction))
|
|
v(lambda: F.smooth_l1_loss(input, input, reduction=reduction))
|
|
v(lambda: F.l1_loss(input, input, reduction=reduction))
|
|
v(lambda: F.l1_loss(cinput, cinput, reduction=reduction))
|
|
v(lambda: F.mse_loss(input, input, reduction=reduction))
|
|
v(lambda: F.hinge_embedding_loss(input, input, reduction=reduction))
|
|
v(lambda: F.poisson_nll_loss(input, input, reduction=reduction))
|
|
v(lambda: F.gaussian_nll_loss(input, input, var, reduction=reduction))
|
|
v(lambda: F.binary_cross_entropy_with_logits(input, input, reduction=reduction))
|
|
|
|
zeros = torch.zeros_like(input).to(torch.int64)
|
|
v(lambda: F.multilabel_soft_margin_loss(input, zeros, reduction=reduction))
|
|
v(lambda: F.multilabel_margin_loss(input, zeros, reduction=reduction))
|
|
|
|
v(lambda: F.triplet_margin_loss(input, input, input, reduction=reduction))
|
|
v(lambda: F.triplet_margin_with_distance_loss(input, input, input, reduction=reduction))
|
|
v(lambda: F.margin_ranking_loss(input, input, input.sign(), reduction=reduction))
|
|
v(lambda: F.cosine_embedding_loss(input, input, input[:, 0].sign(), reduction=reduction))
|
|
|
|
log_probs = torch.randn(50, 16, 20, requires_grad=True, device=device).log_softmax(2)
|
|
targets = torch.randint(1, 20, (16, 30), dtype=torch.long, device=device)
|
|
input_lengths = torch.full((16,), 50, dtype=torch.long, device=device)
|
|
target_lengths = torch.randint(10, 30, (16,), dtype=torch.long, device=device)
|
|
v(lambda: F.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction=reduction))
|
|
|
|
# FIXME: should we allow derivatives on these?
|
|
v(lambda: F.binary_cross_entropy(torch.sigmoid(input), input.detach(), reduction=reduction))
|
|
v(lambda: F.soft_margin_loss(input, input.sign().detach(), reduction=reduction))
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_smooth_l1_loss_vs_huber_loss(self, device):
|
|
def _make_test_tensor(shape, contiguous=True):
|
|
if contiguous:
|
|
test_tensor = torch.randn(shape, device=device)
|
|
else:
|
|
# Select every other element in the innermost dimension to
|
|
# make it non-contiguous.
|
|
doubled_shape = list(shape)
|
|
doubled_shape[-1] *= 2
|
|
test_tensor = torch.randn(doubled_shape, device=device)
|
|
test_tensor = test_tensor[..., ::2]
|
|
return test_tensor
|
|
|
|
def _test_smooth_l1_loss_vs_huber_loss_helper(input, target, beta, require_equal):
|
|
for reduction in ['mean', 'sum', 'none']:
|
|
smooth_l1 = torch.nn.SmoothL1Loss(beta=beta, reduction=reduction)
|
|
# beta hyper-parameter is called delta for Huber
|
|
huber = torch.nn.HuberLoss(delta=beta, reduction=reduction)
|
|
smooth_l1_loss = smooth_l1(input, target)
|
|
huber_loss = huber(input, target)
|
|
|
|
if require_equal:
|
|
self.assertEqual(smooth_l1_loss, huber_loss)
|
|
else:
|
|
# Huber loss should be larger than smooth L1 loss by a factor of beta.
|
|
self.assertEqual(smooth_l1_loss * beta, huber_loss)
|
|
|
|
def _test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta, require_equal):
|
|
# Test the non-vectorized case.
|
|
shape = (2, 2)
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape),
|
|
target=_make_test_tensor(shape),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
# Test the vectorized case (innermost dim > 32).
|
|
shape = (64, 64)
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape),
|
|
target=_make_test_tensor(shape),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
# Test the non-contiguous case.
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape, contiguous=False),
|
|
target=_make_test_tensor(shape, contiguous=False),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
def test_equal_when_beta_is_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=1.0, require_equal=True)
|
|
|
|
def test_unequal_when_beta_is_less_than_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=0.5, require_equal=False)
|
|
|
|
def test_unequal_when_beta_is_greater_than_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=1.5, require_equal=False)
|
|
|
|
test_equal_when_beta_is_one()
|
|
test_unequal_when_beta_is_less_than_one()
|
|
test_unequal_when_beta_is_greater_than_one()
|
|
|
|
# We don't want to make propagating NaN a hard requirement on ops, but for
|
|
# these easy ones, we should make them do so.
|
|
def test_nonlinearity_propagate_nan(self, device):
|
|
def test(nonlinearity, *args, **kwargs):
|
|
x = torch.tensor([nan], device=device)
|
|
fn = getattr(F, nonlinearity)
|
|
try:
|
|
self.assertTrue(math.isnan(fn(x, *args, **kwargs).item()))
|
|
except Exception as e:
|
|
if 'not implemented' not in str(e):
|
|
raise
|
|
|
|
test('relu')
|
|
test('relu', inplace=True)
|
|
test('relu6')
|
|
test('elu')
|
|
test('selu')
|
|
test('celu')
|
|
test('rrelu')
|
|
test('rrelu', inplace=True)
|
|
test('hardtanh')
|
|
test('tanh')
|
|
test('sigmoid')
|
|
test('logsigmoid')
|
|
test('hardshrink')
|
|
test('tanhshrink')
|
|
test('softsign')
|
|
test('softmin', 0)
|
|
test('softmax', 0)
|
|
test('log_softmax', 0)
|
|
test('leaky_relu', 0.2)
|
|
test('threshold', 3, 2)
|
|
test('threshold', 3, 2, inplace=True)
|
|
|
|
def test_pooling_shape(self, device):
|
|
''' Test the output shape calculation for pooling functions '''
|
|
|
|
# Checks output shape against expected for 1D, 2D and 3D
|
|
def check(expected_out_shape, sizes, *args, **kwargs):
|
|
for kernel in ['max', 'avg']:
|
|
for i in [1, 2, 3]:
|
|
if hasattr(torch.nn.functional, f'{kernel}_pool{i}d'):
|
|
op = getattr(torch.nn.functional, f'{kernel}_pool{i}d')
|
|
t = torch.randn(sizes[:i + 2], device=device)
|
|
self.assertEqual(op(t, *args, **kwargs).shape, expected_out_shape[:i + 2])
|
|
|
|
check((1, 1, 3, 3, 4), (1, 1, 5, 6, 7), kernel_size=1, stride=2, padding=0, ceil_mode=True)
|
|
check((1, 1, 2, 3, 3), (1, 1, 3, 4, 5), kernel_size=2, stride=2, padding=1, ceil_mode=False)
|
|
check((1, 1, 2, 3, 3), (1, 1, 3, 4, 5), kernel_size=2, stride=2, padding=1, ceil_mode=True)
|
|
|
|
# Test case from issue https://github.com/pytorch/pytorch/issues/45357
|
|
x = torch.randn(1, 1, 6, 7, device=device)
|
|
y = torch.nn.functional.max_pool2d(x, 1, stride=(2, 2), padding=0, ceil_mode=True)
|
|
self.assertEqual(y.size(), (1, 1, 3, 4))
|
|
|
|
@onlyOnCPUAndCUDA # TODO: fix on XLA
|
|
def test_adaptive_avg_pool2d_output_size_one(self, device):
|
|
def helper(size, memory_format):
|
|
x = torch.randint(1, 10, size, dtype=torch.float, device=device, requires_grad=True)
|
|
if memory_format == 'non_contiguous':
|
|
x = x[::2, ::2, ::2, ::2]
|
|
else:
|
|
x = x.to(memory_format=memory_format)
|
|
|
|
net = torch.nn.AdaptiveAvgPool2d((1, 1))
|
|
out = net(x)
|
|
ref_out = x.contiguous().mean((-1, -2)).view((x.size(0), x.size(1), 1, 1))
|
|
|
|
out.sum().backward() # make sure it doesn't crash
|
|
|
|
self.assertEqual(out, ref_out)
|
|
if memory_format == torch.channels_last:
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
c = out.size(1)
|
|
self.assertEqual(out.stride(), [c, 1, c, c])
|
|
else:
|
|
self.assertTrue(out.is_contiguous())
|
|
c = out.size(1)
|
|
self.assertEqual(out.stride(), [c, 1, 1, 1])
|
|
|
|
for mf in (torch.contiguous_format, torch.channels_last, 'non_contiguous'):
|
|
helper((2, 3, 6, 6), mf)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_adaptive_avg_pool3d_output_size_one(self, device):
|
|
x = torch.randn((2, 3, 6, 6, 6) , dtype=torch.float, device=device, requires_grad=True)
|
|
|
|
net = torch.nn.AdaptiveAvgPool3d(1)
|
|
out = net(x)
|
|
ref_out = x.contiguous().mean((-1, -2, -3)).view(out.shape)
|
|
|
|
out.sum().backward() # make sure it doesn't crash
|
|
|
|
self.assertEqual(out, ref_out)
|
|
self.assertTrue(out.is_contiguous())
|
|
c = out.size(1)
|
|
self.assertEqual(out.stride(), [c, 1, 1, 1, 1])
|
|
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.uint8, torch.int8, torch.short, torch.int, torch.long)
|
|
def test_adaptive_pooling_no_suppot_input(self, device, dtype):
|
|
for numel in (2, 3):
|
|
for pool_type in ('Max', 'Avg'):
|
|
cls_name = 'Adaptive{}Pool{}d'.format(pool_type, numel)
|
|
module_cls = getattr(nn, cls_name)
|
|
output_size = (2,) * numel
|
|
module = module_cls(output_size)
|
|
input = torch.randn((4,) * (numel + 1), device=device).to(dtype)
|
|
with self.assertRaisesRegex(RuntimeError, "not implemented"):
|
|
output = module(input)
|
|
|
|
@onlyCUDA
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
def test_avg_pool2d_nhwc(self, device, dtype):
|
|
def helper(n, c, h, w, kernel_size, stride=None,
|
|
count_include_pad=True, divisor_override=None, padding=0):
|
|
if stride is None:
|
|
stride = kernel_size
|
|
input = torch.randn(n, c, h, w, dtype=dtype, device=device)
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
grad = torch.randn(n, c, (h - kernel_size) // stride + 1, (w - kernel_size) // stride + 1,
|
|
dtype=dtype, device=device)
|
|
pool = torch.nn.AvgPool2d(kernel_size, stride=stride, count_include_pad=count_include_pad,
|
|
divisor_override=divisor_override).to(device)
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_pool = torch.nn.AvgPool2d(kernel_size, stride=stride, count_include_pad=count_include_pad,
|
|
divisor_override=divisor_override).to(device)
|
|
|
|
out = pool(input)
|
|
out.backward(grad)
|
|
ref_out = ref_pool(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertTrue(torch.allclose(out, ref_out))
|
|
self.assertTrue(torch.allclose(input.grad, ref_input.grad))
|
|
|
|
helper(4, 8, 8, 8, 3)
|
|
helper(4, 8, 8, 8, 3, count_include_pad=False, padding=1)
|
|
helper(4, 8, 8, 8, 3, count_include_pad=False, padding=2, stride=2)
|
|
helper(4, 8, 8, 8, 3, divisor_override=42)
|
|
helper(4, 8, 8, 8, 7)
|
|
helper(200, 512, 28, 28, 2)
|
|
helper(4, 8, 7, 7, 3, stride=1)
|
|
helper(4, 8, 7, 7, 3, padding=2, stride=1)
|
|
helper(10, 512, 31, 31, 3, stride=2)
|
|
helper(1, 129, 8, 8, 3, stride=2)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.float)
|
|
def test_max_pool1d_errors(self, device, dtype):
|
|
def check(x, args, message):
|
|
model = torch.nn.MaxPool1d(*args)
|
|
with self.assertRaisesRegex(RuntimeError, r'max_pool1d\(\) ' + message):
|
|
model(torch.tensor(x, device=device, dtype=dtype))
|
|
|
|
# Pooling args: (kernel_size, stride, padding, dilation, return_indices, ceil_mode)
|
|
check(0, (1,), "input tensor must have 2 or 3 dimensions but got 0")
|
|
check([], (1,), "input tensor must have 2 or 3 dimensions but got 1")
|
|
check([[]], (1, 0), "stride must be greater than zero, but got 0")
|
|
check([[]], (1, 1, -1), "padding must be non-negative, but got -1")
|
|
check([[]], (1, 1, 2), "padding should be at most half of kernel size, but got padding=2 and kernel_size=1")
|
|
check([[]], (1, 1, 0, 0), "dilation must be greater than zero, but got 0")
|
|
check([[]], (5, 1, 0, 1), "Invalid computed output size: -4")
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.float, torch.double)
|
|
def test_max_pool1d_corner_cases(self, device, dtype):
|
|
def check(x, args, expected):
|
|
model = torch.nn.MaxPool1d(*args)
|
|
if isinstance(x, list):
|
|
x = torch.tensor(x, device=device, dtype=dtype)
|
|
expected = torch.tensor(expected, device=device, dtype=dtype)
|
|
self.assertEqual(model(x), expected)
|
|
|
|
# Pooling args: (kernel_size, stride, padding, dilation, return_indices, ceil_mode)
|
|
check([[]], (1, None, 0, 1, False, False), [[]])
|
|
check([[[]]], (1, None, 0, 1, False, False), [[[]]])
|
|
check([[[]]], (2, 1, 1, 2, False, True), [[[]]])
|
|
check([[1]], (1, None, 0, 1, False, False), [[1]])
|
|
check([[1]], (2, None, 1, 2, False, False), [[float('-inf')]])
|
|
check([[1], [1]], (2, None, 1, 2, False, False), [[float('-inf')], [float('-inf')]])
|
|
check([[1, 2]], (2, 1, 1, 2, False, False), [[2, 1]])
|
|
check([[1, 2]], (2, 2, 1, 2, False, True), [[2, 2]])
|
|
|
|
empty_tensor = torch.empty((2, 0, 1), device=device, dtype=dtype)
|
|
check(empty_tensor, (1, None, 0, 1, False, False), empty_tensor)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.float, torch.double)
|
|
def test_max_pool1d(self, device, dtype):
|
|
# FIXME For now compare against max_pool1d with indices
|
|
def check(x, *args, **kwargs):
|
|
model = torch.nn.MaxPool1d(*args, **kwargs)
|
|
ref_model = torch.nn.MaxPool1d(*args, **kwargs, return_indices=True)
|
|
self.assertEqual(model(x), ref_model(x)[0])
|
|
|
|
sizes = [random.sample(range(8, 128), 3) for _ in range(3)]
|
|
kernel_sizes = random.sample(range(1, 5), 3)
|
|
strides = random.sample(range(1, 5), 3)
|
|
dilations = random.sample(range(1, 5), 3)
|
|
ceil_modes = [True, False]
|
|
|
|
for size, kernel_size, stride, dilation, ceil_mode in \
|
|
itertools.product(sizes, kernel_sizes, strides, dilations, ceil_modes):
|
|
padding = random.sample(range(0, math.floor(kernel_size / 2) + 1), 1)
|
|
check(torch.randn(size, device=device, dtype=dtype),
|
|
kernel_size, stride, padding, dilation, ceil_mode=ceil_mode)
|
|
|
|
# Non-contiguous test
|
|
tensor = torch.randn(5, 151, 33, device=device, dtype=dtype)[::2, ::3, ::2]
|
|
check(tensor, 3, 2, 1, 2, ceil_mode=True)
|
|
check(tensor.transpose(1, 2), 3, 2, 1, 2, ceil_mode=True)
|
|
|
|
@onlyCUDA
|
|
def test_max_pool2d(self, device):
|
|
def helper(n, c, h, w, ks):
|
|
x = torch.randn(n, c, h, w, device='cuda', dtype=torch.float, requires_grad=True)
|
|
ref_x = x.detach().clone().cpu().requires_grad_()
|
|
|
|
pool = torch.nn.MaxPool2d(kernel_size=ks)
|
|
|
|
y = pool(x)
|
|
ref_y = pool(ref_x)
|
|
|
|
y.sum().backward()
|
|
ref_y.sum().backward()
|
|
|
|
self.assertEqual(y, ref_y)
|
|
self.assertEqual(x.grad, ref_x.grad)
|
|
|
|
helper(2, 8, 4, 4, ks=2)
|
|
helper(1, 100000, 32, 32, ks=4)
|
|
helper(1, 100000, 1, 4, ks=(1, 4)) # test for max_pool1d
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float, torch.double)
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
def test_max_pool2d_nhwc(self, device, dtype):
|
|
def helper(n, c, h, w, kernel_size, stride=None):
|
|
if stride is None:
|
|
stride = kernel_size
|
|
input = torch.randn(n, c, h, w, dtype=dtype, device=device)
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
grad = torch.randn(n, c, (h - kernel_size) // stride + 1, (w - kernel_size) // stride + 1,
|
|
dtype=dtype, device=device)
|
|
pool = torch.nn.MaxPool2d(kernel_size, stride).to(device)
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_pool = torch.nn.MaxPool2d(kernel_size, stride).to(device)
|
|
|
|
out = pool(input)
|
|
out.backward(grad)
|
|
ref_out = ref_pool(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertTrue(torch.allclose(out, ref_out))
|
|
self.assertTrue(torch.allclose(input.grad, ref_input.grad))
|
|
|
|
helper(4, 8, 8, 8, 7)
|
|
helper(200, 512, 28, 28, 2)
|
|
helper(4, 8, 7, 7, 3, stride=1)
|
|
helper(10, 512, 31, 31, 3, stride=2)
|
|
helper(1, 129, 8, 8, 3, stride=2)
|
|
|
|
@onlyCUDA
|
|
def test_max_pool2d_indices(self, device):
|
|
def helper(n, c, h, w, ks):
|
|
if n is None:
|
|
x = torch.randn(c, h, w, device='cuda', dtype=torch.float, requires_grad=True)
|
|
else:
|
|
x = torch.randn(n, c, h, w, device='cuda', dtype=torch.float, requires_grad=True)
|
|
|
|
ref_x = x.detach().clone().cpu().requires_grad_()
|
|
|
|
pool = torch.nn.MaxPool2d(kernel_size=ks, return_indices=True)
|
|
|
|
y, idx = pool(x)
|
|
ref_y, ref_idx = pool(ref_x)
|
|
|
|
y.sum().backward()
|
|
ref_y.sum().backward()
|
|
|
|
self.assertEqual(y, ref_y)
|
|
self.assertEqual(idx, ref_idx) # assertEqual implicitly compares shape for tensors
|
|
self.assertEqual(x.grad, ref_x.grad)
|
|
|
|
helper(2, 8, 4, 4, ks=2)
|
|
helper(None, 3, 50, 50, ks=5)
|
|
|
|
def test_embedding_dense_grad(self, device):
|
|
embd = nn.Embedding(20, 20).to(device)
|
|
weight = embd.weight
|
|
|
|
def fn_wrapper(device):
|
|
def fn(weight):
|
|
inp = torch.tensor([[0, 1, 1, 2], [3, 5, 7, 11]], dtype=torch.long).to(device)
|
|
return torch.nn.functional.embedding(inp, weight)
|
|
return fn
|
|
|
|
fn = fn_wrapper(device)
|
|
_assertGradAndGradgradChecks(self, fn, (weight, ))
|
|
|
|
def test_embedding_scalar_weight_error(self, device):
|
|
indices = torch.rand(2, 2, device=device).long()
|
|
weight = torch.tensor(1.0, device=device)
|
|
with self.assertRaisesRegex(RuntimeError, "'weight' must be at least 1-D"):
|
|
torch.nn.functional.embedding(indices, weight)
|
|
|
|
@dtypesIfCUDA(torch.float16, torch.float64)
|
|
@dtypes(torch.float64)
|
|
def test_embedding_backward(self, device, dtype):
|
|
embedding = nn.Embedding(10, 3, sparse=True)
|
|
tensor = torch.tensor([[7, 1, 3]])
|
|
ones = torch.tensor(1., dtype=dtype).expand(3, 3)
|
|
tensorTwice = tensor.repeat(1, 2)
|
|
onesTwice = torch.cat((ones, ones))
|
|
|
|
embedding = embedding.to(dtype=dtype).to(device)
|
|
tensor = tensor.to(device)
|
|
ones = ones.to(device)
|
|
tensorTwice = tensorTwice.to(device)
|
|
onesTwice = onesTwice.to(device)
|
|
|
|
embedding.zero_grad()
|
|
embedding(tensor[0]).sum().backward()
|
|
self.assertEqual(embedding.weight.grad._indices(), tensor)
|
|
self.assertEqual(embedding.weight.grad._values(), ones)
|
|
|
|
embedding.zero_grad()
|
|
embedding(tensor[0]).sum().backward()
|
|
embedding(tensor[0]).sum().backward()
|
|
self.assertEqual(embedding.weight.grad._indices(), tensorTwice)
|
|
self.assertEqual(embedding.weight.grad._values(), onesTwice)
|
|
|
|
embedding.zero_grad()
|
|
embedding(tensor[0]).sum().backward()
|
|
tensor[0, 0] = 8
|
|
embedding(tensor[0]).sum().backward()
|
|
tensorTwice[0, 3] = 8
|
|
self.assertEqual(embedding.weight.grad._indices(), tensorTwice)
|
|
self.assertEqual(embedding.weight.grad._values(), onesTwice)
|
|
|
|
@dtypesIfCUDA(*ALL_TENSORTYPES2)
|
|
@dtypes(torch.float32)
|
|
def test_embedding_padding_idx(self, device, dtype):
|
|
embedding = nn.Embedding(10, 20, padding_idx=0).to(device, dtype)
|
|
input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long).to(device)
|
|
output = embedding(input)
|
|
self.assertEqual(output[0][0].sum(), 0)
|
|
self.assertEqual(output[1][2].sum(), 0)
|
|
|
|
embedding = nn.Embedding(10, 20, padding_idx=0, sparse=True).to(device, dtype)
|
|
input = torch.tensor([[0, 2, 4, 5], [4, 3, 0, 9]], dtype=torch.long).to(device)
|
|
output = embedding(input)
|
|
self.assertEqual(output[0][0].sum(), 0)
|
|
self.assertEqual(output[1][2].sum(), 0)
|
|
|
|
# negative indexing check for padding_idx
|
|
# padding_idx=-2, num_embeddings=10 ==> index 8 padded
|
|
embedding = nn.Embedding(10, 20, padding_idx=-2).to(device, dtype)
|
|
input = torch.tensor([[0, 2, 8, 5], [4, 8, 0, 9]], dtype=torch.long).to(device)
|
|
output = embedding(input)
|
|
self.assertEqual(output[0][2].sum(), 0)
|
|
self.assertEqual(output[1][1].sum(), 0)
|
|
|
|
embedding = nn.Embedding(10, 20, padding_idx=-2, sparse=True).to(device, dtype)
|
|
input = torch.tensor([[0, 2, 8, 5], [4, 8, 0, 9]], dtype=torch.long).to(device)
|
|
output = embedding(input)
|
|
self.assertEqual(output[0][2].sum(), 0)
|
|
self.assertEqual(output[1][1].sum(), 0)
|
|
|
|
# change padding vector
|
|
padding_vector = torch.ones(20, dtype=dtype, device=device)
|
|
embedding = nn.Embedding(10, 20, padding_idx=2, sparse=True).to(device, dtype)
|
|
with torch.no_grad():
|
|
embedding.weight[2] = padding_vector
|
|
input = torch.tensor([0, 2], dtype=torch.long).to(device)
|
|
output = embedding(input)
|
|
self.assertEqual(output[1], padding_vector)
|
|
|
|
# out of bounds check for padding_idx
|
|
self.assertRaises(AssertionError, nn.Embedding, num_embeddings=10, embedding_dim=20, padding_idx=25)
|
|
self.assertRaises(AssertionError, nn.Embedding, num_embeddings=10, embedding_dim=20, padding_idx=-25)
|
|
|
|
padding_idx = 0
|
|
embedding = nn.Embedding(5, 2, padding_idx=padding_idx).to(device, dtype)
|
|
for n in (1, 2, 1000): # Need large N to trigger all the methods we have implemented
|
|
for other_indices in ([], [1, 3], [2]):
|
|
indices = torch.tensor(other_indices + [padding_idx] * n, dtype=torch.long).to(device)
|
|
pre = embedding.weight[padding_idx].clone()
|
|
embedding(indices).sum().backward()
|
|
after = (embedding.weight + embedding.weight.grad)[padding_idx]
|
|
embedding.zero_grad()
|
|
self.assertEqual(after, pre)
|
|
|
|
# test double backward
|
|
emb_sum = embedding(indices).sum()
|
|
emb_grad = torch.autograd.grad(outputs=emb_sum, inputs=list(embedding.parameters()), retain_graph=True)
|
|
scalar = emb_grad[0].sum() + emb_sum
|
|
scalar.backward()
|
|
after = (embedding.weight + embedding.weight.grad)[padding_idx]
|
|
embedding.zero_grad()
|
|
self.assertEqual(after, pre)
|
|
|
|
# Check correctness of torch.nn.functional.embedding_bag forward and
|
|
# backward functions with padding_idx, given a 1D input separated into bags
|
|
# with an offset array. Compare against an equivalent 2D input that uses
|
|
# padding indices to fill in the gaps indicated by the offset array
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float32, torch.float64)
|
|
@dtypesIfCUDA(torch.half, torch.bfloat16)
|
|
def test_embedding_bag_1D_padding_idx(self, device, dtype):
|
|
num_features = 3
|
|
max_indices_per_bag = 10
|
|
num_bags = 10
|
|
num_words = 100
|
|
|
|
def gen_1D_indices_offsets(include_last_offset, allpad):
|
|
indices = []
|
|
offsets = []
|
|
cur_offset = 0
|
|
|
|
# Make one bag full and one bag empty, for extra coverage
|
|
empty_bag = random.randint(0, num_bags - 1)
|
|
full_bag = empty_bag
|
|
while full_bag == empty_bag:
|
|
full_bag = random.randint(0, num_bags - 1)
|
|
|
|
for bag in range(num_bags):
|
|
offsets.append(cur_offset)
|
|
if bag == full_bag:
|
|
bag_size = max_indices_per_bag
|
|
elif bag == empty_bag:
|
|
bag_size = 0
|
|
else:
|
|
bag_size = random.randint(1, max_indices_per_bag - 1)
|
|
indices += [1 if allpad else random.randint(0, num_words - 1) for _ in range(bag_size)]
|
|
cur_offset += bag_size
|
|
|
|
# embedding_bag requires first entry of offsets to be 0
|
|
assert offsets[0] == 0
|
|
|
|
indices = torch.tensor(indices, device=device)
|
|
|
|
if include_last_offset:
|
|
offsets.append(indices.size(0))
|
|
|
|
offsets = torch.tensor(offsets, device=device)
|
|
|
|
return indices, offsets
|
|
|
|
# Convert a 1-D indices-offsets representation into 2-D. Fill any empty
|
|
# indices with padding_idx
|
|
def gen_2D_indices_from_1D(indices_1D, offsets, include_last_offset, padding_idx):
|
|
assert offsets[0] == 0
|
|
if include_last_offset:
|
|
offsets = offsets[:-1]
|
|
indices_2D = torch.empty(num_bags, max_indices_per_bag, device=device, dtype=torch.long)
|
|
for bag in range(num_bags):
|
|
# Determine the start and end position of the bag within indices_1D
|
|
start = offsets[bag]
|
|
end = len(indices_1D) if bag + 1 == num_bags else offsets[bag + 1]
|
|
end = min(len(indices_1D), end)
|
|
|
|
# Pull out the bag's indices from indices_1D, and fill any
|
|
# remaining space with padding indices
|
|
indices_in_bag = []
|
|
for item_pos in range(0, max_indices_per_bag):
|
|
if (start + item_pos) < end:
|
|
indices_in_bag.append(indices_1D[start + item_pos])
|
|
else:
|
|
indices_in_bag.append(padding_idx)
|
|
indices_2D[bag] = torch.tensor(indices_in_bag, device=device)
|
|
|
|
return indices_2D
|
|
|
|
test_cases = product(['max', 'mean', 'sum'], [False, True], [False, True], [False, True])
|
|
|
|
for mode, sparse, include_last_offset, allpad in test_cases:
|
|
# Max sparse and bfloat16 are not supported
|
|
if mode == 'max':
|
|
if sparse or (dtype == torch.bfloat16):
|
|
continue
|
|
indices_1D, offsets = gen_1D_indices_offsets(include_last_offset, allpad)
|
|
for padding_idx_1D in list(set(indices_1D.tolist())) + [None]:
|
|
msg = (
|
|
f"mode: '{mode}', sparse: {sparse}, include_last_offset: {include_last_offset}, "
|
|
f"padding_idx_1D: {padding_idx_1D}")
|
|
|
|
# If 1D input does not use a padding index, we still need one for the 2D input,
|
|
# so we can add one dummy word to the weights to act as the padded word
|
|
padding_idx_2D = padding_idx_1D if padding_idx_1D is not None else num_words
|
|
num_words_with_padding = num_words if padding_idx_1D is not None else num_words + 1
|
|
|
|
indices_2D = gen_2D_indices_from_1D(
|
|
indices_1D,
|
|
offsets,
|
|
include_last_offset,
|
|
padding_idx_2D)
|
|
|
|
weights = torch.randn(
|
|
num_words_with_padding,
|
|
num_features,
|
|
dtype=dtype,
|
|
device=device,
|
|
requires_grad=True)
|
|
weights_check = weights.clone().detach().requires_grad_(True)
|
|
|
|
bag = torch.nn.functional.embedding_bag(
|
|
indices_1D,
|
|
weights,
|
|
offsets,
|
|
padding_idx=padding_idx_1D,
|
|
mode=mode,
|
|
sparse=sparse,
|
|
include_last_offset=include_last_offset)
|
|
|
|
bag_check = torch.nn.functional.embedding_bag(
|
|
indices_2D,
|
|
weights_check,
|
|
padding_idx=padding_idx_2D,
|
|
mode=mode,
|
|
sparse=sparse)
|
|
self.assertEqual(bag, bag_check, msg=msg)
|
|
|
|
bag.sum().backward()
|
|
bag_check.sum().backward()
|
|
|
|
# Sometimes, half dtype gradients mismatch by a greater amount
|
|
# than other dtypes
|
|
if dtype in [torch.half, torch.bfloat16]:
|
|
atol = 0.01
|
|
rtol = 0.01
|
|
else:
|
|
atol = None
|
|
rtol = None
|
|
self.assertEqual(weights.grad, weights_check.grad, msg=msg, atol=atol, rtol=rtol)
|
|
|
|
# Check correctness of torch.nn.functional.embedding_bag forward and
|
|
# backward functions with padding_idx, given a 2D indices input. Compare
|
|
# against torch.nn.functional.embedding followed by a reduction.
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float32, torch.float64)
|
|
@dtypesIfCUDA(torch.half, torch.bfloat16)
|
|
def test_embedding_bag_2D_padding_idx(self, device, dtype):
|
|
# Use a Python implementation of embedding_bag with padding_idx support
|
|
# to check torch.nn.functional.embedding_bag correctness
|
|
def embedding_bag_check(indices, weights, mode, sparse, padding_idx):
|
|
assert padding_idx is not None
|
|
embedding = torch.nn.functional.embedding(
|
|
indices,
|
|
weights,
|
|
padding_idx=padding_idx,
|
|
sparse=sparse)
|
|
|
|
reduction_dim = indices.dim() - 1
|
|
|
|
if mode == 'sum' or mode == 'mean':
|
|
# We must avoid including elements at padding_idx in the
|
|
# sum/mean, so multiply those elements by 0, and multiply
|
|
# all other elements by 1
|
|
per_sample_weights = indices.ne(padding_idx).to(dtype).unsqueeze(-1)
|
|
res = embedding.mul(per_sample_weights).sum(dim=reduction_dim)
|
|
|
|
if mode == 'mean':
|
|
weights_sum = per_sample_weights.sum(dim=reduction_dim)
|
|
res = res.div(weights_sum)
|
|
|
|
elif mode == 'max':
|
|
# We must avoid allowing elements at padding_idx to be chosen
|
|
# as the max, so set those elements to negative infinity
|
|
res = embedding.masked_fill(
|
|
indices.unsqueeze(-1) == padding_idx, -float('inf')
|
|
).amax(dim=reduction_dim)
|
|
|
|
else:
|
|
raise RuntimeError(f"mode '{mode}' is not available")
|
|
|
|
# If a row is all padding, set its corresponding result row to 0.
|
|
# This is needed because the above mean and max mode
|
|
# implementations set these elements to nan and -inf, respectively
|
|
if mode in ['mean', 'max']:
|
|
res = res.masked_fill(
|
|
indices.eq(padding_idx).all(dim=-1).unsqueeze(-1),
|
|
0)
|
|
|
|
return res
|
|
|
|
num_features = 3
|
|
num_words = 10
|
|
indices_dim1 = 10
|
|
|
|
for mode, sparse, allpad, indices_dim0 in product(['max', 'mean', 'sum'], [False, True], [False, True], [1, 10]):
|
|
# Max sparse and bfloat16 are not supported
|
|
if mode == 'max':
|
|
if sparse or (dtype == torch.bfloat16):
|
|
continue
|
|
|
|
if allpad:
|
|
indices = torch.empty(indices_dim0, indices_dim1, dtype=torch.long, device=device).fill_(1)
|
|
else:
|
|
indices = torch.randint(0, num_words, (indices_dim0, indices_dim1), device=device)
|
|
|
|
if indices_dim0 > 1:
|
|
# Fill one row with duplicate index so we can test with a fully
|
|
# padded row
|
|
duplicate_row = random.randint(0, indices_dim0 - 1)
|
|
indices[duplicate_row] = indices[duplicate_row][0]
|
|
|
|
for padding_idx in list(set(indices.flatten(0, -1).tolist())):
|
|
weights = torch.randn(num_words, num_features, dtype=dtype, device=device, requires_grad=True)
|
|
weights_check = weights.clone().detach().requires_grad_(True)
|
|
|
|
msg = (
|
|
f"mode: '{mode}', sparse: {sparse}, padding_idx: {padding_idx}, "
|
|
f"allpad: {allpad}, indices.size(): {indices.size()}")
|
|
|
|
# Check forward with a Python implementation of padding_idx embedding_bag
|
|
bag_check = embedding_bag_check(
|
|
indices,
|
|
weights_check,
|
|
mode,
|
|
sparse,
|
|
padding_idx)
|
|
bag = torch.nn.functional.embedding_bag(
|
|
indices,
|
|
weights,
|
|
padding_idx=padding_idx,
|
|
mode=mode,
|
|
sparse=sparse)
|
|
|
|
self.assertEqual(bag, bag_check, msg=msg)
|
|
|
|
bag_check.sum().backward()
|
|
grad_check = weights_check.grad
|
|
|
|
bag.sum().backward()
|
|
grad = weights.grad
|
|
|
|
# Sometimes, half dtype gradients mismatch by a greater amount
|
|
# than other dtypes
|
|
if dtype in [torch.half, torch.bfloat16]:
|
|
atol = 0.01
|
|
rtol = 0.01
|
|
else:
|
|
atol = None
|
|
rtol = None
|
|
self.assertEqual(grad, grad_check, msg=msg, atol=atol, rtol=rtol)
|
|
|
|
# Test fails on Vg20
|
|
@skipCUDAIfRocm
|
|
@dtypesIfCUDA(torch.half, torch.float)
|
|
@dtypes(torch.float)
|
|
def test_softmax_results(self, device, dtype):
|
|
# Non-even sizes and non-zero shifts test fallback paths in vectorized kernel
|
|
# Note: dim1 > 1024 is needed to exercise the vectorized (non-persistent) path, (16, 30576) is BERT-esque
|
|
sizes = [(0, 10), (32, 20), (10, 0), (31, 20), (32, 21), (31, 23), (32, 1536), (31, 2048), (33, 2049), (16, 30576)]
|
|
shifts = [(0, 0), (1, 0), (0, 1), (1, 1)]
|
|
for fn in [F.softmax, F.log_softmax]:
|
|
for size in sizes:
|
|
for shift in shifts:
|
|
input = torch.rand(size, device=device, dtype=dtype)
|
|
# Note: With the largest tests we can hit upper limit of fp16 when we
|
|
# sum, so scale the input down to stay in a nicer range.
|
|
if dtype == torch.float16:
|
|
input = input / 100.
|
|
input = input[shift[0]:, shift[1]:]
|
|
# Note; Don't want to bprop back through slice op
|
|
input = input.detach().requires_grad_(True)
|
|
ref_input = input.clone().cpu().detach().requires_grad_(True)
|
|
for dim in [0, 1]:
|
|
ref_output = fn(ref_input, dtype=torch.float, dim=dim)
|
|
output = fn(input, dtype=torch.float, dim=dim)
|
|
grad_output = torch.rand(size, device=device, dtype=dtype)
|
|
grad_output = grad_output[shift[0]:, shift[1]:]
|
|
ref_grad_output = grad_output.clone().cpu().detach()
|
|
grad_input, = torch.autograd.grad(output, input, grad_outputs=(grad_output), create_graph=True)
|
|
ref_grad_input, = torch.autograd.grad(ref_output, ref_input,
|
|
grad_outputs=(ref_grad_output), create_graph=True)
|
|
grad_input.sum().backward()
|
|
ref_grad_input.sum().backward()
|
|
|
|
self.assertEqual(output, ref_output)
|
|
self.assertEqual(grad_input, ref_grad_input)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
@onlyCUDA
|
|
@dtypesIfCUDA(torch.float, torch.half)
|
|
@largeTensorTest("20GB")
|
|
@precisionOverride({torch.half: 0.001})
|
|
def test_softmax_64bit_indexing(self, device, dtype):
|
|
def run_test(*shape):
|
|
x = torch.randn(shape, device="cuda", dtype=torch.float16, requires_grad=True)
|
|
y = F.log_softmax(x, dim=-1, dtype=dtype)
|
|
y.backward(y)
|
|
with torch.no_grad():
|
|
xx = x.cpu().requires_grad_()
|
|
yy = F.log_softmax(xx.float(), dim=-1).to(dtype)
|
|
yy.backward(yy)
|
|
self.assertEqual(y, yy)
|
|
self.assertEqual(x.grad, xx.grad)
|
|
|
|
run_test(1100000000, 2) # Illegal memory access https://github.com/pytorch/pytorch/issues/52715
|
|
run_test(2200000000, 1) # invalid configuration argument https://github.com/pytorch/pytorch/issues/52716
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.half)
|
|
def test_log_softmax_big(self, device, dtype):
|
|
def _test_helper(shape):
|
|
# generate a tensor with big numbers that are exactly representable in dtype
|
|
# and are at a constant offset from tensor with small numbers
|
|
# the logsoftmax of a small and big tensors should be equal
|
|
x_small = torch.randint(100, shape, dtype=dtype, device=device)
|
|
offset = 1.5e3 if dtype == torch.half else 1e7
|
|
x_big = x_small + offset
|
|
self.assertEqual(F.log_softmax(x_small, -1), F.log_softmax(x_big, -1))
|
|
_test_helper((16, 4))
|
|
if self.device_type == 'cuda':
|
|
# test non-persistent softmax kernel
|
|
_test_helper((4, 1536))
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest('12GB')
|
|
def test_conv_large_nosplit(self, device):
|
|
# Here we just test the convolution correctly route to the fallback implementation
|
|
# that is, it does not crash. The correctness of fallback implementation should be
|
|
# covered in other tests
|
|
dtype = torch.half if self.device_type == 'cuda' else torch.float
|
|
conv1 = nn.Conv2d(2, 2, 8, 8).to(device).to(dtype)
|
|
input_large = torch.randn(1, 2, 1024, 1024 * 1024, dtype=dtype, device=device)
|
|
conv1(input_large)
|
|
conv2 = torch.nn.Conv2d(1, 1024, 1, 1).to(device).to(dtype)
|
|
input_large = torch.randn(1, 1, 2048, 1024 , dtype=dtype, device=device)
|
|
conv2(input_large)
|
|
|
|
def test_conv_noncontig_weights(self, device):
|
|
for dim in (1, 2, 3):
|
|
for grouped in (False, True):
|
|
nc = 3
|
|
groups = 3 if grouped else 1
|
|
w = torch.randn([3] * dim, device=device)
|
|
w = w.expand([nc, int(nc / groups)] + list(w.shape))
|
|
w = w.detach().requires_grad_()
|
|
x = torch.randn([1, nc] + ([5] * dim), device=device, requires_grad=True)
|
|
y = getattr(F, 'conv{}d'.format(dim))(x, w, groups=groups)
|
|
y.sum().backward()
|
|
y = getattr(F, 'conv_transpose{}d'.format(dim))(x, w, groups=groups)
|
|
y.sum().backward()
|
|
|
|
def test_conv_noncontig_weights_and_bias(self, device):
|
|
# need floats to exercise https://github.com/pytorch/pytorch/issues/16018
|
|
for bias in [True, False]:
|
|
conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3,
|
|
bias=bias).to(device, torch.float)
|
|
|
|
input_nc = torch.randn((1, 3, 224, 224, 2), device=device, dtype=torch.float)[:, :, :, :, 1]
|
|
input_c = input_nc.contiguous()
|
|
|
|
weight_nc = torch.randn((64, 3, 7, 7, 2), device=device, dtype=torch.float)[:, :, :, :, 1]
|
|
conv1.weight = nn.Parameter(weight_nc)
|
|
weight_c = conv1.weight.contiguous()
|
|
|
|
if bias:
|
|
bias_nc = torch.randn((64, 2), device=device, dtype=torch.float)[:, 1]
|
|
conv1.bias = nn.Parameter(bias_nc)
|
|
bias_c = conv1.bias.contiguous()
|
|
|
|
out1 = conv1(input_nc)
|
|
conv1.weight = nn.Parameter(weight_c)
|
|
if bias:
|
|
conv1.bias = nn.Parameter(bias_c)
|
|
out2 = conv1(input_c)
|
|
self.assertEqual(out1, out2)
|
|
|
|
def test_save_lstm_compatibility(self, device):
|
|
# Test that saving an LSTM in PyTorch 1.7 and older can still be
|
|
# loaded in newer versions of PyTorch.
|
|
model = nn.LSTM(2, 3)
|
|
x = torch.randn(32, 5, 2)
|
|
expected = model(x)
|
|
|
|
# Get a state dict for PyTorch 1.7 LSTM. Before PyTorch 1.8, proj_size
|
|
# didn't exist.
|
|
assert model.proj_size == 0
|
|
state_dict = model.__dict__
|
|
del state_dict['proj_size']
|
|
|
|
# load a model
|
|
loaded_model = nn.LSTM(2, 3)
|
|
loaded_model.__setstate__(state_dict)
|
|
result = loaded_model(x)
|
|
self.assertEqual(result, expected)
|
|
|
|
@onlyCUDA
|
|
@tf32_on_and_off(0.005)
|
|
def test_grid_sample_large(self, device):
|
|
def issue_35202():
|
|
input_tensor = torch.rand(1, 1, 480, 640, dtype=torch.float, device=device, requires_grad=True)
|
|
coords = torch.tensor([[-10059144, 67680944], [67680944, 67680944]], dtype=torch.float, device=device)
|
|
coords = coords.unsqueeze(0).unsqueeze(0).repeat(1, 1, 1, 1)
|
|
result = torch.nn.functional.grid_sample(input_tensor, coords)
|
|
self.assertEqual(result, torch.tensor([[[[0., 0.]]]], dtype=torch.float, device=device))
|
|
result.backward(torch.ones_like(result))
|
|
torch.cuda.synchronize()
|
|
issue_35202()
|
|
|
|
def issue_24823_1(dtype):
|
|
image = torch.arange(27, 0, -1, dtype=dtype, device=device).view(1, 1, 3, 3, 3)
|
|
image.requires_grad_()
|
|
grid = torch.nn.functional.affine_grid(
|
|
torch.tensor([[[1, 0, 0, 0], [0, 1, 0, 0], [0, 0, 1, 0]]], dtype=dtype, device=device),
|
|
(1, 1, 3, 3, 3))
|
|
grid[:, 1, 1, 1, 0] = float('inf')
|
|
result = torch.nn.functional.grid_sample(image, grid, padding_mode='zeros')
|
|
self.assertEqual(result, torch.tensor([[[[[27., 26., 25.], [24., 23., 22.], [21., 20., 19.]],
|
|
[[18., 17., 16.], [15., 0., 13.], [12., 11., 10.]],
|
|
[[9., 8., 7.], [6., 5., 4.], [3., 2., 1.]]]]],
|
|
device=device, dtype=dtype))
|
|
result.backward(torch.ones_like(result))
|
|
expected_grad = torch.ones_like(image)
|
|
expected_grad[0, 0, 1, 1, 1] = 0
|
|
self.assertEqual(image.grad, expected_grad, atol=0.005, rtol=0)
|
|
issue_24823_1(torch.half)
|
|
issue_24823_1(torch.float)
|
|
issue_24823_1(torch.double)
|
|
|
|
def issue_24823_2():
|
|
param = torch.tensor([[[-1.0e+20, 0.0, 0.0], [0.0, -1.0e+20, 0.0]]], dtype=torch.float, device=device)
|
|
img = torch.zeros((1, 1, 4, 4), dtype=torch.float, device=device, requires_grad=True)
|
|
grid = torch.nn.functional.affine_grid(param, img.size())
|
|
result = torch.nn.functional.grid_sample(img, grid)
|
|
self.assertEqual(result, torch.zeros(1, 1, 4, 4, device=device, dtype=torch.float))
|
|
result.backward(torch.ones_like(result))
|
|
torch.cuda.synchronize()
|
|
issue_24823_2()
|
|
|
|
@dtypes(torch.float, torch.double)
|
|
@largeTensorTest(lambda self, device, dtype:
|
|
# Compute sum of the large tensor sizes:
|
|
# (im.numel() + small_image.numel() + small_image.grad.numel() +
|
|
# large_view.grad.numel()) * sizeof(dtype)
|
|
32769 * (65536 + 3 * 65536 / 128) *
|
|
torch.tensor([], dtype=dtype).element_size())
|
|
def test_grid_sample_large_index_2d(self, device, dtype):
|
|
# Test 64-bit indexing with grid_sample (gh-41656)
|
|
# Try accessing the corners, there should be no segfault
|
|
coords = torch.tensor([[[-1., -1.],
|
|
[+1., -1.]],
|
|
|
|
[[-1., +1.],
|
|
[+1., +1.]]], device=device, dtype=dtype)
|
|
coords = coords.expand(1, 2, 2, 2)
|
|
im = torch.zeros([1, 1, 32769, 65536], device=device, dtype=dtype)
|
|
|
|
# Compare sampling with large strides to the same op on a contiguous tensor
|
|
coords = torch.rand(1, 4, 4, 2, device=device, dtype=dtype)
|
|
large_view = im[..., 127::128]
|
|
small_image = torch.rand_like(large_view)
|
|
large_view[...] = small_image
|
|
large_view.requires_grad, small_image.requires_grad = True, True
|
|
self.assertTrue(
|
|
sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31,
|
|
msg="View must use 64-bit indexing")
|
|
for mode, padding_mode, align_corners in itertools.product(
|
|
('nearest', 'bilinear', 'bicubic'), ('zeros', 'border', 'reflection'), (True, False)):
|
|
a = F.grid_sample(
|
|
small_image, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
a.sum().backward()
|
|
|
|
b = F.grid_sample(
|
|
large_view, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
b.sum().backward()
|
|
|
|
self.assertEqual(a, b)
|
|
self.assertEqual(small_image.grad, large_view.grad)
|
|
|
|
small_image.grad.zero_()
|
|
large_view.grad.zero_()
|
|
|
|
@dtypes(torch.float, torch.double)
|
|
@largeTensorTest(lambda self, device, dtype:
|
|
# Compute sum of the large tensor sizes:
|
|
# (im.numel() + small_image.numel() + small_image.grad.numel() +
|
|
# large_view.grad.numel()) * sizeof(dtype)
|
|
2 * 32769 * (32768 + 3 * 32768 / 128) *
|
|
torch.tensor([], dtype=dtype).element_size())
|
|
def test_grid_sample_large_index_3d(self, device, dtype):
|
|
# Test 64-bit indexing with grid_sample (gh-41656)
|
|
# Try accessing the corners, there should be no segfault
|
|
coords = torch.full((1, 2, 2, 2, 3), 1., device=device, dtype=dtype)
|
|
im = torch.zeros([1, 1, 2, 32769, 32768], device=device, dtype=dtype)
|
|
|
|
result = F.grid_sample(im, coords, align_corners=False)
|
|
self.assertEqual(result, torch.zeros((1, 1, 2, 2, 2), device=device, dtype=dtype))
|
|
|
|
# Compare sampling with large strides to the same op on a contiguous tensor
|
|
coords = torch.rand(1, 1, 4, 4, 3, device=device, dtype=dtype)
|
|
large_view = im[..., 127::128]
|
|
small_image = torch.rand_like(large_view)
|
|
large_view[...] = small_image
|
|
small_image.requires_grad, large_view.requires_grad = True, True
|
|
self.assertTrue(
|
|
sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31,
|
|
msg="View must use 64-bit indexing")
|
|
for mode, padding_mode, align_corners in itertools.product(
|
|
('nearest', 'bilinear'), ('zeros', 'border', 'reflection'), (True, False)):
|
|
a = F.grid_sample(
|
|
small_image, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
a.sum().backward()
|
|
|
|
b = F.grid_sample(
|
|
large_view, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
b.sum().backward()
|
|
|
|
self.assertEqual(a, b)
|
|
self.assertEqual(small_image.grad, large_view.grad)
|
|
|
|
small_image.grad.zero_()
|
|
large_view.grad.zero_()
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest('12GB')
|
|
def test_conv_transposed_large(self, device):
|
|
dtype = torch.half if self.device_type == 'cuda' else torch.float
|
|
conv = nn.ConvTranspose2d(1, 1, 1, 1, bias=False).to(device).to(dtype)
|
|
input_large = torch.randn(4096, 1, 512, 1024, dtype=dtype, device=device)
|
|
# forward
|
|
ret = conv(input_large)
|
|
maxdiff0 = (ret.narrow(0, 0, 1024) - conv(input_large.narrow(0, 0, 1024))).abs_().max().item()
|
|
maxdiff1 = (ret.narrow(0, 1024, 1024) - conv(input_large.narrow(0, 1024, 1024))).abs_().max().item()
|
|
maxdiff2 = (ret.narrow(0, 2048, 1024) - conv(input_large.narrow(0, 2048, 1024))).abs_().max().item()
|
|
maxdiff3 = (ret.narrow(0, 3072, 1024) - conv(input_large.narrow(0, 3072, 1024))).abs_().max().item()
|
|
self.assertEqual(maxdiff0, 0)
|
|
self.assertEqual(maxdiff1, 0)
|
|
self.assertEqual(maxdiff2, 0)
|
|
self.assertEqual(maxdiff3, 0)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm
|
|
@largeTensorTest('12GB')
|
|
def test_conv_large(self, device):
|
|
dtype = torch.half if self.device_type == 'cuda' else torch.float
|
|
conv = nn.Conv2d(2, 2, 8, 8, bias=False).to(device).to(dtype)
|
|
input_large = torch.randn(4097, 2, 512, 512, dtype=dtype, device=device)
|
|
# forward
|
|
ret = conv(input_large)
|
|
self.assertEqual(ret[:2048], conv(input_large[:2048]))
|
|
self.assertEqual(ret[2048:4096], conv(input_large[2048:4096]))
|
|
self.assertEqual(ret[4096:], conv(input_large[4096:]))
|
|
|
|
# backward
|
|
conv.zero_grad()
|
|
# When computing the backward, we are using the `max(dim=1)`` to create
|
|
# some sparsity. Without this sparsity, the rounding error would be
|
|
# too large (as large as 1e-5) to satisfy the creterion (1e-6) of `assertEqual`
|
|
ret.view(4097, -1).max(dim=1).values.sum().backward()
|
|
del ret
|
|
grad1 = conv.weight.grad.detach().clone()
|
|
conv.zero_grad()
|
|
conv(input_large[:2048]).view(2048, -1).max(dim=1).values.sum().backward()
|
|
conv(input_large[2048:4096]).view(2048, -1).max(dim=1).values.sum().backward()
|
|
conv(input_large[4096:]).view(1, -1).max(dim=1).values.sum().backward()
|
|
grad2 = conv.weight.grad.detach().clone()
|
|
# gradients are at the order of hundreds, we need to scale it to
|
|
# the order of one so that we can compare
|
|
scale = 1 / grad1.abs().mean()
|
|
grad1 = grad1 * scale
|
|
grad2 = grad2 * scale
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
def _test_gumbel_softmax_st_shapes(self, device, dtype, shape, dim, count_expected):
|
|
logits = torch.randn(shape, dtype=torch.float, device=device)
|
|
logits = logits.to(dtype)
|
|
|
|
y_draw = F.gumbel_softmax(logits, hard=True, dim=dim)
|
|
|
|
# All values positive
|
|
self.assertGreaterEqual(y_draw.min(), 0)
|
|
# Shape unchanged
|
|
self.assertTrue(y_draw.shape == logits.shape)
|
|
# One choice per draw
|
|
self.assertEqual(y_draw.sum(), count_expected, atol=torch.finfo(y_draw.dtype).eps, rtol=0)
|
|
|
|
def _test_gumbel_softmax_straight_through(self, device, dtype):
|
|
num_draws = 100
|
|
|
|
logits = torch.tensor([[0.2, 0.8, 0.1]], device=device)
|
|
logits = logits.reshape([1, 3])
|
|
logits = logits.to(dtype).requires_grad_()
|
|
probs = logits.softmax(dim=-1)
|
|
|
|
counts = torch.zeros_like(logits)
|
|
for _ in range(num_draws):
|
|
y_draw = F.gumbel_softmax(logits, hard=True)
|
|
counts = counts + y_draw
|
|
|
|
# All values positive
|
|
self.assertGreaterEqual(y_draw.min(), 0)
|
|
# Each experiment should result in 1 draw.
|
|
self.assertEqual(counts.sum(), num_draws, atol=torch.finfo(counts.dtype).eps, rtol=0)
|
|
|
|
# check results is asymptotically as expected.
|
|
expected = probs * num_draws
|
|
# ~z is approximately N(0,1) for unbiased count
|
|
z = (counts - expected) / (expected * (1 - probs)).sqrt()
|
|
# A (lazy) approximate 99% two-sided test:
|
|
# occurs with prob alpha~>=0.01 if unbiased
|
|
self.assertLess(z.abs().max().item(), 2.58)
|
|
|
|
def _test_gumbel_softmax_grad(self, device, dtype):
|
|
# "hard" and "not hard" should propagate same gradient.
|
|
logits_soft = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True)
|
|
logits_hard = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True)
|
|
|
|
seed = torch.random.get_rng_state()
|
|
y_soft = F.gumbel_softmax(logits_soft, hard=False)
|
|
torch.random.set_rng_state(seed)
|
|
y_hard = F.gumbel_softmax(logits_hard, hard=True)
|
|
|
|
y_soft.sum().backward()
|
|
y_hard.sum().backward()
|
|
|
|
# 2eps = 1x addition + 1x subtraction.
|
|
tol = 2 * torch.finfo(dtype).eps
|
|
self.assertEqual(logits_soft.grad, logits_hard.grad, atol=tol, rtol=0)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.float, torch.double)
|
|
def test_gumbel_softmax(self, device, dtype):
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=0, count_expected=1)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=-1, count_expected=1)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4], dim=1, count_expected=5)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=1, count_expected=5 * 3)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=-1, count_expected=5 * 4)
|
|
self._test_gumbel_softmax_straight_through(device, dtype)
|
|
self._test_gumbel_softmax_grad(device, dtype)
|
|
|
|
def _test_rnn_retain_variables(self, device, dtype):
|
|
rnns = [nn.LSTM(10, 20, num_layers=2).to(device, dtype),
|
|
nn.GRU(10, 20, num_layers=2).to(device, dtype),
|
|
nn.RNN(10, 20, num_layers=2).to(device, dtype)]
|
|
for rnn in rnns:
|
|
input = torch.randn(5, 6, 10, device=device, dtype=dtype, requires_grad=True)
|
|
output = rnn(input)
|
|
output[0].sum().backward(retain_graph=True)
|
|
grads = [input.grad.data.clone()] + [p.grad.data.clone() for p in rnn.parameters()]
|
|
for _ in range(4):
|
|
rnn.zero_grad()
|
|
input.grad.data.zero_()
|
|
output[0].sum().backward(retain_graph=True)
|
|
grads2 = [input.grad.data] + [p.grad.data for p in rnn.parameters()]
|
|
self.assertEqual(grads, grads2)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.double)
|
|
def test_rnn_retain_variables(self, device, dtype):
|
|
self._test_rnn_retain_variables(device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_rnn_retain_variables(device, dtype)
|
|
|
|
@onlyCUDA
|
|
def test_upsamplingNearest1d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@onlyCUDA
|
|
def test_upsamplingNearest2d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@onlyCUDA
|
|
def test_upsamplingNearest3d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@unittest.expectedFailure
|
|
@skipIfRocm
|
|
@onlyCUDA
|
|
def test_upsamplingNearest2d_launch_fail(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
# launch grid_y == 2**16 (larger than maximum y-dimension limit 65535)
|
|
inp = torch.rand(1, 1, 2**15, 2**8, device=device)
|
|
out = m(inp)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfNotRocm
|
|
def test_upsamplingNearest2d_launch_rocm(self, device):
|
|
# test_upsamplingNearest2d_launch_fail should run OK on ROCm
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(1, 1, 2**15, 2**8, device=device)
|
|
out = m(inp)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfCudnnVersionLessThan(7600)
|
|
def test_CTCLoss_cudnn(self, device):
|
|
def _helper(zero_infinity):
|
|
target_lengths = [30, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device=device).log_softmax(2).requires_grad_()
|
|
|
|
log_probs_ref = log_probs.detach().clone().requires_grad_()
|
|
|
|
with torch.backends.cudnn.flags(enabled=True):
|
|
res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, zero_infinity=zero_infinity)
|
|
res.backward()
|
|
|
|
expected = ctcloss_reference(log_probs, targets.cuda(), input_lengths, target_lengths).float()
|
|
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res2 = torch.nn.functional.ctc_loss(log_probs_ref, targets.cuda().long(), input_lengths, target_lengths,
|
|
zero_infinity=zero_infinity)
|
|
res2.backward()
|
|
|
|
self.assertEqual(res, expected)
|
|
self.assertEqual(res2, res)
|
|
self.assertEqual(log_probs.grad, log_probs_ref.grad)
|
|
|
|
_helper(zero_infinity=True)
|
|
_helper(zero_infinity=False)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfNoCudnn
|
|
def test_contig_wrong_stride_cudnn(self, device):
|
|
# x has to have batch_size 1 to test contiguous checks
|
|
x = torch.randn(1, 16, 5, 5, device=device)
|
|
stride = list(x.stride())
|
|
stride[0] = 20
|
|
# change the stride in dimension 0. the tensor is still contiguous because size[0] is 1
|
|
x.set_(x.storage(), 0, x.size(), stride)
|
|
self.assertTrue(x.is_contiguous())
|
|
F.conv_transpose2d(x, torch.randn(16, 1, 1, 1, device=device))
|
|
F.conv2d(x, torch.randn(1, 16, 1, 1, device=device))
|
|
|
|
@onlyCUDA
|
|
def test_Conv2d_size_1_kernel(self, device):
|
|
x_cpu = torch.randn(2, 3, 5, 5)
|
|
conv_cpu = torch.nn.Conv2d(3, 3, kernel_size=1)
|
|
y_cpu = conv_cpu(x_cpu)
|
|
y = torch.rand_like(y_cpu)
|
|
y_cpu.backward(y)
|
|
|
|
with cudnn.flags(enabled=False):
|
|
conv_cuda = torch.nn.Conv2d(3, 3, kernel_size=1).to(device)
|
|
conv_cuda.bias.data.copy_(conv_cpu.bias.data)
|
|
conv_cuda.weight.data.copy_(conv_cpu.weight.data)
|
|
y_cuda = conv_cuda(x_cpu.to(device))
|
|
y_cuda.backward(y.to(device))
|
|
|
|
self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
|
|
@onlyCUDA
|
|
def test_ConvTranspose2d_size_1_kernel(self, device):
|
|
x_cpu = torch.randn(2, 3, 5, 5)
|
|
conv_cpu = torch.nn.ConvTranspose2d(3, 3, kernel_size=1)
|
|
y_cpu = conv_cpu(x_cpu)
|
|
y = torch.rand_like(y_cpu)
|
|
y_cpu.backward(y)
|
|
|
|
with cudnn.flags(enabled=False):
|
|
conv_cuda = torch.nn.ConvTranspose2d(3, 3, kernel_size=1).to(device)
|
|
conv_cuda.bias.data.copy_(conv_cpu.bias.data)
|
|
conv_cuda.weight.data.copy_(conv_cpu.weight.data)
|
|
y_cuda = conv_cuda(x_cpu.to(device))
|
|
y_cuda.backward(y.to(device))
|
|
|
|
self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
|
|
@onlyCUDA
|
|
def test_ConvTranspose3d_size_1_kernel(self, device):
|
|
x_cpu = torch.randn(2, 3, 3, 5, 5)
|
|
conv_cpu = torch.nn.ConvTranspose3d(3, 3, kernel_size=1)
|
|
y_cpu = conv_cpu(x_cpu)
|
|
y = torch.rand_like(y_cpu)
|
|
y_cpu.backward(y)
|
|
|
|
with cudnn.flags(enabled=False):
|
|
conv_cuda = torch.nn.ConvTranspose3d(3, 3, kernel_size=1).to(device)
|
|
conv_cuda.bias.data.copy_(conv_cpu.bias.data)
|
|
conv_cuda.weight.data.copy_(conv_cpu.weight.data)
|
|
y_cuda = conv_cuda(x_cpu.to(device))
|
|
y_cuda.backward(y.to(device))
|
|
|
|
self.assertEqual(y_cpu, y_cuda, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.bias.grad.data, conv_cuda.bias.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
self.assertEqual(conv_cpu.weight.grad.data, conv_cuda.weight.grad.data, atol=1e-5, rtol=0, exact_device=False)
|
|
|
|
def _ordered_sequence(self, device, dtype):
|
|
"""Create ordered list of random sequences"""
|
|
seqs = [torch.empty(random.randint(1, 6), device=device, dtype=dtype)
|
|
for _ in range(5)]
|
|
seqs = [s.random_(-128, 128) for s in seqs]
|
|
ordered = sorted(seqs, key=len, reverse=True)
|
|
return ordered
|
|
|
|
def _padded_sequence(self, device, dtype):
|
|
"""Create Tensor of random padded sequences"""
|
|
ordered = self._ordered_sequence(device, dtype)
|
|
lengths = [len(i) for i in ordered]
|
|
padded_tensor = rnn_utils.pad_sequence(ordered)
|
|
return padded_tensor, lengths
|
|
|
|
@onlyCUDA
|
|
def test_device_mask(self, device):
|
|
for enforce_sorted in [True, False]:
|
|
padded, lengths = self._padded_sequence('cpu', torch.float)
|
|
packed = rnn_utils.pack_padded_sequence(
|
|
padded, lengths, enforce_sorted=enforce_sorted)
|
|
self.assertFalse(packed.is_cuda)
|
|
packed = packed.to(device)
|
|
self.assertTrue(packed.is_cuda)
|
|
unpacked, _ = rnn_utils.pad_packed_sequence(packed)
|
|
self.assertTrue(unpacked.is_cuda)
|
|
self.assertEqual(unpacked.dtype, torch.float)
|
|
|
|
@onlyCUDA
|
|
def test_overwrite_module_params_on_conversion_cpu_device(self, device):
|
|
# Test that under the current default settings
|
|
# (`torch.__future__.get_overwrite_module_params_on_conversion() == False`),
|
|
# a view to a module's parameters is not pointing to the same storage as
|
|
# its base variable after converting the module to a different device.
|
|
m = nn.Linear(20, 10)
|
|
mw = m.weight[:]
|
|
m.to(device)
|
|
with torch.no_grad():
|
|
# Without using `torch.no_grad()`, this will leak CUDA memory.
|
|
# (Issue is filed at https://github.com/pytorch/pytorch/issues/21875)
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0].device.type == "cpu")
|
|
self.assertTrue(mw._base[0][0].device.type == "cuda")
|
|
|
|
try:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(True)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# a view to a module's parameters is still pointing to the same storage as
|
|
# its base variable after converting the module to a different device.
|
|
m = nn.Linear(20, 10)
|
|
mw = m.weight[:]
|
|
m.to(device)
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0] == mw._base[0][0])
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# `cpu_module.to("cuda")` doesn't preserve previous references to
|
|
# `cpu_module`'s parameters or gradients.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20)
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m.to(device)
|
|
self.assertNotEqual(weight_ref.device, m.weight.device)
|
|
self.assertNotEqual(weight_grad_ref.device, m.weight.grad.device)
|
|
finally:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(False)
|
|
|
|
@onlyCUDA
|
|
@dtypes(*ALL_TENSORTYPES2)
|
|
def test_embedding_max_norm_device(self, device, dtype):
|
|
embedding = nn.Embedding(22, 5, max_norm=1.0).to(device, dtype=dtype)
|
|
# nn.Embedding only takes LongTensor as input
|
|
input = torch.tensor([2, 8, 8, 6], device=device, dtype=torch.long)
|
|
output = embedding(input)
|
|
self.assertEqual(output[1], output[2])
|
|
self.assertTrue(output.data.norm(p=2, dim=1).le(1).all())
|
|
|
|
# Test fails on Vg20
|
|
@skipCUDAIfRocm
|
|
@onlyCUDA
|
|
@dtypes(torch.half, torch.float)
|
|
def test_softmax(self, device, dtype):
|
|
input = torch.rand(32, 100, device=device, dtype=dtype, requires_grad=True)
|
|
inputf = input.to(torch.float).detach().requires_grad_(True)
|
|
out = F.softmax(input, dim=-1, dtype=torch.float)
|
|
outf = F.softmax(inputf, dim=-1)
|
|
# should be bitwise equal
|
|
self.assertEqual(out, outf, atol=0, rtol=0)
|
|
gO = torch.empty_like(outf).uniform_()
|
|
out.backward(gO)
|
|
outf.backward(gO)
|
|
# should be bitwise equal
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0, rtol=0)
|
|
|
|
@onlyCUDA
|
|
def test_pool3d_size_one_feature_dim(self, device):
|
|
# Tests crazy strides for feature dim of size 1
|
|
x = torch.randn(7, 1, 5, 3, 2, device=device)
|
|
strange_strides = [30, 1234, 6, 2, 1]
|
|
y = x.as_strided(x.size(), strange_strides)
|
|
x = x.cpu().as_strided(x.size(), strange_strides)
|
|
|
|
to_test = {
|
|
'max_pool3d': lambda t: F.max_pool3d(t, (5, 1, 1), stride=(5, 1, 1)),
|
|
'avg_pool3d': lambda t: F.avg_pool3d(t, (5, 1, 1), stride=(5, 1, 1)),
|
|
}
|
|
|
|
for test, fn in to_test.items():
|
|
# Should not crash
|
|
out_y = fn(y)
|
|
out_x = fn(x)
|
|
self.assertEqual(out_y, out_x.to(device), msg=test)
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest('6GB')
|
|
def test_pool3d_large_size_int64(self, device):
|
|
# See https://github.com/pytorch/pytorch/issues/52822
|
|
x = torch.randn(70, 32, 100, 100, 100, dtype=torch.half, device=device)
|
|
y = torch.nn.functional.max_pool3d(x, 5)
|
|
torch.cuda.synchronize()
|
|
|
|
ref_x = x.cpu().float() # max_pool3d_cpu is not implemented for half
|
|
ref_y = torch.nn.functional.max_pool3d(ref_x, 5)
|
|
|
|
self.assertEqual(y, ref_y, exact_dtype=False)
|
|
|
|
@onlyCUDA
|
|
def test_AvgPool3d_backward_after_cat_dim1_device(self, device):
|
|
# x has to have batch_size 1 to test contiguous checks
|
|
x = torch.randn(1, 3, 4, 4, 4, device=device, requires_grad=True)
|
|
y = F.avg_pool3d(x, kernel_size=3, padding=1, stride=2)
|
|
|
|
grad = torch.randn(y.size(), device=device)
|
|
# increase the stride in dimension 0. the tensor is still contiguous because size[0] is 1
|
|
stride = list(grad.stride())
|
|
stride[0] = stride[0] * 2
|
|
grad.set_(grad.storage(), 0, grad.size(), stride)
|
|
assert grad.is_contiguous()
|
|
|
|
y.backward(grad)
|
|
|
|
def test_pooling_size_empty(self, device):
|
|
t = torch.rand([1, 2, 3, 4], device=device)
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool1d(t, []))
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool2d(t, []))
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_avg_pool3d(t, []))
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool1d(t, []))
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool2d(t, []))
|
|
self.assertRaises(RuntimeError, lambda: F.adaptive_max_pool3d(t, []))
|
|
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long)))
|
|
def test_embedding_bag_empty_input(self, device, dtypes):
|
|
m = 4
|
|
n = 3
|
|
x = torch.tensor([], device=device, dtype=dtypes[0])
|
|
for sparse in [True, False]:
|
|
Embed = torch.nn.EmbeddingBag(m, n, sparse=sparse)
|
|
Embed.to(device)
|
|
|
|
output = Embed(input=x, offsets=torch.tensor([0], device=device, dtype=dtypes[1]))
|
|
self.assertEqual(output, torch.zeros_like(output))
|
|
|
|
output = Embed(input=x, offsets=torch.tensor([0, 0], device=device, dtype=dtypes[1]))
|
|
self.assertEqual(output, torch.zeros_like(output))
|
|
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long)))
|
|
def test_EmbeddingBag_per_sample_weights_failures(self, device, dtypes):
|
|
# Failure 1: mismatched embeddings / per_sample_weights dtype
|
|
es = nn.EmbeddingBag(5, 2, mode='sum').to(dtype=torch.float, device=device)
|
|
input = torch.tensor([3, 1, 1, 1, 4, 0], dtype=dtypes[0], device=device)
|
|
offsets = torch.tensor([0, 0, 3, 3, 6], dtype=dtypes[1], device=device)
|
|
per_sample_weights = torch.randn_like(input, dtype=torch.double, device=device)
|
|
if device == 'cpu':
|
|
with self.assertRaisesRegex(RuntimeError, 'have the same type as'):
|
|
es(input, offsets, per_sample_weights)
|
|
else:
|
|
with self.assertRaisesRegex(RuntimeError, 'expected scalar type'):
|
|
es(input, offsets, per_sample_weights)
|
|
|
|
# Failure 2.1: input/per_sample_weights have different sizes (1d input)
|
|
input = torch.tensor([3, 1, 1, 1, 4, 0], dtype=dtypes[0], device=device)
|
|
offsets = torch.tensor([0, 0, 3, 3, 6], dtype=dtypes[1], device=device)
|
|
per_sample_weights = torch.randn(5, dtype=torch.float, device=device)
|
|
with self.assertRaisesRegex(ValueError, 'same shape as the input'):
|
|
es(input, offsets, per_sample_weights)
|
|
|
|
# Failure 2.2: input/per_sample_weights have different sizes (2d input)
|
|
input = torch.randint(5, (7, 3), dtype=dtypes[0], device=device)
|
|
offsets = None
|
|
per_sample_weights = torch.randn(7 * 3, dtype=torch.float, device=device)
|
|
with self.assertRaisesRegex(ValueError, 'same shape as the input'):
|
|
es(input, offsets, per_sample_weights)
|
|
|
|
# Failure 3: Unsupported per_sample_weights and mode=('max', 'mean')
|
|
for unsupported_mode in ('max', 'mean'):
|
|
es = nn.EmbeddingBag(5, 2, mode=unsupported_mode).to(
|
|
dtype=torch.float, device=device)
|
|
input = torch.randint(5, (7, 3), dtype=dtypes[0], device=device)
|
|
offsets = None
|
|
per_sample_weights = torch.randn(7, 3, dtype=torch.float, device=device)
|
|
with self.assertRaisesRegex(NotImplementedError,
|
|
"only supported for mode='sum'"):
|
|
es(input, offsets, per_sample_weights)
|
|
|
|
def _embedding_bag_reference_impl(self, input, weight, offsets=None, mode='sum',
|
|
per_sample_weights=None, include_last_offset=False):
|
|
assert mode == 'sum' or per_sample_weights is None
|
|
assert offsets is not None
|
|
if per_sample_weights is None:
|
|
per_sample_weights = torch.ones(input.size()).to(
|
|
dtype=weight.dtype, device=weight.device
|
|
)
|
|
assert input.numel() == per_sample_weights.numel()
|
|
|
|
bags = []
|
|
long_input = input.to(torch.long)
|
|
embeddings = weight.index_select(0, long_input) * per_sample_weights.unsqueeze(1)
|
|
if include_last_offset:
|
|
for index in range(len(offsets) - 1):
|
|
offset = offsets[index]
|
|
next_offset = offsets[index + 1]
|
|
length = next_offset - offset
|
|
if length == 0:
|
|
bags.append(
|
|
torch.tensor([0] * weight.size(1)).to(
|
|
dtype=embeddings.dtype, device=embeddings.device
|
|
)
|
|
)
|
|
else:
|
|
if mode == 'sum':
|
|
bags.append(embeddings.narrow(0, offset, length).sum(0))
|
|
elif mode == 'mean':
|
|
bags.append(embeddings.narrow(0, offset, length).sum(0).div(length))
|
|
else:
|
|
assert mode == 'max'
|
|
bags.append(embeddings.narrow(0, offset, length).max(0)[0])
|
|
else:
|
|
for index, offset in enumerate(offsets):
|
|
if index + 1 < len(offsets):
|
|
next_offset = offsets[index + 1]
|
|
else:
|
|
next_offset = len(long_input)
|
|
length = next_offset - offset
|
|
if length == 0:
|
|
bags.append(
|
|
torch.tensor([0] * weight.size(1)).to(
|
|
dtype=embeddings.dtype, device=embeddings.device
|
|
)
|
|
)
|
|
else:
|
|
if mode == 'sum':
|
|
bags.append(embeddings.narrow(0, offset, length).sum(0))
|
|
elif mode == 'mean':
|
|
bags.append(embeddings.narrow(0, offset, length).sum(0).div(length))
|
|
else:
|
|
assert mode == 'max'
|
|
bags.append(embeddings.narrow(0, offset, length).max(0)[0])
|
|
return torch.stack(bags)
|
|
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double, torch.half)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_EmbeddingBag_empty_per_sample_weights_and_offsets(self, device, dtypes):
|
|
# Test empty input and per sample weight, and backward pass. There was a CUDA
|
|
# invalid configuration bug (more context in #46572)
|
|
def test_per_sample_weights(mode, trainable_scale):
|
|
es = nn.EmbeddingBag(5, 2, mode=mode).to(dtype=dtypes[2], device=device)
|
|
es.weight.data.copy_(
|
|
torch.arange(1, 11, device=device, dtype=dtypes[2]).view_as(es.weight))
|
|
input = torch.tensor([], device=device, dtype=dtypes[0])
|
|
offsets = torch.tensor([0, 0, 0, 0, 0], device=device, dtype=dtypes[1])
|
|
per_sample_weights = torch.randn_like(input, dtype=dtypes[2]) \
|
|
.requires_grad_(trainable_scale)
|
|
ref_per_sample_weights = \
|
|
per_sample_weights.detach().requires_grad_(trainable_scale)
|
|
reference_weights = es.weight.detach().requires_grad_()
|
|
|
|
expected = self._embedding_bag_reference_impl(
|
|
input, reference_weights, offsets, mode, ref_per_sample_weights)
|
|
result = es(input, offsets, per_sample_weights)
|
|
self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
grad = torch.randn_like(expected)
|
|
result.backward(grad)
|
|
# the reference impl doesn't have grad fn for empty input; but the grad should
|
|
# simply be a zero tensor
|
|
ref_weights_grad = torch.zeros_like(es.weight)
|
|
self.assertEqual(es.weight.grad, ref_weights_grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
if trainable_scale:
|
|
ref_per_sample_weights_grad = torch.empty_like(per_sample_weights)
|
|
self.assertEqual(per_sample_weights.grad, ref_per_sample_weights_grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
modes = ('sum',)
|
|
trainable_scale = (True, False)
|
|
for mode, trainable in itertools.product(modes, trainable_scale):
|
|
test_per_sample_weights(mode, trainable)
|
|
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double, torch.half)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_EmbeddingBag_per_sample_weights_and_offsets(self, device, dtypes):
|
|
def test_per_sample_weights(mode, trainable_scale):
|
|
es = nn.EmbeddingBag(5, 2, mode=mode).to(dtype=dtypes[2], device=device)
|
|
es.weight.data.copy_(
|
|
torch.arange(1, 11, device=device, dtype=dtypes[2]).view_as(es.weight))
|
|
input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtypes[0])
|
|
offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=dtypes[1])
|
|
per_sample_weights = torch.randn_like(input, dtype=dtypes[2]) \
|
|
.requires_grad_(trainable_scale)
|
|
ref_per_sample_weights = \
|
|
per_sample_weights.detach().requires_grad_(trainable_scale)
|
|
reference_weights = es.weight.detach().requires_grad_()
|
|
|
|
expected = self._embedding_bag_reference_impl(
|
|
input, reference_weights, offsets, mode, ref_per_sample_weights)
|
|
result = es(input, offsets, per_sample_weights)
|
|
self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
grad = torch.randn_like(expected).to(dtype=dtypes[2], device=device)
|
|
result.backward(grad)
|
|
expected.backward(grad)
|
|
self.assertEqual(es.weight.grad, reference_weights.grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
if trainable_scale:
|
|
self.assertEqual(per_sample_weights.grad, ref_per_sample_weights.grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
modes = ('sum',)
|
|
trainable_scale = (True, False)
|
|
for mode, trainable in itertools.product(modes, trainable_scale):
|
|
test_per_sample_weights(mode, trainable)
|
|
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double, torch.half)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_EmbeddingBag_per_sample_weights_and_new_offsets(self, device, dtypes):
|
|
def test_per_sample_weights_new_offsets(mode, trainable_scale, include_last_offset, has_weight=True):
|
|
es = nn.EmbeddingBag(5, 2, mode=mode, include_last_offset=include_last_offset).to(dtype=dtypes[2], device=device)
|
|
es.weight.data.copy_(
|
|
torch.arange(1, 11, device=device, dtype=dtypes[2]).view_as(es.weight))
|
|
input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtypes[0])
|
|
offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=dtypes[1])
|
|
|
|
if include_last_offset:
|
|
offsets = torch.cat((offsets, torch.tensor([input.size(0)], device=device, dtype=dtypes[1])), 0)
|
|
|
|
if has_weight:
|
|
per_sample_weights = torch.randn_like(input, device=device, dtype=dtypes[2]) \
|
|
.requires_grad_(trainable_scale)
|
|
ref_per_sample_weights = \
|
|
per_sample_weights.detach().requires_grad_(trainable_scale)
|
|
else:
|
|
per_sample_weights = None
|
|
ref_per_sample_weights = None
|
|
|
|
reference_weights = es.weight.detach().requires_grad_()
|
|
|
|
expected = self._embedding_bag_reference_impl(
|
|
input, reference_weights, offsets, mode, ref_per_sample_weights, include_last_offset)
|
|
result = es(input, offsets, per_sample_weights)
|
|
self.assertEqual(result, expected, atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
grad = torch.randn_like(expected)
|
|
result.backward(grad)
|
|
expected.backward(grad)
|
|
self.assertEqual(es.weight.grad, reference_weights.grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
if has_weight and trainable_scale:
|
|
self.assertEqual(per_sample_weights.grad, ref_per_sample_weights.grad,
|
|
atol=dtype2prec_DONTUSE[dtypes[2]], rtol=0)
|
|
|
|
trainable_scale = (True, False)
|
|
include_last_offset = (True, False)
|
|
modes = (('sum', False), ('sum', True), ('max', False), ('mean', False))
|
|
for (mode, has_weight), trainable, include_last_offset in itertools.product(
|
|
modes, trainable_scale, include_last_offset
|
|
):
|
|
test_per_sample_weights_new_offsets(
|
|
mode, trainable, include_last_offset, has_weight
|
|
)
|
|
|
|
def _test_EmbeddingBag_vs_Embedding(self, N, D, B, L, max_norm=None,
|
|
mode='mean',
|
|
device='cpu',
|
|
wdtype=torch.float,
|
|
dtype=torch.long,
|
|
test_per_sample_weights=False,
|
|
trainable_per_sample_weights=False,
|
|
sparse=False,
|
|
test_backward=True,
|
|
backward_prec=None):
|
|
es = nn.EmbeddingBag(N, D, mode=mode, sparse=sparse, max_norm=max_norm).to(device, wdtype)
|
|
e = nn.Embedding(N, D, max_norm=max_norm).to(device, wdtype)
|
|
e.weight.data.copy_(es.weight)
|
|
input = torch.randint(N, (B, L), device=device, dtype=dtype)
|
|
offsets = torch.arange(0, B, device=device, dtype=dtype).mul_(L)
|
|
grad_output = torch.rand(B, D, device=device, dtype=wdtype)
|
|
|
|
if test_per_sample_weights:
|
|
# To prevent large gradients, weights should sum to 1 for each bag
|
|
per_sample_weights = \
|
|
torch.randn(B, L, device=device, dtype=wdtype).softmax(dim=-1)
|
|
per_sample_weights_reference = \
|
|
per_sample_weights.clone().requires_grad_(trainable_per_sample_weights)
|
|
per_sample_weights.requires_grad_(trainable_per_sample_weights)
|
|
output = es(input.view(-1), offsets, per_sample_weights.view(-1))
|
|
else:
|
|
output = es(input.view(-1), offsets)
|
|
per_sample_weights = None
|
|
per_sample_weights_reference = None
|
|
|
|
if mode == 'sum':
|
|
if test_per_sample_weights:
|
|
ref_output = (e(input) * per_sample_weights_reference.unsqueeze(-1)).sum(1)
|
|
else:
|
|
ref_output = e(input).sum(1)
|
|
elif mode == 'mean':
|
|
assert not test_per_sample_weights
|
|
ref_output = e(input).mean(1)
|
|
elif mode == 'max':
|
|
assert not test_per_sample_weights
|
|
ref_output = e(input).max(1)[0]
|
|
|
|
self.assertEqual(output, ref_output, atol=dtype2prec_DONTUSE[wdtype], rtol=0)
|
|
|
|
if not test_backward:
|
|
return
|
|
|
|
output.backward(grad_output)
|
|
ref_output.backward(grad_output)
|
|
es_weight_grad = es.weight.grad.data
|
|
if sparse:
|
|
es_weight_grad = es.weight.grad.data.to_dense()
|
|
|
|
# We have more floating point error here because we are dealing with larger numbers
|
|
if backward_prec is None:
|
|
needed_prec = dtype2prec_DONTUSE[wdtype] * 5
|
|
else:
|
|
needed_prec = backward_prec
|
|
|
|
self.assertEqual(es_weight_grad, e.weight.grad, atol=needed_prec, rtol=0)
|
|
|
|
if test_per_sample_weights and trainable_per_sample_weights:
|
|
self.assertEqual(per_sample_weights.grad, per_sample_weights_reference.grad,
|
|
atol=dtype2prec_DONTUSE[wdtype], rtol=0)
|
|
|
|
@skipCUDAIf(True, "Temporarily disabled. See t54369166")
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.half, torch.float, torch.double)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_EmbeddingBag_per_sample_weights_and_no_offsets(self, device, dtypes):
|
|
def run_tests(mode, sparse, trainable_per_sample_weights):
|
|
kwargs = dict(test_per_sample_weights=True, device=device,
|
|
mode=mode, wdtype=dtypes[1], dtype=dtypes[0], sparse=sparse,
|
|
trainable_per_sample_weights=trainable_per_sample_weights)
|
|
|
|
# Simple case
|
|
self._test_EmbeddingBag_vs_Embedding(2, 3, 5, 7, **kwargs)
|
|
|
|
# B * L > 1000
|
|
self._test_EmbeddingBag_vs_Embedding(2, 5, 53, 23, **kwargs)
|
|
|
|
# Large num_embedding
|
|
self._test_EmbeddingBag_vs_Embedding(101, 5, 3, 7, **kwargs)
|
|
|
|
# Large embedding_dim
|
|
self._test_EmbeddingBag_vs_Embedding(2, 101, 3, 7, **kwargs)
|
|
|
|
modes = ('sum',)
|
|
sparsity = (True, False)
|
|
trainable_scale = (True, False)
|
|
for mode, sparse, trainable_per_sample_weights in \
|
|
itertools.product(modes, sparsity, trainable_scale):
|
|
run_tests(mode, sparse, trainable_per_sample_weights)
|
|
|
|
# Test CUDA Dense on half precision
|
|
if device == 'cuda':
|
|
modes = ('sum',)
|
|
sparsity = (False,)
|
|
trainable_scale = (True, False)
|
|
for mode, sparse, trainable_per_sample_weights in \
|
|
itertools.product(modes, sparsity, trainable_scale):
|
|
run_tests(mode, sparse, trainable_per_sample_weights)
|
|
|
|
def _test_EmbeddingBag(
|
|
self,
|
|
device,
|
|
mode,
|
|
sparse,
|
|
wdtype=torch.double,
|
|
dtype=torch.long,
|
|
odtype=torch.long,
|
|
test_backward=True,
|
|
):
|
|
# check a known test example
|
|
es = nn.EmbeddingBag(5, 2, mode=mode, sparse=sparse).to(device, wdtype)
|
|
es.weight.data.copy_(torch.arange(1, 11, device=device, dtype=wdtype).view_as(es.weight))
|
|
input = torch.tensor([3, 1, 1, 1, 4, 0], device=device, dtype=dtype)
|
|
offsets = torch.tensor([0, 0, 3, 3, 6], device=device, dtype=odtype)
|
|
|
|
grad_output = torch.tensor(
|
|
[1, 2,
|
|
3, 4], device=device, dtype=wdtype).view(2, 2)
|
|
grad_output_with_empty = torch.tensor(
|
|
[99, 99,
|
|
1, 2,
|
|
99, 99,
|
|
3, 4,
|
|
99, 99], device=device, dtype=wdtype).view(5, 2)
|
|
|
|
if mode == "sum" or mode == "mean":
|
|
denominator = 1 if mode == "sum" else 3
|
|
expected_output = torch.tensor(
|
|
[[13, 16],
|
|
[13, 16]], device=device, dtype=wdtype) / denominator
|
|
|
|
expected_output_with_empty = torch.tensor(
|
|
[[0, 0],
|
|
[13, 16],
|
|
[0, 0],
|
|
[13, 16],
|
|
[0, 0]], device=device, dtype=wdtype) / denominator
|
|
|
|
expected_grad_weight = torch.tensor(
|
|
[[3, 4],
|
|
[5, 8],
|
|
[0, 0],
|
|
[1, 2],
|
|
[3, 4]], device=device, dtype=wdtype) / denominator
|
|
elif mode == "max":
|
|
expected_output = torch.tensor(
|
|
[[7, 8],
|
|
[9, 10]], device=device, dtype=wdtype)
|
|
|
|
expected_output_with_empty = torch.tensor(
|
|
[[0, 0],
|
|
[7, 8],
|
|
[0, 0],
|
|
[9, 10],
|
|
[0, 0]], device=device, dtype=wdtype)
|
|
|
|
expected_grad_weight = torch.tensor(
|
|
[[0, 0],
|
|
[0, 0],
|
|
[0, 0],
|
|
[1, 2],
|
|
[3, 4]], device=device, dtype=wdtype)
|
|
output = es(input, offsets)
|
|
output.backward(grad_output_with_empty)
|
|
|
|
es_weight_grad = es.weight.grad.data
|
|
if sparse:
|
|
es_weight_grad = es.weight.grad.to_dense()
|
|
self.assertEqual(output, expected_output_with_empty)
|
|
self.assertEqual(es_weight_grad, expected_grad_weight, atol=dtype2prec_DONTUSE[wdtype], rtol=0)
|
|
|
|
# check same example except as 2D (2 x 3)
|
|
input = input.view(2, -1)
|
|
es.zero_grad()
|
|
output = es(input)
|
|
output.backward(grad_output)
|
|
|
|
es_weight_grad = es.weight.grad
|
|
if sparse:
|
|
es_weight_grad = es.weight.grad.to_dense()
|
|
self.assertEqual(output, expected_output)
|
|
self.assertEqual(es_weight_grad, expected_grad_weight, atol=dtype2prec_DONTUSE[wdtype], rtol=0)
|
|
|
|
# test all empty bags
|
|
es.zero_grad()
|
|
inputs = torch.tensor([], dtype=dtype, device=device)
|
|
offsets = torch.tensor([0, 0, 0, 0], dtype=odtype, device=device)
|
|
es(inputs, offsets).sum().backward()
|
|
dense_grad = es.weight.grad
|
|
if dense_grad.is_sparse:
|
|
dense_grad = dense_grad.to_dense()
|
|
self.assertEqual(dense_grad, torch.zeros_like(es.weight))
|
|
|
|
# now compare EmbeddingBag vs Embedding + Sum/Mean, for constant bag length
|
|
N, D, B, L = random.randint(1, 100), random.randint(1, 100), random.randint(1, 50), random.randint(1, 50)
|
|
kwargs = dict(mode=mode, sparse=sparse, device=device, wdtype=wdtype, dtype=dtype, test_backward=test_backward)
|
|
self._test_EmbeddingBag_vs_Embedding(N, D, B, L, **kwargs)
|
|
for max_norm in (None, 3):
|
|
for p in itertools.product([1, 2], repeat=4):
|
|
self._test_EmbeddingBag_vs_Embedding(*p, max_norm=max_norm, **kwargs)
|
|
|
|
# check that giving illegal input combos raises error
|
|
es = nn.EmbeddingBag(10, 20, mode=mode, sparse=sparse)
|
|
input = torch.ones(3, 4, dtype=dtype)
|
|
offset = torch.arange(0, 3, dtype=odtype)
|
|
self.assertRaises(ValueError, lambda: es(input, offset))
|
|
self.assertRaises(ValueError, lambda: es(input.view(-1)))
|
|
offset[0] = 1
|
|
if self.device_type == "cpu":
|
|
self.assertRaises(RuntimeError, lambda: es(input.view(-1), offset))
|
|
offset[0] = 0
|
|
offset[-1] = 100
|
|
self.assertRaises(RuntimeError, lambda: es(input.view(-1), offset))
|
|
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double, torch.half)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_embedding_bag_device(self, device, dtypes):
|
|
self._test_EmbeddingBag(device, 'sum', False, wdtype=dtypes[2], dtype=dtypes[0], odtype=dtypes[1])
|
|
self._test_EmbeddingBag(device, 'mean', False, wdtype=dtypes[2], dtype=dtypes[0], odtype=dtypes[1])
|
|
self._test_EmbeddingBag(device, 'max', False, wdtype=dtypes[2], dtype=dtypes[0], odtype=dtypes[1])
|
|
|
|
test_backward = False
|
|
if self.device_type == 'cuda':
|
|
# see 'todo' in test_embedding_bag.
|
|
test_backward = dtypes[2] is not torch.float16
|
|
elif self.device_type == 'cpu':
|
|
# TODO: figure out why precision on sparse embeddings isn't the
|
|
# same as for dense.
|
|
test_backward = dtypes[2] is not torch.float
|
|
|
|
self._test_EmbeddingBag(
|
|
device,
|
|
'sum',
|
|
True,
|
|
wdtype=dtypes[2],
|
|
dtype=dtypes[0],
|
|
odtype=dtypes[1],
|
|
test_backward=test_backward,
|
|
)
|
|
self._test_EmbeddingBag(
|
|
device,
|
|
'mean',
|
|
True,
|
|
wdtype=dtypes[2],
|
|
dtype=dtypes[0],
|
|
odtype=dtypes[1],
|
|
test_backward=test_backward,
|
|
)
|
|
|
|
@dtypesIfCUDA(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double, torch.half)))
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long), (torch.float, torch.double)))
|
|
def test_embedding_bag_non_contiguous_weight(self, device, dtypes):
|
|
weight_tensor = torch.randn(3, 4, dtype=dtypes[2], device=device)
|
|
|
|
weight_tensor_non_contig = weight_tensor[:, :3] # This is non-contiguous strided.
|
|
weight_tensor_contig = weight_tensor_non_contig.clone().contiguous() # Contig-strided.
|
|
|
|
index = torch.tensor([0, 1, 2], dtype=dtypes[0], device=device)
|
|
offsets = torch.tensor([0, 2], dtype=dtypes[1], device=device)
|
|
for mode in ['sum', 'mean', 'max']:
|
|
output_non_contig = F.embedding_bag(
|
|
input=index,
|
|
weight=weight_tensor_non_contig,
|
|
offsets=offsets,
|
|
mode=mode,
|
|
)
|
|
output_contig = F.embedding_bag(
|
|
input=index,
|
|
weight=weight_tensor_contig,
|
|
offsets=offsets,
|
|
mode=mode,
|
|
)
|
|
self.assertEqual(output_non_contig, output_contig)
|
|
|
|
|
|
@onlyCUDA
|
|
@dtypes(*itertools.product((torch.int, torch.long), (torch.int, torch.long)))
|
|
def test_embedding_bag_bfloat16(self, device, dtypes):
|
|
self._test_EmbeddingBag(device, 'sum', True, wdtype=torch.bfloat16, dtype=dtypes[0], odtype=dtypes[1], test_backward=True)
|
|
self._test_EmbeddingBag(device, 'mean', True, wdtype=torch.bfloat16, dtype=dtypes[0], odtype=dtypes[1], test_backward=True)
|
|
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half, torch.float, torch.double)
|
|
def test_multihead_attention_dtype(self, device, dtype):
|
|
embed_dim = 128
|
|
num_heads = 8
|
|
sl = 10
|
|
bs = 8
|
|
model = nn.MultiheadAttention(embed_dim, num_heads).cuda().to(dtype)
|
|
q = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype)
|
|
k = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype)
|
|
v = torch.randn(sl, bs, embed_dim, device=device, dtype=dtype)
|
|
out = model(q, k, v)
|
|
self.assertEqual(q.size(), out[0].size())
|
|
self.assertEqual(dtype, out[0].dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes(include_bfloat16=AMPERE_OR_ROCM))
|
|
@dtypes(torch.float)
|
|
def test_Conv2d_naive_groups(self, device, dtype):
|
|
# Check that grouped convolutions matches two half convolutions
|
|
m = nn.Conv2d(4, 4, kernel_size=3, groups=2).to(device, dtype)
|
|
i = torch.randn(2, 4, 6, 6, device=device, dtype=dtype, requires_grad=True)
|
|
output = m(i)
|
|
grad_output = torch.randn(2, 4, 4, 4, device=device, dtype=dtype)
|
|
output.backward(grad_output)
|
|
|
|
m1 = nn.Conv2d(2, 2, kernel_size=3).to(device, dtype)
|
|
m1.weight.data.copy_(m.weight.data[:2])
|
|
m1.bias.data.copy_(m.bias.data[:2])
|
|
i1 = i.data[:, :2].contiguous().requires_grad_(True)
|
|
output1 = m1(i1)
|
|
output1.backward(grad_output[:, :2].contiguous())
|
|
|
|
m2 = nn.Conv2d(2, 2, kernel_size=3).to(device, dtype)
|
|
m2.weight.data.copy_(m.weight.data[2:])
|
|
m2.bias.data.copy_(m.bias.data[2:])
|
|
i2 = i.data[:, 2:].contiguous().requires_grad_(True)
|
|
output2 = m2(i2)
|
|
output2.backward(grad_output[:, 2:].contiguous())
|
|
|
|
self.assertEqual(output, torch.cat([output1, output2], 1))
|
|
self.assertEqual(i.grad.data,
|
|
torch.cat([i1.grad.data, i2.grad.data], 1),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.bias.grad.data,
|
|
torch.cat([m1.bias.grad.data, m2.bias.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
self.assertEqual(m.weight.grad.data,
|
|
torch.cat([m1.weight.grad.data, m2.weight.grad.data], 0),
|
|
atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
def _test_batchnorm_grad(self, device, dtype=torch.double):
|
|
bs, n_feat, size_feat = 4, 5, 6
|
|
input = torch.arange(bs * n_feat * size_feat, device=device,
|
|
requires_grad=True, dtype=dtype).view(bs, n_feat, size_feat)
|
|
weight = torch.arange(1, n_feat + 1, device=device, requires_grad=True, dtype=dtype)
|
|
bias = torch.arange(n_feat, device=device, requires_grad=True, dtype=dtype)
|
|
running_mean = 1 - torch.arange(n_feat, device=device, dtype=dtype)
|
|
running_var = 2 * torch.arange(n_feat, device=device, dtype=dtype)
|
|
for training in [False, True]:
|
|
_assertGradAndGradgradChecks(self, F.batch_norm, (input, running_mean, running_var, weight, bias,
|
|
training, 0.1, 0.0001))
|
|
|
|
def test_batchnorm_grad(self, device):
|
|
self._test_batchnorm_grad(device)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_grad(device)
|
|
|
|
|
|
def test_hardsigmoid_grad(self, device):
|
|
inputs = (torch.randn(4, 16, 16, device=device) - 0.5) * 10
|
|
inputs.requires_grad = True
|
|
self.assertTrue(gradcheck(F.hardsigmoid, (inputs,)))
|
|
|
|
# currently fails on XLA
|
|
@onlyOnCPUAndCUDA
|
|
def test_hardswish_grad(self, device):
|
|
inputs = (torch.randn(4, 16, 16, device=device) - 0.5) * 10
|
|
inputs.requires_grad = True
|
|
self.assertTrue(gradcheck(F.hardswish, (inputs,)))
|
|
|
|
|
|
def _test_batchnorm_eval(self, device, dtype, module_dtype=None):
|
|
module_dtype = module_dtype or dtype
|
|
module = nn.BatchNorm1d(3).to(device, module_dtype)
|
|
module.eval()
|
|
|
|
data = torch.rand(4, 3, device=device, dtype=dtype, requires_grad=True)
|
|
grad = torch.rand(4, 3, device=device, dtype=dtype)
|
|
|
|
# 1st pass
|
|
res1 = module(data)
|
|
res1.backward(grad)
|
|
grad1 = data.grad.clone()
|
|
|
|
# 2nd pass
|
|
if data.grad is not None:
|
|
data.grad.data.zero_()
|
|
|
|
res2 = module(data)
|
|
res2.backward(grad)
|
|
grad2 = data.grad.clone()
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
# track_running_stats=False
|
|
module = nn.BatchNorm1d(3, track_running_stats=False).to(device, module_dtype)
|
|
|
|
data = torch.rand(4, 3, device=device, dtype=dtype, requires_grad=True)
|
|
grad = torch.rand(4, 3, device=device, dtype=dtype)
|
|
|
|
# 1st pass
|
|
res1 = module(data)
|
|
res1.backward(grad)
|
|
grad1 = data.grad.clone()
|
|
|
|
# set eval
|
|
module.eval()
|
|
|
|
# 2nd pass
|
|
if data.grad is not None:
|
|
data.grad.data.zero_()
|
|
|
|
res2 = module(data)
|
|
res2.backward(grad)
|
|
grad2 = data.grad.clone()
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.bfloat16)
|
|
def test_batchnorm_eval(self, device, dtype):
|
|
self._test_batchnorm_eval(device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_eval(device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_batchnorm_eval_mixed(self, device, dtype):
|
|
# Test bfloat16 input with float module
|
|
self._test_batchnorm_eval(device, dtype, torch.float)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_eval(device, dtype, torch.float)
|
|
|
|
def _test_batchnorm_simple_average(self, device, dtype, module_dtype=None):
|
|
module_dtype = module_dtype or dtype
|
|
module = nn.BatchNorm1d(3, momentum=None).to(dtype=module_dtype, device=device)
|
|
zeros = torch.zeros(3, dtype=module_dtype, device=device)
|
|
ones = torch.ones(3, dtype=module_dtype, device=device)
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
data1 = torch.rand(4, 3, dtype=dtype, device=device)
|
|
data2 = torch.rand(4, 3, dtype=dtype, device=device)
|
|
|
|
# 1st pass
|
|
res1 = module(data1)
|
|
running_mean1 = module.running_mean.clone()
|
|
running_var1 = module.running_var.clone()
|
|
self.assertNotEqual(running_mean1, zeros)
|
|
self.assertNotEqual(running_var1, ones)
|
|
|
|
# reset stats
|
|
module.reset_running_stats()
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
# 2nd pass
|
|
res2 = module(data2)
|
|
running_mean2 = module.running_mean.clone()
|
|
running_var2 = module.running_var.clone()
|
|
self.assertNotEqual(running_mean2, zeros)
|
|
self.assertNotEqual(running_var2, ones)
|
|
|
|
# reset stats
|
|
module.reset_running_stats()
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
# 3rd (combined) pass
|
|
res3 = module(data1)
|
|
res4 = module(data2)
|
|
self.assertEqual(res3, res1)
|
|
self.assertEqual(res4, res2)
|
|
self.assertEqual(module.running_mean, (running_mean1 + running_mean2) / 2)
|
|
self.assertEqual(module.running_var, (running_var1 + running_var2) / 2)
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.bfloat16)
|
|
def test_batchnorm_simple_average(self, device, dtype):
|
|
self._test_batchnorm_simple_average(device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_simple_average(device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_batchnorm_simple_average_mixed(self, device, dtype):
|
|
self._test_batchnorm_simple_average(device, dtype, torch.float)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_simple_average(device, dtype, torch.float)
|
|
|
|
def _test_maxpool_indices(self, num_dim, adaptive=False, device="cpu", dtype=torch.float):
|
|
def expected_indices(dim):
|
|
if dim == 1:
|
|
return torch.tensor([1, 3], dtype=torch.double).repeat(2, 2, 1)
|
|
if dim == 2:
|
|
return torch.tensor([[5, 7], [13, 15]], dtype=torch.double).repeat(2, 2, 1, 1)
|
|
|
|
def expected_grad(dim):
|
|
if dim == 1:
|
|
return torch.tensor([0, 1, 0, 1], dtype=torch.double).repeat(2, 2, 1)
|
|
grad = expected_grad(dim - 1)
|
|
zero = torch.zeros(grad.size())
|
|
return torch.stack((zero, grad, zero, grad), 2)
|
|
|
|
def expected_output(dim):
|
|
if dim == 1:
|
|
return torch.arange(2, 17, 2).view(2, 2, 2)
|
|
if dim == 2:
|
|
col = torch.arange(6, 63, 8)
|
|
return torch.stack([col, col + 2], 1).view(2, 2, 2, 2)
|
|
|
|
if adaptive:
|
|
cls_name = 'AdaptiveMaxPool{}d'.format(num_dim)
|
|
else:
|
|
cls_name = 'MaxPool{}d'.format(num_dim)
|
|
module_cls = getattr(nn, cls_name)
|
|
module = module_cls(2, return_indices=True).to(device, dtype=dtype)
|
|
numel = 4 ** (num_dim + 1)
|
|
input = torch.arange(1, numel + 1).view(2, 2, *repeat(4, num_dim)).to(device, dtype=dtype)
|
|
input_var = input.clone().detach().requires_grad_()
|
|
|
|
# Check forward
|
|
output, indices = module(input_var)
|
|
if num_dim != 3:
|
|
expected_indices = expected_indices(num_dim)
|
|
expected_output = expected_output(num_dim)
|
|
self.assertEqual(indices.dim(), input.dim())
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(indices.data.squeeze(), expected_indices)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(output.data.squeeze(), expected_output)
|
|
self.assertTrue(output.requires_grad)
|
|
self.assertFalse(indices.requires_grad)
|
|
|
|
# Make sure backward works
|
|
grad_output = torch.ones(output.size(), device=device, dtype=dtype)
|
|
output.backward(grad_output, retain_graph=True)
|
|
expected_grad = expected_grad(num_dim)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(input_var.grad.data, expected_grad.view_as(input))
|
|
|
|
# Make sure backward after changing indices will result in an error
|
|
indices.add_(1)
|
|
self.assertRaises(RuntimeError, lambda: output.backward(grad_output))
|
|
|
|
# Make sure -Infinity is handled correctly
|
|
t = torch.tensor([[[float("-inf")]]])
|
|
m = nn.MaxPool1d(kernel_size=1, return_indices=True)
|
|
output, indices = m(t)
|
|
self.assertEqual(output[0, 0, 0], float("-inf"))
|
|
self.assertEqual(indices[0, 0, 0], 0)
|
|
|
|
t = torch.tensor([[[float("-inf")]]])
|
|
m = nn.MaxPool2d(kernel_size=1, return_indices=True)
|
|
output, indices = m(t)
|
|
self.assertEqual(output[0, 0, 0], float("-inf"))
|
|
self.assertEqual(indices[0, 0, 0], 0)
|
|
|
|
t = torch.tensor([[[[float("-inf")]]]])
|
|
m = nn.MaxPool3d(kernel_size=1, return_indices=True)
|
|
output, indices = m(t)
|
|
self.assertEqual(output[0, 0, 0, 0], float("-inf"))
|
|
self.assertEqual(indices[0, 0, 0, 0], 0)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_MaxPool1d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(1, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_MaxPool2d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(2, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_MaxPool3d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(3, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_AdaptiveMaxPool1d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(1, adaptive=True, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_AdaptiveMaxPool2d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(2, adaptive=True, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_AdaptiveMaxPool3d_indices(self, device, dtype):
|
|
self._test_maxpool_indices(3, adaptive=True, device=device, dtype=dtype)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.float)
|
|
@onlyOnCPUAndCUDA # TODO: Fails on XLA
|
|
def test_max_pool_nan_inf(self, device, dtype):
|
|
for adaptive in ['', 'adaptive_']:
|
|
for num_dim in [1, 2, 3]:
|
|
fn_name = '{}max_pool{}d'.format(adaptive, num_dim)
|
|
fn = getattr(F, fn_name)
|
|
|
|
x = torch.full([1, 1] + num_dim * [3], nan, device=device, dtype=dtype, requires_grad=True)
|
|
res = fn(x, 1 if adaptive else 3)
|
|
res.backward(torch.randn_like(res))
|
|
self.assertTrue(math.isnan(res.item()))
|
|
x.requires_grad_(False)
|
|
res = fn(x, 1 if adaptive else 3)
|
|
self.assertTrue(math.isnan(res.item()))
|
|
|
|
x2 = torch.full([1, 1] + num_dim * [3], -inf, device=device, dtype=dtype, requires_grad=True)
|
|
res2 = fn(x2, 1 if adaptive else 3)
|
|
res2.backward(torch.randn_like(res2))
|
|
self.assertTrue(math.isinf(res2.item()))
|
|
x2.requires_grad_(False)
|
|
res2 = fn(x2, 1 if adaptive else 3)
|
|
self.assertTrue(math.isinf(res2.item()))
|
|
|
|
@onlyOnCPUAndCUDA
|
|
@dtypes(torch.float, torch.double)
|
|
def test_grid_sample_nan_inf(self, device, dtype):
|
|
input = torch.zeros([1, 1, 3, 3], device=device, dtype=dtype)
|
|
grid = torch.tensor([[[[nan, 0], [0, inf]]]], device=device, dtype=dtype)
|
|
for padding_mode in ('reflection', 'border', 'zeros'):
|
|
sample = torch.nn.functional.grid_sample(input=input, grid=grid, mode='nearest',
|
|
padding_mode=padding_mode, align_corners=False)
|
|
self.assertEqual(sample, torch.zeros([1, 1, 1, 2], device=device, dtype=dtype))
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_fractional_max_pool2d(self, device):
|
|
x = torch.randn(1, 2, 7, 7, requires_grad=True, device=device)
|
|
samples = x.new(1, 2, 2).uniform_()
|
|
|
|
def func(x):
|
|
return F.fractional_max_pool2d(
|
|
x, (2, 2), output_size=(3, 3), _random_samples=samples)
|
|
|
|
self.assertEqual(func(x).shape, (1, 2, 3, 3))
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
x = torch.randn(2, 7, 7, requires_grad=True, device=device)
|
|
self.assertEqual(func(x).shape, (2, 3, 3))
|
|
if self.device_type != 'cuda':
|
|
# Reference: https://github.com/pytorch/pytorch/issues/52427
|
|
# Raises -> RuntimeError: TensorAccessor expected 4 dims but tensor has 3
|
|
# on CUDA in gradcheck
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
for kernel_size in [(), (1,)]:
|
|
with self.assertRaisesRegex(RuntimeError, "kernel_size must either"):
|
|
# Incorrect kernel_size
|
|
F.fractional_max_pool2d(x, kernel_size=kernel_size, output_size=(3, 3), _random_samples=samples)
|
|
|
|
err_large_msg = "too large relative to input "
|
|
err_out_size_msg = "output_size must either"
|
|
for output_size, msg in [((9, 3), err_large_msg + "height"),
|
|
((3, 9), err_large_msg + "width"),
|
|
((3,), err_out_size_msg),
|
|
((), err_out_size_msg)]:
|
|
with self.assertRaisesRegex(RuntimeError, msg):
|
|
# Incorrect output_size
|
|
F.fractional_max_pool2d(x, (2, 2), output_size=output_size, _random_samples=samples)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_fractional_max_pool3d(self, device):
|
|
x = torch.randn(1, 2, 7, 7, 7, requires_grad=True, device=device)
|
|
samples = x.new(1, 2, 3).uniform_()
|
|
|
|
def func(x):
|
|
return F.fractional_max_pool3d(
|
|
x, (2, 2, 2), output_size=(3, 3, 3), _random_samples=samples)
|
|
|
|
self.assertEqual(func(x).shape, (1, 2, 3, 3, 3))
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
x = torch.randn(2, 7, 7, 7, requires_grad=True, device=device)
|
|
self.assertEqual(func(x).shape, (2, 3, 3, 3))
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
for kernel_size in [(), (1,), (1, 1)]:
|
|
with self.assertRaisesRegex(RuntimeError, "kernel_size must either"):
|
|
# Incorrect kernel_size
|
|
F.fractional_max_pool3d(x, kernel_size=kernel_size, output_size=(3, 3, 3), _random_samples=samples)
|
|
|
|
err_large_msg = "too large relative to input "
|
|
err_out_size_msg = "output_size must either"
|
|
for output_size, msg in [((9, 3, 3), err_large_msg + "time"),
|
|
((3, 9, 3), err_large_msg + "height"),
|
|
((3, 3, 9), err_large_msg + "width"),
|
|
((3, 3), err_out_size_msg),
|
|
((3,), err_out_size_msg),
|
|
((), err_out_size_msg)]:
|
|
with self.assertRaisesRegex(RuntimeError, msg):
|
|
# Incorrect output_size
|
|
F.fractional_max_pool3d(x, (2, 2, 2), output_size=output_size, _random_samples=samples)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.float)
|
|
@onlyOnCPUAndCUDA # TODO: Fails on XLA
|
|
def test_fractional_max_pool_nan_inf(self, device, dtype):
|
|
for num_dim in [2, 3]:
|
|
fn_name = 'FractionalMaxPool{}d'.format(num_dim)
|
|
fn = getattr(nn, fn_name)(kernel_size=2, output_size=1)
|
|
x = torch.full([1, 1] + num_dim * [3], nan, device=device, dtype=dtype, requires_grad=True)
|
|
res = fn(x)
|
|
res.backward(torch.randn_like(res))
|
|
self.assertTrue(math.isnan(res.item()))
|
|
|
|
x2 = torch.full([1, 1] + num_dim * [3], -inf, device=device, dtype=dtype, requires_grad=True)
|
|
res2 = fn(x2)
|
|
res2.backward(torch.randn_like(res2))
|
|
self.assertTrue(math.isinf(res2.item()))
|
|
|
|
@onlyOnCPUAndCUDA # TODO: RuntimeError message different on XLA
|
|
def test_pooling_zero_stride(self, device):
|
|
for op in ('max', 'avg'):
|
|
for num_dim in [1, 2, 3]:
|
|
fn_name = '{}_pool{}d'.format(op, num_dim)
|
|
fn = getattr(F, fn_name)
|
|
x = torch.ones([1, 2] + num_dim * [4], device=device, dtype=torch.float)
|
|
self.assertRaisesRegex(RuntimeError, r"stride should not be zero|stride must be greater than zero",
|
|
lambda: fn(x, kernel_size=2, stride=0))
|
|
|
|
fn_module_name = '{}Pool{}d'.format(op.title(), num_dim)
|
|
fn_module = getattr(nn, fn_module_name)(kernel_size=2, stride=0)
|
|
self.assertRaisesRegex(RuntimeError, r"stride should not be zero|stride must be greater than zero",
|
|
lambda: fn_module(x))
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_pool_large_size(self, device, dtype):
|
|
for op in ('max', 'avg'):
|
|
for num_dim in [1, 2, 3]:
|
|
fn_name = '{}_pool{}d'.format(op, num_dim)
|
|
fn = getattr(F, fn_name)
|
|
# 16777217 is the smallest integer not expressible in float32
|
|
x = torch.ones([1, 1, 16777217] + (num_dim - 1) * [1],
|
|
device=device, dtype=dtype)
|
|
res = fn(x, 1, stride=1, padding=0)
|
|
# check if the output shape was still computed correctly
|
|
self.assertEqual(x.shape[2], res.shape[2])
|
|
|
|
@dtypesIfCUDA(*get_all_fp_dtypes())
|
|
@dtypes(torch.float)
|
|
def test_pool_invalid_size(self, device, dtype):
|
|
for op in ('max', 'avg'):
|
|
for num_dim in [1, 2, 3]:
|
|
fn_name = '{}_pool{}d'.format(op, num_dim)
|
|
if op == 'max':
|
|
# New implementation without indices supports empty tensors
|
|
# TODO(Heitor) change once with_indices code is updated
|
|
fn_name += '_with_indices'
|
|
fn = getattr(F, fn_name)
|
|
# use a configuration that gives zero outputs only
|
|
# when doing a correct floor division by the stride
|
|
x = torch.ones([1, 1] + num_dim * [4],
|
|
device=device, dtype=dtype)
|
|
with self.assertRaisesRegex(RuntimeError, r"too small|smaller than"):
|
|
try:
|
|
res = fn(x, 3, stride=2, padding=0, dilation=2)
|
|
except TypeError:
|
|
# some implementations do not support dilation
|
|
res = fn(x, 6, stride=2, padding=0)
|
|
|
|
def test_CTCLoss_empty_target(self, device):
|
|
target_lengths = [0, 0, 0]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (0,), dtype=torch.long, device=device)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2)
|
|
loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((loss >= 0).all().item())
|
|
self.assertEqual(-log_probs.sum(0)[:, 0], loss)
|
|
|
|
target_lengths = [0, 9, 0]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (9,), dtype=torch.long, device=device)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2)
|
|
loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((loss >= 0).all().item())
|
|
self.assertEqual(-log_probs.sum(0)[[0, 2], 0], loss[[0, 2]])
|
|
|
|
def test_empty_dropout(self, device):
|
|
x = torch.tensor([]).to(device)
|
|
out = torch.nn.functional.dropout(x)
|
|
self.assertEqual(out.size(), x.size())
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.float)
|
|
@tf32_on_and_off(0.005)
|
|
def test_variable_sequence(self, device, dtype):
|
|
def pad(var, length):
|
|
if var.size(0) == length:
|
|
return var
|
|
return torch.cat([var, var.new_zeros(length - var.size(0), *var.size()[1:])])
|
|
|
|
def maybe_index_tuple(maybe_tuple_of_tensors, index):
|
|
if maybe_tuple_of_tensors is None:
|
|
return None
|
|
return tuple(maybe_tuple_of_tensors[j][:, index:index + 1, :].contiguous()
|
|
for j in range(2))
|
|
|
|
def check_lengths(lengths, enforce_sorted, use_default_hiddens, proj_size):
|
|
input_size = 3
|
|
hidden_size = 4
|
|
num_layers = 2
|
|
bidirectional = True
|
|
|
|
max_length = max(lengths)
|
|
x_leaf = torch.randn(max_length, len(lengths), input_size, device=device,
|
|
dtype=dtype, requires_grad=True)
|
|
num_directions = 2 if bidirectional else 1
|
|
lstm = nn.LSTM(input_size, hidden_size, bidirectional=bidirectional,
|
|
num_layers=num_layers, proj_size=proj_size).to(device, dtype)
|
|
lstm2 = deepcopy(lstm).to(device, dtype)
|
|
x = x_leaf
|
|
|
|
hidden0 = None
|
|
if not use_default_hiddens:
|
|
real_hidden_size = hidden_size if proj_size == 0 else proj_size
|
|
hidden0 = (torch.randn(num_directions * num_layers, len(lengths), real_hidden_size,
|
|
device=device, dtype=dtype),
|
|
torch.randn(num_directions * num_layers, len(lengths), hidden_size,
|
|
device=device, dtype=dtype))
|
|
|
|
# Compute sequences separately
|
|
seq_outs = []
|
|
seq_hiddens = []
|
|
for i, l in enumerate(lengths):
|
|
hidden_i = maybe_index_tuple(hidden0, i)
|
|
out, hid = lstm2(x[:l, i:i + 1], hidden_i)
|
|
out_pad = pad(out, max_length)
|
|
seq_outs.append(out_pad)
|
|
seq_hiddens.append(hid)
|
|
seq_out = torch.cat(seq_outs, 1)
|
|
seq_hidden = tuple(torch.cat(hids, 1) for hids in zip(*seq_hiddens))
|
|
|
|
# Use packed format
|
|
packed = rnn_utils.pack_padded_sequence(x, lengths, enforce_sorted=enforce_sorted)
|
|
packed_out, packed_hidden = lstm(packed, hidden0)
|
|
unpacked, unpacked_len = rnn_utils.pad_packed_sequence(packed_out)
|
|
|
|
# Check forward
|
|
prec = dtype2prec_DONTUSE[dtype]
|
|
self.assertEqual(packed_hidden, seq_hidden, atol=prec, rtol=0)
|
|
self.assertEqual(unpacked, seq_out, atol=prec, rtol=0)
|
|
self.assertEqual(unpacked_len, lengths, atol=prec, rtol=0)
|
|
|
|
# Check backward
|
|
seq_out.sum().backward()
|
|
grad_x = x_leaf.grad.data.clone()
|
|
x_leaf.grad.data.zero_()
|
|
unpacked.sum().backward()
|
|
|
|
self.assertEqual(x_leaf.grad, grad_x, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
for p1, p2 in zip(lstm.parameters(), lstm2.parameters()):
|
|
prec = dtype2prec_DONTUSE[dtype]
|
|
if dtype == torch.float16:
|
|
prec = 4e-2
|
|
self.assertEqual(p1.grad, p2.grad, atol=prec, rtol=0)
|
|
|
|
tests = [
|
|
# enforce_sorted, lengths
|
|
[True, [5]],
|
|
[False, [5]],
|
|
[True, [10, 10, 6, 2, 2, 1, 1]],
|
|
[False, [10, 10, 6, 2, 2, 1, 1]],
|
|
[False, [2, 1, 3, 2, 10, 5, 3]],
|
|
]
|
|
|
|
for enforce_sorted, seq_lens, in tests:
|
|
for use_default_hiddens in (True, False):
|
|
for proj_size in [0, 2]:
|
|
check_lengths(seq_lens, enforce_sorted, use_default_hiddens, proj_size)
|
|
|
|
def _test_batchnorm_update_stats(self, device, dtype=torch.float):
|
|
module = nn.BatchNorm1d(3).to(device, dtype)
|
|
|
|
data = torch.rand(4, 3, device=device, dtype=dtype)
|
|
|
|
# training pass
|
|
old_running_mean = module.running_mean.clone()
|
|
old_running_var = module.running_var.clone()
|
|
old_num_batches_tracked = module.num_batches_tracked.clone()
|
|
module(data)
|
|
self.assertNotEqual(old_running_mean, module.running_mean)
|
|
self.assertNotEqual(old_running_var, module.running_var)
|
|
self.assertEqual(old_num_batches_tracked + 1, module.num_batches_tracked)
|
|
|
|
# eval pass
|
|
module.eval()
|
|
old_running_mean = module.running_mean.clone()
|
|
old_running_var = module.running_var.clone()
|
|
old_num_batches_tracked = module.num_batches_tracked.clone()
|
|
module(data)
|
|
self.assertEqual(old_running_mean, module.running_mean)
|
|
self.assertEqual(old_running_var, module.running_var)
|
|
self.assertEqual(old_num_batches_tracked, module.num_batches_tracked)
|
|
|
|
def test_batchnorm_update_stats(self, device):
|
|
self._test_batchnorm_update_stats(device)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_update_stats(device)
|
|
|
|
def test_multi_margin_loss_errors(self, device):
|
|
self.assertRaises(RuntimeError,
|
|
lambda: nn.functional.multi_margin_loss(torch.randn(5, device=device),
|
|
torch.zeros(3, device=device)))
|
|
|
|
def _test_bfloat16_ops(self, op, device, inp_dims=(), prec=1e-2):
|
|
# fp32 compute
|
|
input1 = torch.randn(inp_dims, dtype=torch.float32, device=device, requires_grad=True)
|
|
out1 = op(input1)
|
|
grad_input1 = torch.randn_like(out1, device=device)
|
|
out1.backward(grad_input1)
|
|
|
|
# bfloat16 compute
|
|
op_bfp16 = op.bfloat16()
|
|
input2 = input1.detach().bfloat16().requires_grad_()
|
|
grad_input2 = grad_input1.bfloat16()
|
|
out2 = op_bfp16(input2)
|
|
out2.backward(grad_input2)
|
|
|
|
self.assertEqual(out1, out2, atol=prec, rtol=0, exact_dtype=False)
|
|
self.assertEqual(input1.grad.data, input2.grad.data, atol=prec, rtol=0, exact_dtype=False)
|
|
|
|
@onlyCUDA
|
|
def test_activations_bfloat16(self, device):
|
|
self._test_bfloat16_ops(torch.nn.ReLU(), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.Threshold(0.1, 20), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.ELU(), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.Softplus(), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.Hardshrink(), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.Softshrink(), device, inp_dims=(5), prec=1e-2)
|
|
self._test_bfloat16_ops(torch.nn.LeakyReLU(), device, inp_dims=(5), prec=1e-2)
|
|
|
|
@onlyCUDA
|
|
def test_pooling_bfloat16(self, device):
|
|
self._test_bfloat16_ops(torch.nn.AvgPool1d(3, stride=2), device, inp_dims=(8, 4, 16), prec=0.05)
|
|
self._test_bfloat16_ops(torch.nn.AvgPool2d(3, stride=2), device, inp_dims=(8, 4, 16, 16), prec=0.05)
|
|
self._test_bfloat16_ops(torch.nn.AvgPool3d(3, stride=2), device, inp_dims=(8, 4, 16, 16, 16), prec=0.05)
|
|
self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool1d(3), device, inp_dims=(8, 4, 16), prec=0.05)
|
|
self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool2d((3, 5)), device, inp_dims=(8, 4, 16, 16), prec=0.05)
|
|
self._test_bfloat16_ops(torch.nn.AdaptiveAvgPool3d((3, 5, 7)), device, inp_dims=(8, 4, 16, 16, 16), prec=0.05)
|
|
|
|
@onlyCUDA
|
|
def test_softmax_bfloat16(self, device):
|
|
self._test_bfloat16_ops(torch.nn.Softmax(dim=1), device, inp_dims=(16, 32), prec=1e-2)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm
|
|
@skipCUDAIfCudnnVersionLessThan(7603)
|
|
@dtypes(torch.half, torch.float)
|
|
def test_conv_cudnn_nhwc(self, device, dtype):
|
|
def helper(n, c, h, w, out_channels, kernel_size, groups):
|
|
input = torch.randint(-3, 3, (n, c, h, w), dtype=dtype, device=device)\
|
|
.to(memory_format=torch.channels_last)
|
|
input.requires_grad_()
|
|
conv = nn.Conv2d(c, out_channels, kernel_size, groups=groups)\
|
|
.to(device='cuda', dtype=dtype, memory_format=torch.channels_last)
|
|
for p in conv.parameters():
|
|
p.data = torch.randint_like(p, -3, 3)
|
|
|
|
# use FP64 channels-first conv as reference
|
|
ref_input = input.detach().clone().contiguous().double().requires_grad_()
|
|
ref_conv = nn.Conv2d(c, out_channels, kernel_size, groups=groups)
|
|
# load_state_dict will restore the stride & memory_layout on ref_conv.weight.
|
|
ref_conv.load_state_dict(conv.state_dict())
|
|
ref_conv = ref_conv.to(device='cuda', dtype=torch.double, memory_format=torch.contiguous_format)
|
|
|
|
out = conv(input)
|
|
ref_out = ref_conv(ref_input)
|
|
|
|
grad = torch.randint_like(out, -3, 3)
|
|
ref_grad = grad.detach().clone().double().contiguous()
|
|
|
|
out.backward(grad)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(input.grad.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(conv.weight.grad.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertTrue(ref_input.grad.is_contiguous())
|
|
self.assertTrue(ref_conv.weight.grad.is_contiguous())
|
|
|
|
self.assertEqual(out, ref_out, exact_dtype=False)
|
|
self.assertEqual(conv.weight.grad, ref_conv.weight.grad, exact_dtype=False)
|
|
self.assertEqual(conv.bias.grad, ref_conv.bias.grad, exact_dtype=False)
|
|
self.assertEqual(input.grad, ref_input.grad, exact_dtype=False)
|
|
|
|
helper(2, 8, 4, 4, out_channels=4, kernel_size=3, groups=1)
|
|
helper(2, 8, 4, 4, out_channels=8, kernel_size=3, groups=8)
|
|
helper(1, 16, 56, 56, out_channels=16, kernel_size=3, groups=1)
|
|
helper(1, 16, 56, 56, out_channels=16, kernel_size=3, groups=16)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm
|
|
@skipCUDAIfCudnnVersionLessThan(8005)
|
|
@dtypes(torch.half, torch.float)
|
|
def test_conv_cudnn_ndhwc(self, device, dtype):
|
|
def helper(n, c, d, h, w, out_channels, kernel_size, groups):
|
|
input = torch.randint(-2, 2, (n, c, d, h, w), dtype=dtype, device=device)\
|
|
.to(memory_format=torch.channels_last_3d)
|
|
input.requires_grad_()
|
|
conv = nn.Conv3d(c, out_channels, kernel_size, groups=groups)\
|
|
.to(device='cuda', dtype=dtype, memory_format=torch.channels_last_3d)
|
|
for p in conv.parameters():
|
|
p.data = torch.randint_like(p, -2, 2)
|
|
|
|
# use FP64 channels-first conv as reference
|
|
ref_input = input.detach().clone().contiguous().double().requires_grad_()
|
|
ref_conv = nn.Conv3d(c, out_channels, kernel_size, groups=groups)
|
|
# load_state_dict will restore the stride & memory_layout on ref_conv.weight.
|
|
ref_conv.load_state_dict(conv.state_dict())
|
|
ref_conv = ref_conv.to(device='cuda', dtype=torch.double, memory_format=torch.contiguous_format)
|
|
|
|
out = conv(input)
|
|
ref_out = ref_conv(ref_input)
|
|
|
|
grad = torch.randint_like(out, -2, 2)
|
|
ref_grad = grad.detach().clone().double().contiguous()
|
|
|
|
out.backward(grad)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last_3d))
|
|
self.assertTrue(input.grad.is_contiguous(memory_format=torch.channels_last_3d))
|
|
self.assertTrue(conv.weight.grad.is_contiguous(memory_format=torch.channels_last_3d))
|
|
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertTrue(ref_input.grad.is_contiguous())
|
|
self.assertTrue(ref_conv.weight.grad.is_contiguous())
|
|
|
|
self.assertEqual(out, ref_out, exact_dtype=False)
|
|
self.assertEqual(conv.weight.grad, ref_conv.weight.grad, exact_dtype=False)
|
|
self.assertEqual(conv.bias.grad, ref_conv.bias.grad, exact_dtype=False)
|
|
self.assertEqual(input.grad, ref_input.grad, exact_dtype=False)
|
|
|
|
helper(2, 8, 4, 4, 4, out_channels=4, kernel_size=3, groups=1)
|
|
helper(2, 8, 4, 4, 4, out_channels=8, kernel_size=3, groups=8)
|
|
helper(1, 16, 18, 18, 18, out_channels=16, kernel_size=3, groups=1)
|
|
helper(1, 16, 18, 18, 18, out_channels=16, kernel_size=3, groups=16)
|
|
|
|
def _run_conv(self, layer, device, inp, grad, ref_conv, ref_input, ref_out,
|
|
input_format, weight_format, grad_format, output_format):
|
|
conv = layer(inp.size(1), grad.size(1),
|
|
ref_conv.weight.size(2)).float().to(device)
|
|
# load_state_dict will restore the stride & memory_layout on ref_conv.weight.
|
|
conv.load_state_dict(ref_conv.state_dict())
|
|
weight_data = conv.weight.detach().clone().contiguous(memory_format=weight_format)
|
|
conv.weight.data = weight_data.resize_(weight_data.size(), memory_format=weight_format)
|
|
input = inp.clone().contiguous(memory_format=input_format)
|
|
input.resize_(input.size(), memory_format=input_format)
|
|
input = input.requires_grad_()
|
|
grad = grad.contiguous(memory_format=grad_format)
|
|
grad.resize_(grad.size(), memory_format=grad_format)
|
|
out = conv(input)
|
|
out.backward(grad)
|
|
self.assertTrue(out.is_contiguous(memory_format=output_format))
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(conv.weight.grad, ref_conv.weight.grad)
|
|
self.assertEqual(conv.bias.grad, ref_conv.bias.grad)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
def _test_conv_cudnn_nhwc_nchw(self, layer, n, c, h, w, k, filter_size, device):
|
|
data = torch.randint(1, 10, (n, c, h, w), dtype=torch.float32, device=device)
|
|
ref_input = data.clone().contiguous().requires_grad_(True)
|
|
ref_conv = layer(c, k, filter_size).float().to(device)
|
|
ref_out = ref_conv(ref_input)
|
|
grad = torch.randint(1, 10, ref_out.size(), dtype=torch.float32, device="cuda")
|
|
ref_out.backward(grad)
|
|
|
|
for w_f in [torch.contiguous_format, torch.channels_last]:
|
|
for g_f in [torch.contiguous_format, torch.channels_last]:
|
|
for input_format in [torch.contiguous_format, torch.channels_last]:
|
|
output_format = torch.contiguous_format
|
|
# Older versions of CudNN have Channels Last support disabled
|
|
if torch.backends.cudnn.version() >= 7603:
|
|
if input_format == torch.channels_last:
|
|
output_format = torch.channels_last
|
|
# This is because we have N111 weight that cannot handle
|
|
# the ambiguous memory_format
|
|
if w_f == torch.channels_last:
|
|
if layer == nn.Conv2d and filter_size * c != 1:
|
|
output_format = torch.channels_last
|
|
if layer == nn.ConvTranspose2d and filter_size * k != 1:
|
|
output_format = torch.channels_last
|
|
self._run_conv(layer, device, data, grad, ref_conv, ref_input,
|
|
ref_out, input_format, w_f, g_f, output_format)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm
|
|
@skipCUDAIfCudnnVersionLessThan(7603)
|
|
@tf32_on_and_off(0.05)
|
|
def test_conv_cudnn_mismatch_memory_format(self, device):
|
|
configs = [
|
|
[4, 2, 8, 8, 4, 2],
|
|
[4, 1, 8, 8, 4, 2],
|
|
[1, 1, 8, 8, 4, 2],
|
|
[4, 2, 2, 8, 4, 1],
|
|
[4, 2, 1, 8, 4, 1],
|
|
[4, 2, 8, 8, 4, 1],
|
|
[4, 1, 8, 8, 4, 1],
|
|
]
|
|
for n, c, h, w, k, filter_size in configs:
|
|
self._test_conv_cudnn_nhwc_nchw(nn.Conv2d, n, c, h, w, k, filter_size, device)
|
|
self._test_conv_cudnn_nhwc_nchw(nn.ConvTranspose2d, n, c, h, w, k, filter_size, device)
|
|
|
|
# torch.half is erroring out on Windows with CUDA 10.1 + cuDNN 7.6.4
|
|
# returning CUDNN_STATUS_BAD_PARAM
|
|
# Disabling that specific test for now [see issue # 33918]
|
|
@onlyCUDA
|
|
@skipCUDAIfNoCudnn
|
|
@dtypes(torch.float, torch.double)
|
|
def test_conv_cudnn_nhwc_support(self, device, dtype):
|
|
input = torch.randn((1, 16, 1, 1), dtype=dtype, device="cuda", requires_grad=True)
|
|
weight = torch.randn((8, 16, 3, 3), dtype=dtype, device="cuda", requires_grad=True)
|
|
weight = weight.to(memory_format=torch.channels_last)
|
|
o = torch.conv2d(input, weight, None, (2, 1), (1, 1), (1, 1), 1)
|
|
self.assertTrue(o.is_contiguous(memory_format=torch.channels_last))
|
|
o.sum().backward()
|
|
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm
|
|
@skipCUDAIfCudnnVersionLessThan(7603)
|
|
def test_convert_conv2d_weight_memory_format(self, device):
|
|
input = torch.randint(1, 10, (2, 8, 4, 4), dtype=torch.float32, device=device)
|
|
model = nn.Sequential(
|
|
nn.Conv2d(8, 4, 3),
|
|
nn.BatchNorm2d(4)).to(device).float()
|
|
for memory_format in [torch.channels_last, torch.contiguous_format]:
|
|
model = nn.utils.convert_conv2d_weight_memory_format(model, memory_format)
|
|
out = model(input)
|
|
self.assertTrue(out.is_contiguous(memory_format=memory_format))
|
|
|
|
model = nn.Sequential(
|
|
nn.ConvTranspose2d(8, 4, 3),
|
|
nn.BatchNorm2d(4)).to(device).float()
|
|
for memory_format in [torch.channels_last, torch.contiguous_format]:
|
|
model = nn.utils.convert_conv2d_weight_memory_format(model, memory_format)
|
|
out = model(input)
|
|
self.assertTrue(out.is_contiguous(memory_format=memory_format))
|
|
|
|
def test_nll_loss_mismatched_batch(self, device):
|
|
x = torch.randn((10, 3), requires_grad=True, device=device)
|
|
# t should have size (10,)
|
|
t = torch.zeros((3,), dtype=torch.int64, device=device)
|
|
with self.assertRaisesRegex(ValueError, 'Expected.*batch_size'):
|
|
F.nll_loss(x, t)
|
|
|
|
def test_nll_loss_out_of_bounds_ignore_index(self, device):
|
|
x = torch.randn(6, 3, requires_grad=True, device=device)
|
|
t = torch.tensor([0, 1, 255, 0, 1, 2], dtype=torch.int64, device=device)
|
|
for reduction in ['mean', 'none']:
|
|
F.nll_loss(x, t, ignore_index=255, reduction=reduction).sum().backward()
|
|
|
|
def _nll_loss_helper(self, input_size, reduction, expected, device):
|
|
input = torch.rand(input_size, requires_grad=True, device=device)
|
|
num_channels = input_size[1]
|
|
target_size = (input_size[0], ) + tuple(input_size[2:])
|
|
target = torch.randint(num_channels, target_size, device=device)
|
|
|
|
output = F.nll_loss(input, target, reduction=reduction)
|
|
# TODO(#38095): Replace assertEqualIgnoreType. See issue #38095
|
|
self.assertEqualIgnoreType(output, expected)
|
|
|
|
output.sum().backward()
|
|
self.assertEqual(input.grad.size(), input.size())
|
|
|
|
def test_nll_loss_empty_tensor_reduction_none(self, device):
|
|
self._nll_loss_helper([0, 3], "none", torch.empty([0], device=device), device)
|
|
self._nll_loss_helper([0, 3, 5, 7], "none", torch.empty([0, 5, 7], device=device), device)
|
|
self._nll_loss_helper([2, 3, 0, 7], "none", torch.empty([2, 0, 7], device=device), device)
|
|
self._nll_loss_helper([2, 3, 5, 0], "none", torch.empty([2, 5, 0], device=device), device)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "none", torch.empty([2, 5, 7, 0], device=device), device)
|
|
|
|
@unittest.skipIf(TEST_WITH_UBSAN, "division-by-zero error with UBSAN")
|
|
def test_nll_loss_empty_tensor_reduction_mean(self, device):
|
|
nan = torch.tensor(float('nan'), device=device)
|
|
self._nll_loss_helper([0, 3], "mean", nan, device)
|
|
self._nll_loss_helper([0, 3, 5, 7], "mean", nan, device)
|
|
self._nll_loss_helper([2, 3, 0, 7], "mean", nan, device)
|
|
self._nll_loss_helper([2, 3, 5, 0], "mean", nan, device)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "mean", nan, device)
|
|
|
|
def test_nll_loss_empty_tensor_reduction_sum(self, device):
|
|
zero = torch.tensor(0, device=device)
|
|
self._nll_loss_helper([0, 3], "sum", zero, device)
|
|
self._nll_loss_helper([0, 3, 5, 7], "sum", zero, device)
|
|
self._nll_loss_helper([2, 3, 0, 7], "sum", zero, device)
|
|
self._nll_loss_helper([2, 3, 5, 0], "sum", zero, device)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "sum", zero, device)
|
|
|
|
def test_nll_loss_total_weight_is_zero(self, device):
|
|
|
|
def helper(input_size):
|
|
input = torch.ones(input_size, requires_grad=True, device=device)
|
|
num_channels = input_size[1]
|
|
target_size = (input_size[0], ) + tuple(input_size[2:])
|
|
target = torch.zeros(target_size, dtype=torch.long, device=device)
|
|
weight = torch.zeros([num_channels], device=device)
|
|
self.assertEqual(F.nll_loss(input, target, weight).item(), 0)
|
|
|
|
helper([2, 3])
|
|
helper([2, 3, 5, 7])
|
|
helper([2, 3, 5, 7, 9])
|
|
|
|
def test_softshrink_negative(self, device):
|
|
input = torch.randn(5, device=device, requires_grad=True)
|
|
m = torch.nn.Softshrink(-1)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r'lambda must be greater or equal to 0, but found to be -1\.'):
|
|
m(input)
|
|
|
|
def test_unfold(self, device):
|
|
def func(x):
|
|
return F.unfold(x, kernel_size=(3, 3))
|
|
seeds = (13, 256, 811, 43, 7)
|
|
for sd in seeds:
|
|
torch.manual_seed(sd)
|
|
x = torch.randn(1, 1, 5, 5, device=device, requires_grad=True)
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
def test_fold(self, device):
|
|
def func(x):
|
|
return F.fold(x, output_size=(4, 5), kernel_size=(2, 2))
|
|
seeds = (44, 83, 71, 25, 999)
|
|
for sd in seeds:
|
|
torch.manual_seed(sd)
|
|
x = torch.randn(1, 12, 12, device=device, requires_grad=True)
|
|
gradcheck(func, [x])
|
|
gradgradcheck(func, [x])
|
|
|
|
def test_logsigmoid_out(self, device):
|
|
# this isn't actually documented, but was broken previously:
|
|
# https://github.com/pytorch/pytorch/issues/36499
|
|
x = torch.randn(2, 3, device=device).t()
|
|
empty_out = torch.randn(0, device=device)
|
|
self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=empty_out))
|
|
|
|
noncontig_out = torch.randn(2, 3, device=device).t()
|
|
self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=noncontig_out))
|
|
|
|
def test_maxpool3d_non_square_backward(self, device):
|
|
# previous CUDA routine of this backward calculates kernel launch grid size
|
|
# with last two dimensions interchanged, so the tailing along the longer dim
|
|
# get ignored. Here we test whether every position gets gradient.
|
|
for dim in (2, 3, 4):
|
|
shape = tuple(32 if i != dim else 256 for i in range(4))
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
F.max_pool3d(x, kernel_size=(1, 1, 1)).sum().backward()
|
|
self.assertTrue(torch.allclose(x.grad, torch.ones_like(x.grad)))
|
|
|
|
# Check that clip_grad_norm_ raises an error if the total norm of the
|
|
# parameters' gradients is non-finite
|
|
def test_clip_grad_norm_error_if_nonfinite(self, device):
|
|
norms_pos = [0.1, 1, 2, 3.5, inf]
|
|
norms_neg = [-0.1, -1, -2, -3.5]
|
|
norms_except_0 = norms_pos + norms_neg
|
|
norms_all = norms_except_0 + [0]
|
|
|
|
# Each entry in test_cases has the following values, in this order:
|
|
#
|
|
# grad_only_one_elem If True, only one element of the parameter's
|
|
# gradient is set to the scalar grad, and the
|
|
# rest of the elements are 0. If False, all grad
|
|
# elements are equal to the scalar.
|
|
#
|
|
# prefix_finite_grad_param If True, prefix a parameter that has a grad
|
|
# of 1.
|
|
#
|
|
# scalars Scalars to use as the parameter's grad, through
|
|
# multiplication
|
|
#
|
|
# norms_nonfinite Norm types that should produce nonfinite total norm
|
|
#
|
|
# norms_finite Norm types that should produce finite total norm
|
|
test_cases = [
|
|
# Test errors from an infinite grad
|
|
(False, False, [inf, -inf], norms_except_0, [0]),
|
|
(False, True, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
(True, False, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
(True, True, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
|
|
# Test errors from a NaN grad
|
|
(False, False, [nan], norms_except_0, [0]),
|
|
(False, True, [nan], norms_except_0, [0]),
|
|
(True, False, [nan], norms_except_0, [0]),
|
|
(True, True, [nan], norms_except_0, [0]),
|
|
|
|
# Test a grad that should never error
|
|
(False, False, [2e22, -2e22], [], norms_all),
|
|
(False, True, [2e22, -2e22], [], norms_all),
|
|
(True, False, [2e22, -2e22], [], norms_all),
|
|
(True, True, [2e22, -2e22], [], norms_all),
|
|
|
|
# Test a grad that will overflow to inf for only some norm orders
|
|
(False, False, [2e200, -2e200], [3.5, 2, -2, -3.5], [inf, 1, 0.1, 0, -1, -0.1]),
|
|
(False, True, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
(True, False, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
(True, True, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
]
|
|
|
|
def gen_parameters(scalar, grad_only_one_elem, prefix_finite_grad_param):
|
|
param = torch.ones(10, dtype=torch.float64, device=device, requires_grad=True)
|
|
|
|
if grad_only_one_elem:
|
|
param[1].mul(scalar).sum().backward()
|
|
else:
|
|
param.mul(scalar).sum().backward()
|
|
|
|
if prefix_finite_grad_param:
|
|
prefix_param = torch.ones(1, dtype=torch.float64, device=device, requires_grad=True)
|
|
prefix_param.mul(1).sum().backward()
|
|
parameters = [prefix_param, param]
|
|
else:
|
|
parameters = [param]
|
|
|
|
return parameters
|
|
|
|
def run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, is_norm_nonfinite):
|
|
msg = (
|
|
f'norm_type: {norm_type}, ',
|
|
f'error_if_nonfinite: {error_if_nonfinite}, '
|
|
f'scalar: {scalar}, '
|
|
f'grad_only_one_elem: {grad_only_one_elem}, '
|
|
f'prefix_finite_grad_param: {prefix_finite_grad_param}, '
|
|
f'is_norm_nonfinite: {is_norm_nonfinite}')
|
|
|
|
parameters = gen_parameters(scalar, grad_only_one_elem, prefix_finite_grad_param)
|
|
|
|
# Should only throw an error if the total norm is expected to be
|
|
# nonfinite and `error_if_nonfinite=True`
|
|
if is_norm_nonfinite and error_if_nonfinite:
|
|
error_msg = f'The total norm of order {float(norm_type)} for gradients'
|
|
|
|
grads_before = [p.grad.clone() for p in parameters]
|
|
|
|
with self.assertRaisesRegex(RuntimeError, error_msg, msg=msg):
|
|
clip_grad_norm_(parameters, 1, norm_type=norm_type, error_if_nonfinite=True)
|
|
|
|
# Grad should not change if error is thrown
|
|
grads_after = [p.grad for p in parameters]
|
|
self.assertEqual(grads_before, grads_after, msg=msg)
|
|
else:
|
|
clip_grad_norm_(parameters, 1, norm_type=norm_type, error_if_nonfinite=error_if_nonfinite)
|
|
|
|
for grad_only_one_elem, prefix_finite_grad_param, scalars, norms_nonfinite, norms_finite in test_cases:
|
|
for error_if_nonfinite in [False, True]:
|
|
for norm_type, scalar in product(norms_nonfinite, scalars):
|
|
run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, True)
|
|
|
|
for norm_type, scalar in product(norms_finite, scalars):
|
|
run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, False)
|
|
|
|
@onlyCUDA
|
|
@deviceCountAtLeast(2)
|
|
def test_clip_grad_norm_multi_device(self, devices):
|
|
class TestModel(nn.Module):
|
|
def __init__(self):
|
|
super(TestModel, self).__init__()
|
|
self.layer1 = nn.Linear(10, 10)
|
|
self.layer2 = nn.Linear(10, 10)
|
|
|
|
test_model = TestModel()
|
|
test_model.layer1.to(devices[0])
|
|
test_model.layer2.to(devices[1])
|
|
ref_model = TestModel().to(devices[0])
|
|
for norm_type in [2., math.inf]:
|
|
for p in test_model.parameters():
|
|
p.grad = torch.ones_like(p)
|
|
for p in ref_model.parameters():
|
|
p.grad = torch.ones_like(p)
|
|
norm = clip_grad_norm_(test_model.parameters(), 0.5, norm_type=norm_type)
|
|
expected = clip_grad_norm_(ref_model.parameters(), 0.5, norm_type=norm_type)
|
|
self.assertEqual(norm, expected)
|
|
for p, pe in zip(test_model.parameters(), ref_model.parameters()):
|
|
self.assertEqual(p.grad.to(devices[0]), pe.grad)
|
|
|
|
def test_elu_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.elu(x, inplace=True)
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.elu_(x)
|
|
|
|
@expectedFailureMeta # https://github.com/pytorch/pytorch/issues/54897
|
|
def test_hardswish_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.hardswish(x, inplace=True)
|
|
|
|
def test_silu_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.silu(x, inplace=True)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_mish_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.mish(x, inplace=True)
|
|
|
|
def test_softplus_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.softplus(x, out=x)
|
|
|
|
def test_softplus_low_threshold(self, device):
|
|
# Ensure gradients are computed correctly with a low threshold.
|
|
model = torch.nn.Softplus(threshold=1).double()
|
|
input = torch.tensor(0.9, device=device, dtype=torch.double,
|
|
requires_grad=True)
|
|
output = model(input)
|
|
torch.autograd.gradcheck(model, input)
|
|
|
|
def test_softshrink_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.softshrink(x, out=x)
|
|
|
|
def test_leaky_relu_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.leaky_relu(x, inplace=True)
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.leaky_relu_(x)
|
|
|
|
def test_threshold_inplace_overlap(self, device):
|
|
# Inplace threshold is okay, because it is idempotent
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
F.threshold(x, 0.5, 0.5, inplace=True)
|
|
F.threshold_(x, 0.5, 0.5)
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_triplet_margin_with_distance_loss_default_parity(self, device):
|
|
# Test for `nn.TripletMarginWithDistanceLoss` and
|
|
# `F.triplet_margin_with_distance_loss`. Checks
|
|
# for parity against the respective non-distance-agnostic
|
|
# implementations of triplet margin loss (``nn.TripletMarginLoss`
|
|
# and `F.triplet_margin_loss`) under *default args*.
|
|
|
|
for extra_args in \
|
|
itertools.product((0.5, 1, 1.5), (True, False), ('none', 'mean', 'sum')):
|
|
kwargs = {'margin': extra_args[0], 'swap': extra_args[1], 'reduction': extra_args[2]}
|
|
|
|
anchor = torch.randn(5, 10, device=device, requires_grad=True)
|
|
positive = torch.randn(5, 10, device=device, requires_grad=True)
|
|
negative = torch.randn(5, 10, device=device, requires_grad=True)
|
|
|
|
# Test forward, functional
|
|
expected = F.triplet_margin_loss(anchor, positive, negative, **kwargs)
|
|
actual = F.triplet_margin_with_distance_loss(anchor, positive, negative, **kwargs)
|
|
self.assertEqual(actual, expected, rtol=1e-6, atol=1e-6)
|
|
|
|
# Test forward, module
|
|
loss_ref = nn.TripletMarginLoss(**kwargs)
|
|
loss_op = nn.TripletMarginWithDistanceLoss(**kwargs)
|
|
self.assertEqual(loss_op(anchor, positive, negative),
|
|
loss_ref(anchor, positive, negative),
|
|
rtol=1e-6, atol=1e-6)
|
|
|
|
# Test backward
|
|
self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss(
|
|
a, p, n, **kwargs), (anchor, positive, negative)))
|
|
self.assertTrue(gradcheck(lambda a, p, n: loss_op(a, p, n),
|
|
(anchor, positive, negative)))
|
|
|
|
@onlyOnCPUAndCUDA
|
|
def test_triplet_margin_with_distance_loss(self, device):
|
|
# Test for parity between `nn.TripletMarginWithDistanceLoss` and
|
|
# `F.triplet_margin_with_distance_loss`.
|
|
|
|
pairwise_distance = nn.PairwiseDistance()
|
|
|
|
def cosine_distance(x, y):
|
|
return 1.0 - F.cosine_similarity(x, y)
|
|
|
|
distance_functions = (pairwise_distance, cosine_distance,
|
|
lambda x, y: 1.0 - F.cosine_similarity(x, y))
|
|
|
|
reductions = ('mean', 'none', 'sum')
|
|
margins = (1.0, 1.5, 0.5)
|
|
swaps = (True, False)
|
|
|
|
for distance_fn, reduction, margin, swap \
|
|
in itertools.product(distance_functions, reductions, margins, swaps):
|
|
anchor = torch.randn(5, 10, device=device, requires_grad=True)
|
|
positive = torch.randn(5, 10, device=device, requires_grad=True)
|
|
negative = torch.randn(5, 10, device=device, requires_grad=True)
|
|
|
|
# Test backward
|
|
self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss(
|
|
a, p, n, distance_function=distance_fn, reduction=reduction, margin=margin, swap=swap),
|
|
(anchor, positive, negative)))
|
|
loss_op = nn.TripletMarginWithDistanceLoss(distance_function=distance_fn,
|
|
reduction=reduction, margin=margin, swap=swap)
|
|
self.assertTrue(gradcheck(lambda a, p, n: loss_op(
|
|
a, p, n), (anchor, positive, negative)))
|
|
traced_loss_op = torch.jit.trace(loss_op, (anchor, positive, negative))
|
|
self.assertTrue(gradcheck(lambda a, p, n: traced_loss_op(
|
|
a, p, n), (anchor, positive, negative)))
|
|
|
|
# Test forward parity
|
|
functional = F.triplet_margin_with_distance_loss(anchor, positive, negative,
|
|
distance_function=distance_fn,
|
|
reduction=reduction, margin=margin, swap=swap)
|
|
modular = loss_op(anchor, positive, negative)
|
|
traced = traced_loss_op(anchor, positive, negative)
|
|
self.assertEqual(functional, modular, atol=1e-6, rtol=1e-6)
|
|
self.assertEqual(traced, modular, atol=1e-6, rtol=1e-6)
|
|
|
|
def test_to_complex(self, device):
|
|
m = nn.Linear(3, 5).to(device)
|
|
self.assertIs(m, m.to(device))
|
|
m.to(torch.cfloat)
|
|
self.assertIs(m.weight.dtype, torch.cfloat)
|
|
m.to(torch.cdouble)
|
|
self.assertIs(m.weight.dtype, torch.cdouble)
|
|
m.to(torch.float)
|
|
self.assertIs(m.weight.dtype, torch.float)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Trigger warning
|
|
m.to(torch.cfloat)
|
|
# Check warning occurs
|
|
self.assertEqual(len(w), 1)
|
|
self.assertTrue("Complex modules are a new feature" in str(w[-1].message))
|
|
|
|
@skipMeta
|
|
@dtypes(torch.float32, torch.float64)
|
|
def test_module_to_empty(self, device, dtype):
|
|
class MyModule(nn.Module):
|
|
def __init__(self, in_features, out_features, device=None, dtype=None):
|
|
super().__init__()
|
|
factory_kwargs = {"device": device, "dtype": dtype}
|
|
self.weight = nn.Parameter(torch.randn(in_features, out_features, **factory_kwargs))
|
|
|
|
def forward(self, x):
|
|
return x @ self.weight
|
|
|
|
# Test meta module instantiation.
|
|
input = torch.randn(5, 10, device=device, dtype=dtype)
|
|
m = MyModule(10, 1, device='meta', dtype=dtype)
|
|
m(input)
|
|
|
|
# Test materializing meta module on a real device.
|
|
m.to_empty(device=device)
|
|
m(input)
|
|
with torch.no_grad():
|
|
torch.nn.init.kaiming_uniform_(m.weight)
|
|
m(input)
|
|
|
|
# Test creating meta module from materialized module.
|
|
m.to_empty(device='meta')
|
|
m(input)
|
|
|
|
@skipMeta
|
|
def test_skip_init(self, device):
|
|
torch.manual_seed(1)
|
|
m_initialized = torch.nn.Linear(5, 1)
|
|
m_initialized.to(device)
|
|
|
|
torch.manual_seed(1)
|
|
m_uninitialized = torch.nn.utils.skip_init(torch.nn.Linear, 5, 1, device=device)
|
|
|
|
self.assertEqual(m_initialized.weight.device, m_uninitialized.weight.device)
|
|
self.assertFalse(torch.allclose(m_initialized.weight, m_uninitialized.weight))
|
|
|
|
class TestModuleGlobalHooks(TestCase):
|
|
|
|
def tearDown(self):
|
|
nn.modules.module._global_backward_hooks = OrderedDict()
|
|
nn.modules.module._global_forward_hooks = OrderedDict()
|
|
nn.modules.module._global_forward_pre_hooks = OrderedDict()
|
|
|
|
def test_module_global_hooks(self):
|
|
module = nn.Sigmoid
|
|
|
|
module_1 = module()
|
|
module_2 = module()
|
|
module_3 = module()
|
|
|
|
input = torch.ones(5, 5, requires_grad=True)
|
|
|
|
counter = {
|
|
'forwards': 0,
|
|
'backwards': 0
|
|
}
|
|
|
|
def fw_hook(inc, h_module, input, output):
|
|
self.assertIsInstance(input, tuple)
|
|
self.assertTrue(isinstance(output, torch.Tensor))
|
|
self.assertTrue(isinstance(h_module, module))
|
|
self.assertEqual(input[0], torch.ones(5, 5))
|
|
self.assertEqual(output, torch.empty(5, 5).fill_(1 / (1 + 1 / math.e)))
|
|
counter['forwards'] += inc
|
|
|
|
def bw_hook(inc, h_module, grad_input, grad_output):
|
|
self.assertIsInstance(grad_input, tuple)
|
|
self.assertIsInstance(grad_output, tuple)
|
|
self.assertTrue(isinstance(h_module, module))
|
|
self.assertEqual(grad_output[0], torch.ones(5, 5) * 2)
|
|
counter['backwards'] += inc
|
|
|
|
test_fwd = nn.modules.module.register_module_forward_hook(lambda *args: fw_hook(1, *args))
|
|
|
|
module_1(input)
|
|
module_2(input)
|
|
module_3(input)
|
|
self.assertEqual(counter['forwards'], 3)
|
|
self.assertEqual(counter['backwards'], 0)
|
|
|
|
test_bwd = nn.modules.module.register_module_backward_hook(
|
|
lambda *args: bw_hook(1, *args))
|
|
|
|
output_1 = module_1(input)
|
|
output_2 = module_2(input)
|
|
output_3 = module_3(input)
|
|
self.assertEqual(counter['forwards'], 6)
|
|
self.assertEqual(counter['backwards'], 0)
|
|
|
|
output_1.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
output_2.backward(torch.ones(5, 5) * 2, retain_graph=False)
|
|
output_3.backward(torch.ones(5, 5) * 2, retain_graph=False)
|
|
self.assertEqual(counter['forwards'], 6)
|
|
self.assertEqual(counter['backwards'], 3)
|
|
|
|
output_1.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
self.assertEqual(counter['forwards'], 6)
|
|
self.assertEqual(counter['backwards'], 4)
|
|
|
|
test2_fwd = nn.modules.module.register_module_forward_hook(lambda *args: fw_hook(2, *args))
|
|
|
|
output = module_1(input)
|
|
output = module_2(input)
|
|
output = module_3(input)
|
|
self.assertEqual(counter['forwards'], 15)
|
|
self.assertEqual(counter['backwards'], 4)
|
|
|
|
test2_bwd = nn.modules.module.register_module_backward_hook(lambda *args: bw_hook(2, *args))
|
|
|
|
module_1(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 18)
|
|
self.assertEqual(counter['backwards'], 7)
|
|
|
|
test2_bwd.remove()
|
|
|
|
module_2(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 21)
|
|
self.assertEqual(counter['backwards'], 8)
|
|
|
|
test2_fwd.remove()
|
|
|
|
module_3(input).backward(torch.ones(5, 5) * 2)
|
|
self.assertEqual(counter['forwards'], 22)
|
|
self.assertEqual(counter['backwards'], 9)
|
|
|
|
test_fwd.remove()
|
|
test_bwd.remove()
|
|
|
|
def test_module_global_hook_invalid_outputs(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
|
|
def bw_fail1(self, grad_input, grad_output):
|
|
return grad_input[:-1]
|
|
|
|
def bw_fail2(self, grad_input, grad_output):
|
|
return grad_input + (torch.randn(2, 2),)
|
|
|
|
with nn.modules.module.register_module_backward_hook(bw_fail1):
|
|
with self.assertRaisesRegex(RuntimeError, 'got 0, but expected 1'):
|
|
module(input).sum().backward()
|
|
|
|
with nn.modules.module.register_module_backward_hook(bw_fail2):
|
|
with self.assertRaisesRegex(RuntimeError, 'got 2, but expected 1'):
|
|
module(input).sum().backward()
|
|
|
|
def test_module_backward_global_hook_writeable(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
sig_x = torch.sigmoid(input)
|
|
|
|
def bw_hook(module, grad_input, grad_output):
|
|
for grad in grad_input:
|
|
self.assertTrue(isinstance(grad, torch.Tensor))
|
|
for grad in grad_output:
|
|
self.assertTrue(isinstance(grad, torch.Tensor))
|
|
return tuple(gi * 2 for gi in grad_input)
|
|
|
|
nn.modules.module.register_module_backward_hook(bw_hook)
|
|
module(input).backward(torch.ones(5, 5))
|
|
expected_grad = sig_x * (1 - sig_x) * 2
|
|
self.assertEqual(input.grad, expected_grad)
|
|
|
|
def test_module_global_forward_preforward_hook_writeable(self):
|
|
module = nn.Sigmoid()
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
sig_x = torch.sigmoid(input)
|
|
|
|
def forward_pre_hook(m, input):
|
|
return torch.nn.functional.relu(input[0])
|
|
|
|
def forward_hook(m, input, output):
|
|
return -output
|
|
|
|
nn.modules.module.register_module_forward_pre_hook(forward_pre_hook)
|
|
nn.modules.module.register_module_forward_hook(forward_hook)
|
|
output = module(input)
|
|
expected_res = -torch.sigmoid(torch.nn.functional.relu(input))
|
|
self.assertEqual(output, expected_res)
|
|
output.backward(torch.ones(5, 5) * 2, retain_graph=True)
|
|
mask = (input > 0).double()
|
|
expected_grad = -sig_x * (1 - sig_x) * 2 * mask
|
|
self.assertEqual(input.grad, expected_grad)
|
|
|
|
def test_global_and_local_hooks_order(self):
|
|
module = nn.Sigmoid()
|
|
|
|
global_forward_pre_called = False
|
|
local_forward_pre_called = False
|
|
global_forward_called = False
|
|
local_forward_called = False
|
|
global_backward_called = False
|
|
local_backward_called = False
|
|
|
|
def global_forward_pre_hook(m, input):
|
|
nonlocal global_forward_pre_called
|
|
self.assertTrue(not local_forward_pre_called)
|
|
global_forward_pre_called = True
|
|
return input
|
|
|
|
def local_forward_pre_hook(m, input):
|
|
nonlocal local_forward_pre_called
|
|
self.assertTrue(global_forward_pre_called)
|
|
local_forward_pre_called = True
|
|
return input
|
|
|
|
def global_forward_hook(m, input, output):
|
|
nonlocal global_forward_called
|
|
self.assertTrue(not local_forward_called)
|
|
global_forward_called = True
|
|
return output
|
|
|
|
def local_forward_hook(m, input, output):
|
|
nonlocal local_forward_called
|
|
self.assertTrue(global_forward_called)
|
|
local_forward_called = True
|
|
return output
|
|
|
|
def global_backward_hook(m, input, output):
|
|
nonlocal global_backward_called
|
|
self.assertTrue(not local_backward_called)
|
|
global_backward_called = True
|
|
return input
|
|
|
|
def local_backward_hook(m, input, output):
|
|
nonlocal local_backward_called
|
|
self.assertTrue(global_backward_called)
|
|
local_backward_called = True
|
|
return input
|
|
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
nn.modules.module.register_module_forward_pre_hook(global_forward_pre_hook)
|
|
module.register_forward_pre_hook(local_forward_pre_hook)
|
|
nn.modules.module.register_module_forward_hook(global_forward_hook)
|
|
module.register_forward_hook(local_forward_hook)
|
|
nn.modules.module.register_module_backward_hook(global_backward_hook)
|
|
module.register_backward_hook(local_backward_hook)
|
|
|
|
output = module(input)
|
|
self.assertTrue(local_forward_called and local_forward_pre_called and global_forward_called and global_forward_pre_called)
|
|
|
|
output.backward(torch.ones(5, 5), retain_graph=True)
|
|
self.assertTrue(local_backward_called and global_backward_called)
|
|
|
|
|
|
class LazyModule(torch.nn.modules.lazy.LazyModuleMixin, torch.nn.Module):
|
|
pass
|
|
|
|
|
|
class TestLazyModules(TestCase):
|
|
|
|
@suppress_warnings
|
|
def test_lazy_module_parameter(self):
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
state_dict = module.state_dict()
|
|
self.assertIsInstance(state_dict['test_param'], UninitializedParameter)
|
|
new_module = LazyModule()
|
|
# An error is raised when there is an attempt to replace an existing parameter
|
|
# with an uninitialized one
|
|
new_module.register_parameter('test_param', nn.Parameter(torch.ones(5, 5)))
|
|
with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'):
|
|
new_module.load_state_dict(state_dict)
|
|
# Uninitialized parameters are overriden when the state dict to be loaded contains a valid one
|
|
new_module = LazyModule()
|
|
new_module.register_parameter('test_param', nn.Parameter(torch.ones(5, 5)))
|
|
module.load_state_dict(new_module.state_dict())
|
|
self.assertEqual(module.test_param, torch.ones((5, 5)))
|
|
|
|
# Uninitialized parameters are left unchanged
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
|
|
new_module = LazyModule()
|
|
new_module.register_parameter('test_param', UninitializedParameter())
|
|
module.load_state_dict(new_module.state_dict())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
|
|
@suppress_warnings
|
|
def test_lazy_module_buffer(self):
|
|
module = LazyModule()
|
|
module.register_buffer('test_buffer', UninitializedBuffer())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
state_dict = module.state_dict()
|
|
self.assertIsInstance(state_dict['test_buffer'], UninitializedBuffer)
|
|
new_module = LazyModule()
|
|
# An error is raised when there is an attempt to replace an existing parameter
|
|
# with an uninitialized one
|
|
new_module.register_buffer('test_buffer', torch.ones(5, 5))
|
|
with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'):
|
|
new_module.load_state_dict(state_dict)
|
|
# Uninitialized parameters are overriden when the state dict to be loaded contains a valid one
|
|
new_module = LazyModule()
|
|
new_module.register_buffer('test_buffer', torch.ones(5, 5))
|
|
module.load_state_dict(new_module.state_dict())
|
|
self.assertEqual(module.test_buffer, torch.ones((5, 5)))
|
|
|
|
# Uninitialized parameters are left unchanged
|
|
module = LazyModule()
|
|
module.register_buffer('test_buffer', UninitializedBuffer())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
|
|
new_module = LazyModule()
|
|
new_module.register_buffer('test_buffer', UninitializedBuffer())
|
|
module.load_state_dict(new_module.state_dict())
|
|
module.load_state_dict(new_module.state_dict())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
|
|
@suppress_warnings
|
|
def test_lazy_module_jit_param(self):
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
with self.assertRaisesRegex(RuntimeError, 'run a forward pass'):
|
|
torch.jit.script(module)
|
|
|
|
@suppress_warnings
|
|
def test_lazy_module_jit_buffer(self):
|
|
module = LazyModule()
|
|
module.register_buffer('test_buffer', UninitializedBuffer())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
with self.assertRaisesRegex(RuntimeError, 'run a forward pass'):
|
|
torch.jit.script(module)
|
|
|
|
@suppress_warnings
|
|
def test_lazy_share_memory_param(self):
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
with self.assertRaisesRegex(RuntimeError, 'share memory on an uninitialized'):
|
|
module.share_memory()
|
|
|
|
@suppress_warnings
|
|
def test_lazy_share_memory_buffer(self):
|
|
module = LazyModule()
|
|
module.register_buffer('test_buffer', UninitializedBuffer())
|
|
self.assertTrue(module.has_uninitialized_params())
|
|
with self.assertRaisesRegex(RuntimeError, 'share memory on an uninitialized'):
|
|
module.share_memory()
|
|
|
|
@suppress_warnings
|
|
def test_linear(self):
|
|
module = nn.LazyLinear(10)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
input = torch.ones(5, 5)
|
|
module(input)
|
|
self.assertIsInstance(module, nn.Linear)
|
|
self.assertNotIsInstance(module, nn.LazyLinear)
|
|
self.assertTrue(module.weight.shape == (10, 5))
|
|
self.assertTrue(module.bias.shape == (10,))
|
|
y = module(input)
|
|
self.assertTrue(torch.equal(torch.nn.functional.linear(input, module.weight, module.bias), y))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_linear_pickle(self):
|
|
module = nn.LazyLinear(10)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
module = pickle.loads(pickle.dumps(module))
|
|
self.assertIsInstance(module, nn.LazyLinear)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
input = torch.ones(5, 5)
|
|
module(input) # fully materialized
|
|
new_module = pickle.loads(pickle.dumps(module))
|
|
self.assertIsInstance(new_module, nn.Linear)
|
|
self.assertNotIsInstance(new_module, nn.LazyLinear)
|
|
self.assertTrue(new_module.weight.shape == (10, 5))
|
|
self.assertNotIsInstance(new_module.weight, UninitializedParameter)
|
|
self.assertTrue(new_module.bias.shape == (10,))
|
|
self.assertNotIsInstance(new_module.bias, UninitializedParameter)
|
|
|
|
@suppress_warnings
|
|
def test_linear_state(self):
|
|
module = nn.Linear(5, 10)
|
|
lazy_module = nn.LazyLinear(10)
|
|
lazy_module.load_state_dict(module.state_dict())
|
|
# Parameters have been initialized but the module won't become a full
|
|
# Linear one until the first iteration. This is due to
|
|
# limitations on the state_dict loading logic
|
|
self.assertFalse(lazy_module.has_uninitialized_params())
|
|
self.assertTrue(lazy_module.weight.shape == (10, 5))
|
|
self.assertTrue(lazy_module.bias.shape == (10,))
|
|
|
|
module = nn.Linear(5, 10)
|
|
lazy_module = nn.LazyLinear(10)
|
|
with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'):
|
|
module.load_state_dict(lazy_module.state_dict())
|
|
|
|
def _check_lazy_conv(self, cls, lazy_cls, func, init_args, input_shape,
|
|
expected_weight_shape, expected_bias_shape):
|
|
module = lazy_cls(*init_args)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
if module.bias is not None:
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
input = torch.ones(*input_shape)
|
|
module(input)
|
|
self.assertIsInstance(module, cls)
|
|
self.assertNotIsInstance(module, lazy_cls)
|
|
self.assertEqual(module.weight.shape, expected_weight_shape)
|
|
if module.bias is not None:
|
|
self.assertEqual(module.bias.shape, expected_bias_shape)
|
|
y = module(input)
|
|
self.assertTrue(torch.equal(func(input, module.weight, module.bias), y))
|
|
|
|
def _check_lazy_conv_pickle(self, cls, lazy_cls, init_args, input_shape,
|
|
expected_weight_shape, expected_bias_shape):
|
|
module = lazy_cls(*init_args)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
if module.bias is not None:
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
module = pickle.loads(pickle.dumps(module))
|
|
self.assertIsInstance(module, lazy_cls)
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
if module.bias is not None:
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
input = torch.ones(*input_shape)
|
|
module(input) # fully materialized
|
|
new_module = pickle.loads(pickle.dumps(module))
|
|
self.assertIsInstance(new_module, cls)
|
|
self.assertNotIsInstance(new_module, lazy_cls)
|
|
self.assertEqual(new_module.weight.shape, expected_weight_shape)
|
|
self.assertNotIsInstance(new_module.weight, UninitializedParameter)
|
|
if new_module.bias is not None:
|
|
self.assertEqual(new_module.bias.shape, expected_bias_shape)
|
|
self.assertNotIsInstance(new_module.bias, UninitializedParameter)
|
|
|
|
def _check_lazy_conv_state(self, gen_module, gen_lazy_module,
|
|
expected_weight_shape, expected_bias_shape):
|
|
module = gen_module()
|
|
lazy_module = gen_lazy_module()
|
|
lazy_module.load_state_dict(module.state_dict())
|
|
# Parameters have been initialized but the module won't become a full
|
|
# Conv one until the first iteration. This is due to
|
|
# limitations on the state_dict loading logic
|
|
self.assertFalse(lazy_module.has_uninitialized_params())
|
|
self.assertEqual(lazy_module.weight.shape, expected_weight_shape)
|
|
if lazy_module.bias is not None:
|
|
self.assertEqual(lazy_module.bias.shape, expected_bias_shape)
|
|
|
|
module = gen_module()
|
|
lazy_module = gen_lazy_module()
|
|
with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'):
|
|
module.load_state_dict(lazy_module.state_dict())
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv1d(self):
|
|
self._check_lazy_conv(nn.Conv1d, nn.LazyConv1d, torch.nn.functional.conv1d,
|
|
(32, 2), (192, 16, 50), (32, 16, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv1d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.Conv1d, nn.LazyConv1d, (32, 2), (192, 16, 50),
|
|
(32, 16, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv1d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.Conv1d(16, 32, 2),
|
|
lambda: nn.LazyConv1d(32, 2),
|
|
(32, 16, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv2d(self):
|
|
self._check_lazy_conv(nn.Conv2d, nn.LazyConv2d, torch.nn.functional.conv2d,
|
|
(32, 2), (192, 16, 8, 6), (32, 16, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv2d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.Conv2d, nn.LazyConv2d, (32, 2), (192, 16, 8, 6),
|
|
(32, 16, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv2d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.Conv2d(16, 32, 2),
|
|
lambda: nn.LazyConv2d(32, 2),
|
|
(32, 16, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv3d(self):
|
|
self._check_lazy_conv(nn.Conv3d, nn.LazyConv3d, torch.nn.functional.conv3d,
|
|
(32, 2), (192, 16, 8, 7, 6), (32, 16, 2, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv3d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.Conv3d, nn.LazyConv3d, (32, 2), (192, 16, 8, 7, 6),
|
|
(32, 16, 2, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv3d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.Conv3d(16, 32, 2),
|
|
lambda: nn.LazyConv3d(32, 2),
|
|
(32, 16, 2, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transposed1d(self):
|
|
self._check_lazy_conv(nn.ConvTranspose1d, nn.LazyConvTranspose1d, torch.nn.functional.conv_transpose1d,
|
|
(32, 2), (192, 16, 50), (16, 32, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose1d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.ConvTranspose1d, nn.LazyConvTranspose1d, (32, 2),
|
|
(192, 16, 50), (16, 32, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose1d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.ConvTranspose1d(16, 32, 2),
|
|
lambda: nn.LazyConvTranspose1d(32, 2),
|
|
(16, 32, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose2d(self):
|
|
self._check_lazy_conv(nn.ConvTranspose2d, nn.LazyConvTranspose2d, torch.nn.functional.conv_transpose2d,
|
|
(32, 2), (192, 16, 8, 6), (16, 32, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose2d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.ConvTranspose2d, nn.LazyConvTranspose2d, (32, 2),
|
|
(192, 16, 8, 6), (16, 32, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose2d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.ConvTranspose2d(16, 32, 2),
|
|
lambda: nn.LazyConvTranspose2d(32, 2),
|
|
(16, 32, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose3d(self):
|
|
self._check_lazy_conv(nn.ConvTranspose3d, nn.LazyConvTranspose3d, torch.nn.functional.conv_transpose3d,
|
|
(32, 2), (192, 16, 8, 7, 6), (16, 32, 2, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose3d_pickle(self):
|
|
self._check_lazy_conv_pickle(nn.ConvTranspose3d, nn.LazyConvTranspose3d, (32, 2),
|
|
(192, 16, 8, 7, 6), (16, 32, 2, 2, 2), (32,))
|
|
|
|
@suppress_warnings
|
|
def test_lazy_conv_transpose3d_state(self):
|
|
self._check_lazy_conv_state(lambda: nn.ConvTranspose3d(16, 32, 2),
|
|
lambda: nn.LazyConvTranspose3d(32, 2),
|
|
(16, 32, 2, 2, 2), (32,))
|
|
|
|
def _check_lazy_batchnorm(self, cls, lazy_cls, input_shape):
|
|
for affine in [False, True]:
|
|
for track_running_stats in [False, True]:
|
|
lazy_module = lazy_cls(affine=affine, track_running_stats=track_running_stats)
|
|
|
|
if affine:
|
|
self.assertIsInstance(lazy_module.weight, UninitializedParameter)
|
|
self.assertIsInstance(lazy_module.bias, UninitializedParameter)
|
|
if track_running_stats:
|
|
self.assertIsInstance(lazy_module.running_mean, UninitializedBuffer)
|
|
self.assertIsInstance(lazy_module.running_var, UninitializedBuffer)
|
|
|
|
input = torch.ones(*input_shape)
|
|
y = lazy_module(input)
|
|
self.assertIsInstance(lazy_module, cls)
|
|
self.assertNotIsInstance(lazy_module, lazy_cls)
|
|
|
|
num_features = input_shape[1]
|
|
module = cls(num_features, affine=affine, track_running_stats=track_running_stats)
|
|
expected = module(input)
|
|
|
|
if module.weight is not None:
|
|
self.assertEqual(lazy_module.weight.shape, module.weight.shape)
|
|
self.assertEqual(lazy_module.weight, module.weight)
|
|
if module.bias is not None:
|
|
self.assertEqual(lazy_module.bias.shape, module.bias.shape)
|
|
self.assertEqual(lazy_module.bias, module.bias)
|
|
if module.running_mean is not None:
|
|
self.assertEqual(lazy_module.running_mean.shape, module.running_mean.shape)
|
|
self.assertEqual(lazy_module.running_mean, module.running_mean)
|
|
if module.running_var is not None:
|
|
self.assertEqual(lazy_module.running_var.shape, module.running_var.shape)
|
|
self.assertEqual(lazy_module.running_var, module.running_var)
|
|
if module.num_batches_tracked is not None:
|
|
self.assertEqual(lazy_module.num_batches_tracked.shape, module.num_batches_tracked.shape)
|
|
self.assertEqual(lazy_module.num_batches_tracked, module.num_batches_tracked)
|
|
|
|
def _check_lazy_batchnorm_pickle(self, cls, lazy_cls, input_shape):
|
|
for affine in [False, True]:
|
|
for track_running_stats in [False, True]:
|
|
module = lazy_cls(affine=affine, track_running_stats=track_running_stats)
|
|
module = pickle.loads(pickle.dumps(module))
|
|
|
|
self.assertIsInstance(module, lazy_cls)
|
|
if affine:
|
|
self.assertIsInstance(module.weight, UninitializedParameter)
|
|
self.assertIsInstance(module.bias, UninitializedParameter)
|
|
if track_running_stats:
|
|
self.assertIsInstance(module.running_mean, UninitializedBuffer)
|
|
self.assertIsInstance(module.running_var, UninitializedBuffer)
|
|
|
|
input = torch.ones(*input_shape)
|
|
module(input) # fully materialized
|
|
module = pickle.loads(pickle.dumps(module))
|
|
|
|
self.assertNotIsInstance(module, lazy_cls)
|
|
self.assertIsInstance(module, cls)
|
|
if affine:
|
|
self.assertNotIsInstance(module.weight, UninitializedParameter)
|
|
self.assertNotIsInstance(module.bias, UninitializedParameter)
|
|
if track_running_stats:
|
|
self.assertNotIsInstance(module.running_mean, UninitializedBuffer)
|
|
self.assertNotIsInstance(module.running_var, UninitializedBuffer)
|
|
|
|
def _check_lazy_batchnorm_state(self, cls, lazy_cls):
|
|
module = cls(10)
|
|
lazy_module = lazy_cls(affine=True, track_running_stats=True)
|
|
lazy_module.load_state_dict(module.state_dict())
|
|
# Parameters have been initialized but the module won't become a full
|
|
# Conv one until the first iteration. This is due to
|
|
# limitations on the state_dict loading logic
|
|
self.assertFalse(lazy_module.has_uninitialized_params())
|
|
self.assertEqual(lazy_module.weight.shape, (10,))
|
|
self.assertEqual(lazy_module.bias.shape, (10,))
|
|
self.assertEqual(lazy_module.running_mean.shape, (10,))
|
|
self.assertEqual(lazy_module.running_var.shape, (10,))
|
|
|
|
module = cls(10)
|
|
lazy_module = lazy_cls()
|
|
with self.assertRaisesRegex(RuntimeError, 'shape of an uninitialized'):
|
|
module.load_state_dict(lazy_module.state_dict())
|
|
|
|
def test_lazy_batchnorm1d(self):
|
|
self._check_lazy_batchnorm(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 3, 6))
|
|
self._check_lazy_batchnorm(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 6))
|
|
|
|
def test_lazy_batchnorm1d_pickle(self):
|
|
self._check_lazy_batchnorm_pickle(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 3, 6))
|
|
self._check_lazy_batchnorm_pickle(nn.BatchNorm1d, nn.LazyBatchNorm1d, (16, 6))
|
|
|
|
def test_lazy_batchnorm1d_state(self):
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm1d, nn.LazyBatchNorm1d)
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm1d, nn.LazyBatchNorm1d)
|
|
|
|
def test_lazy_batchnorm2d(self):
|
|
self._check_lazy_batchnorm(nn.BatchNorm2d, nn.LazyBatchNorm2d, (16, 3, 6, 7))
|
|
|
|
def test_lazy_batchnorm2d_pickle(self):
|
|
self._check_lazy_batchnorm_pickle(nn.BatchNorm2d, nn.LazyBatchNorm2d, (16, 3, 6, 7))
|
|
|
|
def test_lazy_batchnorm2d_state(self):
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm2d, nn.LazyBatchNorm2d)
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm2d, nn.LazyBatchNorm2d)
|
|
|
|
def test_lazy_batchnorm3d(self):
|
|
self._check_lazy_batchnorm(nn.BatchNorm3d, nn.LazyBatchNorm3d, (16, 3, 6, 7, 8))
|
|
|
|
def test_lazy_batchnorm3d_pickle(self):
|
|
self._check_lazy_batchnorm_pickle(nn.BatchNorm3d, nn.LazyBatchNorm3d, (16, 3, 6, 7, 8))
|
|
|
|
def test_lazy_batchnorm3d_state(self):
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm3d, nn.LazyBatchNorm3d)
|
|
self._check_lazy_batchnorm_state(nn.BatchNorm3d, nn.LazyBatchNorm3d)
|
|
|
|
@suppress_warnings
|
|
def test_materialize_dtype(self):
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
module.test_param.materialize(10)
|
|
self.assertTrue(module.test_param.dtype == torch.float64)
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
module.half()
|
|
module.test_param.materialize(10)
|
|
self.assertTrue(module.test_param.dtype == torch.float16)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
@suppress_warnings
|
|
def test_materialize_device(self):
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
module.test_param.materialize(10)
|
|
self.assertTrue(module.test_param.device.type == 'cpu')
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
module.cuda()
|
|
module.test_param.materialize(10)
|
|
self.assertTrue(module.test_param.device.type == 'cuda')
|
|
|
|
@suppress_warnings
|
|
def test_chained_initialization(self):
|
|
class MyNetwork(torch.nn.Module):
|
|
def __init__(self):
|
|
super(MyNetwork, self).__init__()
|
|
self.linear_1 = torch.nn.LazyLinear(15)
|
|
self.linear_2 = torch.nn.LazyLinear(10)
|
|
|
|
def forward(self, x):
|
|
y = self.linear_1(x)
|
|
return self.linear_2(y)
|
|
|
|
net = MyNetwork()
|
|
net(torch.ones(5, 10))
|
|
self.assertTrue(net.linear_1.weight.shape == (15, 10))
|
|
self.assertTrue(net.linear_1.bias.shape == (15,))
|
|
self.assertTrue(net.linear_2.weight.shape == (10, 15))
|
|
self.assertTrue(net.linear_2.bias.shape == (10,))
|
|
|
|
@suppress_warnings
|
|
def test_optimizer_pass(self):
|
|
optimizers = [torch.optim.Adadelta, torch.optim.Adagrad, torch.optim.Adam,
|
|
torch.optim.AdamW, torch.optim.Adamax,
|
|
torch.optim.ASGD, torch.optim.SGD, torch.optim.Rprop,
|
|
torch.optim.RMSprop, torch.optim.LBFGS]
|
|
|
|
def run_step(module, optim):
|
|
self.assertIsInstance(optim.param_groups[0]['params'][0], UninitializedParameter)
|
|
module.test_param.materialize(10)
|
|
self.assertIsInstance(optim.param_groups[0]['params'][0], Parameter)
|
|
self.assertNotIsInstance(optim.param_groups[0]['params'][0], UninitializedParameter)
|
|
for p in module.parameters():
|
|
p.grad = torch.rand_like(p)
|
|
if isinstance(optim, torch.optim.LBFGS):
|
|
optim.step(lambda: 1.0)
|
|
else:
|
|
optim.step()
|
|
|
|
for optim_cls in optimizers:
|
|
module = LazyModule()
|
|
module.register_parameter('test_param', UninitializedParameter())
|
|
if optim_cls is torch.optim.SGD:
|
|
optim = optim_cls(module.parameters(), lr=0.0)
|
|
elif optim_cls is torch.optim.Adagrad:
|
|
with self.assertRaisesRegex(ValueError, 'uninitialized parameter'):
|
|
optim = optim_cls(module.parameters())
|
|
continue
|
|
else:
|
|
optim = optim_cls(module.parameters())
|
|
run_step(module, optim)
|
|
|
|
@suppress_warnings
|
|
def test_weight_norm(self):
|
|
m = nn.LazyLinear(7)
|
|
with self.assertRaisesRegex(ValueError, 'have uninitialized parameters.'):
|
|
m = torch.nn.utils.weight_norm(m)
|
|
|
|
@suppress_warnings
|
|
def test_spectral_norm(self):
|
|
m = nn.LazyLinear(7)
|
|
with self.assertRaisesRegex(ValueError, 'have uninitialized parameters.'):
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
|
|
@suppress_warnings
|
|
def test_invalid_functions(self):
|
|
param = torch.nn.parameter.UninitializedParameter()
|
|
with self.assertRaisesRegex(ValueError, 'uninitialized parameter'):
|
|
torch.empty_like(param)
|
|
|
|
with self.assertRaisesRegex(ValueError, 'uninitialized parameter'):
|
|
torch.add(param, param)
|
|
|
|
with self.assertRaisesRegex(ValueError, 'uninitialized parameter'):
|
|
param + param
|
|
|
|
class TestFunctionalPickle(TestCase):
|
|
|
|
# issue gh-38137
|
|
def test_pickle_softsign(self):
|
|
# Make sure it does not throw an exception
|
|
s = pickle.dumps(F.softsign)
|
|
|
|
|
|
instantiate_device_type_tests(TestNNDeviceType, globals())
|
|
|
|
if __name__ == '__main__':
|
|
run_tests()
|