mirror of
https://github.com/zebrajr/pytorch.git
synced 2025-12-06 12:20:52 +01:00
Fixes https://github.com/pytorch/pytorch/issues/139467 Refactor `nn.utils.clip_grad_norm_` into `nn.utils.get_total_norm` and then `nn.utils.clip_grads_with_norm_` . `clip_grad_norm_` now calls into these two new ops, `get_total_norm` is generalized (rather than `get_grad_norm` due to the discussion on the issue from @awgu) Pull Request resolved: https://github.com/pytorch/pytorch/pull/139662 Approved by: https://github.com/H-Huang
13079 lines
599 KiB
Python
13079 lines
599 KiB
Python
# Owner(s): ["module: nn"]
|
|
|
|
import contextlib
|
|
import math
|
|
import random
|
|
import unittest
|
|
import io
|
|
import itertools
|
|
import warnings
|
|
import pickle
|
|
import re
|
|
from copy import deepcopy
|
|
from itertools import product
|
|
from functools import partial
|
|
from collections import OrderedDict
|
|
from unittest import SkipTest
|
|
|
|
import torch
|
|
from torch import inf, nan
|
|
import torch.autograd.forward_ad as fwAD
|
|
import torch.backends.cudnn as cudnn
|
|
import torch.nn as nn
|
|
import torch.nn.functional as F
|
|
import torch.nn.utils.rnn as rnn_utils
|
|
from torch.nn.utils import clip_grad_norm_, clip_grad_value_, clip_grads_with_norm_, get_total_norm
|
|
from torch.nn.utils import parameters_to_vector, vector_to_parameters
|
|
from torch.nn.utils.fusion import fuse_conv_bn_weights
|
|
from torch.nn.utils.fusion import fuse_linear_bn_weights
|
|
from torch.nn import Buffer, Parameter
|
|
from torch.nn.parallel._functions import Broadcast
|
|
from torch.testing._internal.common_dtype import integral_types, get_all_math_dtypes, floating_types
|
|
from torch.testing._internal.common_utils import freeze_rng_state, run_tests, TestCase, skipIfNoLapack, skipIfRocm, \
|
|
TEST_NUMPY, TEST_SCIPY, TEST_WITH_CROSSREF, TEST_WITH_ROCM, \
|
|
download_file, get_function_arglist, load_tests, skipIfMps, \
|
|
IS_PPC, \
|
|
parametrize as parametrize_test, subtest, instantiate_parametrized_tests, \
|
|
skipIfTorchDynamo, gcIfJetson, set_default_dtype
|
|
from torch.testing._internal.common_cuda import TEST_CUDA, TEST_MULTIGPU, TEST_CUDNN, PLATFORM_SUPPORTS_FLASH_ATTENTION
|
|
from torch.testing._internal.common_nn import NNTestCase, NewModuleTest, CriterionTest, \
|
|
module_tests, criterion_tests, loss_reference_fns, _create_basic_net, \
|
|
ctcloss_reference, new_module_tests, single_batch_reference_fn, _test_bfloat16_ops, _test_module_empty_input
|
|
from torch.testing._internal.common_device_type import dtypesIfMPS, instantiate_device_type_tests, dtypes, \
|
|
dtypesIfCUDA, precisionOverride, skipCUDAIfCudnnVersionLessThan, onlyCUDA, onlyCPU, \
|
|
skipCUDAIfRocm, skipCUDAIf, skipCUDAIfNotRocm, \
|
|
onlyNativeDeviceTypes, deviceCountAtLeast, largeTensorTest, expectedFailureMeta, expectedFailureMPS, \
|
|
skipMeta, get_all_device_types
|
|
|
|
from hypothesis import given
|
|
import torch.testing._internal.hypothesis_utils as hu
|
|
from torch.testing._internal.common_utils import _assertGradAndGradgradChecks, gradcheck, gradgradcheck, \
|
|
GRADCHECK_NONDET_TOL
|
|
from torch.testing._internal.common_utils import dtype2prec_DONTUSE
|
|
from torch.testing._internal.common_cuda import tf32_on_and_off, tf32_is_not_fp32, tf32_off, tf32_on
|
|
from torch.types import _TensorOrTensors
|
|
from torch.testing._internal.common_mkldnn import bf32_on_and_off
|
|
|
|
AMPERE_OR_ROCM = TEST_WITH_ROCM or tf32_is_not_fp32()
|
|
|
|
# load_tests from common_utils is used to automatically filter tests for
|
|
# sharding on sandcastle. This line silences flake warnings
|
|
load_tests = load_tests
|
|
|
|
if TEST_SCIPY:
|
|
import scipy.signal
|
|
import scipy.ndimage
|
|
|
|
if TEST_NUMPY:
|
|
import numpy as np
|
|
|
|
|
|
# WARNING: If you add a new top-level test case to this file, you MUST
|
|
# update test/run_test.py to list it, otherwise it will NOT be run in
|
|
# CI.
|
|
|
|
class TestNN(NNTestCase):
|
|
_do_cuda_memory_leak_check = True
|
|
_do_cuda_non_default_stream = True
|
|
|
|
def _forward(self, module, input: _TensorOrTensors):
|
|
with freeze_rng_state():
|
|
if isinstance(input, tuple):
|
|
return module(*input)
|
|
else:
|
|
return module(input)
|
|
|
|
def _backward(self, module, input: _TensorOrTensors, output, grad_output, create_graph=False):
|
|
output.backward(grad_output, retain_graph=True, create_graph=create_graph)
|
|
if isinstance(input, tuple):
|
|
return tuple(i.grad.data if i.grad is not None else None for i in input)
|
|
else:
|
|
return input.grad.data if input.grad is not None else None
|
|
|
|
def _forward_criterion(self, criterion, input, target, extra_args=None):
|
|
if extra_args is None:
|
|
extra_args = ()
|
|
if isinstance(input, tuple):
|
|
args = input + (target,) + extra_args
|
|
output = criterion(*args)
|
|
else:
|
|
output = criterion(input, target, *extra_args)
|
|
return output
|
|
|
|
def _backward_criterion(self, criterion, input, output, target, gradOutput=None, extra_args=None):
|
|
if extra_args is None:
|
|
extra_args = ()
|
|
input_tuple = input if isinstance(input, tuple) else (input,)
|
|
output_tuple = output if isinstance(output, tuple) else (output,)
|
|
for i in input_tuple:
|
|
if i.grad is not None:
|
|
i.grad.data.zero_()
|
|
args = input_tuple + (target,) + extra_args
|
|
if gradOutput is None:
|
|
gradOutput = torch.ones(())
|
|
criterion(*args).backward(gradOutput.to(output_tuple[0]))
|
|
if isinstance(input, tuple):
|
|
return tuple(i.grad.data for i in input)
|
|
else:
|
|
return input.grad.data
|
|
|
|
def _zero_grad_parameters(self, module):
|
|
for p in module.parameters():
|
|
if p.grad is not None:
|
|
with torch.no_grad():
|
|
p.grad.zero_()
|
|
p.grad.detach_()
|
|
|
|
def _get_parameters(self, module):
|
|
params = []
|
|
d_params = []
|
|
for p in module.parameters():
|
|
params.append(p)
|
|
d_params.append(p.grad)
|
|
return params, d_params
|
|
|
|
def test_parse_to(self):
|
|
# Test for buggy use of THPMemoryFormat_New
|
|
self.assertEqual(
|
|
repr(torch._C._nn._parse_to(memory_format=torch.contiguous_format)[3]),
|
|
"torch.contiguous_format"
|
|
)
|
|
|
|
def test_requires_grad_(self):
|
|
m = _create_basic_net()[-1]
|
|
assert len(list(m.buffers())) > 0, 'invalid test'
|
|
assert all(not b.requires_grad for b in m.buffers()) > 0, 'invalid test'
|
|
assert len(list(m.parameters())) > 0, 'invalid test'
|
|
assert all(p.requires_grad for p in m.parameters()) > 0, 'invalid test'
|
|
for requires_grad in (False, True):
|
|
self.assertIs(m.requires_grad_(requires_grad), m)
|
|
for p in m.parameters():
|
|
self.assertEqual(p.requires_grad, requires_grad)
|
|
for b in m.buffers():
|
|
self.assertFalse(b.requires_grad)
|
|
|
|
def test_module_backcompat(self):
|
|
from torch.serialization import SourceChangeWarning
|
|
path = download_file('https://download.pytorch.org/test_data/linear.pt')
|
|
with warnings.catch_warnings():
|
|
warnings.simplefilter('ignore', SourceChangeWarning)
|
|
# weights_only=False as this is legacy code that saves the model
|
|
m = torch.load(path, weights_only=False)
|
|
input = torch.randn(2, 3, dtype=torch.float)
|
|
self.assertEqual(m(input).size(), (2, 5))
|
|
|
|
def test_module_super_init(self):
|
|
class MyMixin:
|
|
def __init__(self, *a, **kw):
|
|
super().__init__(*a, **kw)
|
|
self.mixin_init = True
|
|
|
|
class MyModuleWithMixinBefore(MyMixin, nn.Module):
|
|
pass
|
|
|
|
class MyModuleWithMixinAfter(nn.Module, MyMixin):
|
|
pass
|
|
|
|
self.assertTrue(hasattr(MyModuleWithMixinBefore(), 'mixin_init'))
|
|
self.assertFalse(hasattr(MyModuleWithMixinAfter(), 'mixin_init'))
|
|
|
|
nn.Module.call_super_init = True
|
|
self.assertTrue(hasattr(MyModuleWithMixinBefore(), 'mixin_init'))
|
|
self.assertTrue(hasattr(MyModuleWithMixinAfter(), 'mixin_init'))
|
|
nn.Module.call_super_init = False
|
|
|
|
MyModuleWithMixinBefore.call_super_init = True
|
|
MyModuleWithMixinAfter.call_super_init = True
|
|
self.assertTrue(hasattr(MyModuleWithMixinBefore(), 'mixin_init'))
|
|
self.assertTrue(hasattr(MyModuleWithMixinAfter(), 'mixin_init'))
|
|
MyModuleWithMixinBefore.call_super_init = False
|
|
MyModuleWithMixinAfter.call_super_init = False
|
|
|
|
def test_share_memory(self):
|
|
class Net(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.p = nn.Parameter(torch.eye(5))
|
|
self.par = nn.ParameterList()
|
|
self.par.append(nn.Parameter(torch.randn(10)))
|
|
|
|
def forward(self, inp):
|
|
# NB: dead code
|
|
return inp.clone()
|
|
|
|
net = Net()
|
|
for p in net.parameters():
|
|
self.assertFalse(p.storage().is_shared())
|
|
for b in net.buffers():
|
|
self.assertFalse(b.storage().is_shared())
|
|
net.share_memory()
|
|
for p in net.parameters():
|
|
self.assertTrue(p.storage().is_shared())
|
|
for b in net.buffers():
|
|
self.assertTrue(b.storage().is_shared())
|
|
|
|
def test_to(self):
|
|
m = nn.Linear(3, 5)
|
|
self.assertIs(m, m.to('cpu'))
|
|
self.assertIs(m, m.to('cpu', dtype=torch.float32))
|
|
self.assertEqual(m.double(), m.to(torch.float64))
|
|
self.assertRaises(RuntimeError, lambda: m.to('cpu', copy=True))
|
|
|
|
if torch.cuda.is_available():
|
|
for cuda in ['cuda', 'cuda:0' if torch.cuda.device_count() == 1 else 'cuda:1']:
|
|
m2 = m.cuda(device=cuda)
|
|
self.assertIs(m2, m2.to(cuda))
|
|
self.assertEqual(m, m2.to('cpu'))
|
|
self.assertEqual(m2, m.to(cuda))
|
|
self.assertIs(m2, m2.to(dtype=torch.float32))
|
|
self.assertEqual(m2.double(), m2.to(dtype=torch.float64))
|
|
|
|
def test_zero_grad(self):
|
|
i = torch.randn(2, 5, requires_grad=True)
|
|
module = nn.Linear(5, 5)
|
|
for p in module.parameters():
|
|
p.requires_grad = False
|
|
module.zero_grad()
|
|
|
|
module.weight.requires_grad = True
|
|
module.zero_grad()
|
|
self.assertIsNone(module.weight.grad) # uninitialized grad
|
|
|
|
module(i).sum().backward()
|
|
self.assertIsNotNone(module.weight.grad)
|
|
self.assertGreater(module.weight.grad.data.abs().sum(), 0)
|
|
module.zero_grad()
|
|
self.assertIsNone(module.weight.grad)
|
|
|
|
module.bias.requires_grad = True
|
|
module.zero_grad()
|
|
self.assertIsNone(module.weight.grad)
|
|
self.assertIsNone(module.bias.grad)
|
|
module(i).sum().backward()
|
|
self.assertIsNotNone(module.weight.grad)
|
|
self.assertIsNotNone(module.bias.grad)
|
|
self.assertGreater(module.weight.grad.data.abs().sum(), 0)
|
|
self.assertGreater(module.bias.grad.data.abs().sum(), 0)
|
|
module.zero_grad(set_to_none=False) # Force set to zeros.
|
|
self.assertEqual(module.weight.grad.data, module.weight.data.clone().zero_())
|
|
self.assertEqual(module.bias.grad.data, module.bias.data.clone().zero_())
|
|
|
|
module.zero_grad()
|
|
self.assertIsNone(module.weight.grad)
|
|
self.assertIsNone(module.bias.grad)
|
|
|
|
def test_no_grad(self):
|
|
for dtype in [torch.bfloat16, torch.float, torch.double]:
|
|
module = nn.Conv2d(2, 5, kernel_size=3, padding=1).to(dtype)
|
|
input = torch.randn(1, 2, 10, 10).to(dtype)
|
|
x = input
|
|
y = input.clone()
|
|
|
|
output = module(x)
|
|
self.assertTrue(output.requires_grad)
|
|
output.backward(torch.ones(1, 5, 10, 10))
|
|
|
|
with torch.no_grad():
|
|
output2 = module(y)
|
|
self.assertFalse(output2.requires_grad)
|
|
self.assertRaises(RuntimeError, lambda: output2.backward(torch.ones(1, 5, 10, 10)))
|
|
|
|
def test_parameters_and_named_parameters(self):
|
|
def names(named_parameters):
|
|
return [k for k, _ in named_parameters]
|
|
|
|
l, n, s = _create_basic_net()
|
|
|
|
self.assertEqual(len(list(l.parameters())), 1)
|
|
self.assertEqual(
|
|
names(l.named_parameters()),
|
|
['layer_dummy_param'])
|
|
|
|
self.assertEqual(len(list(n.parameters())), 2)
|
|
self.assertEqual(
|
|
names(n.named_parameters()),
|
|
['dummy_param', 'l1.layer_dummy_param'])
|
|
|
|
self.assertEqual(len(list(n.parameters(recurse=False))), 1)
|
|
self.assertEqual(
|
|
names(n.named_parameters(recurse=False)),
|
|
['dummy_param'])
|
|
|
|
self.assertEqual(len(list(s.parameters())), 2)
|
|
self.assertEqual(
|
|
names(s.named_parameters()),
|
|
['0.dummy_param', '0.l1.layer_dummy_param'])
|
|
|
|
def test_named_parameters_remove_duplicate(self):
|
|
def names(named_parameters):
|
|
return [k for k, _ in named_parameters]
|
|
|
|
class M1(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.param1 = nn.Parameter(torch.empty(3, 3))
|
|
self.param2 = self.param1
|
|
|
|
m1 = M1()
|
|
self.assertEqual(names(m1.named_parameters()),
|
|
["param1"])
|
|
self.assertEqual(names(m1.named_parameters(remove_duplicate=False)),
|
|
["param1", "param2"])
|
|
|
|
class M2(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.mod1 = nn.Linear(3, 4, bias=False)
|
|
self.mod2 = self.mod1
|
|
|
|
m2 = M2()
|
|
self.assertEqual(names(m2.named_parameters()),
|
|
["mod1.weight"])
|
|
self.assertEqual(names(m2.named_parameters(remove_duplicate=False)),
|
|
["mod1.weight", "mod2.weight"])
|
|
|
|
def test_buffers_and_named_buffers(self):
|
|
def names(named_buffers):
|
|
return [k for k, _ in named_buffers]
|
|
|
|
l, n, s = _create_basic_net()
|
|
|
|
self.assertEqual(len(list(l.buffers())), 1)
|
|
self.assertEqual(
|
|
names(l.named_buffers()),
|
|
['layer_dummy_buf'])
|
|
|
|
self.assertEqual(len(list(n.buffers())), 2)
|
|
self.assertEqual(
|
|
names(n.named_buffers()),
|
|
['dummy_buf', 'l1.layer_dummy_buf'])
|
|
|
|
self.assertEqual(len(list(n.buffers(recurse=False))), 1)
|
|
self.assertEqual(
|
|
names(n.named_buffers(recurse=False)),
|
|
['dummy_buf'])
|
|
|
|
self.assertEqual(len(list(s.buffers())), 2)
|
|
self.assertEqual(
|
|
names(s.named_buffers()),
|
|
['0.dummy_buf', '0.l1.layer_dummy_buf'])
|
|
|
|
# test remove_duplicate
|
|
class M(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.buffer1 = Buffer(torch.empty(3, 5))
|
|
self.buffer2 = self.buffer1
|
|
|
|
m = M()
|
|
self.assertEqual(names(m.named_buffers()),
|
|
["buffer1"])
|
|
self.assertEqual(names(m.named_buffers(remove_duplicate=False)),
|
|
["buffer1", "buffer2"])
|
|
|
|
def test_buffer_bad_module_subclass(self):
|
|
class MyBadModule(nn.Linear):
|
|
def __init__(self) -> None:
|
|
super().__init__(2, 2)
|
|
self.bar = Buffer(torch.rand(2, 2))
|
|
|
|
def register_buffer(self, name, value):
|
|
# persistent is explicitly missing!
|
|
super().register_buffer(name, value, True)
|
|
|
|
foo = MyBadModule()
|
|
self.assertIsNotNone(foo.bar)
|
|
|
|
def test_call_supports_python_dict_output(self):
|
|
class Net(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.l1 = nn.Linear(10, 20)
|
|
self.register_backward_hook(self.hook)
|
|
self.check_backward_hook_flag = False
|
|
|
|
def hook(self, module, grad_out, grad_in):
|
|
self.check_backward_hook_flag = True
|
|
|
|
def forward(self, inputs):
|
|
return {"output": self.l1(inputs).sum()}
|
|
|
|
net = Net()
|
|
model_output = net(torch.randn([5, 10]))
|
|
model_output["output"].backward()
|
|
self.assertTrue(net.check_backward_hook_flag)
|
|
|
|
def test_children(self):
|
|
l1 = nn.Linear(2, 2)
|
|
l2 = nn.Linear(2, 2)
|
|
l3 = nn.Linear(2, 2)
|
|
l4 = nn.Linear(2, 2)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(l1, l2, l1, l2, subnet)
|
|
self.assertEqual(list(s.children()), [l1, l2, subnet])
|
|
|
|
def test_train_errors_for_invalid_mode(self):
|
|
class SubclassNet(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.l1 = nn.Linear(2, 2)
|
|
|
|
def forward(self, inputs):
|
|
return self.l1(inputs)
|
|
|
|
subclass_net = SubclassNet()
|
|
sequential_net = nn.Sequential(nn.Linear(2, 2), nn.Linear(2, 2))
|
|
|
|
error_modes = ["invalid_str", torch.device('cpu')]
|
|
modules_to_check = [subclass_net, sequential_net]
|
|
|
|
for error_mode, module in itertools.product(error_modes, modules_to_check):
|
|
with self.assertRaises(ValueError):
|
|
module.train(error_mode)
|
|
|
|
def test_dir(self):
|
|
linear = nn.Linear(2, 2)
|
|
linear._test_submodule = nn.Linear(2, 2)
|
|
linear._test_parameter = Parameter(torch.empty(2, 2))
|
|
linear._test_buffer = Buffer(torch.empty(2, 2))
|
|
keys = dir(linear)
|
|
self.assertIn('_test_submodule', keys)
|
|
self.assertIn('_test_parameter', keys)
|
|
self.assertIn('_test_buffer', keys)
|
|
|
|
for key in keys:
|
|
self.assertTrue(hasattr(linear, key))
|
|
|
|
def test_repr(self):
|
|
# no extra information or sub-modules
|
|
empty_sequential = nn.Sequential()
|
|
expected_repr_empty = 'Sequential()'
|
|
self.assertEqual(repr(empty_sequential), expected_repr_empty)
|
|
|
|
# one liner extra information
|
|
linear = nn.Linear(1, 1)
|
|
expected_repr_linear = 'Linear(in_features=1, out_features=1, bias=True)'
|
|
self.assertEqual(repr(linear), expected_repr_linear)
|
|
|
|
# sub-modules repr
|
|
sequential = nn.Sequential(linear)
|
|
expected_repr_sequential = 'Sequential(\n' \
|
|
' (0): Linear(in_features=1, out_features=1, bias=True)\n' \
|
|
')'
|
|
self.assertEqual(repr(sequential), expected_repr_sequential)
|
|
|
|
def test_dir_digit(self):
|
|
model = nn.Sequential(nn.Linear(2, 2))
|
|
keys = dir(model)
|
|
self.assertNotIn('0', keys)
|
|
|
|
def test_named_children(self):
|
|
l1 = nn.Linear(2, 2)
|
|
l2 = nn.Linear(2, 2)
|
|
l3 = nn.Linear(2, 2)
|
|
l4 = nn.Linear(2, 2)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential()
|
|
with self.assertRaises(KeyError):
|
|
s.add_module('', l1)
|
|
with self.assertRaises(KeyError):
|
|
s.add_module('name.with.dot', l1)
|
|
s.add_module('layer1', l1)
|
|
s.add_module('layer2', l2)
|
|
s.add_module('layer3', l1)
|
|
s.add_module('layer4', l2)
|
|
s.add_module('subnet', subnet)
|
|
self.assertEqual(list(s.named_children()), [('layer1', l1), ('layer2', l2), ('subnet', subnet)])
|
|
|
|
def test_modules(self):
|
|
class Net(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.l1 = l
|
|
self.l2 = l
|
|
self.param = torch.empty(3, 5)
|
|
|
|
l = nn.Linear(10, 20)
|
|
n = Net()
|
|
s = nn.Sequential(n, n, n, n)
|
|
self.assertEqual(list(s.modules()), [s, n, l])
|
|
|
|
def test_named_modules(self):
|
|
class Net(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.l1 = l
|
|
self.l2 = l
|
|
self.param = torch.empty(3, 5)
|
|
self.block = block
|
|
l = nn.Linear(10, 20)
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(10, 20)
|
|
block = nn.Sequential()
|
|
block.add_module('linear1', l1)
|
|
block.add_module('linear2', l2)
|
|
n = Net()
|
|
s = nn.Sequential(n, n)
|
|
self.assertEqual(list(s.named_modules()), [('', s), ('0', n), ('0.l1', l),
|
|
('0.block', block), ('0.block.linear1', l1),
|
|
('0.block.linear2', l2)])
|
|
# test the option to not remove duplicate module instances
|
|
self.assertEqual(list(s.named_modules(remove_duplicate=False)), [
|
|
('', s), ('0', n), ('0.l1', l), ('0.l2', l),
|
|
('0.block', block), ('0.block.linear1', l1),
|
|
('0.block.linear2', l2),
|
|
('1', n), ('1.l1', l), ('1.l2', l),
|
|
('1.block', block), ('1.block.linear1', l1),
|
|
('1.block.linear2', l2)])
|
|
|
|
def test_register_buffer_raises_error_if_name_is_not_string(self):
|
|
m = nn.Module()
|
|
expected_error = 'buffer name should be a string. Got '
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'int'):
|
|
m.register_buffer(1, torch.rand(5))
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'):
|
|
m.register_buffer(None, torch.rand(5))
|
|
|
|
def test_register_buffer_raises_error_if_attr_exists(self):
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
with self.assertRaises(KeyError):
|
|
m.attribute_name = Buffer(torch.rand(5))
|
|
|
|
del m.attribute_name
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
del m.attribute_name
|
|
m.add_module('attribute_name', nn.Module())
|
|
with self.assertRaises(KeyError):
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
|
|
def test_register_buffer_raises_error_if_not_tensor(self):
|
|
m = nn.Module()
|
|
with self.assertRaises(TypeError):
|
|
m.register_buffer('attribute_name', 5)
|
|
|
|
def test_register_buffer_allows_overwriting_with_same_name(self):
|
|
m = nn.Module()
|
|
buffer1 = torch.rand(5)
|
|
buffer2 = buffer1 + 5
|
|
buffer3 = None
|
|
m.register_buffer('buffer_name', buffer1)
|
|
self.assertEqual(m.buffer_name, buffer1)
|
|
m.register_buffer('buffer_name', buffer2)
|
|
self.assertEqual(m.buffer_name, buffer2)
|
|
m.register_buffer('buffer_name', buffer3)
|
|
self.assertEqual(m.buffer_name, buffer3)
|
|
m.buffer_name = Buffer(buffer1)
|
|
self.assertEqual(m.buffer_name, Buffer(buffer1))
|
|
m.buffer_name = Buffer(buffer2)
|
|
self.assertEqual(m.buffer_name, Buffer(buffer2))
|
|
m.buffer_name = Buffer(buffer3)
|
|
self.assertEqual(m.buffer_name, Buffer(buffer3))
|
|
|
|
def test_get_buffer(self):
|
|
m = nn.Module()
|
|
buffer1 = torch.randn(2, 3)
|
|
buffer2 = torch.randn(4, 5)
|
|
m.foo = Buffer(buffer1)
|
|
m.register_buffer('bar', buffer2)
|
|
self.assertEqual(buffer1, m.get_buffer('foo'))
|
|
self.assertEqual(buffer2, m.get_buffer('bar'))
|
|
|
|
def test_get_buffer_from_submodules(self):
|
|
class MyModule(nn.Module):
|
|
def __init__(self, foo, bar):
|
|
super().__init__()
|
|
self.sub = Sub(foo, bar)
|
|
|
|
class Sub(nn.Module):
|
|
def __init__(self, foo, bar):
|
|
super().__init__()
|
|
self.foo = Buffer(foo)
|
|
self.subsub = SubSub(bar)
|
|
|
|
class SubSub(nn.Module):
|
|
def __init__(self, bar):
|
|
super().__init__()
|
|
self.bar = Buffer(bar)
|
|
|
|
foo = torch.randn(2, 3)
|
|
bar = torch.randn(4, 5)
|
|
m = MyModule(foo, bar)
|
|
self.assertEqual(foo, m.get_buffer('sub.foo'))
|
|
self.assertEqual(bar, m.get_buffer('sub.subsub.bar'))
|
|
|
|
def test_buffer_not_persistent(self):
|
|
m = nn.Module()
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
def test_buffer_not_persistent_del(self):
|
|
m = nn.Module()
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
del m.buf
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
|
|
def test_buffer_not_persistent_overwrite(self):
|
|
m = nn.Module()
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
m.buf = nn.Buffer(torch.rand(5))
|
|
|
|
# can we overwrite a non-persistent buffer with a persistent one?
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 1)
|
|
|
|
# can we overwrite a persistent buffer with a non-persistent one?
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
def test_buffer_not_persistent_assign(self):
|
|
m = nn.Module()
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
# Assigning None removes the buffer but if we then assign a new Tensor
|
|
# to the same property, it should still be marked as a buffer.
|
|
m.buf = None
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
m.buf = torch.rand(5)
|
|
self.assertTrue(len(list(m.buffers())) == 1)
|
|
self.assertTrue(len(m.state_dict()) == 0)
|
|
|
|
# Assigning a Parameter removes the buffer.
|
|
m.buf = nn.Parameter(torch.rand(5))
|
|
self.assertTrue(len(list(m.buffers())) == 0)
|
|
self.assertTrue(len(m.state_dict()) == 1)
|
|
|
|
def test_buffer_not_persistent_load(self):
|
|
m = nn.Module()
|
|
m.buf = nn.Buffer(torch.rand(5), persistent=False)
|
|
m.load_state_dict({})
|
|
|
|
def test_register_parameter_raises_error_if_name_is_not_string(self):
|
|
m = nn.Module()
|
|
expected_error = 'parameter name should be a string. Got '
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'int'):
|
|
m.register_parameter(1, nn.Parameter())
|
|
with self.assertRaisesRegex(TypeError, expected_error + 'NoneType'):
|
|
m.register_parameter(None, nn.Parameter())
|
|
|
|
def test_register_parameter_raises_error_if_attr_exists(self):
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
del m.attribute_name
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
del m.attribute_name
|
|
m.attribute_name = Buffer(torch.rand(5))
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
del m.attribute_name
|
|
m.add_module('attribute_name', nn.Module())
|
|
with self.assertRaises(KeyError):
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
|
|
def test_register_parameter_allows_overwriting_with_same_name(self):
|
|
m = nn.Module()
|
|
param1 = nn.Parameter(torch.rand(5))
|
|
param2 = nn.Parameter(param1.data + 5)
|
|
param3 = None
|
|
m.register_parameter('param_name', param1)
|
|
self.assertEqual(m.param_name, param1)
|
|
m.register_parameter('param_name', param2)
|
|
self.assertEqual(m.param_name, param2)
|
|
m.register_parameter('param_name', param3)
|
|
self.assertEqual(m.param_name, param3)
|
|
|
|
def test_add_module_raises_error_if_attr_exists(self):
|
|
methods_to_test = ['add_module', 'register_module']
|
|
for fn in methods_to_test:
|
|
m = nn.Module()
|
|
m.attribute_name = 5
|
|
with self.assertRaises(KeyError):
|
|
getattr(m, fn)('attribute_name', nn.Module())
|
|
|
|
del m.attribute_name
|
|
m.register_buffer('attribute_name', torch.rand(5))
|
|
with self.assertRaises(KeyError):
|
|
getattr(m, fn)('attribute_name', nn.Module())
|
|
|
|
del m.attribute_name
|
|
m.register_parameter('attribute_name', nn.Parameter())
|
|
with self.assertRaises(KeyError):
|
|
getattr(m, fn)('attribute_name', nn.Module())
|
|
|
|
@unittest.expectedFailure
|
|
def test_getattr_with_property(self):
|
|
class Model(nn.Module):
|
|
@property
|
|
def some_property(self):
|
|
return self.something_that_doesnt_exist
|
|
|
|
model = Model()
|
|
|
|
with self.assertRaisesRegex(
|
|
AttributeError,
|
|
r"'Model' object has no attribute 'something_that_doesnt_exist'"):
|
|
model.some_property
|
|
|
|
def test_Sequential_getitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
self.assertIs(n[0], l1)
|
|
self.assertIs(n[1], l2)
|
|
self.assertIs(n[2], l3)
|
|
self.assertIs(n[3], l4)
|
|
self.assertIs(n[torch.tensor(3, dtype=torch.int64)], l4)
|
|
self.assertEqual(n[1:], nn.Sequential(l2, l3, l4))
|
|
self.assertEqual(n[3:], nn.Sequential(l4))
|
|
self.assertEqual(n[:-1], nn.Sequential(l1, l2, l3))
|
|
self.assertEqual(n[:-3], nn.Sequential(l1))
|
|
self.assertEqual(n[::-1], nn.Sequential(l4, l3, l2, l1))
|
|
|
|
def test_Sequential_setitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3)
|
|
n[0] = l4
|
|
n[-1] = l4
|
|
n[torch.tensor(1, dtype=torch.int16)] = l1
|
|
self.assertIs(n[0], l4)
|
|
self.assertIs(n[1], l1)
|
|
self.assertIs(n[2], l4)
|
|
|
|
def test_Sequential_setitem_named(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(OrderedDict([
|
|
('linear1', l1),
|
|
('linear2', l2),
|
|
('linear3', l3),
|
|
]))
|
|
|
|
n[0] = l4
|
|
n[-1] = l4
|
|
self.assertEqual(n.linear1, l4)
|
|
self.assertEqual(n.linear3, l4)
|
|
|
|
def test_Sequential_delitem(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
del n[-1]
|
|
self.assertEqual(n, nn.Sequential(l1, l2, l3))
|
|
del n[1::2]
|
|
self.assertEqual(n, nn.Sequential(l1, l3))
|
|
|
|
def test_Sequential_add(self):
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 4)
|
|
l4 = nn.Linear(4, 5)
|
|
n = nn.Sequential(l1, l2)
|
|
other = nn.Sequential(l3, l4)
|
|
self.assertEqual(n + other, nn.Sequential(l1, l2, l3, l4))
|
|
|
|
def test_Sequential_iadd(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3)
|
|
n2 = nn.Sequential(l4)
|
|
n += n2
|
|
n2 += n
|
|
self.assertEqual(n, nn.Sequential(l1, l2, l3, l4))
|
|
self.assertEqual(n2, nn.Sequential(l4, l1, l2, l3, l4))
|
|
|
|
def test_Sequential_mul(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
n2 = n * 2
|
|
self.assertEqual(n2, nn.Sequential(l1, l2, l3, l4, l1, l2, l3, l4))
|
|
|
|
def test_Sequential_rmul(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
n2 = 2 * n
|
|
self.assertEqual(n2, nn.Sequential(l1, l2, l3, l4, l1, l2, l3, l4))
|
|
|
|
def test_Sequential_imul(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3, l4)
|
|
n *= 2
|
|
self.assertEqual(n, nn.Sequential(l1, l2, l3, l4, l1, l2, l3, l4))
|
|
n *= 2
|
|
self.assertEqual(
|
|
n,
|
|
nn.Sequential(l1, l2, l3, l4, l1, l2, l3, l4, l1, l2, l3, l4, l1, l2, l3, l4)
|
|
)
|
|
|
|
def test_Sequential_append(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n = nn.Sequential(l1, l2, l3)
|
|
n2 = n.append(l4)
|
|
self.assertEqual(n, nn.Sequential(l1, l2, l3, l4))
|
|
self.assertEqual(n2, nn.Sequential(l1, l2, l3, l4))
|
|
self.assertEqual(nn.Sequential(l1).append(l2).append(l4), nn.Sequential(l1, l2, l4))
|
|
|
|
def test_Sequential_pop(self):
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 4)
|
|
l4 = nn.Linear(4, 5)
|
|
n1 = nn.Sequential(l1, l2, l3, l4)
|
|
self.assertEqual(l4, n1.pop(3))
|
|
n2 = nn.Sequential(l1, l2, l3)
|
|
self.assertEqual(n1, n2)
|
|
# check order of the index
|
|
for k, mod in zip(range(len(n1)), n1):
|
|
self.assertIs(n1[k], mod)
|
|
|
|
def test_Sequential_insert(self):
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 4)
|
|
|
|
n1 = nn.Sequential(l1, l2, l3)
|
|
module_1 = nn.Linear(4, 5)
|
|
n2 = nn.Sequential(l1, module_1, l2, l3)
|
|
self.assertEqual(n1.insert(1, module_1), n2)
|
|
|
|
# test for negative support
|
|
n3 = nn.Sequential(l1, l2, l3)
|
|
module_2 = nn.Linear(5, 6)
|
|
n4 = nn.Sequential(l1, module_2, l2, l3)
|
|
self.assertEqual(n3.insert(-2, module_2), n4)
|
|
|
|
def test_Sequential_insert_fail_case(self):
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 4)
|
|
|
|
module = nn.Linear(5, 6)
|
|
|
|
# test for error case
|
|
n1 = nn.Sequential(l1, l2, l3)
|
|
with self.assertRaises(IndexError):
|
|
n1.insert(-5, module)
|
|
|
|
with self.assertRaises(AssertionError):
|
|
n1.insert(1, [nn.Linear(6, 7)])
|
|
|
|
def test_Sequential_extend(self):
|
|
l1 = nn.Linear(10, 20)
|
|
l2 = nn.Linear(20, 30)
|
|
l3 = nn.Linear(30, 40)
|
|
l4 = nn.Linear(40, 50)
|
|
n1 = nn.Sequential(l1, l2)
|
|
n2 = nn.Sequential(l3, l4)
|
|
n3 = nn.Sequential(l1, l2)
|
|
for l in n2:
|
|
n1.append(l)
|
|
n3.extend(n2)
|
|
self.assertEqual(n3, n1)
|
|
|
|
def test_ModuleList(self):
|
|
modules = [nn.ReLU(), nn.Linear(5, 5)]
|
|
module_list = nn.ModuleList(modules)
|
|
|
|
def check():
|
|
self.assertEqual(len(module_list), len(modules))
|
|
for m1, m2 in zip(modules, module_list):
|
|
self.assertIs(m1, m2)
|
|
for m1, m2 in zip(modules, module_list.children()):
|
|
self.assertIs(m1, m2)
|
|
for i in range(len(modules)):
|
|
self.assertIs(module_list[i], modules[i])
|
|
|
|
check()
|
|
modules += [nn.Conv2d(3, 4, 3)]
|
|
module_list += [modules[-1]]
|
|
check()
|
|
modules = modules + [nn.Conv2d(3, 4, 3, bias=False), nn.GELU()]
|
|
module_list = module_list + nn.ModuleList(modules[-2:])
|
|
check()
|
|
modules.insert(1, nn.Linear(3, 2))
|
|
module_list.insert(1, modules[1])
|
|
check()
|
|
modules.append(nn.Tanh())
|
|
module_list.append(modules[-1])
|
|
check()
|
|
next_modules = [nn.Linear(5, 5), nn.Sigmoid()]
|
|
modules.extend(next_modules)
|
|
module_list.extend(next_modules)
|
|
check()
|
|
modules[2] = nn.Conv2d(5, 3, 2)
|
|
module_list[2] = modules[2]
|
|
check()
|
|
modules[-1] = nn.Conv2d(5, 2, 1)
|
|
module_list[-1] = modules[-1]
|
|
check()
|
|
idx = torch.tensor(2, dtype=torch.int32)
|
|
modules[2] = nn.Conv2d(5, 3, 2)
|
|
module_list[idx] = modules[2]
|
|
self.assertIs(module_list[idx], modules[2])
|
|
check()
|
|
self.assertEqual(module_list[1:], nn.ModuleList(modules[1:]))
|
|
self.assertEqual(module_list[3:], nn.ModuleList(modules[3:]))
|
|
self.assertEqual(module_list[:-1], nn.ModuleList(modules[:-1]))
|
|
self.assertEqual(module_list[:-3], nn.ModuleList(modules[:-3]))
|
|
self.assertEqual(module_list[::-1], nn.ModuleList(modules[::-1]))
|
|
del module_list[-1]
|
|
self.assertEqual(module_list, nn.ModuleList(modules[:-1]))
|
|
del module_list[1::2]
|
|
self.assertEqual(module_list, nn.ModuleList(modules[:-1][0::2]))
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_list += nn.ReLU()
|
|
with self.assertRaises(TypeError):
|
|
module_list.extend(nn.ReLU())
|
|
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 2)
|
|
l4 = nn.Linear(2, 3)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(
|
|
OrderedDict([
|
|
("layer1", l1),
|
|
("layer2", l2),
|
|
("layer3", l3),
|
|
("layer4", l4),
|
|
("subnet_layer", subnet)
|
|
])
|
|
)
|
|
modules = list(s.modules())
|
|
module_list = nn.ModuleList()
|
|
module_list.extend(s.modules())
|
|
check()
|
|
|
|
modules = [nn.ReLU(), nn.Linear(5, 5), nn.Conv2d(3, 4, 3)]
|
|
module_list = nn.ModuleList(modules)
|
|
self.assertEqual(modules.pop(1), module_list.pop(1))
|
|
self.assertEqual(modules, module_list)
|
|
# check order of the index
|
|
for k, mod in zip(range(len(module_list)), module_list):
|
|
self.assertIs(module_list[k], mod)
|
|
|
|
# verify the right exception is thrown when trying to "forward" through a ModuleList
|
|
self.assertRaises(NotImplementedError, module_list)
|
|
self.assertRaises(NotImplementedError, module_list, torch.rand(1, 3))
|
|
|
|
def test_ModuleDict(self):
|
|
modules = OrderedDict([
|
|
('act', nn.ReLU()),
|
|
('conv', nn.Conv2d(10, 10, 5)),
|
|
('fc', nn.Linear(5, 5)),
|
|
])
|
|
|
|
module_dict = nn.ModuleDict(modules)
|
|
|
|
def check():
|
|
self.assertEqual(len(module_dict), len(modules))
|
|
for k1, m2 in zip(modules, module_dict.children()):
|
|
self.assertIs(modules[k1], m2)
|
|
for k1, k2 in zip(modules, module_dict):
|
|
self.assertIs(modules[k1], module_dict[k2])
|
|
for k in module_dict:
|
|
self.assertIs(module_dict[k], modules[k])
|
|
for k in module_dict.keys():
|
|
self.assertIs(module_dict[k], modules[k])
|
|
for k, v in module_dict.items():
|
|
self.assertIs(modules[k], v)
|
|
for k1, m2 in zip(modules, module_dict.values()):
|
|
self.assertIs(modules[k1], m2)
|
|
for k in modules.keys():
|
|
self.assertTrue(k in module_dict)
|
|
check()
|
|
|
|
modules['conv'] = nn.Conv2d(3, 4, 3)
|
|
module_dict['conv'] = modules['conv']
|
|
check()
|
|
|
|
next_modules = [
|
|
('fc2', nn.Linear(5, 5)),
|
|
('act', nn.Sigmoid()),
|
|
]
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = OrderedDict([
|
|
('fc3', nn.Linear(5, 5)),
|
|
('act2', nn.Sigmoid()),
|
|
])
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = {
|
|
'fc4': nn.Linear(5, 5),
|
|
'act3': nn.Sigmoid()
|
|
}
|
|
modules.update(next_modules.items())
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
next_modules = nn.ModuleDict([
|
|
('fc5', nn.Linear(5, 5)),
|
|
('act4', nn.Sigmoid()),
|
|
])
|
|
modules.update(next_modules)
|
|
module_dict.update(next_modules)
|
|
check()
|
|
|
|
del module_dict['fc']
|
|
del modules['fc']
|
|
check()
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict.update(nn.ReLU())
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict.update([nn.ReLU()])
|
|
|
|
with self.assertRaises(ValueError):
|
|
module_dict.update([[nn.ReLU()]])
|
|
|
|
with self.assertRaises(TypeError):
|
|
module_dict[1] = nn.ReLU()
|
|
|
|
s = nn.Sequential(modules)
|
|
module_dict = nn.ModuleDict(s.named_children())
|
|
check()
|
|
|
|
c = module_dict.pop('conv')
|
|
self.assertIs(c, modules['conv'])
|
|
modules.pop('conv')
|
|
check()
|
|
|
|
module_dict.clear()
|
|
self.assertEqual(len(module_dict), 0)
|
|
modules.clear()
|
|
check()
|
|
|
|
# verify the right exception is thrown when trying to "forward" through a ModuleDict
|
|
self.assertRaises(NotImplementedError, module_dict)
|
|
self.assertRaises(NotImplementedError, module_dict, torch.rand(1, 3))
|
|
|
|
@skipIfTorchDynamo()
|
|
def test_ParameterList(self):
|
|
def make_param():
|
|
return Parameter(torch.randn(2, 2))
|
|
parameters = [make_param(), make_param()]
|
|
param_list = nn.ParameterList(parameters)
|
|
|
|
def check():
|
|
self.assertEqual(len(parameters), len(param_list))
|
|
for p1, p2 in zip(parameters, param_list):
|
|
self.assertIs(p1, p2)
|
|
for p1, p2 in zip(filter(lambda x: isinstance(x, Parameter), parameters), param_list.parameters()):
|
|
self.assertIs(p1, p2)
|
|
for i in range(len(parameters)):
|
|
self.assertIs(parameters[i], param_list[i])
|
|
|
|
check()
|
|
parameters += [make_param()]
|
|
param_list += [parameters[-1]]
|
|
check()
|
|
parameters.append(make_param())
|
|
param_list.append(parameters[-1])
|
|
check()
|
|
next_params = [make_param(), make_param()]
|
|
parameters.extend(next_params)
|
|
param_list.extend(next_params)
|
|
check()
|
|
parameters[2] = make_param()
|
|
param_list[2] = parameters[2]
|
|
check()
|
|
parameters[-1] = make_param()
|
|
param_list[-1] = parameters[-1]
|
|
check()
|
|
idx = torch.tensor(2, dtype=torch.int32)
|
|
parameters[2] = make_param()
|
|
param_list[idx] = parameters[2]
|
|
self.assertIs(param_list[idx], parameters[2])
|
|
check()
|
|
self.assertEqual(param_list[1:], nn.ParameterList(parameters[1:]))
|
|
self.assertEqual(param_list[3:], nn.ParameterList(parameters[3:]))
|
|
self.assertEqual(param_list[:-1], nn.ParameterList(parameters[:-1]))
|
|
self.assertEqual(param_list[:-3], nn.ParameterList(parameters[:-3]))
|
|
self.assertEqual(param_list[::-1], nn.ParameterList(parameters[::-1]))
|
|
|
|
with self.assertRaises(TypeError):
|
|
param_list += make_param()
|
|
with self.assertRaises(TypeError):
|
|
param_list.extend(make_param())
|
|
|
|
l1 = nn.Linear(1, 2)
|
|
l2 = nn.Linear(2, 3)
|
|
l3 = nn.Linear(3, 2)
|
|
l4 = nn.Linear(2, 3)
|
|
subnet = nn.Sequential(l3, l4)
|
|
s = nn.Sequential(
|
|
OrderedDict([
|
|
("layer1", l1),
|
|
("layer2", l2),
|
|
("layer3", l3),
|
|
("layer4", l4),
|
|
("subnet_layer", subnet)
|
|
])
|
|
)
|
|
parameters = list(s.parameters())
|
|
param_list = nn.ParameterList()
|
|
param_list.extend(s.parameters())
|
|
check()
|
|
|
|
param_list.append(torch.rand(2, 2))
|
|
self.assertIsInstance(param_list[-1], Parameter)
|
|
parameters.append(param_list[-1])
|
|
|
|
param_list.extend([torch.rand(2, 2), "foo"])
|
|
self.assertIsInstance(param_list[-2], Parameter)
|
|
self.assertIsInstance(param_list[-1], str)
|
|
parameters.extend(param_list[-2:])
|
|
|
|
param_list += ["bar", torch.rand(2, 2)]
|
|
self.assertIsInstance(param_list[-2], str)
|
|
self.assertIsInstance(param_list[-1], Parameter)
|
|
parameters += param_list[-2:]
|
|
check()
|
|
|
|
def test_ParameterList_meta(self):
|
|
p = torch.nn.Parameter(torch.empty(1, device='meta'))
|
|
self.assertExpectedInline(str(p), """\
|
|
Parameter containing:
|
|
tensor(..., device='meta', size=(1,), requires_grad=True)""")
|
|
pl = torch.nn.ParameterList([p])
|
|
self.assertExpectedInline(str(pl), """ParameterList( (0): Parameter containing: [torch.float32 of size 1])""")
|
|
|
|
def test_ParameterList_replication(self):
|
|
# The actual replication code from DP cannot be used on CPU so doing it manually here
|
|
def make_param():
|
|
return Parameter(torch.randn(2, 2))
|
|
parameters = [make_param(), make_param()]
|
|
param_list = nn.ParameterList(parameters)
|
|
|
|
new_param_list = param_list._replicate_for_data_parallel()
|
|
|
|
for n, p in param_list.named_parameters():
|
|
# Do a view here so that we can check the base later
|
|
setattr(new_param_list, n, p.view_as(p))
|
|
|
|
for p, p2 in zip(param_list, new_param_list):
|
|
self.assertEqual(p, p2)
|
|
self.assertIsNotNone(p2.grad_fn)
|
|
self.assertIs(p2._base, p)
|
|
|
|
def test_ParameterDict(self):
|
|
parameters = OrderedDict([
|
|
('p1', Parameter(torch.randn(10, 10))),
|
|
('p2', Parameter(torch.randn(10, 10))),
|
|
('p3', Parameter(torch.randn(10, 10))),
|
|
])
|
|
|
|
parameter_dict = nn.ParameterDict(parameters)
|
|
|
|
def check():
|
|
self.assertEqual(len(parameter_dict), len(parameters))
|
|
for i, (k1, (k2, m2)) in enumerate(zip(parameters, parameter_dict.named_parameters())):
|
|
self.assertEqual(k1, k2)
|
|
self.assertIs(parameters[k1], m2)
|
|
for k1, k2 in zip(parameters, parameter_dict):
|
|
self.assertIs(parameters[k1], parameter_dict[k2])
|
|
for k in parameter_dict:
|
|
self.assertIs(parameter_dict[k], parameters[k])
|
|
for k in parameter_dict.keys():
|
|
self.assertIs(parameter_dict[k], parameters[k])
|
|
for k, v in parameter_dict.items():
|
|
self.assertIs(v, parameters[k])
|
|
for k1, m2 in zip(parameters, parameter_dict.values()):
|
|
self.assertIs(parameters[k1], m2)
|
|
for k in parameters.keys():
|
|
self.assertTrue(k in parameter_dict)
|
|
|
|
check()
|
|
|
|
parameters['p4'] = Parameter(torch.randn(10, 10))
|
|
parameter_dict['p4'] = parameters['p4']
|
|
check()
|
|
|
|
next_parameters = [
|
|
('p5', Parameter(torch.randn(10, 10))),
|
|
('p2', Parameter(torch.randn(10, 10))),
|
|
]
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = OrderedDict([
|
|
('p6', Parameter(torch.randn(10, 10))),
|
|
('p5', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = {
|
|
'p8': Parameter(torch.randn(10, 10)),
|
|
'p7': Parameter(torch.randn(10, 10))
|
|
}
|
|
parameters.update(sorted(next_parameters.items()))
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
next_parameters = nn.ParameterDict([
|
|
('p10', Parameter(torch.randn(10, 10))),
|
|
('p9', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameters.update(next_parameters)
|
|
parameter_dict.update(next_parameters)
|
|
check()
|
|
|
|
del parameter_dict['p3']
|
|
del parameters['p3']
|
|
check()
|
|
|
|
with self.assertRaises(TypeError):
|
|
parameter_dict.update(1)
|
|
|
|
with self.assertRaises(TypeError):
|
|
parameter_dict.update([1])
|
|
|
|
with self.assertRaises(ValueError):
|
|
parameter_dict.update(Parameter(torch.randn(10, 10)))
|
|
|
|
p_pop = parameter_dict.pop('p4')
|
|
self.assertIs(p_pop, parameters['p4'])
|
|
parameters.pop('p4')
|
|
check()
|
|
|
|
# Check reverse works
|
|
forward = list(iter(parameter_dict))
|
|
backward = list(reversed(parameter_dict))
|
|
self.assertEqual(len(forward), len(backward))
|
|
n = len(forward)
|
|
for i in range(n):
|
|
self.assertIs(forward[i], backward[n - i - 1])
|
|
check()
|
|
|
|
# Check copy works
|
|
copy = parameter_dict.copy()
|
|
|
|
# Check all keys are present and have shallow copied values
|
|
for key in parameter_dict:
|
|
self.assertTrue(key in copy)
|
|
self.assertEqual(parameter_dict[key], copy[key])
|
|
self.assertIs(parameter_dict[key], copy[key])
|
|
check()
|
|
|
|
parameter_dict["p20"] = Parameter(torch.randn(10, 10))
|
|
copy["p21"] = Parameter(torch.randn(9, 10))
|
|
|
|
self.assertTrue("p20" in parameter_dict)
|
|
self.assertFalse("p20" in copy)
|
|
self.assertFalse("p21" in parameter_dict)
|
|
self.assertTrue("p21" in copy)
|
|
parameter_dict.pop("p20")
|
|
check()
|
|
|
|
p = Parameter(torch.randn(10, 10))
|
|
parameter_dict['p12'] = p
|
|
p_popitem = parameter_dict.popitem()
|
|
self.assertEqual(p_popitem[0], 'p12')
|
|
self.assertIs(p_popitem[1], p)
|
|
check()
|
|
|
|
# Unit test for set_default
|
|
# 1. Ensure parameter is correctly inserted when
|
|
# the key is not present in `ParameterDict`
|
|
assert 'p11' not in parameter_dict
|
|
assert 'p11' not in parameters
|
|
parameters['p11'] = Parameter(torch.randn(10, 10))
|
|
p_setdefault = parameter_dict.setdefault('p11', parameters['p11'])
|
|
self.assertIs(p_setdefault, parameters['p11'])
|
|
self.assertIs(p_setdefault, parameter_dict['p11'])
|
|
check()
|
|
# 2. Ensure parameter is NOT inserted when the
|
|
# key is already present in `ParameterDict`
|
|
p = Parameter(torch.randn(10, 10))
|
|
self.assertFalse(parameter_dict.setdefault('p11', p) is p)
|
|
check()
|
|
# 3. Ensure `None` is inserted when the key is not
|
|
# present in `Parameter` and parameter is not specified
|
|
self.assertIs(parameter_dict.setdefault('p26'), None)
|
|
del parameter_dict['p26']
|
|
check()
|
|
|
|
parameters2 = OrderedDict([
|
|
('p13', Parameter(torch.randn(10, 10))),
|
|
('p2', Parameter(torch.randn(10, 10))),
|
|
('p3', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameter_dict2 = nn.ParameterDict(parameters2)
|
|
parameters.update(parameters2)
|
|
parameter_dict |= parameter_dict2
|
|
check()
|
|
|
|
parameters2 = OrderedDict()
|
|
parameter_dict2 = nn.ParameterDict(parameters2)
|
|
parameters.update(parameters2)
|
|
parameter_dict |= parameter_dict2
|
|
check()
|
|
|
|
parameters2 = OrderedDict([
|
|
('p14', Parameter(torch.randn(10, 10))),
|
|
('p15', Parameter(torch.randn(10, 10))),
|
|
('p13', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameter_dict2 = nn.ParameterDict(parameters2)
|
|
parameters.update(parameters2)
|
|
parameter_dict |= parameter_dict2
|
|
check()
|
|
|
|
# Check __or__ and __ror__ works
|
|
parameters2 = OrderedDict([
|
|
('p20', Parameter(torch.randn(10, 10))),
|
|
('p21', Parameter(torch.randn(10, 10))),
|
|
('p22', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameter_dict2 = nn.ParameterDict(parameters2)
|
|
parameters.update(parameters2)
|
|
parameter_dict = parameter_dict | parameter_dict2
|
|
check()
|
|
|
|
parameters2 = OrderedDict([
|
|
('p23', Parameter(torch.randn(10, 10))),
|
|
('p24', Parameter(torch.randn(10, 10))),
|
|
('p25', Parameter(torch.randn(10, 10))),
|
|
])
|
|
parameter_dict2 = nn.ParameterDict(parameters2)
|
|
parameters2.update(parameters)
|
|
parameters = parameters2
|
|
parameter_dict = parameter_dict2 | parameter_dict
|
|
check()
|
|
|
|
parameters['p17'] = Parameter(torch.randn(10, 10))
|
|
parameter_dict['p17'] = parameters['p17']
|
|
self.assertIs(parameters['p17'], parameter_dict.get('p17'))
|
|
temp_param = Parameter(torch.randn(10, 10))
|
|
self.assertIs(parameters['p17'], parameter_dict.get('p17', temp_param))
|
|
self.assertIs(None, parameter_dict.get('p18'))
|
|
self.assertIs(temp_param, parameter_dict.get('p18', temp_param))
|
|
check()
|
|
|
|
parameter_dict.clear()
|
|
self.assertEqual(len(parameter_dict), 0)
|
|
parameters.clear()
|
|
check()
|
|
|
|
parameter_dict2 = parameter_dict.fromkeys(['p19', 'p20'])
|
|
self.assertEqual({'p19': None, 'p20': None}, parameter_dict2)
|
|
check()
|
|
|
|
parameter_dict2 = parameter_dict.fromkeys(['p19', 'p20'], temp_param)
|
|
self.assertEqual({'p19': temp_param, 'p20': temp_param}, parameter_dict2)
|
|
check()
|
|
|
|
parameter_dict['p21'] = torch.rand(2, 2)
|
|
self.assertIsInstance(parameter_dict['p21'], Parameter)
|
|
parameters['p21'] = parameter_dict['p21']
|
|
|
|
parameter_dict.update({'p22': torch.rand(2, 2), 'foo': 'bar'})
|
|
self.assertIsInstance(parameter_dict['p22'], Parameter)
|
|
self.assertIsInstance(parameter_dict['foo'], str)
|
|
parameters['p22'] = parameter_dict['p22']
|
|
parameters['foo'] = parameter_dict['foo']
|
|
|
|
def test_ParameterDict_replication(self):
|
|
# The actual replication code from DP cannot be used on CPU so doing it manually here
|
|
def make_param():
|
|
return Parameter(torch.randn(2, 2))
|
|
parameters = {"foo": make_param(), "bar": make_param()}
|
|
param_dict = nn.ParameterDict(parameters)
|
|
|
|
new_param_dict = param_dict._replicate_for_data_parallel()
|
|
|
|
for n, p in param_dict.named_parameters():
|
|
# Do a view here so that we can check the base later
|
|
setattr(new_param_dict, n, p.view_as(p))
|
|
|
|
for (k, p), (k2, p2) in zip(param_dict.items(), new_param_dict.items()):
|
|
self.assertEqual(k, k2)
|
|
self.assertEqual(p, p2)
|
|
self.assertIsNotNone(p2.grad_fn)
|
|
self.assertIs(p2._base, p)
|
|
|
|
self.assertEqual(param_dict["foo"], new_param_dict["foo"])
|
|
|
|
def test_add_module(self):
|
|
methods_to_test = ['add_module', 'register_module']
|
|
for fn in methods_to_test:
|
|
l = nn.Linear(10, 20)
|
|
net = nn.Module()
|
|
net.l = l
|
|
net.l2 = l
|
|
getattr(net, fn)('empty', None)
|
|
self.assertEqual(net.l, l)
|
|
self.assertEqual(net.l2, l)
|
|
self.assertEqual(net.empty, None)
|
|
getattr(net, fn)('l3', l)
|
|
self.assertEqual(net.l3, l)
|
|
l3 = nn.Linear(20, 10)
|
|
getattr(net, fn)('l', l3)
|
|
self.assertEqual(net.l, l3)
|
|
self.assertRaises(TypeError, lambda: getattr(net, fn)('x', 'non-module'))
|
|
self.assertRaisesRegex(TypeError, 'module name should be a string. Got int',
|
|
lambda: getattr(net, fn)(1, l))
|
|
self.assertRaisesRegex(TypeError, 'module name should be a string. Got NoneType',
|
|
lambda: getattr(net, fn)(None, l))
|
|
|
|
def test_set_submodule(self):
|
|
net = nn.Module()
|
|
net.t = nn.Module()
|
|
l = nn.Linear(1, 2)
|
|
target = "t.l"
|
|
net.set_submodule(target, l)
|
|
self.assertEqual(net.get_submodule(target), l)
|
|
l2 = nn.Linear(2, 1)
|
|
net.set_submodule(target, l2)
|
|
self.assertEqual(net.get_submodule(target), l2)
|
|
self.assertRaises(ValueError, net.set_submodule, "", l)
|
|
self.assertRaises(AttributeError, net.set_submodule, "a.l", l)
|
|
|
|
def test_module_to_argparse(self):
|
|
net = nn.Sequential(nn.Linear(3, 3))
|
|
cpu = torch.device('cpu')
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(torch.long)
|
|
with self.assertRaises(TypeError):
|
|
net.to(None, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, torch.long, True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, dtype=torch.long, non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to([])
|
|
with self.assertRaises(TypeError):
|
|
net.to({}, non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(torch.tensor(3, dtype=torch.long), non_blocking=True)
|
|
with self.assertRaises(TypeError):
|
|
net.to(cpu, torch.tensor(3, dtype=torch.long), non_blocking=True)
|
|
|
|
def test_RNN_nonlinearity(self):
|
|
rnn = torch.nn.RNN(1, 10)
|
|
self.assertEqual(rnn.nonlinearity, 'tanh')
|
|
|
|
rnn = torch.nn.RNN(1, 10, nonlinearity='relu')
|
|
self.assertEqual(rnn.nonlinearity, 'relu')
|
|
|
|
with self.assertRaisesRegex(ValueError, 'Unknown nonlinearity'):
|
|
rnn = torch.nn.RNN(1, 10, nonlinearity='garbage')
|
|
|
|
def test_RNN_nonlinearity_passed_as_arg(self):
|
|
rnn = torch.nn.RNN(2, 3, 1, 'relu')
|
|
self.assertEqual(rnn.nonlinearity, 'relu')
|
|
|
|
def test_module_apply_inplace_op(self):
|
|
def add_one_inplace(t):
|
|
return t.add_(1.0)
|
|
|
|
# Test that applying an in-place operation to a module would bump
|
|
# the module's parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
pvm = m.weight.mul(m.weight)
|
|
m_weight_version_saved = m.weight._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(m.weight._version, m_weight_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pvm.backward(torch.randn(10, 20))
|
|
|
|
# Test that applying an in-place operation to a module would bump
|
|
# the module's parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
pgm = m.weight.grad.mul(m.weight.grad)
|
|
m_weight_grad_version_saved = m.weight.grad._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(m.weight.grad._version, m_weight_grad_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pgm.backward(torch.randn(10, 20))
|
|
|
|
def test_overwrite_module_params_on_conversion(self):
|
|
# Test that if the conversion function passed to `module._apply()`
|
|
# changes the TensorImpl type of `module`'s parameters, the `module`'s
|
|
# parameters are always overwritten, regardless of the value of
|
|
# `torch.__future__.get_overwrite_module_params_on_conversion()`.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20)
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m = m._apply(lambda t: torch.sparse_coo_tensor(torch.zeros([2, 1]), torch.ones([1]), torch.Size([10, 20])))
|
|
self.assertNotEqual(weight_ref.layout, m.weight.layout)
|
|
self.assertNotEqual(weight_grad_ref.layout, m.weight.grad.layout)
|
|
|
|
# Test that under the current default settings
|
|
# (`torch.__future__.get_overwrite_module_params_on_conversion() == False`),
|
|
# a view to a module's parameters is not pointing to the same storage as
|
|
# its base variable after converting the module to a different dtype.
|
|
m = nn.Linear(20, 10).float()
|
|
mw = m.weight[:]
|
|
m.double()
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0].dtype == torch.float)
|
|
self.assertTrue(mw._base[0][0].dtype == torch.double)
|
|
|
|
try:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(True)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# a view to a module's parameters is still pointing to the same storage as
|
|
# its base variable after converting the module to a different dtype.
|
|
m = nn.Linear(20, 10).float()
|
|
mw = m.weight[:]
|
|
m.double()
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0] == mw._base[0][0])
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# `float_module.double()` doesn't preserve previous references to
|
|
# `float_module`'s parameters or gradients.
|
|
m = nn.Linear(20, 10).float()
|
|
m.weight.grad = torch.randn(10, 20).float()
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m.double()
|
|
self.assertNotEqual(weight_ref.dtype, m.weight.dtype)
|
|
self.assertNotEqual(weight_grad_ref.dtype, m.weight.grad.dtype)
|
|
|
|
def add_one_inplace(t):
|
|
return t.add_(1.0)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an in-place operation to a module would bump the module's
|
|
# original parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
pvm = m.weight.mul(m.weight)
|
|
weight_ref = m.weight
|
|
m_weight_version_saved = weight_ref._version
|
|
m = m._apply(add_one_inplace)
|
|
# Test that the in-place operation bumps the original parameter's version counter
|
|
self.assertGreater(weight_ref._version, m_weight_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pvm.backward(torch.randn(10, 20))
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an in-place operation to a module would bump the module's
|
|
# original parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
pgm = m.weight.grad.mul(m.weight.grad)
|
|
weight_grad_ref = m.weight.grad
|
|
m_weight_grad_version_saved = weight_grad_ref._version
|
|
m = m._apply(add_one_inplace)
|
|
self.assertGreater(weight_grad_ref._version, m_weight_grad_version_saved)
|
|
with self.assertRaisesRegex(RuntimeError, "modified by an inplace operation"):
|
|
pgm.backward(torch.randn(10, 20))
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an out-of-place operation to a module doesn't bump
|
|
# the module's original parameters' version counter.
|
|
m = nn.Linear(20, 10)
|
|
weight_ref = m.weight
|
|
m_weight_version_saved = weight_ref._version
|
|
m = m._apply(lambda t: torch.randn(t.shape))
|
|
self.assertEqual(weight_ref._version, m_weight_version_saved)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# applying an out-of-place operation to a module doesn't bump
|
|
# the module's original parameters' gradients' version counter.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20).requires_grad_()
|
|
weight_grad_ref = m.weight.grad
|
|
m_weight_grad_version_saved = weight_grad_ref._version
|
|
m = m._apply(lambda t: torch.randn(t.shape))
|
|
self.assertEqual(weight_grad_ref._version, m_weight_grad_version_saved)
|
|
finally:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(False)
|
|
|
|
def test_swap_module_params_poisons_acc_grad(self):
|
|
try:
|
|
torch.__future__.set_swap_module_params_on_conversion(True)
|
|
# (1) backward cannot be run after _apply
|
|
# forward will init AccumulateGrad nodes, which bumps use_count of parameters' at::Tensors
|
|
# additionally, if any Tensors are saved for backward, their use_count will be bumped
|
|
m = torch.nn.Linear(2, 3)
|
|
inp = torch.randn(2, 2)
|
|
out = m(inp)
|
|
m.half()
|
|
self.assertTrue(all(p.dtype == torch.float16 for p in m.parameters()))
|
|
with self.assertRaisesRegex(RuntimeError, "Trying to execute AccumulateGrad node that was poisoned by swap_tensors"):
|
|
out.sum().backward()
|
|
# (2) _apply can be run after backward()
|
|
# After running backward, all the references generated by "save for backward" will be cleared
|
|
# So the use_count will be 2 (1 from Tensor itself, and 1 from AccumulateGrad node), swap_tensors
|
|
# should allow this.
|
|
inp2 = torch.randn(2, 2, dtype=torch.half)
|
|
out2 = m(inp2)
|
|
out2.sum().backward()
|
|
m.float()
|
|
self.assertTrue(all(p.dtype == torch.float32 for p in m.parameters()))
|
|
out3 = m(inp)
|
|
finally:
|
|
torch.__future__.set_swap_module_params_on_conversion(False)
|
|
|
|
def test_type(self):
|
|
l = nn.Linear(10, 20)
|
|
net = nn.Module()
|
|
net.l = l
|
|
net.l2 = l
|
|
net.add_module('empty', None)
|
|
net.indices = Buffer(torch.LongTensor(1))
|
|
net.float()
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.double()
|
|
self.assertIsInstance(l.weight.data, torch.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.DoubleTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to(torch.half)
|
|
self.assertIsInstance(l.weight.data, torch.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
if TEST_CUDA:
|
|
net.float().cuda()
|
|
self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.cpu()
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to("cuda", torch.double, True)
|
|
self.assertIsInstance(l.weight.data, torch.cuda.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.DoubleTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.to(torch.empty(1, device="cuda:0", dtype=torch.half))
|
|
self.assertIsInstance(l.weight.data, torch.cuda.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.cuda.LongTensor)
|
|
net.to(torch.device("cpu"), non_blocking=True)
|
|
self.assertIsInstance(l.weight.data, torch.HalfTensor)
|
|
self.assertIsInstance(l.bias.data, torch.HalfTensor)
|
|
self.assertIsInstance(net.indices, torch.LongTensor)
|
|
net.to(torch.float)
|
|
self.assertIsInstance(l.weight.data, torch.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.FloatTensor)
|
|
net.to(torch.DoubleTensor(1))
|
|
self.assertIsInstance(l.weight.data, torch.DoubleTensor)
|
|
self.assertIsInstance(l.bias.data, torch.DoubleTensor)
|
|
if TEST_CUDA:
|
|
net.to(device='cuda', dtype=torch.float)
|
|
self.assertIsInstance(l.weight.data, torch.cuda.FloatTensor)
|
|
self.assertIsInstance(l.bias.data, torch.cuda.FloatTensor)
|
|
|
|
def test_non_leaf_parameters(self):
|
|
l1 = nn.Linear(10, 10)
|
|
l2 = nn.Linear(10, 10)
|
|
|
|
def assign_weight():
|
|
l2.weight = l1.weight + 2
|
|
|
|
self.assertRaises(TypeError, assign_weight)
|
|
# This should work though
|
|
l2.weight = Parameter(torch.randn(10, 10))
|
|
|
|
def test_parameters_to_vector(self):
|
|
conv1 = nn.Conv2d(3, 10, 5)
|
|
fc1 = nn.Linear(10, 20)
|
|
model = nn.Sequential(conv1, fc1)
|
|
|
|
vec = parameters_to_vector(model.parameters())
|
|
self.assertEqual(vec.size(0), 980)
|
|
|
|
def test_vector_to_parameters(self):
|
|
conv1 = nn.Conv2d(3, 10, 5)
|
|
fc1 = nn.Linear(10, 20)
|
|
model = nn.Sequential(conv1, fc1)
|
|
|
|
vec = torch.arange(0., 980)
|
|
vector_to_parameters(vec, model.parameters())
|
|
|
|
sample = next(model.parameters())[0, 0, 0]
|
|
self.assertTrue(torch.equal(sample.data, vec.data[:5]))
|
|
|
|
def test_rnn_weight_norm(self):
|
|
def check_weight_norm(l, name, num_params):
|
|
# This Module has 4 or 5 parameters called:
|
|
# 'weight_ih_l0', 'weight_hh_l0', 'bias_ih_l0', 'bias_hh_l0', weight_hr_l0
|
|
|
|
# Applying weight norm on one of them causes it to become a tensor
|
|
l = torch.nn.utils.weight_norm(l, name=name)
|
|
self.assertEqual(
|
|
sum(isinstance(p, torch.nn.Parameter) for p in l._flat_weights),
|
|
num_params - 1,
|
|
)
|
|
|
|
# Removing the weight norm reparametrization restores the Parameter
|
|
l = torch.nn.utils.remove_weight_norm(l, name=name)
|
|
self.assertEqual(
|
|
sum(isinstance(p, torch.nn.Parameter) for p in l._flat_weights),
|
|
num_params,
|
|
)
|
|
|
|
# Make sure that, upon removal of the reparametrization, the
|
|
# `._parameters` and `.named_parameters` contain the right params.
|
|
# Specifically, the original weight ('weight_ih_l0') should be placed
|
|
# back in the parameters, while the reparametrization components
|
|
# ('weight_ih_l0_v' and 'weight_ih_l0_g') should be removed.
|
|
self.assertTrue(name in l._parameters)
|
|
self.assertIsNotNone(l._parameters[name])
|
|
self.assertTrue(name + '_v' not in l._parameters)
|
|
self.assertTrue(name + '_g' not in l._parameters)
|
|
self.assertTrue(name in dict(l.named_parameters()))
|
|
self.assertIsNotNone(dict(l.named_parameters())[name])
|
|
self.assertTrue(name + '_v' not in dict(l.named_parameters()))
|
|
self.assertTrue(name + '_g' not in dict(l.named_parameters()))
|
|
|
|
check_weight_norm(torch.nn.LSTM(32, 32), 'weight_ih_l0', 4)
|
|
check_weight_norm(torch.nn.LSTM(32, 32, proj_size=16), 'weight_hr_l0', 5)
|
|
|
|
|
|
def test_weight_norm(self):
|
|
for dtype in [torch.float, torch.bfloat16]:
|
|
input = torch.randn(3, 4, dtype=dtype)
|
|
m = nn.Linear(4, 5).to(dtype=dtype)
|
|
expected_output = m(input)
|
|
|
|
# add weight normalization
|
|
m = torch.nn.utils.weight_norm(m)
|
|
self.assertEqual(m.weight_v.size(), m.weight.size())
|
|
self.assertEqual(m.weight_g.size(), (5, 1))
|
|
self.assertEqual(m(input), expected_output, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
# remove weight norm
|
|
m = torch.nn.utils.remove_weight_norm(m)
|
|
self.assertFalse(hasattr(m, 'weight_g'))
|
|
self.assertFalse(hasattr(m, 'weight_v'))
|
|
self.assertEqual(m(input), expected_output, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
# test with dim=1
|
|
m = torch.nn.utils.weight_norm(m, dim=1)
|
|
self.assertEqual(m.weight_v.size(), m.weight.size())
|
|
self.assertEqual(m.weight_g.size(), (1, 4))
|
|
self.assertEqual(m(input), expected_output, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
|
|
# test with dim=None
|
|
m = nn.Linear(4, 5).to(dtype=dtype)
|
|
expected_output = m(input)
|
|
m = torch.nn.utils.weight_norm(m, dim=None)
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'register two weight_norm hooks'):
|
|
m = torch.nn.utils.weight_norm(m)
|
|
m = torch.nn.utils.weight_norm(m)
|
|
|
|
# For float16, the forward of the Module doesn't work but we must still be able
|
|
# to register the weight norm as this is often done before sending the Module to
|
|
# CUDA.
|
|
m = nn.Linear(4, 5, dtype=torch.float16)
|
|
m = torch.nn.utils.weight_norm(m)
|
|
|
|
def test_parameterlistdict_setting_attributes(self):
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod.train()
|
|
mod.eval()
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
mod.train()
|
|
mod.eval()
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
def test_parameterlistdict_pickle(self):
|
|
m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
# Test whether loading from older checkpoints works without triggering warnings
|
|
m = nn.ParameterList(map(nn.Parameter, [torch.rand(2), torch.rand(2)]))
|
|
del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
# Test whether loading from older checkpoints works without triggering warnings
|
|
m = nn.ParameterDict({"a": nn.Parameter(torch.rand(2)), "b": nn.Parameter(torch.rand(2))})
|
|
del m._forward_pre_hooks, m._state_dict_hooks, m._load_state_dict_pre_hooks, m._non_persistent_buffers_set
|
|
with warnings.catch_warnings(record=True) as w:
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertTrue(len(w) == 0)
|
|
|
|
def test_weight_norm_pickle(self):
|
|
m = torch.nn.utils.weight_norm(nn.Linear(5, 7))
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertIsInstance(m, nn.Linear)
|
|
|
|
@skipIfTorchDynamo("TorchDynamo fails here for unknown reasons")
|
|
@set_default_dtype(torch.double)
|
|
def test_spectral_norm(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
|
|
self.assertEqual(m.weight_u.size(), torch.Size([m.weight.size(0)]))
|
|
# weight_orig should be trainable
|
|
self.assertTrue(hasattr(m, 'weight_orig'))
|
|
self.assertTrue('weight_orig' in m._parameters)
|
|
# weight_u should be just a reused buffer
|
|
self.assertTrue(hasattr(m, 'weight_u'))
|
|
self.assertTrue('weight_u' in m._buffers)
|
|
self.assertTrue('weight_v' in m._buffers)
|
|
# weight should be a plain attribute, not counted as a buffer or a param
|
|
self.assertFalse('weight' in m._buffers)
|
|
self.assertFalse('weight' in m._parameters)
|
|
# it should also be sharing storage as `weight_orig`
|
|
self.assertEqual(m.weight_orig.storage(), m.weight.storage())
|
|
self.assertEqual(m.weight_orig.size(), m.weight.size())
|
|
self.assertEqual(m.weight_orig.stride(), m.weight.stride())
|
|
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertFalse(hasattr(m, 'weight_orig'))
|
|
self.assertFalse(hasattr(m, 'weight_u'))
|
|
# weight should be converted back as a parameter
|
|
self.assertTrue(hasattr(m, 'weight'))
|
|
self.assertTrue('weight' in m._parameters)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'register two spectral_norm hooks'):
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
|
|
# test correctness in training/eval modes and cpu/multi-gpu settings
|
|
for apply_dp in (True, False):
|
|
if apply_dp:
|
|
if not TEST_MULTIGPU:
|
|
continue
|
|
device = torch.device('cuda:0')
|
|
|
|
def maybe_wrap(m):
|
|
return torch.nn.DataParallel(m, [0, 1])
|
|
else:
|
|
device = torch.device('cpu')
|
|
|
|
def maybe_wrap(m):
|
|
return m
|
|
|
|
for requires_grad in (True, False):
|
|
m = nn.Linear(3, 4).to(device)
|
|
m.weight.requires_grad_(requires_grad)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
wrapped_m = maybe_wrap(m)
|
|
self.assertTrue(hasattr(m, 'weight_u'))
|
|
u0 = m.weight_u.clone()
|
|
v0 = m.weight_v.clone()
|
|
|
|
# TEST TRAINING BEHAVIOR
|
|
|
|
# assert that u and v are updated
|
|
input = torch.randn(2, 3, device=device)
|
|
out = wrapped_m(input)
|
|
self.assertNotEqual(u0, m.weight_u)
|
|
self.assertNotEqual(v0, m.weight_v)
|
|
|
|
# assert that backprop reaches weight_orig
|
|
# can't use gradcheck because the function changes as we
|
|
# activate through it in training mode
|
|
if requires_grad:
|
|
torch.autograd.grad(out.sum(), m.weight_orig)
|
|
|
|
# test backward works with multiple forwards
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = m.weight_u.clone()
|
|
saved_v = m.weight_v.clone()
|
|
|
|
def fn(input):
|
|
m.weight_u.data.copy_(saved_u)
|
|
m.weight_v.data.copy_(saved_v)
|
|
out0 = wrapped_m(input)
|
|
out1 = wrapped_m(input)
|
|
return out0 + out1
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),), check_batched_grad=False)
|
|
|
|
# test removing
|
|
pre_remove_out = wrapped_m(input)
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
for _ in range(3):
|
|
pre_remove_out = wrapped_m(input)
|
|
m = torch.nn.utils.remove_spectral_norm(m)
|
|
self.assertEqual(wrapped_m(input), pre_remove_out)
|
|
|
|
# TEST EVAL BEHAVIOR
|
|
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
wrapped_m(input)
|
|
last_train_out = wrapped_m(input)
|
|
last_train_u = m.weight_u.clone()
|
|
last_train_v = m.weight_v.clone()
|
|
wrapped_m.zero_grad()
|
|
wrapped_m.eval()
|
|
|
|
eval_out0 = wrapped_m(input)
|
|
# assert eval gives same result as last training iteration
|
|
self.assertEqual(eval_out0, last_train_out)
|
|
# assert doing more iteartion in eval don't change things
|
|
self.assertEqual(eval_out0, wrapped_m(input))
|
|
self.assertEqual(last_train_u, m.weight_u)
|
|
self.assertEqual(last_train_v, m.weight_v)
|
|
|
|
# FIXME: the code below is flaky when executed with DataParallel
|
|
# see https://github.com/pytorch/pytorch/issues/13818
|
|
if apply_dp:
|
|
continue
|
|
|
|
# test backward works with multiple forwards in mixed training
|
|
# and eval modes
|
|
# it uses training mode so we need to reset `u` and `v` vectors
|
|
# to same value at beginning for finite difference test to pass
|
|
saved_u = m.weight_u.clone()
|
|
saved_v = m.weight_v.clone()
|
|
|
|
def fn(input):
|
|
m.weight_u.data.copy_(saved_u)
|
|
m.weight_v.data.copy_(saved_v)
|
|
wrapped_m.train()
|
|
out0 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out1 = wrapped_m(input)
|
|
wrapped_m.train()
|
|
out2 = wrapped_m(input)
|
|
wrapped_m.eval()
|
|
out3 = wrapped_m(input)
|
|
return out0 + out1 + out2 + out3
|
|
|
|
gradcheck(fn, (input.clone().requires_grad_(),))
|
|
|
|
# assert that backprop reaches weight_orig in eval
|
|
if requires_grad:
|
|
def fn(weight):
|
|
return wrapped_m(input)
|
|
|
|
gradcheck(fn, (m.weight_orig,))
|
|
|
|
def test_groupnorm_nhwc(self):
|
|
def helper(self, size, groups, memory_format, is_mixed, device, dtype):
|
|
channels = size[1]
|
|
input = torch.randn(size, dtype=dtype, device=device, requires_grad=True)
|
|
input = input.contiguous(memory_format=memory_format)
|
|
input.retain_grad()
|
|
grad = torch.randn(size, dtype=dtype, device=device)
|
|
grad = grad.contiguous(memory_format=memory_format)
|
|
if dtype == torch.bfloat16 and is_mixed:
|
|
gn = nn.GroupNorm(groups, channels).to(device).to(torch.float)
|
|
else:
|
|
gn = nn.GroupNorm(groups, channels).to(device).to(dtype)
|
|
gn.weight.data.uniform_()
|
|
gn.bias.data.uniform_()
|
|
|
|
ref_input = input.detach().clone().contiguous(memory_format=torch.contiguous_format).requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous(memory_format=torch.contiguous_format)
|
|
if dtype == torch.bfloat16 and is_mixed:
|
|
ref_gn = nn.GroupNorm(groups, channels).to(device).to(torch.float)
|
|
else:
|
|
ref_gn = nn.GroupNorm(groups, channels).to(device).to(dtype)
|
|
ref_gn.load_state_dict(gn.state_dict())
|
|
out = gn(input)
|
|
out.backward(grad)
|
|
ref_out = ref_gn(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=memory_format))
|
|
print(f'{memory_format}')
|
|
self.assertTrue(ref_out.is_contiguous(memory_format=torch.contiguous_format))
|
|
|
|
self.assertEqual(out, ref_out)
|
|
# parameters in bfloat16/Half is not recommended
|
|
atol = 5e-4
|
|
rtol = 8e-3
|
|
|
|
self.assertEqual(gn.weight.grad, ref_gn.weight.grad, atol=atol, rtol=rtol)
|
|
self.assertEqual(gn.bias.grad, ref_gn.bias.grad, atol=atol, rtol=rtol)
|
|
self.assertEqual(input.grad, ref_input.grad, atol=atol, rtol=rtol)
|
|
|
|
for device in ['cpu'] + (['cuda'] if TEST_CUDA else []):
|
|
for dtype in [torch.float, torch.double]:
|
|
if device == 'cuda' and dtype not in [torch.float, torch.double]:
|
|
continue
|
|
for is_mixed in [True, False]:
|
|
helper(self, (4, 8, 10, 10), 4, torch.channels_last, is_mixed, device, dtype)
|
|
helper(self, (2, 30, 9, 9), 3, torch.channels_last, is_mixed, device, dtype)
|
|
helper(self, (4, 8, 40, 40), 4, torch.channels_last, is_mixed, device, dtype)
|
|
helper(self, (4, 40, 40, 40), 2, torch.channels_last, is_mixed, device, dtype)
|
|
helper(self, (2, 30, 50, 50), 3, torch.channels_last, is_mixed, device, dtype)
|
|
helper(self, (2, 60, 50, 50), 3, torch.channels_last, is_mixed, device, dtype)
|
|
|
|
# channels_last_3d is currently not supported for cuda
|
|
if device == 'cpu':
|
|
helper(self, (2, 9, 7, 11, 15), 3, torch.channels_last_3d, is_mixed, device, dtype)
|
|
helper(self, (2, 9, 7, 200, 15), 3, torch.channels_last_3d, is_mixed, device, dtype)
|
|
helper(self, (2, 60, 7, 200, 15), 3, torch.channels_last_3d, is_mixed, device, dtype)
|
|
|
|
@skipIfNoLapack
|
|
def test_spectral_norm_load_state_dict(self):
|
|
inp = torch.randn(2, 3)
|
|
for activate_times in (0, 3):
|
|
# Test backward compatibility
|
|
# At version None -> 1: weight becomes not a buffer and v vector becomes a buffer
|
|
m = nn.Linear(3, 5)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
snm.train()
|
|
for _ in range(activate_times):
|
|
snm(inp)
|
|
|
|
version_latest_ref_state_dict = deepcopy(snm.state_dict())
|
|
self.assertEqual({'weight_orig', 'bias', 'weight_u', 'weight_v'}, set(version_latest_ref_state_dict.keys()))
|
|
|
|
# test that non-strict loading works
|
|
non_strict_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
non_strict_state_dict['nonsense'] = 'nonsense'
|
|
with self.assertRaisesRegex(RuntimeError, r'Unexpected key\(s\) in state_dict: "nonsense"'):
|
|
snm.load_state_dict(non_strict_state_dict, strict=True)
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_orig']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_u']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight_v']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
non_strict_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict._metadata['']['spectral_norm'] # remove metadata info
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['weight'] # remove W buffer
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
del non_strict_state_dict['bias']
|
|
snm.load_state_dict(non_strict_state_dict, strict=False)
|
|
|
|
# craft a version None state_dict
|
|
version_none_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
self.assertIn('spectral_norm', version_none_state_dict._metadata[''])
|
|
del version_none_state_dict._metadata['']['spectral_norm'] # remove metadata info
|
|
del version_none_state_dict['weight_v'] # remove v vector
|
|
version_none_state_dict['weight'] = snm.weight.detach().clone() # set W as a buffer
|
|
|
|
# normal state_dict
|
|
for version_latest_with_metadata in [True, False]:
|
|
version_latest_state_dict = deepcopy(version_latest_ref_state_dict)
|
|
|
|
if not version_latest_with_metadata:
|
|
# We want to still load a user-crafted state_dict, one without metadata
|
|
del version_latest_state_dict._metadata['']['spectral_norm']
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
snm.load_state_dict(version_latest_ref_state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
out0_eval = snm(inp)
|
|
snm.train()
|
|
out1_train = snm(inp)
|
|
out2_train = snm(inp)
|
|
snm.eval()
|
|
out3_eval = snm(inp)
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
snm.load_state_dict(version_none_state_dict)
|
|
if activate_times > 0:
|
|
# since in loading version None state dict, we assume that the
|
|
# values in the state dict have gone through at lease one
|
|
# forward, we only test for equivalence when activate_times > 0.
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
self.assertEqual(out0_eval, snm(inp))
|
|
snm.train()
|
|
self.assertEqual(out1_train, snm(inp))
|
|
self.assertEqual(out2_train, snm(inp))
|
|
snm.eval()
|
|
self.assertEqual(out3_eval, snm(inp))
|
|
|
|
# test that re-wrapping does not matter
|
|
m = torch.nn.utils.remove_spectral_norm(snm)
|
|
snm = torch.nn.utils.spectral_norm(m)
|
|
|
|
# Test normal loading
|
|
snm.load_state_dict(version_latest_state_dict)
|
|
with torch.no_grad():
|
|
snm.eval()
|
|
self.assertEqual(out0_eval, snm(inp))
|
|
snm.train()
|
|
self.assertEqual(out1_train, snm(inp))
|
|
self.assertEqual(out2_train, snm(inp))
|
|
snm.eval()
|
|
self.assertEqual(out3_eval, snm(inp))
|
|
|
|
def test_spectral_norm_dim(self):
|
|
inp = torch.randn(2, 3, 10, 12)
|
|
m = nn.ConvTranspose2d(3, 4, (5, 6))
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
# this should not run into incompatible shapes
|
|
x = m(inp)
|
|
# check that u refers to the same dimension
|
|
self.assertEqual(m.weight_u.shape, m.weight_orig[0, :, 0, 0].shape)
|
|
|
|
def test_spectral_norm_forward(self):
|
|
input = torch.randn(3, 5)
|
|
m = nn.Linear(5, 7)
|
|
m = torch.nn.utils.spectral_norm(m)
|
|
# naive forward
|
|
_weight, _bias, _u = m.weight_orig, m.bias, m.weight_u
|
|
_weight_mat = _weight.view(_weight.size(0), -1)
|
|
_v = torch.mv(_weight_mat.t(), _u)
|
|
_v = F.normalize(_v, dim=0, eps=1e-12)
|
|
_u = torch.mv(_weight_mat, _v)
|
|
_u = F.normalize(_u, dim=0, eps=1e-12)
|
|
_weight.data /= torch.dot(_u, torch.matmul(_weight_mat, _v))
|
|
out_hat = torch.nn.functional.linear(input, _weight, _bias)
|
|
expect_out = m(input)
|
|
self.assertEqual(expect_out, out_hat)
|
|
|
|
def test_spectral_norm_pickle(self):
|
|
m = torch.nn.utils.spectral_norm(nn.Linear(5, 7))
|
|
m = pickle.loads(pickle.dumps(m))
|
|
self.assertIsInstance(m, nn.Linear)
|
|
|
|
def test_threshold_int(self):
|
|
x = torch.tensor([-3, -2, -1, 0, 1, 2, 3])
|
|
expected = torch.tensor([99, 99, 99, 99, 1, 2, 3])
|
|
self.assertEqual(F.threshold(x, 0, 99), expected)
|
|
|
|
def test_threshold_bfloat16_half(self):
|
|
x = torch.randn(100)
|
|
for dtype in [torch.bfloat16, torch.half]:
|
|
for threshold in [0, -0.5, 0.5, float('inf'), float('-inf'), float('nan')]:
|
|
expected = F.threshold(x, threshold, 0).to(dtype=dtype).float()
|
|
res_bf16 = F.threshold(x.to(dtype=dtype), threshold, 0).float()
|
|
self.assertEqual(res_bf16, expected)
|
|
|
|
@unittest.skipUnless('fbgemm' in torch.backends.quantized.supported_engines,
|
|
'Linear_FP16_weight requires FBGEMM. FBGEMM is only optimized for CPUs'
|
|
' with instruction set support avx2 or newer.')
|
|
def test_fb_fc_packed(self):
|
|
X = np.random.rand(16, 16).astype(np.float32) - 0.5
|
|
W = np.random.rand(16, 16).astype(np.float32) - 0.5
|
|
b = np.random.rand(16).astype(np.float32) - 0.5
|
|
|
|
def fc_op(X, W, b):
|
|
return np.dot(X, W.T) + b
|
|
|
|
x_tensor = torch.tensor(X)
|
|
w_tensor = torch.tensor(W)
|
|
b_tensor = torch.tensor(b)
|
|
packed_w_tensor = torch.fbgemm_pack_gemm_matrix_fp16(w_tensor)
|
|
actual_output = torch.fbgemm_linear_fp16_weight(x_tensor, packed_w_tensor, b_tensor)
|
|
expected_output = fc_op(X, W, b)
|
|
torch.testing.assert_close(torch.from_numpy(expected_output), actual_output.cpu(), atol=1e-3, rtol=1e-3)
|
|
|
|
def test_pad_scalar_error(self):
|
|
inputs = torch.tensor(0., requires_grad=True)
|
|
self.assertRaises(RuntimeError, lambda: F.pad(inputs, (1, 1)))
|
|
self.assertRaises(RuntimeError, lambda: F.pad(inputs, (1,)))
|
|
|
|
def test_nested_tensor_from_mask(self):
|
|
N, L, D = 10, 12, 14
|
|
|
|
input = torch.rand(N, L, D)
|
|
mask = torch.ones(N, L, dtype=torch.bool)
|
|
# Leave first row be all True to maintain the nt's size unchanged
|
|
for i in range(1, N):
|
|
end = torch.randint(1, L, size=()).item()
|
|
mask[i, end:] = False
|
|
|
|
nt = torch._nested_tensor_from_mask(input, mask)
|
|
input_convert = nt.to_padded_tensor(0.)
|
|
input.masked_fill_(mask.reshape(N, L, 1).logical_not(), 0.)
|
|
|
|
self.assertEqual(input, input_convert)
|
|
|
|
def test_nested_tensor_from_mask_error(self):
|
|
N, L, D = 10, 12, 14
|
|
|
|
input = torch.rand(N, L, D)
|
|
# Mask is not bool
|
|
mask = torch.zeros(N, L, dtype=torch.float)
|
|
self.assertRaises(RuntimeError, lambda: torch._nested_tensor_from_mask(input, mask))
|
|
|
|
# Mask size is not 2
|
|
mask = torch.zeros(N, L, D, dtype=torch.bool)
|
|
self.assertRaises(RuntimeError, lambda: torch._nested_tensor_from_mask(input, mask))
|
|
|
|
# Input size is not 3
|
|
mask = torch.zeros(N, L, dtype=torch.bool)
|
|
input = torch.rand(N, L)
|
|
self.assertRaises(RuntimeError, lambda: torch._nested_tensor_from_mask(input, mask))
|
|
|
|
# Mask size does not match input
|
|
mask = torch.zeros(N + 1, L + 1, dtype=torch.bool)
|
|
input = torch.rand(N, L, D)
|
|
self.assertRaises(RuntimeError, lambda: torch._nested_tensor_from_mask(input, mask))
|
|
|
|
# Mask is not padding format
|
|
mask = torch.ones(N, L, dtype=torch.bool)
|
|
mask[0, 0] = False
|
|
mask[0, 2] = False
|
|
self.assertRaises(RuntimeError, lambda: torch._nested_tensor_from_mask(input, mask))
|
|
|
|
def test_normalize(self):
|
|
inputs = torch.randn(1, 3, 4, 4, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,)))
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=2, dim=-2), (inputs,)))
|
|
|
|
inputs = torch.randn((), requires_grad=True)
|
|
self.assertTrue(gradcheck(lambda x: F.normalize(x, p=1, dim=-1), (inputs,)))
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
# Skip the test for ROCm as per https://github.com/pytorch/pytorch/issues/53190
|
|
@skipIfRocm
|
|
def test_broadcast_double_backwards_gpu(self):
|
|
tensors = (torch.randn(4, 4, device='cuda', requires_grad=True, dtype=torch.double),
|
|
torch.randn(4, 4, device='cuda', requires_grad=True, dtype=torch.double),
|
|
torch.randn(4, 4, device='cuda', requires_grad=True, dtype=torch.double))
|
|
# TODO(#50743): the following segfaults with check_batched_grad=True
|
|
_assertGradAndGradgradChecks(self, lambda *i: Broadcast.apply((0, 1), *i), tensors,
|
|
check_batched_grad=False)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_broadcast_not_requiring_grad(self):
|
|
variables = [
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
torch.randn(1, 2, device='cuda', requires_grad=False),
|
|
torch.randn(1, 2, device='cuda', requires_grad=False),
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
torch.randn(1, 2, device='cuda', requires_grad=True),
|
|
]
|
|
broadcasted_variables = Broadcast.apply((0, 1), *variables)
|
|
for output_idx, broadcasted_var in enumerate(broadcasted_variables):
|
|
input_var = variables[output_idx % len(variables)]
|
|
self.assertEqual(input_var.requires_grad, broadcasted_var.requires_grad)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_broadcast_no_grad(self):
|
|
x = torch.randn(1, 2, dtype=torch.float32, requires_grad=True, device='cuda')
|
|
with torch.no_grad():
|
|
broadcasted = Broadcast.apply((0, 1), x)
|
|
self.assertTrue(x.requires_grad)
|
|
for output in broadcasted:
|
|
self.assertFalse(output.requires_grad)
|
|
|
|
def test_state_dict(self):
|
|
l = nn.Linear(5, 5)
|
|
block = nn.Module()
|
|
block.conv = nn.Conv2d(3, 3, 3, bias=False)
|
|
net = nn.Module()
|
|
net.linear1 = l
|
|
net.linear2 = l
|
|
net.bn = nn.BatchNorm2d(2)
|
|
net.block = block
|
|
net.add_module('empty', None)
|
|
|
|
state_dict = net.state_dict()
|
|
self.assertEqual(len(state_dict), 10)
|
|
self.assertEqual(len(state_dict._metadata), 6)
|
|
self.assertIn('', state_dict._metadata)
|
|
self.assertIn('linear1', state_dict._metadata)
|
|
self.assertIn('linear1.weight', state_dict)
|
|
self.assertIn('linear1.bias', state_dict)
|
|
self.assertIn('linear2', state_dict._metadata)
|
|
self.assertIn('linear2.weight', state_dict)
|
|
self.assertIn('linear2.bias', state_dict)
|
|
self.assertIn('block', state_dict._metadata)
|
|
self.assertIn('block.conv', state_dict._metadata)
|
|
self.assertIn('block.conv.weight', state_dict)
|
|
self.assertIn('block.conv.weight', state_dict)
|
|
self.assertNotIn('block.conv.bias', state_dict)
|
|
self.assertIn('bn', state_dict._metadata)
|
|
self.assertIn('bn.weight', state_dict)
|
|
self.assertIn('bn.bias', state_dict)
|
|
self.assertIn('bn.running_var', state_dict)
|
|
self.assertIn('bn.running_mean', state_dict)
|
|
self.assertIn('bn.num_batches_tracked', state_dict)
|
|
self.assertFalse(any(k.startswith('empty') for k in state_dict.keys()))
|
|
for k, v in state_dict.items():
|
|
param = net
|
|
for component in k.split('.'):
|
|
param = getattr(param, component)
|
|
if isinstance(param, Parameter):
|
|
param = param.data
|
|
self.assertEqual(v.data_ptr(), param.data_ptr())
|
|
|
|
l = nn.Linear(5, 5)
|
|
state_dict = l.state_dict()
|
|
self.assertEqual(len(state_dict), 2)
|
|
self.assertEqual(len(state_dict._metadata), 1)
|
|
self.assertIn('', state_dict._metadata)
|
|
self.assertTrue(state_dict._metadata['']['version'] >= 0)
|
|
self.assertEqual(state_dict['weight'].data_ptr(), l.weight.data_ptr())
|
|
self.assertEqual(state_dict['bias'].data_ptr(), l.bias.data_ptr())
|
|
|
|
# Reference https://github.com/pytorch/pytorch/pull/75507#issuecomment-1110291545
|
|
self.assertNotWarn(lambda: l.state_dict(destination={}), "Should not warn kwarg destination w/o _metadata")
|
|
|
|
def test_extra_state(self):
|
|
|
|
class SubModule(torch.nn.Module):
|
|
def __init__(self, foo):
|
|
super().__init__()
|
|
self.foo = foo
|
|
|
|
def get_extra_state(self):
|
|
return {
|
|
'foo': self.foo
|
|
}
|
|
|
|
def set_extra_state(self, state):
|
|
self.foo = state['foo']
|
|
|
|
class MyModule(torch.nn.Module):
|
|
def __init__(self, foo, bar):
|
|
super().__init__()
|
|
self.sub = SubModule(foo)
|
|
self.bar = bar
|
|
|
|
def get_extra_state(self):
|
|
return {
|
|
'bar': self.bar
|
|
}
|
|
|
|
def set_extra_state(self, state):
|
|
self.bar = state['bar']
|
|
|
|
# Ensure state_dict contains the extra state by loading it into another module.
|
|
m = MyModule(3, 'something')
|
|
m2 = MyModule(5, 'something else')
|
|
m2.load_state_dict(m.state_dict())
|
|
self.assertEqual(m.state_dict(), m2.state_dict())
|
|
self.assertEqual(m2.bar, m.bar)
|
|
self.assertEqual(m2.sub.foo, m.sub.foo)
|
|
|
|
def test_extra_state_non_dict(self):
|
|
|
|
class MyModule(torch.nn.Module):
|
|
def __init__(self, foo):
|
|
super().__init__()
|
|
self.foo = foo
|
|
|
|
def get_extra_state(self):
|
|
return self.foo
|
|
|
|
def set_extra_state(self, state):
|
|
self.foo = state
|
|
|
|
# Test various types of extra state.
|
|
for state in ('something', 5, MyModule(3)):
|
|
m = MyModule(state)
|
|
m2 = MyModule('something else')
|
|
m2.load_state_dict(m.state_dict())
|
|
self.assertEqual(m.state_dict(), m2.state_dict())
|
|
self.assertEqual(m.foo, m2.foo)
|
|
|
|
def test_extra_state_missing_set_extra_state(self):
|
|
|
|
class MyModule(torch.nn.Module):
|
|
def get_extra_state(self):
|
|
return {
|
|
'foo': 5
|
|
}
|
|
|
|
m = MyModule()
|
|
with self.assertRaisesRegex(RuntimeError, 'Unexpected key'):
|
|
m.load_state_dict(m.state_dict())
|
|
|
|
def test_extra_state_missing_get_extra_state(self):
|
|
|
|
class MyModule(torch.nn.Module):
|
|
def set_extra_state(self):
|
|
pass
|
|
|
|
m = MyModule()
|
|
with self.assertRaisesRegex(RuntimeError, 'Missing key'):
|
|
m.load_state_dict(m.state_dict())
|
|
|
|
@skipIfTorchDynamo("TorchDynamo fails here for unknown reasons")
|
|
def test_parameter_assignment(self):
|
|
l = nn.Linear(5, 5)
|
|
|
|
def num_params():
|
|
return len(list(l.parameters()))
|
|
|
|
self.assertEqual(num_params(), 2)
|
|
|
|
new_param = Parameter(torch.randn(5, 5))
|
|
l.param_name = new_param
|
|
self.assertEqual(num_params(), 3)
|
|
self.assertObjectIn(new_param, l.parameters())
|
|
|
|
var = torch.randn(5, 5)
|
|
l.var_name = var
|
|
self.assertEqual(num_params(), 3)
|
|
self.assertNotIn(id(var), map(id, l.parameters()))
|
|
|
|
# Make sure Variables are not saved as parameters
|
|
l.variable_attr = torch.empty(5, 5)
|
|
self.assertEqual(num_params(), 3)
|
|
l.param_attr = Parameter(torch.empty(5, 5))
|
|
self.assertEqual(num_params(), 4)
|
|
|
|
# It shouldn't be possible to replace a parameter with a Variable
|
|
def assign_var():
|
|
l.param_attr = torch.empty(5, 5)
|
|
|
|
self.assertRaises(TypeError, assign_var)
|
|
# But replacing it with None should be fine
|
|
l.param_attr = None
|
|
self.assertEqual(num_params(), 3)
|
|
|
|
def test_assignment(self):
|
|
l = nn.Module()
|
|
a = nn.Parameter(torch.randn(2))
|
|
b = nn.Parameter(torch.randn(3))
|
|
c = nn.Parameter(torch.randn(4))
|
|
q = nn.Linear(4, 4)
|
|
r = nn.Linear(5, 5)
|
|
w = nn.Linear(6, 6)
|
|
|
|
def test_assignments(get_list, a, b, c):
|
|
# Check that None can be shadowed
|
|
l.a = None
|
|
self.assertIsNone(l.a)
|
|
self.assertIn('a', l.__dict__)
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [a])
|
|
self.assertNotIn('a', l.__dict__)
|
|
|
|
# Assign second object
|
|
l.b = None
|
|
self.assertIsNone(l.b)
|
|
self.assertIn('b', l.__dict__)
|
|
l.b = b
|
|
self.assertIs(l.b, b)
|
|
self.assertEqual(get_list(), [a, b])
|
|
self.assertNotIn('b', l.__dict__)
|
|
|
|
# Remove and add the object back. Order should be unchanged.
|
|
l.a = None
|
|
self.assertIsNone(l.a)
|
|
self.assertEqual(get_list(), [b])
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [a, b])
|
|
|
|
# Replace object with another one. Order should be unchanged.
|
|
l.a = c
|
|
self.assertIs(l.a, c)
|
|
self.assertEqual(get_list(), [c, b])
|
|
|
|
# Remove and reassign an attribute. It should appear at the end of the list now.
|
|
del l.a
|
|
self.assertFalse(hasattr(l, 'a'))
|
|
l.a = a
|
|
self.assertIs(l.a, a)
|
|
self.assertEqual(get_list(), [b, a])
|
|
|
|
test_assignments(lambda: list(l.parameters()), a, b, c)
|
|
del l.a, l.b
|
|
self.assertEqual(list(l.parameters()), [])
|
|
|
|
test_assignments(lambda: list(l.children()), q, r, w)
|
|
del l.a, l.b
|
|
self.assertEqual(list(l.children()), [])
|
|
|
|
buf = Buffer(torch.randn(10))
|
|
l.buf = buf
|
|
self.assertIs(l.buf, buf)
|
|
l.buf = None
|
|
self.assertIs(l.buf, None)
|
|
self.assertNotIn('buf', l.__dict__) # should be stored in l._buffers
|
|
l.buf = buf
|
|
self.assertIn('buf', l.state_dict())
|
|
self.assertEqual(l.state_dict()['buf'], buf)
|
|
|
|
def test_container_copy(self):
|
|
class Model(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.linear = nn.Linear(4, 5)
|
|
|
|
def forward(self, input):
|
|
return self.linear(input)
|
|
|
|
input = torch.randn(2, 4)
|
|
|
|
model = Model()
|
|
model_cp = deepcopy(model)
|
|
self.assertEqual(model(input).data, model_cp(input).data)
|
|
|
|
model_cp.linear.weight.data[:] = 2
|
|
self.assertNotEqual(model(input).data, model_cp(input).data)
|
|
|
|
def test_RNN_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
for module in (nn.RNNCell, nn.GRUCell):
|
|
for bias in (True, False):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 20)
|
|
cell = module(10, 20, bias=bias)
|
|
for _ in range(6):
|
|
hx = cell(input, hx)
|
|
|
|
hx.sum().backward()
|
|
|
|
def test_RNN_cell_forward_zero_hidden_size(self):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 0)
|
|
cell_shared_param = (10, 0)
|
|
for cell in (nn.RNNCell(*cell_shared_param, nonlinearity="relu"),
|
|
nn.RNNCell(*cell_shared_param, nonlinearity="tanh"),
|
|
nn.GRUCell(*cell_shared_param)):
|
|
self.assertEqual(cell(input, hx).shape, torch.Size([3, 0]))
|
|
|
|
def _test_loss_equal_input_target_shape(self, cast):
|
|
# Tests losses whose inputs should have the same size.
|
|
losses = {
|
|
'mse_loss': lambda x, y: F.mse_loss(x, y),
|
|
'l1_loss': lambda x, y: F.l1_loss(x, y),
|
|
'smooth_l1_loss': lambda x, y: F.smooth_l1_loss(x, y),
|
|
'huber_loss': lambda x, y: F.huber_loss(x, y),
|
|
'kl_div': lambda x, y: F.kl_div(x, y),
|
|
'poisson_nll_loss': lambda x, y: F.poisson_nll_loss(x, y),
|
|
}
|
|
|
|
input = cast(torch.randn(3, 5))
|
|
target = cast(torch.randn(5, 3))
|
|
for fn in losses.values():
|
|
self.assertRaises(Exception, lambda: fn(input, target))
|
|
|
|
def test_loss_equal_input_target_shape(self):
|
|
self._test_loss_equal_input_target_shape(lambda x: x)
|
|
|
|
def test_mse_loss_size_warning(self):
|
|
i = torch.randn((10, 1), requires_grad=True)
|
|
t = torch.randn((10,))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Trigger Warning
|
|
F.mse_loss(i, t)
|
|
# Check warning occurs
|
|
self.assertEqual(len(w), 1)
|
|
self.assertIn('Please ensure they have the same size.', str(w[0]))
|
|
|
|
def test_weighted_mse_loss(self):
|
|
inputs = torch.tensor([1.0, 2.0, 3.0, 4.0], requires_grad=True)
|
|
targets = torch.tensor([1.5, 2.5, 3.5, 4.5])
|
|
weight = torch.tensor([1.0, 2.0, 3.0, 4.0])
|
|
loss = F.mse_loss(inputs, targets, weight=weight, reduction='mean')
|
|
expected_loss = torch.tensor(0.25)
|
|
self.assertTrue(torch.isclose(loss, expected_loss), f"Expected {expected_loss}, but got {loss}")
|
|
|
|
def test_weighted_l1_loss_with_weights(self):
|
|
inputs = torch.tensor([1.0, 2.0, 3.0, 4.0], requires_grad=True)
|
|
targets = torch.tensor([1.5, 2.5, 3.5, 4.5])
|
|
weight = torch.tensor([1.0, 2.0, 3.0, 4.0])
|
|
loss = F.l1_loss(inputs, targets, weight=weight, reduction='mean')
|
|
expected_loss = torch.tensor(0.5)
|
|
self.assertTrue(torch.isclose(loss, expected_loss), f"Expected {expected_loss}, but got {loss}")
|
|
|
|
def test_weighted_huber_loss(self):
|
|
inputs = torch.tensor([1.0, 2.0, 3.0, 4.0], requires_grad=True)
|
|
targets = torch.tensor([1.5, 2.5, 3.5, 4.5])
|
|
weight = torch.tensor([1.0, 2.0, 3.0, 4.0])
|
|
loss = F.huber_loss(input=inputs, target=targets, weight=weight, reduction='mean', delta=1.0)
|
|
expected_loss = torch.tensor(0.25)
|
|
print(torch.isclose(loss, expected_loss, atol=1e-6), f"Expected {expected_loss}, but got {loss}")
|
|
|
|
def test_gaussian_nll_loss_broadcasting(self):
|
|
input = torch.tensor([[0.5, 1.5, 2.5], [2., 4., 6.]])
|
|
target_full = torch.tensor([[1., 2., 3.], [1., 2., 3.]])
|
|
target_part = torch.tensor([[1., 2., 3.]])
|
|
var_full = torch.tensor([[0.5, 0.5, 0.5], [1.5, 1.5, 1.5]])
|
|
var_part1 = torch.tensor([[0.5], [1.5]])
|
|
var_part2 = torch.tensor([0.5, 1.5])
|
|
component_wise_loss = 0.5 * (torch.log(var_full) + (input - target_full)**2 / var_full)
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_full, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_full, var_part1, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_full, var_part2, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_part1, reduction='none'))
|
|
self.assertEqual(component_wise_loss,
|
|
F.gaussian_nll_loss(input, target_part, var_part2, reduction='none'))
|
|
|
|
def test_gaussian_nll_loss_args(self):
|
|
input = torch.randn(3, 5)
|
|
with self.assertRaisesRegex(ValueError, 'var is of incorrect size'):
|
|
target = torch.randn(3, 5)
|
|
var = torch.ones(3, 3)
|
|
torch.nn.functional.gaussian_nll_loss(input, target, var)
|
|
with self.assertRaisesRegex(ValueError, 'var has negative entry/entries'):
|
|
var = -1 * torch.ones(3, 5)
|
|
torch.nn.functional.gaussian_nll_loss(input, target, var)
|
|
|
|
def test_KLDivLoss_batch_mean(self):
|
|
input_shape = (2, 5)
|
|
log_prob1 = F.log_softmax(torch.randn(input_shape), 1)
|
|
prob2 = F.softmax(torch.randn(input_shape), 1)
|
|
|
|
loss = nn.KLDivLoss(reduction='batchmean')
|
|
l = loss(log_prob1, prob2)
|
|
|
|
loss_none_reduce = nn.KLDivLoss(reduction='sum')(log_prob1, prob2)
|
|
expected = loss_none_reduce / input_shape[0]
|
|
|
|
self.assertEqual(l, expected)
|
|
|
|
def test_KLDivLoss_batch_mean_log_target(self):
|
|
input_shape = (2, 5)
|
|
log_prob1 = F.log_softmax(torch.randn(input_shape), 1)
|
|
log_prob2 = F.log_softmax(torch.randn(input_shape), 1)
|
|
|
|
loss = nn.KLDivLoss(reduction='batchmean', log_target=True)
|
|
l = loss(log_prob1, log_prob2)
|
|
|
|
loss_none_reduce = nn.KLDivLoss(reduction='sum', log_target=True)(log_prob1, log_prob2)
|
|
expected = loss_none_reduce / input_shape[0]
|
|
|
|
self.assertEqual(l, expected)
|
|
|
|
def test_CTCLoss_typechecks(self):
|
|
target_lengths = torch.tensor([30, 25, 20])
|
|
input_lengths = torch.tensor([50, 50, 50])
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
_input_lengths = input_lengths.to(dtype=torch.float)
|
|
torch.nn.functional.ctc_loss(log_probs, targets, _input_lengths, target_lengths)
|
|
with self.assertRaises(RuntimeError):
|
|
target_lengths = target_lengths.to(dtype=torch.float)
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_lengthchecks_cuda(self):
|
|
for target_lengths in [[30, 25, 20], [-1, -1, -1]]:
|
|
for input_lengths in [[50, 50, 50], [-1, -1, -1]]:
|
|
targets = torch.randint(1, 15, (3, 29), dtype=torch.long, device='cuda')
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
def test_CTCLoss_lengthchecks_cpu(self):
|
|
for target_lengths in [[30, 25, 20], [-1, -1, -1]]:
|
|
for input_lengths in [[50, 50, 50], [-1, -1, -1]]:
|
|
targets = torch.randint(1, 15, (3, 29), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float).log_softmax(2)
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_long_targets(self):
|
|
input_length = 4000
|
|
vocab_size = 3
|
|
batch_size = 4
|
|
target_length = 1200
|
|
|
|
log_probs = torch.randn(input_length, batch_size, vocab_size, dtype=torch.double).log_softmax(2).requires_grad_()
|
|
targets = torch.randint(low=1, high=vocab_size - 1, size=(batch_size, target_length), dtype=torch.long)
|
|
input_lengths = batch_size * [input_length]
|
|
target_lengths = batch_size * [target_length]
|
|
|
|
res_cpu = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
grad_out = torch.randn_like(res_cpu)
|
|
grad_cpu, = torch.autograd.grad(res_cpu, log_probs, grad_out)
|
|
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res_gpu = torch.nn.functional.ctc_loss(log_probs.cuda(), targets.cuda(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
grad_gpu, = torch.autograd.grad(res_gpu, log_probs, grad_out.cuda())
|
|
self.assertEqual(res_cpu, res_gpu, atol=1e-4, rtol=0)
|
|
self.assertEqual(grad_cpu, grad_gpu, atol=1e-4, rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_critical_target_len(self):
|
|
# cudnn has an unexpected problem with target length 256, see issue #53505
|
|
N = 1
|
|
S = 256
|
|
C = 10
|
|
T = 500
|
|
target = torch.randint(low=1, high=C, size=(S,), dtype=torch.int)
|
|
input_lengths = torch.full(size=(N,), fill_value=T, dtype=torch.int)
|
|
target_lengths = torch.tensor(S, dtype=torch.int)
|
|
inp = torch.randn(T, N, C, dtype=torch.float, device='cuda').log_softmax(2).requires_grad_()
|
|
with cudnn.flags(enabled=True):
|
|
res_gpu = torch.nn.functional.ctc_loss(inp, target, input_lengths, target_lengths, reduction='none')
|
|
res_cpu = torch.nn.functional.ctc_loss(inp.cpu(), target, input_lengths, target_lengths, reduction='none')
|
|
self.assertEqual(res_cpu, res_gpu, atol=1e-3, rtol=0)
|
|
|
|
def test_CTCLoss_zero_lengths(self):
|
|
devices = ['cpu']
|
|
devices += ['cuda'] if TEST_CUDA else []
|
|
N = 3
|
|
S = 2
|
|
C = 200
|
|
T = 1
|
|
target = torch.randint(low=1, high=C, size=(N, S), dtype=torch.int)
|
|
input_lengths = torch.full(size=(N,), fill_value=0, dtype=torch.int)
|
|
target_lengths = torch.full(size=(N,), fill_value=0, dtype=torch.int)
|
|
for device in devices:
|
|
inp = torch.randn(T, N, C, dtype=torch.float, device=device).log_softmax(2).requires_grad_()
|
|
res = torch.nn.functional.ctc_loss(inp, target, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((res == 0).all().item())
|
|
res.sum().backward()
|
|
self.assertTrue((inp.grad == 0).all().item())
|
|
target_lengths = torch.full(size=(N,), fill_value=1, dtype=torch.int)
|
|
for device in devices:
|
|
inp = torch.randn(T, N, C, dtype=torch.float, device=device).log_softmax(2).requires_grad_()
|
|
res = torch.nn.functional.ctc_loss(inp, target, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((res == torch.inf).all().item())
|
|
res.sum().backward()
|
|
self.assertTrue((inp.grad == 0).all().item())
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_CTCLoss_zero_infinity(self):
|
|
target_lengths = [60, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int, device='cuda')
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device='cuda').log_softmax(2).requires_grad_()
|
|
res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res2 = torch.nn.functional.ctc_loss(log_probs, targets.cuda().long(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
res_cpu = torch.nn.functional.ctc_loss(log_probs.cpu(), targets.cpu(), input_lengths, target_lengths,
|
|
reduction='sum', zero_infinity=True)
|
|
|
|
self.assertEqual(res2, res, atol=1e-4, rtol=0)
|
|
self.assertEqual(res_cpu, res.cpu(), atol=1e-4, rtol=0)
|
|
g1, = torch.autograd.grad(res, log_probs)
|
|
g2, = torch.autograd.grad(res2, log_probs)
|
|
g3, = torch.autograd.grad(res_cpu, log_probs)
|
|
self.assertEqual(g2, g3, atol=1e-4, rtol=0)
|
|
self.assertEqual(g1, g2, atol=1e-4, rtol=0)
|
|
self.assertTrue((g1 == g1).all().item()) # check that we don't have NaN
|
|
|
|
def test_RNN_cell_no_broadcasting(self):
|
|
def test(cell_module, input, hx, input_size, hidden_size):
|
|
cell = cell_module(input_size, hidden_size)
|
|
self.assertRaises(RuntimeError, lambda: cell(input, hx))
|
|
|
|
def test_all(hidden_size, bad_hx, good_hx, input_size, input):
|
|
test(nn.RNNCell, input, bad_hx, input_size, hidden_size)
|
|
test(nn.GRUCell, input, bad_hx, input_size, hidden_size)
|
|
test(nn.LSTMCell, input, (bad_hx, good_hx), input_size, hidden_size)
|
|
test(nn.LSTMCell, input, (good_hx, bad_hx), input_size, hidden_size)
|
|
|
|
hidden_size = 20
|
|
input_size = 10
|
|
input = torch.randn(3, input_size)
|
|
bad_hx = torch.randn(1, hidden_size)
|
|
good_hx = torch.randn(3, hidden_size)
|
|
|
|
# Test hidden/input batch size broadcasting
|
|
test_all(hidden_size, bad_hx, good_hx, input_size, input)
|
|
|
|
# Test hx's hidden_size vs module's hidden_size broadcasting
|
|
bad_hx = torch.randn(3, 1)
|
|
test_all(hidden_size, bad_hx, good_hx, input_size, input)
|
|
|
|
# Test input's input_size vs module's input_size broadcasting
|
|
bad_input = torch.randn(3, 1)
|
|
test_all(hidden_size, good_hx, good_hx, input_size, bad_input)
|
|
|
|
def test_LSTM_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
for bias in (True, False):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 20)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20, bias=bias)
|
|
for _ in range(6):
|
|
hx, cx = lstm(input, (hx, cx))
|
|
|
|
(hx + cx).sum().backward()
|
|
|
|
def test_LSTM_cell_forward_input_size(self):
|
|
input = torch.randn(3, 11)
|
|
hx = torch.randn(3, 20)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20)
|
|
self.assertRaises(Exception, lambda: lstm(input, (hx, cx)))
|
|
|
|
def test_LSTM_cell_forward_hidden_size(self):
|
|
input = torch.randn(3, 10)
|
|
hx = torch.randn(3, 21)
|
|
cx = torch.randn(3, 20)
|
|
lstm = nn.LSTMCell(10, 20)
|
|
self.assertRaises(Exception, lambda: lstm(input, (hx, cx)))
|
|
self.assertRaises(Exception, lambda: lstm(input, (cx, hx)))
|
|
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_pack_sequence_batch_sizes_throw(self):
|
|
with self.assertRaisesRegex(ValueError, r"batch_sizes should always be on CPU"):
|
|
m = nn.LSTM(3, 4, bidirectional=True, num_layers=2).to('cuda')
|
|
a = torch.rand(5, 3, device='cuda')
|
|
b = torch.tensor([1, 1, 1, 1, 1], device='cuda')
|
|
input = nn.utils.rnn.PackedSequence(a, b)
|
|
|
|
def test_Transformer_cell(self):
|
|
# this is just a smoke test; these modules are implemented through
|
|
# autograd so no Jacobian test is needed
|
|
d_model = 512
|
|
nhead = 16
|
|
num_encoder_layers = 4
|
|
num_decoder_layers = 3
|
|
dim_feedforward = 256
|
|
dropout = 0.3
|
|
bsz = 8
|
|
seq_length = 35
|
|
tgt_length = 15
|
|
for batch_first, src_size, tgt_size in zip((True, False),
|
|
[(bsz, seq_length, d_model),
|
|
(seq_length, bsz, d_model)],
|
|
[(bsz, tgt_length, d_model),
|
|
(tgt_length, bsz, d_model)]):
|
|
transformer = nn.Transformer(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, batch_first=batch_first,
|
|
dtype=torch.double)
|
|
src = torch.randn(src_size, dtype=torch.double)
|
|
src_mask = transformer.generate_square_subsequent_mask(seq_length).double()
|
|
tgt = torch.randn(tgt_size, dtype=torch.double)
|
|
tgt_mask = transformer.generate_square_subsequent_mask(tgt_length).double()
|
|
memory_mask = torch.randn(tgt_length, seq_length).double()
|
|
src_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5
|
|
tgt_key_padding_mask = torch.rand(bsz, tgt_length) >= 0.5
|
|
memory_key_padding_mask = torch.rand(bsz, seq_length) >= 0.5
|
|
|
|
output = transformer(src, tgt,
|
|
src_mask=src_mask,
|
|
tgt_mask=tgt_mask,
|
|
memory_mask=memory_mask,
|
|
src_key_padding_mask=src_key_padding_mask,
|
|
tgt_key_padding_mask=tgt_key_padding_mask,
|
|
memory_key_padding_mask=memory_key_padding_mask)
|
|
output.sum().backward()
|
|
|
|
def test_transformerdecoderlayer(self):
|
|
# this is a deterministic test for TransformerDecoderLayer
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
seq_length = 5
|
|
tgt_length = 3
|
|
|
|
for batch_first in (False, True):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]])
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.314351, 0.094805, -0.671322, 0.101977]]])
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
memory_input = torch.tensor([[[1., 2., 3., 4.]]])
|
|
result = model(decoder_input, memory_input)
|
|
result = result.detach().numpy()
|
|
ref_output = perm_fn(torch.tensor([[[2.422245, 0.051716, -0.606338, -0.024756]],
|
|
[[2.422245, 0.051716, -0.606338, -0.024756]]]))
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.343536, 0.085561, -0.654954, 0.074991]],
|
|
[[2.343536, 0.085561, -0.654954, 0.074991]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]))
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 3) == 1
|
|
result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask[0, 2] = 1
|
|
key_padding_mask[1, 1] = 1
|
|
key_padding_mask[1, 2] = 1
|
|
result = model(decoder_input, memory_input, tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430025, 0.027643, -0.601164, -0.073476],
|
|
[2.4323, 0.029375, -0.599553, -0.071881]],
|
|
[[2.428523, 0.026838, -0.602226, -0.07391],
|
|
[2.432634, 0.029842, -0.599318, -0.071253]],
|
|
[[2.432278, 0.028152, -0.599555, -0.074139],
|
|
[2.432659, 0.029244, -0.599294, -0.072382]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 5) == 1
|
|
result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask[0, 4] = 1
|
|
key_padding_mask[1, 3] = 1
|
|
key_padding_mask[1, 4] = 1
|
|
result = model(decoder_input, memory_input, memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429757, 0.027358, -0.601351, -0.073816],
|
|
[2.432692, 0.028583, -0.599263, -0.073634]],
|
|
[[2.428247, 0.02662, -0.602419, -0.074123],
|
|
[2.432657, 0.029055, -0.599293, -0.072732]],
|
|
[[2.431515, 0.027687, -0.600096, -0.074459],
|
|
[2.433075, 0.028543, -0.598987, -0.073985]]]))
|
|
result = result.detach().numpy()
|
|
ref_output = ref_output.detach().numpy()
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
np.testing.assert_allclose(result, ref_output, atol=1e-5)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_transformerdecoderlayer_gelu(self):
|
|
# this is a deterministic test for TransformerDecoderLayer with gelu activation
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
seq_length = 5
|
|
tgt_length = 3
|
|
|
|
for activation, batch_first in product(('gelu', F.gelu, nn.GELU()), (True, False)):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerDecoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
activation, batch_first=batch_first)
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]])
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]])
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]])
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-5, atol=0)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.415448, 0.054389, -0.610932, -0.0156613]],
|
|
[[2.415448, 0.054389, -0.610932, -0.0156613]]]))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-5, atol=0)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]]))
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.338531, 0.087709, -0.65776, 0.080646]],
|
|
[[2.338531, 0.087709, -0.65776, 0.080646]]]))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-5, atol=0)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]))
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]))
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42049104, 0.03443088, -0.60793706, -0.05436271],
|
|
[2.42210631, 0.03546578, -0.60679895, -0.05357488]],
|
|
[[2.41907674, 0.0336104, -0.60892977, -0.05490462],
|
|
[2.42216881, 0.03586554, -0.6067524, -0.05289126]],
|
|
[[2.42205716, 0.03488046, -0.60683681, -0.05460596],
|
|
[2.42240309, 0.0354595, -0.60659063, -0.05378816]]]))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-5, atol=0)
|
|
|
|
@skipIfRocm(msg='Large numerical errors')
|
|
def test_transformerdecoder(self):
|
|
def get_a_test_layer(use_cuda, activation, batch_first=False):
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
layer = nn.TransformerDecoderLayer(
|
|
d_model,
|
|
nhead,
|
|
dim_feedforward=dim_feedforward,
|
|
dropout=dropout,
|
|
activation=activation,
|
|
batch_first=batch_first).to(device)
|
|
|
|
with torch.no_grad():
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(layer.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
return layer
|
|
|
|
# this is a deterministic test for TransformerDecoder
|
|
for batch_first in (False, True):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
activation = F.relu
|
|
use_cuda = torch.cuda.is_available()
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation,
|
|
batch_first=batch_first)
|
|
|
|
model = nn.TransformerDecoder(decoder_layer, 1).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[2.314351, 0.094805, -0.671322, 0.101977]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.422245, 0.051716, -0.606338, -0.024756]],
|
|
[[2.422245, 0.051716, -0.606338, -0.024756]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.343536, 0.085561, -0.654954, 0.074991]],
|
|
[[2.343536, 0.085561, -0.654954, 0.074991]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 3).to(device) == 1
|
|
result = model(decoder_input, memory_input,
|
|
tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# key_padding_mask
|
|
key_padding_mask[0, 2] = 1
|
|
key_padding_mask[1, 1] = 1
|
|
key_padding_mask[1, 2] = 1
|
|
result = model(decoder_input, memory_input,
|
|
tgt_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430025, 0.027643, -0.601164, -0.073476],
|
|
[2.4323, 0.029375, -0.599553, -0.071881]],
|
|
[[2.428523, 0.026838, -0.602226, -0.07391],
|
|
[2.432634, 0.029842, -0.599318, -0.071253]],
|
|
[[2.432278, 0.028152, -0.599555, -0.074139],
|
|
[2.432659, 0.029244, -0.599294, -0.072382]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask = torch.zeros(2, 5).to(device) == 1
|
|
result = model(decoder_input, memory_input,
|
|
memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.430065, 0.027862, -0.601136, -0.073096],
|
|
[2.431935, 0.028907, -0.599809, -0.072488]],
|
|
[[2.428457, 0.027053, -0.602275, -0.073462],
|
|
[2.431970, 0.029387, -0.599789, -0.071621]],
|
|
[[2.431934, 0.028196, -0.599802, -0.073809],
|
|
[2.432306, 0.028858, -0.599542, -0.072846]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# memory_key_padding_mask
|
|
key_padding_mask[0, 4] = 1
|
|
key_padding_mask[1, 3] = 1
|
|
key_padding_mask[1, 4] = 1
|
|
result = model(decoder_input,
|
|
memory_input,
|
|
memory_key_padding_mask=key_padding_mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429757, 0.027358, -0.601351, -0.073816],
|
|
[2.432692, 0.028583, -0.599263, -0.073634]],
|
|
[[2.428247, 0.02662, -0.602419, -0.074123],
|
|
[2.432657, 0.029055, -0.599293, -0.072732]],
|
|
[[2.431515, 0.027687, -0.600096, -0.074459],
|
|
[2.433075, 0.028543, -0.598987, -0.073985]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# multiple layers no norm
|
|
model = nn.TransformerDecoder(decoder_layer, 2).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[2.31316, 0.0950293, -0.671995, 0.102802]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# multiple layers no norm
|
|
model = nn.TransformerDecoder(decoder_layer, 6).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]],
|
|
[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]],
|
|
[[2.42794, 0.026164, -0.60263, -0.0747591],
|
|
[2.43113, 0.0279516, -0.600376, -0.0736896]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# multiple layers with norm
|
|
# d_model = 4
|
|
norm = nn.LayerNorm(4)
|
|
model = nn.TransformerDecoder(decoder_layer, 2, norm=norm).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor(
|
|
[[[1.66166, -0.326986, -1.01466, -0.320017]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# multiple layers with norm
|
|
model = nn.TransformerDecoder(decoder_layer, 6, norm=norm).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]],
|
|
[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]],
|
|
[[1.69559, -0.357291, -0.894741, -0.443553],
|
|
[1.69571, -0.357363, -0.894154, -0.444196]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
# gelu activation test cases
|
|
activation = "gelu"
|
|
use_cuda = torch.cuda.is_available()
|
|
device = torch.device("cuda" if use_cuda else "cpu")
|
|
|
|
decoder_layer = get_a_test_layer(use_cuda=use_cuda, activation=activation,
|
|
batch_first=batch_first)
|
|
|
|
model = nn.TransformerDecoder(decoder_layer, 1).to(device)
|
|
|
|
# deterministic input
|
|
decoder_input = torch.tensor([[[20., 30., 40., 50.]]]).to(device)
|
|
memory_input = torch.tensor([[[60., 70., 80., 90.]]]).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = torch.tensor([[[2.306435, 0.095946, -0.675796, 0.10687]]]).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-3)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.415448, 0.054389, -0.610932, -0.0156613]],
|
|
[[2.415448, 0.054389, -0.610932, -0.0156613]]])).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]])).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[9., 10., 11., 12.]],
|
|
[[11., 12., 13., 14.]]])).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.338531, 0.087709, -0.65776, 0.080646]],
|
|
[[2.338531, 0.087709, -0.65776, 0.080646]]])).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-4)
|
|
|
|
# deterministic input
|
|
decoder_input = perm_fn(torch.tensor([[[0.4517, 0.6793, 0.5313, 0.0034],
|
|
[0.2678, 0.3677, 0.4459, 0.7166]],
|
|
[[0.8100, 0.3716, 0.4096, 0.1976],
|
|
[0.6958, 0.8844, 0.6081, 0.8315]],
|
|
[[0.0494, 0.9343, 0.5955, 0.3830],
|
|
[0.5404, 0.3464, 0.9378, 0.6200]]]
|
|
)).to(device)
|
|
memory_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]]
|
|
)).to(device)
|
|
result = model(decoder_input, memory_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42049104, 0.03443088, -0.60793706, -0.05436271],
|
|
[2.42210631, 0.03546578, -0.60679895, -0.05357488]],
|
|
[[2.41907674, 0.0336104, -0.60892977, -0.05490462],
|
|
[2.42216881, 0.03586554, -0.6067524, -0.05289126]],
|
|
[[2.42205716, 0.03488046, -0.60683681, -0.05460596],
|
|
[2.42240309, 0.0354595, -0.60659063, -0.05378816]]]
|
|
)).to(device)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
torch.testing.assert_close(result, ref_output, rtol=1e-7, atol=1e-5)
|
|
|
|
@unittest.skipIf(not (TEST_CUDNN and TEST_MULTIGPU), 'CUDNN or multi-gpu not available')
|
|
def test_cudnn_rnn_dropout_states_device(self):
|
|
rnn = nn.RNN(10, 20, num_layers=2, dropout=.5)
|
|
device = 1
|
|
input = torch.randn(5, 4, 10).cuda(device)
|
|
rnn.cuda(device)
|
|
hx = torch.randn(2, 4, 20).cuda(device)
|
|
output = rnn(input, hx)
|
|
|
|
def test_cudnn_forward_exception(self):
|
|
rnns = [
|
|
(nn.LSTM(10, 20, batch_first=True), (torch.zeros(1, 2, 19), torch.zeros(1, 2, 19))),
|
|
(nn.LSTM(10, 20, batch_first=True, proj_size=10), (torch.zeros(1, 2, 19), torch.zeros(1, 2, 19))),
|
|
(nn.GRU(10, 20, batch_first=True), torch.zeros(1, 2, 19)),
|
|
(nn.RNN(10, 20, batch_first=True), torch.zeros(1, 2, 19)),
|
|
]
|
|
x_wrong = torch.randn(2, 3, 3)
|
|
x_right = torch.randn(2, 3, 10)
|
|
for rnn, hidden in rnns:
|
|
self.assertRaisesRegex(RuntimeError, "Expected hidden.*size.*got", rnn, x_right, hidden)
|
|
self.assertRaisesRegex(RuntimeError, re.escape("input.size(-1) must be equal to input_size"), rnn, x_wrong)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
@skipIfRocm
|
|
def test_cudnn_weight_format(self):
|
|
rnns = [
|
|
nn.LSTM(10, 20, batch_first=True),
|
|
nn.LSTM(10, 20, batch_first=True, proj_size=10),
|
|
nn.GRU(10, 20, batch_first=True),
|
|
nn.RNN(10, 20, batch_first=True)
|
|
]
|
|
first_warn = True
|
|
for rnn in rnns:
|
|
rnn.cuda()
|
|
input = torch.randn(5, 4, 10, requires_grad=True, device="cuda")
|
|
hx = torch.randn(1, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars = [input, hx] + list(rnn.parameters())
|
|
if isinstance(rnn, nn.LSTM):
|
|
# LSTM with projections has different hx size
|
|
if rnn.proj_size > 0:
|
|
hx = torch.randn(1, 5, 10, requires_grad=True, device="cuda")
|
|
all_vars[1] = hx
|
|
cx = torch.randn(1, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars[2:2] = [cx]
|
|
hx = (hx, cx)
|
|
|
|
output = rnn(input, hx)
|
|
output[0].sum().backward()
|
|
grads = [v.grad.data.clone() for v in all_vars]
|
|
for v in all_vars:
|
|
v.grad.data.zero_()
|
|
|
|
# Weights will no longer view onto the same chunk of memory
|
|
weight = all_vars[4]
|
|
weight_data = weight.data.clone()
|
|
with torch.no_grad():
|
|
weight.set_(weight_data)
|
|
|
|
for _ in range(2):
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output_noncontig = rnn(input, hx)
|
|
if first_warn:
|
|
self.assertEqual(len(w), 1)
|
|
self.assertIn('weights are not part of single contiguous chunk of memory', w[0].message.args[0])
|
|
first_warn = False
|
|
warnings.resetwarnings()
|
|
output_noncontig[0].sum().backward()
|
|
grads_noncontig = [v.grad.data.clone() for v in all_vars]
|
|
for v in all_vars:
|
|
v.grad.data.zero_()
|
|
self.assertEqual(output, output_noncontig)
|
|
self.assertEqual(grads_noncontig, grads)
|
|
|
|
# Make sure these still share storage
|
|
weight_data[:] = 4
|
|
self.assertEqual(weight_data, all_vars[4].data)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, 'CUDNN not available')
|
|
def test_cudnn_weight_tying(self):
|
|
rnns = [
|
|
nn.LSTM(10, 20, batch_first=True, bidirectional=True),
|
|
nn.LSTM(10, 20, batch_first=True, bidirectional=True, proj_size=10),
|
|
nn.GRU(10, 20, batch_first=True, bidirectional=True),
|
|
nn.RNN(10, 20, batch_first=True, bidirectional=True)
|
|
]
|
|
for rnn in rnns:
|
|
rnn.bias_ih_l0_reverse = rnn.bias_ih_l0
|
|
rnn.cuda()
|
|
input = torch.randn(5, 4, 10, requires_grad=True, device="cuda")
|
|
hx = torch.randn(2, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars = [input, hx] + list(rnn.parameters())
|
|
opt = torch.optim.SGD(rnn.parameters(), lr=0.1)
|
|
opt.zero_grad()
|
|
if isinstance(rnn, nn.LSTM):
|
|
# LSTM with projections has different hx size
|
|
if rnn.proj_size > 0:
|
|
hx = torch.randn(2, 5, 10, requires_grad=True, device="cuda")
|
|
all_vars[1] = hx
|
|
cx = torch.randn(2, 5, 20, requires_grad=True, device="cuda")
|
|
all_vars[2:2] = [cx]
|
|
hx = (hx, cx)
|
|
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output = rnn(input, hx)
|
|
output[0].sum().backward()
|
|
|
|
opt.step()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
output_cuda = rnn(input, hx)
|
|
rnn.cpu()
|
|
hx = (hx[0].cpu(), hx[1].cpu()) if isinstance(rnn, nn.LSTM) else hx.cpu()
|
|
output_cpu = rnn(input.cpu(), hx)
|
|
self.assertEqual(output_cuda, output_cpu)
|
|
|
|
|
|
def test_transformer_args_check(self):
|
|
model_name = 'Transformer'
|
|
d_model = 128
|
|
nhead = 4
|
|
num_encoder_layers = 2
|
|
num_decoder_layers = 3
|
|
dim_feedforward = 65
|
|
dropout = 0.3
|
|
bsz = 3
|
|
seq_len = 35
|
|
tgt_len = 15
|
|
activations = [F.relu, F.gelu]
|
|
|
|
wrong_bsz = 7
|
|
wrong_d_model = 63
|
|
wrong_nhead = 5
|
|
wrong_activation = "abc"
|
|
|
|
def test(encoder_input_shape, decoder_input_shape,
|
|
src_mask_len=None, tgt_mask_len=None, memory_mask_size=None,
|
|
src_key_padding_mask_size=None, tgt_key_padding_mask_size=None,
|
|
memory_key_padding_mask_size=None,
|
|
src_is_causal=False, tgt_is_causal=False,
|
|
memory_is_causal=False):
|
|
|
|
encoder_input = torch.randn(encoder_input_shape)
|
|
decoder_input = torch.randn(decoder_input_shape)
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers,
|
|
num_decoder_layers, dim_feedforward, dropout)
|
|
|
|
if src_mask_len is not None:
|
|
src_mask = model.generate_square_subsequent_mask(src_mask_len)
|
|
else:
|
|
src_mask = None
|
|
|
|
if tgt_mask_len is not None:
|
|
tgt_mask = model.generate_square_subsequent_mask(tgt_mask_len)
|
|
else:
|
|
tgt_mask = None
|
|
|
|
if memory_mask_size is not None:
|
|
memory_task = torch.rand(memory_mask_size)
|
|
else:
|
|
memory_task = None
|
|
|
|
if src_key_padding_mask_size is not None:
|
|
src_key_padding_mask = torch.rand(src_key_padding_mask_size) >= 0.5
|
|
else:
|
|
src_key_padding_mask = None
|
|
|
|
if tgt_key_padding_mask_size is not None:
|
|
tgt_key_padding_mask = torch.rand(tgt_key_padding_mask_size) >= 0.5
|
|
else:
|
|
tgt_key_padding_mask = None
|
|
|
|
if memory_key_padding_mask_size is not None:
|
|
memory_key_padding_mask = torch.rand(memory_key_padding_mask_size) >= 0.5
|
|
else:
|
|
memory_key_padding_mask = None
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
model(encoder_input, decoder_input,
|
|
src_mask=src_mask,
|
|
tgt_mask=tgt_mask,
|
|
memory_mask=memory_task,
|
|
src_key_padding_mask=src_key_padding_mask,
|
|
tgt_key_padding_mask=tgt_key_padding_mask,
|
|
memory_key_padding_mask=memory_key_padding_mask,
|
|
src_is_causal=src_is_causal,
|
|
tgt_is_causal=tgt_is_causal,
|
|
memory_is_causal=memory_is_causal)
|
|
|
|
|
|
correct_encoder_input_shape = (seq_len, bsz, d_model)
|
|
correct_decoder_input_shape = (tgt_len, bsz, d_model)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
# Incorrect encoder_input batch size
|
|
encoder_input_shape = update_shape(correct_encoder_input_shape, 1, wrong_bsz)
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect decoder_input batch size
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = update_shape(correct_decoder_input_shape, 1, wrong_bsz)
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect encoder_input input size
|
|
encoder_input_shape = update_shape(correct_encoder_input_shape, 2, wrong_d_model)
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect decoder_input input size
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = update_shape(correct_decoder_input_shape, 2, wrong_d_model)
|
|
test(encoder_input_shape, decoder_input_shape)
|
|
|
|
# Incorrect nhead
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
model = getattr(nn, model_name)(d_model, wrong_nhead, num_encoder_layers,
|
|
num_decoder_layers, dim_feedforward, dropout)
|
|
|
|
# Incorrect src_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_src_mask_size = seq_len + 1
|
|
test(encoder_input_shape, decoder_input_shape, src_mask_len=wrong_src_mask_size)
|
|
|
|
# Incorrect tgt_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_tgt_mask_size = tgt_len + 1
|
|
test(encoder_input_shape, decoder_input_shape, tgt_mask_len=wrong_tgt_mask_size)
|
|
|
|
# Incorrect memory_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
wrong_tgt_mask_size = tgt_len + 1
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
memory_mask_size=(wrong_tgt_mask_size, wrong_src_mask_size))
|
|
|
|
# Incorrect src_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
src_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size))
|
|
|
|
# Incorrect tgt_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
tgt_key_padding_mask_size=(wrong_bsz, wrong_tgt_mask_size))
|
|
|
|
# Incorrect memory_key_padding_mask
|
|
encoder_input_shape = correct_encoder_input_shape
|
|
decoder_input_shape = correct_decoder_input_shape
|
|
with self.assertRaises(AssertionError):
|
|
test(encoder_input_shape, decoder_input_shape,
|
|
memory_key_padding_mask_size=(wrong_bsz, wrong_src_mask_size))
|
|
|
|
# Correct activations
|
|
for activation in activations:
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, activation)
|
|
# Incorrect activation
|
|
with self.assertRaises(RuntimeError):
|
|
model = getattr(nn, model_name)(d_model, nhead, num_encoder_layers, num_decoder_layers,
|
|
dim_feedforward, dropout, wrong_activation)
|
|
|
|
|
|
def test_transformer_layer_args_check(self):
|
|
model_names = ['TransformerEncoderLayer', 'TransformerDecoderLayer']
|
|
d_model = 128
|
|
nhead = 4
|
|
dim_feedforward = 65
|
|
dropout = 0.3
|
|
bsz = 3
|
|
seq_len = 35
|
|
tgt_len = 15
|
|
activations = [F.relu, F.gelu]
|
|
|
|
wrong_activation = "abc"
|
|
|
|
encoder_input_shape = (seq_len, bsz, d_model)
|
|
decoder_input_shape = (tgt_len, bsz, d_model)
|
|
|
|
encoder_input = torch.randn(encoder_input_shape)
|
|
decoder_input = torch.randn(decoder_input_shape)
|
|
|
|
for model_name in model_names:
|
|
for activation in activations:
|
|
model = getattr(nn, model_name)(d_model, nhead, dim_feedforward,
|
|
dropout, activation)
|
|
# Incorrect activation
|
|
for model_name in model_names:
|
|
with self.assertRaises(RuntimeError):
|
|
model = getattr(nn, model_name)(d_model, nhead, dim_feedforward,
|
|
dropout, wrong_activation)
|
|
|
|
def test_rnn_args_check(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
bad_size = 7 # prime number so that no size can divide it.
|
|
|
|
def test(input_shape, hidden_shape, mode):
|
|
for input, hidden in get_inputs(input_shape, hidden_shape, mode):
|
|
model = getattr(nn, mode)(input_size, hidden_size, num_layers)
|
|
self.assertRaises(RuntimeError, lambda: model(input, hidden))
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
def get_inputs(input_shape, hidden_shape, mode):
|
|
'''returns list( tuple(input, hidden) )
|
|
where input, hidden are inputs to a model'''
|
|
input = torch.randn(input_shape)
|
|
hidden = torch.randn(hidden_shape)
|
|
if mode != 'LSTM':
|
|
return [(input, hidden)]
|
|
if hidden_shape == correct_hidden_shape:
|
|
return [(input, (hidden, hidden))]
|
|
good_hidden = torch.randn(correct_hidden_shape)
|
|
return [
|
|
(input, (hidden, good_hidden)),
|
|
(input, (good_hidden, hidden)),
|
|
]
|
|
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
for mode in rnn_modes:
|
|
# Incorrect input batch size
|
|
input_shape = update_shape(correct_input_shape, 1, bad_size)
|
|
hidden_shape = correct_hidden_shape
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden batch size
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 1, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect input size
|
|
input_shape = update_shape(correct_input_shape, 2, bad_size)
|
|
hidden_shape = correct_hidden_shape
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 2, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
# Incorrect hidden[0]
|
|
input_shape = correct_input_shape
|
|
hidden_shape = update_shape(correct_hidden_shape, 0, bad_size)
|
|
test(input_shape, hidden_shape, mode)
|
|
|
|
def test_projections_lstm_args_check(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
proj_size = 2
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
bad_size = 7 # prime number so that no size can divide it.
|
|
|
|
def test(input_shape, hidden_h_shape, hidden_c_shape):
|
|
for input, hidden in get_inputs(input_shape, hidden_h_shape, hidden_c_shape):
|
|
model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size)
|
|
self.assertRaises(RuntimeError, lambda: model(input, hidden))
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size)
|
|
correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
def update_shape(shape, dim, new_dim_size):
|
|
new_shape = list(shape)
|
|
new_shape[dim] = new_dim_size
|
|
return tuple(new_shape)
|
|
|
|
def get_inputs(input_shape, hidden_h_shape, hidden_c_shape):
|
|
'''returns list( tuple(input, hidden) )
|
|
where input, hidden are inputs to a model'''
|
|
input = torch.randn(input_shape)
|
|
hidden_h = torch.randn(hidden_h_shape)
|
|
hidden_c = torch.randn(hidden_c_shape)
|
|
return [(input, (hidden_h, hidden_c))]
|
|
|
|
# Incorrect input batch size
|
|
input_shape = update_shape(correct_input_shape, 1, bad_size)
|
|
test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape)
|
|
|
|
# Incorrect hidden batch size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 1, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 1, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect input size
|
|
input_shape = update_shape(correct_input_shape, 2, bad_size)
|
|
test(input_shape, correct_hidden_h_shape, correct_hidden_c_shape)
|
|
|
|
# Incorrect hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 2, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 2, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect hidden[0]
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size)
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect proj size = hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, hidden_size)
|
|
hidden_c_shape = correct_hidden_c_shape
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect proj size != hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = update_shape(correct_hidden_h_shape, 0, bad_size)
|
|
hidden_c_shape = correct_hidden_c_shape
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
# Incorrect cell size != hidden size
|
|
input_shape = correct_input_shape
|
|
hidden_h_shape = correct_hidden_h_shape
|
|
hidden_c_shape = update_shape(correct_hidden_c_shape, 0, bad_size)
|
|
test(input_shape, hidden_h_shape, hidden_c_shape)
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_rnn_check_device(self):
|
|
import copy
|
|
input_size = 3
|
|
hidden_size = 5
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
|
|
for mode in rnn_modes:
|
|
model = getattr(nn, mode)(input_size, hidden_size, num_layers)
|
|
model_cuda = copy.deepcopy(model).to('cuda:0')
|
|
input = torch.randn(correct_input_shape)
|
|
hidden = torch.randn(correct_hidden_shape)
|
|
|
|
# input and weights are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and parameter tensors are not at the same device"):
|
|
model(input.to('cuda:0'))
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and parameter tensors are not at the same device"):
|
|
model_cuda(input)
|
|
|
|
# input and hiddens are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"Input and hidden tensors are not at the same device"):
|
|
if mode == 'LSTM':
|
|
model(input, (hidden.to('cuda:0'), hidden.to('cuda:0')))
|
|
else:
|
|
model(input, (hidden.to('cuda:0')))
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"Input and hidden tensors are not at the same device"):
|
|
if mode == 'LSTM':
|
|
model_cuda(input.to('cuda:0'), (hidden, hidden))
|
|
else:
|
|
model_cuda(input.to('cuda:0'), (hidden))
|
|
|
|
# hidden tensors are not at the same CUDA device
|
|
if mode == 'LSTM':
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and hidden tensors are not at the same device"):
|
|
model(input.to('cuda:0'), (hidden.to('cuda:0'), hidden.to('cuda:1')))
|
|
|
|
@unittest.skipIf(not TEST_MULTIGPU, "multi-GPU not supported")
|
|
def test_projections_lstm_check_device(self):
|
|
input_size = 3
|
|
hidden_size = 5
|
|
proj_size = 2
|
|
num_layers = 2
|
|
batch_size = 4
|
|
seq_len = 6
|
|
num_directions = 1
|
|
|
|
correct_input_shape = (seq_len, batch_size, input_size)
|
|
correct_hidden_h_shape = (num_layers * num_directions, batch_size, proj_size)
|
|
correct_hidden_c_shape = (num_layers * num_directions, batch_size, hidden_size)
|
|
|
|
model = nn.LSTM(input_size, hidden_size, num_layers, proj_size=proj_size)
|
|
input = torch.randn(correct_input_shape)
|
|
hidden_h = torch.randn(correct_hidden_h_shape)
|
|
hidden_c = torch.randn(correct_hidden_c_shape)
|
|
|
|
# input and weights are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and parameter tensors are not at the same device"):
|
|
model(input.to('cuda:0'))
|
|
|
|
# input and hiddens are not at the same device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"Input and hidden tensors are not at the same device"):
|
|
model(input, (hidden_h.to('cuda:0'), hidden_c.to('cuda:0')))
|
|
|
|
# hidden tensors are not at the same CUDA device
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"Input and hidden tensors are not at the same device"):
|
|
model(input.to('cuda:0'), (hidden_h.to('cuda:0'), hidden_c.to('cuda:1')))
|
|
|
|
def test_rnn_initial_hidden_state(self):
|
|
rnn_modes = ['RNN', 'GRU', 'LSTM']
|
|
for mode in rnn_modes:
|
|
rnn = getattr(nn, mode)(30, 20, 2)
|
|
input = torch.randn(10, 32, 30)
|
|
hidden = torch.zeros(2, 32, 20)
|
|
|
|
if mode == 'LSTM':
|
|
hidden = (hidden, hidden)
|
|
output1, hidden1 = rnn(input, hidden)
|
|
output2, hidden2 = rnn(input)
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hidden1, hidden2)
|
|
|
|
def test_projections_lstm_initial_hidden_state(self):
|
|
for bidir in [False, True]:
|
|
rnn = nn.LSTM(30, 20, 2, bidirectional=bidir, proj_size=10)
|
|
num_dirs = 2 if bidir else 1
|
|
input = torch.randn(10, 32, 30)
|
|
hidden_h = torch.zeros(2 * num_dirs, 32, 10)
|
|
hidden_c = torch.zeros(2 * num_dirs, 32, 20)
|
|
hidden = (hidden_h, hidden_c)
|
|
output1, hidden1 = rnn(input, hidden)
|
|
output2, hidden2 = rnn(input)
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hidden1, hidden2)
|
|
|
|
def test_projections_errors_on_gru_and_rnn(self):
|
|
error_msg = "proj_size argument is only supported for LSTM, not RNN or GRU"
|
|
for mode in ['RNN', 'GRU']:
|
|
with self.assertRaisesRegex(ValueError, error_msg):
|
|
rnn = getattr(nn, mode)(30, 20, 2, proj_size=10)
|
|
|
|
def _test_RNN_cpu_vs_cudnn(self, dropout, dtype=torch.double):
|
|
|
|
def forward_backward(cuda, rnn, input_val, grad_output, weights_val, hx_val, grad_hy,
|
|
cx_val=None, grad_cy=None):
|
|
is_lstm = isinstance(rnn, nn.LSTM)
|
|
|
|
for x_layer, y_layer in zip(rnn.all_weights, weights_val):
|
|
for x, y in zip(x_layer, y_layer):
|
|
x.data.copy_(y.data)
|
|
|
|
if isinstance(input_val, rnn_utils.PackedSequence):
|
|
input = rnn_utils.PackedSequence(
|
|
input_val.data.data.requires_grad_(True), input_val.batch_sizes)
|
|
input_var = input.data
|
|
else:
|
|
input = input_val.clone().requires_grad_(True)
|
|
input_var = input
|
|
if is_lstm:
|
|
if cx_val is None:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
hx_val.add(1).requires_grad_(True))
|
|
else:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
cx_val.add(1).requires_grad_(True))
|
|
else:
|
|
hx = hx_val.clone().requires_grad_(True)
|
|
|
|
if cuda:
|
|
rnn.cuda()
|
|
input_var.data = input_var.data.cuda()
|
|
if is_lstm:
|
|
hx[0].data = hx[0].data.cuda()
|
|
hx[1].data = hx[1].data.cuda()
|
|
else:
|
|
hx.data = hx.data.cuda()
|
|
grad_hy = grad_hy.cuda()
|
|
if grad_cy is not None:
|
|
grad_cy = grad_cy.cuda()
|
|
grad_output = grad_output.cuda()
|
|
|
|
output, hy = rnn(input, hx)
|
|
|
|
if isinstance(output, rnn_utils.PackedSequence):
|
|
output = output.data
|
|
|
|
if is_lstm:
|
|
if grad_cy is None:
|
|
torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_hy + 1])
|
|
else:
|
|
torch.autograd.backward([output, hy[0], hy[1]], [grad_output, grad_hy, grad_cy + 1])
|
|
else:
|
|
torch.autograd.backward([output, hy], [grad_output, grad_hy])
|
|
|
|
return {'output': output.data,
|
|
'hy': hy[0].data if is_lstm else hy.data,
|
|
'weights': rnn.all_weights,
|
|
'grad_input': input_var.grad.data,
|
|
'grad_hx': hx[0].grad.data if is_lstm else hx.grad.data,
|
|
'cy': hy[1].data if is_lstm else None,
|
|
'grad_cx': hx[1].grad.data if is_lstm else None}
|
|
|
|
input_size = 10
|
|
hidden_size = 6
|
|
proj_size = 3
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
|
|
def make_noncontig(tensor):
|
|
ndim = tensor.dim()
|
|
return torch.stack([tensor.clone().zero_(), tensor], ndim).select(ndim, 1)
|
|
|
|
def compare_cpu_gpu(outputs_cpu, outputs_gpu):
|
|
self.assertEqual(list(outputs_cpu.keys()), list(outputs_gpu.keys()))
|
|
for key in outputs_cpu.keys():
|
|
if key != 'weights':
|
|
self.assertEqual(outputs_cpu[key], outputs_gpu[key], atol=5e-5, rtol=0, msg=key)
|
|
|
|
# check grad weights separately, as nested dict
|
|
for cpu_layer_weight, gpu_layer_weight in zip(outputs_cpu['weights'], outputs_gpu['weights']):
|
|
for (cpu_weight, gpu_weight) in zip(cpu_layer_weight, gpu_layer_weight):
|
|
self.assertEqual(cpu_weight.grad.data, gpu_weight.grad.data, atol=5e-5, rtol=0)
|
|
|
|
for module in (nn.RNN, nn.LSTM, nn.GRU):
|
|
for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \
|
|
in product((True, False), repeat=6):
|
|
|
|
num_directions = 2 if bidirectional else 1
|
|
if batch_first:
|
|
input_val = torch.randn(batch, seq_length, input_size, dtype=dtype)
|
|
grad_output = torch.randn(batch, seq_length, hidden_size * num_directions, dtype=dtype)
|
|
else:
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, hidden_size * num_directions, dtype=dtype)
|
|
|
|
hx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
if not contig:
|
|
grad_output = make_noncontig(grad_output)
|
|
grad_hy = make_noncontig(grad_hy)
|
|
input_var = make_noncontig(input_val)
|
|
hx_val = make_noncontig(hx_val)
|
|
|
|
if variable_len:
|
|
lengths = [7, 5, 5, 2, 1, 1]
|
|
if lens_as_tensor:
|
|
lengths = torch.tensor(lengths, dtype=torch.long)
|
|
input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first)
|
|
grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data
|
|
|
|
rnn = module(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first).to(dtype)
|
|
|
|
outputs_cpu = forward_backward(
|
|
False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
rnn_gpu = module(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first).to(dtype)
|
|
|
|
outputs_gpu = forward_backward(
|
|
True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
for nonlinearity in ('tanh', 'relu'):
|
|
hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(
|
|
seq_length, batch, hidden_size * num_directions, dtype=dtype)
|
|
grad_hy = torch.randn(
|
|
num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
rnn = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype)
|
|
outputs_cpu = forward_backward(False, rnn, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
rnn_gpu = nn.RNN(input_size, hidden_size, num_layers, bias=bias, nonlinearity=nonlinearity).to(dtype)
|
|
outputs_gpu = forward_backward(True, rnn_gpu, input_val, grad_output, rnn.all_weights, hx_val, grad_hy)
|
|
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
# checking LSTM with projections
|
|
for bias, bidirectional, batch_first, contig, variable_len, lens_as_tensor \
|
|
in product((True, False), repeat=6):
|
|
num_directions = 2 if bidirectional else 1
|
|
if batch_first:
|
|
input_val = torch.randn(batch, seq_length, input_size, dtype=dtype)
|
|
grad_output = torch.randn(batch, seq_length, proj_size * num_directions, dtype=dtype)
|
|
else:
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, proj_size * num_directions, dtype=dtype)
|
|
|
|
hx_val = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype)
|
|
cx_val = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers * num_directions, batch, proj_size, dtype=dtype)
|
|
grad_cy = torch.randn(num_layers * num_directions, batch, hidden_size, dtype=dtype)
|
|
|
|
if not contig:
|
|
grad_output = make_noncontig(grad_output)
|
|
grad_hy = make_noncontig(grad_hy)
|
|
grad_cy = make_noncontig(grad_cy)
|
|
input_var = make_noncontig(input_val)
|
|
hx_val = make_noncontig(hx_val)
|
|
cx_val = make_noncontig(cx_val)
|
|
|
|
if variable_len:
|
|
lengths = [7, 5, 5, 2, 1, 1]
|
|
if lens_as_tensor:
|
|
lengths = torch.tensor(lengths, dtype=torch.long)
|
|
input_val = rnn_utils.pack_padded_sequence(input_val, lengths, batch_first=batch_first)
|
|
grad_output = rnn_utils.pack_padded_sequence(grad_output, lengths, batch_first=batch_first).data
|
|
|
|
rnn = nn.LSTM(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first,
|
|
proj_size=proj_size).to(dtype)
|
|
|
|
outputs_cpu = forward_backward(
|
|
False, rnn, input_val, grad_output, rnn.all_weights,
|
|
hx_val, grad_hy, cx_val, grad_cy)
|
|
|
|
rnn_gpu = nn.LSTM(input_size,
|
|
hidden_size,
|
|
num_layers,
|
|
bias=bias,
|
|
dropout=dropout,
|
|
bidirectional=bidirectional,
|
|
batch_first=batch_first,
|
|
proj_size=proj_size).to(dtype)
|
|
|
|
outputs_gpu = forward_backward(
|
|
True, rnn_gpu, input_val, grad_output, rnn.all_weights,
|
|
hx_val, grad_hy, cx_val, grad_cy)
|
|
compare_cpu_gpu(outputs_cpu, outputs_gpu)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_cpu_vs_cudnn_no_dropout(self):
|
|
dtype = torch.double
|
|
self._test_RNN_cpu_vs_cudnn(0, dtype)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_cpu_vs_cudnn_with_dropout(self):
|
|
# Because of dropout randomness, can only compare dropout=0 and dropout=1
|
|
self._test_RNN_cpu_vs_cudnn(1)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_cudnn_weight_norm(self):
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
|
|
# runs on CPU to acquire expected output
|
|
def check_weight_norm(m, name):
|
|
input = torch.randn(seq_length, batch, input_size)
|
|
expected_output = m(input)
|
|
|
|
# adds weight normalization
|
|
m = torch.nn.utils.weight_norm(m, name=name)
|
|
|
|
# moves to CUDA
|
|
m = m.cuda()
|
|
input = input.cuda()
|
|
|
|
# otherwise, subsequent warnings will be hidden, and further tests rely on them
|
|
warnings.simplefilter("always")
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
# remove weight norm
|
|
m = torch.nn.utils.remove_weight_norm(m, name=name)
|
|
self.assertEqual(m(input), expected_output)
|
|
|
|
check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers), 'weight_hh_l0')
|
|
check_weight_norm(nn.LSTM(input_size, hidden_size, num_layers, proj_size=3), 'weight_hr_l0')
|
|
|
|
@unittest.skipIf(not TEST_CUDA, 'CUDA not available')
|
|
def test_partial_flat_weights(self):
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
|
|
m = nn.LSTM(input_size, hidden_size, num_layers)
|
|
inp = torch.randn(3, 2, 10)
|
|
out_expected = m(inp)
|
|
# deletes an attribute of original LSTM
|
|
weight_orig = m.weight_hh_l0
|
|
del m.weight_hh_l0
|
|
self.assertFalse(hasattr(m, "weight_hh_l0"))
|
|
# verifies that moving to CUDA with only some attributes defined
|
|
# does not throw an error
|
|
m.cuda()
|
|
# recompute the weight and make sure that module can be used
|
|
m.weight_hh_l0 = weight_orig.cuda()
|
|
inp = inp.cuda()
|
|
# otherwise, subsequent warnings will be hidden, and further tests rely on them
|
|
warnings.simplefilter("always")
|
|
self.assertEqual(m(inp)[0].cpu(), out_expected[0])
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
@set_default_dtype(torch.double)
|
|
def test_RNN_dropout(self):
|
|
# checking the assumption that cuDNN sticks dropout in between
|
|
# RNN layers
|
|
for p in (0, 0.276, 0.731, 1):
|
|
for train in (True, False):
|
|
for cuda in (True, False):
|
|
rnn = nn.RNN(10, 1000, 2, bias=False, dropout=p, nonlinearity='relu')
|
|
if cuda:
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
rnn.weight_ih_l0.data.fill_(1)
|
|
rnn.weight_hh_l0.data.fill_(1)
|
|
rnn.weight_ih_l1.data.fill_(1)
|
|
rnn.weight_hh_l1.data.fill_(1)
|
|
input = torch.ones(1, 1, 10)
|
|
hx = torch.zeros(2, 1, 1000)
|
|
if cuda:
|
|
input = input.cuda()
|
|
hx = hx.cuda()
|
|
|
|
output, hy = rnn(input, hx)
|
|
self.assertEqual(output.data.min(), output.data.max())
|
|
output_val = output.data[0][0][0]
|
|
if p == 0 or not train:
|
|
self.assertEqual(output_val, 10000)
|
|
elif p == 1:
|
|
self.assertEqual(output_val, 0)
|
|
else:
|
|
self.assertGreater(output_val, 8000)
|
|
self.assertLess(output_val, 12000)
|
|
denorm_mod = (output_val * (1 - p)) % 10
|
|
self.assertLess(min(denorm_mod, 10 - denorm_mod), 1e-2)
|
|
|
|
self.assertEqual(hy[0].data.min(), hy[0].data.max())
|
|
self.assertEqual(hy[1].data.min(), hy[1].data.max())
|
|
self.assertEqual(hy.data[0][0][0], 10)
|
|
self.assertEqual(hy.data[1][0][0], output_val)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
@set_default_dtype(torch.double)
|
|
def test_error_RNN_seq_len_zero(self):
|
|
# checking error message when RNN has seq_len = 0
|
|
for module in (nn.RNN, nn.LSTM, nn.GRU):
|
|
for bidirectional in [True, False]:
|
|
for device in get_all_device_types():
|
|
input = torch.ones(0, 10, 5)
|
|
rnn = module(5, 6, bidirectional=bidirectional)
|
|
if device == 'cuda':
|
|
rnn.cuda()
|
|
input = input.cuda()
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "Expected sequence length to be larger than 0 in RNN"):
|
|
rnn(input)
|
|
|
|
def test_RNN_input_size_zero(self):
|
|
for module in (nn.RNN, nn.LSTM, nn.GRU):
|
|
for device in get_all_device_types():
|
|
input = torch.zeros((5, 0, 3))
|
|
rnn = module(input_size=3, hidden_size=4)
|
|
if device == 'cuda':
|
|
rnn.cuda()
|
|
input = input.cuda()
|
|
outs = rnn(input)
|
|
self.assertEqual(outs[0].shape, torch.Size([5, 0, 4]))
|
|
# Check that backward does not cause a hard error
|
|
outs[0].sum().backward()
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_RNN_dropout_state(self):
|
|
for p in (0, 0.1234):
|
|
for train in (True, False):
|
|
for cuda in (True, False):
|
|
rnn = nn.RNN(100, 100, 2, bias=False, dropout=p, nonlinearity='relu')
|
|
if cuda:
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
input = torch.rand(1, 1, 100)
|
|
hx = torch.rand(2, 1, 100)
|
|
if cuda:
|
|
input = input.cuda()
|
|
hx = hx.cuda()
|
|
|
|
output1, hy1 = rnn(input, hx)
|
|
output2, hy2 = rnn(input, hx)
|
|
|
|
buf = io.BytesIO()
|
|
rnn_pickle = torch.save(rnn, buf)
|
|
buf.seek(0)
|
|
# weights_only=False as this is legacy code that saves the model
|
|
rnn2 = torch.load(buf, weights_only=False)
|
|
rnn2.flatten_parameters()
|
|
output3, hy3 = rnn2(input, hx)
|
|
|
|
if p == 0 or not train:
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(output1, output3)
|
|
self.assertEqual(hy1, hy2)
|
|
self.assertEqual(hy1, hy3)
|
|
else:
|
|
self.assertNotEqual(output1, output2)
|
|
self.assertNotEqual(output1, output3)
|
|
self.assertNotEqual(hy1, hy2)
|
|
self.assertNotEqual(hy1, hy3)
|
|
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
@set_default_dtype(torch.double)
|
|
def test_RNN_change_dropout(self):
|
|
for train, cuda in product((True, False), repeat=2):
|
|
rnn = nn.RNN(100, 100, 2, dropout=0, nonlinearity='relu')
|
|
input = torch.rand(3, 2, 100)
|
|
if cuda:
|
|
input.data = input.data.cuda()
|
|
rnn.cuda()
|
|
|
|
if train:
|
|
rnn.train()
|
|
else:
|
|
rnn.eval()
|
|
|
|
prev_output = None
|
|
for p in (0, 0.5, 0, 0.7, 0.2, 1, 0.2, 0):
|
|
rnn.dropout = p
|
|
output1, hy1 = rnn(input)
|
|
output2, hy2 = rnn(input)
|
|
|
|
if p == 0 or p == 1 or not train:
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hy1, hy2)
|
|
else:
|
|
self.assertNotEqual(output1, output2)
|
|
self.assertNotEqual(hy1, hy2)
|
|
|
|
if prev_output is not None:
|
|
if not train:
|
|
self.assertEqual(output1.data, prev_output)
|
|
self.assertEqual(output2.data, prev_output)
|
|
else:
|
|
self.assertNotEqual(output1.data, prev_output)
|
|
self.assertNotEqual(output2.data, prev_output)
|
|
prev_output = output1.data
|
|
|
|
def test_inplace_thnn(self):
|
|
modules = [nn.ReLU, nn.ELU, nn.SELU, nn.CELU, nn.RReLU]
|
|
for mod in modules:
|
|
r = mod(inplace=True)
|
|
input = torch.randn(5, 5, requires_grad=True)
|
|
output = r(input + 0)
|
|
grad_output = torch.randn(5, 5)
|
|
grad_output_clone = grad_output.clone()
|
|
output.backward(grad_output)
|
|
self.assertEqual(grad_output, grad_output_clone)
|
|
|
|
|
|
def test_pixel_shuffle_unshuffle(self):
|
|
def _test_pixel_shuffle_unshuffle_helper(num_input_dims, valid_channels_dim=True,
|
|
upscale_factor=None):
|
|
# Function to imperatively ensure pixels are shuffled to the correct locations.
|
|
# Used to validate the batch operations in pixel_shuffle.
|
|
def _verify_pixel_shuffle(input, output, upscale_factor):
|
|
for c in range(output.size(-3)):
|
|
for h in range(output.size(-2)):
|
|
for w in range(output.size(-1)):
|
|
height_idx = h // upscale_factor
|
|
weight_idx = w // upscale_factor
|
|
channel_idx = (upscale_factor * (h % upscale_factor)) + (w % upscale_factor) + \
|
|
(c * upscale_factor ** 2)
|
|
self.assertEqual(output[..., c, h, w], input[..., channel_idx, height_idx, weight_idx])
|
|
|
|
upscale_factor = random.randint(2, 5) if upscale_factor is None else upscale_factor
|
|
# If valid_channels_dim=False, add 1 to make channels dim indivisible by upscale_factor ** 2.
|
|
channels = random.randint(1, 4) * upscale_factor ** 2 + (0 if valid_channels_dim else 1)
|
|
height = random.randint(5, 10)
|
|
width = random.randint(5, 10)
|
|
|
|
if num_input_dims == 1:
|
|
input = torch.rand(channels, requires_grad=True)
|
|
elif num_input_dims == 2:
|
|
input = torch.rand(height, width, requires_grad=True)
|
|
else:
|
|
batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)]
|
|
input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True)
|
|
ps = nn.PixelShuffle(upscale_factor)
|
|
pus = nn.PixelUnshuffle(downscale_factor=upscale_factor)
|
|
|
|
if num_input_dims >= 3 and valid_channels_dim and upscale_factor > 0:
|
|
output = ps(input)
|
|
_verify_pixel_shuffle(input, output, upscale_factor)
|
|
output.backward(output.data)
|
|
self.assertEqual(input.data, input.grad.data)
|
|
|
|
# Ensure unshuffle properly inverts shuffle.
|
|
unshuffle_output = pus(output)
|
|
self.assertEqual(input, unshuffle_output)
|
|
else:
|
|
self.assertRaises(RuntimeError, lambda: ps(input))
|
|
|
|
def _test_pixel_unshuffle_error_case_helper(num_input_dims, valid_height_dim=True, valid_width_dim=True,
|
|
downscale_factor=None):
|
|
downscale_factor = random.randint(2, 5) if downscale_factor is None else downscale_factor
|
|
channels = random.randint(1, 4)
|
|
# If valid_height_dim=False, add 1 to make height dim indivisible by downscale_factor.
|
|
height = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_height_dim else 1)
|
|
# If valid_width_dim=False, add 1 to make width dim indivisible by downscale_factor.
|
|
width = random.randint(3, 5) * abs(downscale_factor) + (0 if valid_width_dim else 1)
|
|
|
|
if num_input_dims == 1:
|
|
input = torch.rand(channels, requires_grad=True)
|
|
elif num_input_dims == 2:
|
|
input = torch.rand(height, width, requires_grad=True)
|
|
else:
|
|
batch_sizes = [random.randint(1, 3) for _ in range(num_input_dims - 3)]
|
|
input = torch.rand(*batch_sizes, channels, height, width, requires_grad=True)
|
|
|
|
pus = nn.PixelUnshuffle(downscale_factor)
|
|
self.assertRaises(RuntimeError, lambda: pus(input))
|
|
|
|
def _test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims):
|
|
# For 1D - 2D, this is an error case.
|
|
# For 3D - 5D, this is a success case for pixel_shuffle + pixel_unshuffle.
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims)
|
|
|
|
# Error cases for pixel_shuffle.
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, valid_channels_dim=False)
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=0)
|
|
_test_pixel_shuffle_unshuffle_helper(num_input_dims=num_input_dims, upscale_factor=-2)
|
|
|
|
# Error cases for pixel_unshuffle.
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_height_dim=False)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, valid_width_dim=False)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=0)
|
|
_test_pixel_unshuffle_error_case_helper(num_input_dims=num_input_dims, downscale_factor=-2)
|
|
|
|
def test_pixel_shuffle_unshuffle_1D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=1)
|
|
|
|
def test_pixel_shuffle_unshuffle_2D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=2)
|
|
|
|
def test_pixel_shuffle_unshuffle_3D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=3)
|
|
|
|
def test_pixel_shuffle_unshuffle_4D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=4)
|
|
|
|
def test_pixel_shuffle_unshuffle_5D():
|
|
_test_pixel_shuffle_unshuffle_for_input_dims(num_input_dims=5)
|
|
|
|
test_pixel_shuffle_unshuffle_1D()
|
|
test_pixel_shuffle_unshuffle_2D()
|
|
test_pixel_shuffle_unshuffle_3D()
|
|
test_pixel_shuffle_unshuffle_4D()
|
|
test_pixel_shuffle_unshuffle_5D()
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_pixel_shuffle_nhwc_cpu(self):
|
|
input = torch.randn(3, 18, 4, 4, device='cpu')
|
|
input = input.contiguous(memory_format=torch.channels_last).requires_grad_()
|
|
grad = torch.randn(3, 18, 4, 4, device='cpu')
|
|
ps = torch.nn.PixelShuffle(3)
|
|
pus = torch.nn.PixelUnshuffle(3)
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_ps = torch.nn.PixelShuffle(3)
|
|
ref_pus = torch.nn.PixelUnshuffle(3)
|
|
|
|
out = pus(ps(input))
|
|
out.backward(grad)
|
|
ref_out = ref_pus(ref_ps(ref_input))
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
# These tests should be OpInfo'd
|
|
def test_elu_inplace_on_view(self):
|
|
v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True, dtype=torch.double)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
view = x.narrow(0, 1, 2)
|
|
res = F.elu(view, inplace=True)
|
|
self.assertIs(res, view)
|
|
return x
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
def test_elu_inplace_gradgrad(self):
|
|
v = torch.randn(8, requires_grad=True, dtype=torch.double)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
return F.elu(x, inplace=True)
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
def test_relu_inplace_on_view(self):
|
|
v = torch.tensor([1.0, -1.0, 1.0, -1.0], requires_grad=True, dtype=torch.double)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
view = x.narrow(0, 1, 2)
|
|
res = F.relu(view, inplace=True)
|
|
self.assertIs(res, view)
|
|
return x
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
def test_PReLU_backward_requires_grad_false(self):
|
|
devices = ['cpu']
|
|
devices += ['cuda'] if TEST_CUDA else []
|
|
for d in devices:
|
|
m = nn.PReLU().to(d)
|
|
x = torch.randn(2, 3, 4, 5, device=d, requires_grad=False)
|
|
y = m(x)
|
|
y.mean().backward()
|
|
self.assertEqual(x.grad, None)
|
|
|
|
def test_bce_loss_always_nonnegative(self):
|
|
target = torch.ones(5)
|
|
input = torch.ones(5)
|
|
self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0)
|
|
|
|
target = torch.zeros(5)
|
|
input = torch.zeros(5)
|
|
self.assertEqual((nn.BCELoss()(input, target) < 0).sum(), 0)
|
|
|
|
def test_bce_with_logits_raises_if_target_and_input_are_different_size(self):
|
|
target = torch.rand(5)
|
|
input = torch.rand(5, 1)
|
|
with self.assertRaises(ValueError):
|
|
nn.BCEWithLogitsLoss()(input, target)
|
|
|
|
target = torch.rand(5, 1)
|
|
input = torch.rand(5)
|
|
with self.assertRaises(ValueError):
|
|
nn.BCEWithLogitsLoss()(input, target)
|
|
|
|
def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss(self):
|
|
sigmoid = nn.Sigmoid()
|
|
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target))
|
|
|
|
weight = torch.rand(4)
|
|
self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target))
|
|
|
|
target = torch.zeros(4, 1, dtype=torch.float)
|
|
output = torch.empty(4, 1, dtype=torch.float).fill_(-100)
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target), nn.BCELoss()(sigmoid(output), target))
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss(reduction='none')(output, target),
|
|
nn.BCELoss(reduction='none')(sigmoid(output), target))
|
|
|
|
weight = torch.rand(1, dtype=torch.float)
|
|
self.assertEqual(nn.BCEWithLogitsLoss(weight)(output, target), nn.BCELoss(weight)(sigmoid(output), target))
|
|
|
|
def test_bce_loss_input_range(self):
|
|
bceloss = nn.BCELoss()
|
|
|
|
target = torch.rand(25, 25)
|
|
output_valid = torch.rand(25, 25)
|
|
output_too_negative = output_valid - 1.0
|
|
output_too_positive = output_valid + 1.0
|
|
|
|
loss_valid = bceloss(output_valid, target)
|
|
with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'):
|
|
loss_too_negative = bceloss(output_too_negative, target)
|
|
with self.assertRaisesRegex(RuntimeError, 'between 0 and 1'):
|
|
loss_too_positive = bceloss(output_too_positive, target)
|
|
|
|
def test_bce_loss_size_mismatch(self):
|
|
bceloss = nn.BCELoss()
|
|
a = torch.rand(25)
|
|
b = torch.rand(25, 1)
|
|
with self.assertRaisesRegex(ValueError, r'Using a target size \('):
|
|
bceloss(a, b)
|
|
|
|
def test_bce_with_logits_gives_same_result_as_sigmoid_and_bce_loss_large_tensors_with_grad(self):
|
|
x_size = 1024
|
|
y_size = 256
|
|
target = torch.rand(x_size, y_size)
|
|
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
output_sig = torch.rand(x_size, y_size) - 0.5
|
|
output_logits = output_sig.clone().detach()
|
|
|
|
output_sig.requires_grad = True
|
|
output_logits.requires_grad = True
|
|
weight = torch.rand(y_size)
|
|
|
|
loss_sig = nn.BCELoss(weight, reduction=reduction)(
|
|
torch.sigmoid(output_sig), target
|
|
)
|
|
loss_logits = nn.BCEWithLogitsLoss(weight, reduction=reduction)(
|
|
output_logits, target
|
|
)
|
|
|
|
self.assertEqual(loss_logits, loss_sig)
|
|
|
|
if reduction == 'none':
|
|
grad = torch.rand(x_size, y_size)
|
|
loss_sig.backward(grad)
|
|
loss_logits.backward(grad)
|
|
else:
|
|
loss_sig.backward()
|
|
loss_logits.backward()
|
|
|
|
self.assertEqual(output_sig.grad, output_logits.grad)
|
|
|
|
def test_bce_with_logits_has_correct_forward_grad(self):
|
|
output = torch.randn(3, 5, requires_grad=True, dtype=torch.double)
|
|
target = torch.randn(3, 5, dtype=torch.double)
|
|
for reduction in ('sum', 'mean', 'none'):
|
|
gradcheck(lambda self, target: nn.BCEWithLogitsLoss(reduction=reduction)(self, target),
|
|
(output, target), check_forward_ad=True)
|
|
|
|
def test_bce_with_logits_has_correct_grad_at_zero(self):
|
|
output = torch.zeros(3, 1, requires_grad=True)
|
|
target = torch.zeros(3, 1)
|
|
nn.BCEWithLogitsLoss(reduction='sum')(output, target).backward()
|
|
expected_grad = torch.empty(3, 1).fill_(0.5)
|
|
self.assertEqual(output.grad, expected_grad)
|
|
|
|
def test_bce_with_logits_broadcasts_weights(self):
|
|
target = torch.rand(16, 4)
|
|
output = torch.rand(16, 4) - 0.5
|
|
|
|
weight = torch.rand(4)
|
|
out1 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
weight = torch.rand(16, 1)
|
|
out1 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCEWithLogitsLoss(weight)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
def test_bce_with_logits_ones_in_pos_weights_are_the_same_as_none(self):
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
pos_weight = torch.ones(64, 4)
|
|
|
|
self.assertEqual(nn.BCEWithLogitsLoss()(output, target),
|
|
nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target))
|
|
|
|
def test_bce_with_logits_broadcasts_pos_weights(self):
|
|
target = torch.rand(64, 4)
|
|
output = torch.rand(64, 4) - 0.5
|
|
pos_weight = torch.rand(4)
|
|
out1 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target)
|
|
|
|
pos_weight1 = pos_weight.expand(1, 4)
|
|
out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight1)(output, target)
|
|
|
|
pos_weight2 = pos_weight.expand(64, 4)
|
|
out3 = nn.BCEWithLogitsLoss(pos_weight=pos_weight2)(output, target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
self.assertEqual(out1, out3)
|
|
|
|
def test_bce_with_logits_with_pos_weight_has_correct_grad_at_zero(self):
|
|
output = torch.zeros(3, 1, requires_grad=True)
|
|
target = torch.zeros(3, 1)
|
|
pos_weight = torch.ones(3, 1)
|
|
nn.BCEWithLogitsLoss(pos_weight=pos_weight, reduction='sum')(output, target).backward()
|
|
expected_grad = torch.empty(3, 1).fill_(0.5)
|
|
grad = output.grad
|
|
self.assertEqual(grad, expected_grad)
|
|
|
|
def test_bce_with_logits_stability(self):
|
|
output = torch.tensor([0., -120.])
|
|
target = torch.tensor([0., 1.])
|
|
pos_weight = torch.tensor([1., 1.])
|
|
|
|
out1 = nn.BCEWithLogitsLoss()(output, target)
|
|
self.assertTrue(torch.isfinite(out1).all().item())
|
|
|
|
out2 = nn.BCEWithLogitsLoss(pos_weight=pos_weight)(output, target)
|
|
self.assertTrue(torch.isfinite(out2).all().item())
|
|
|
|
def test_bce_loss_broadcasts_weights(self):
|
|
sigmoid = nn.Sigmoid()
|
|
target = torch.rand(16, 4)
|
|
output = torch.rand(16, 4) - 0.5
|
|
|
|
weight = torch.rand(4)
|
|
out1 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
weight = torch.rand(16, 1)
|
|
out1 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
weight = weight.expand(16, 4).contiguous()
|
|
out2 = nn.BCELoss(weight)(sigmoid(output), target)
|
|
|
|
self.assertEqual(out1, out2)
|
|
|
|
def test_hardtanh_inplace_gradgrad(self):
|
|
v = torch.randn(8, requires_grad=True, dtype=torch.double)
|
|
|
|
def func(root):
|
|
x = root.clone()
|
|
return F.hardtanh(x, inplace=True)
|
|
|
|
gradcheck(func, [v])
|
|
gradgradcheck(func, [v])
|
|
|
|
# test hardtanh backward for large tensor
|
|
def test_hardtanh_backward(self):
|
|
x = torch.randn(128, 10000, requires_grad=True)
|
|
grad = torch.randn(128, 10000)
|
|
z = torch.zeros(128, 10000)
|
|
y = F.hardtanh(x)
|
|
y.backward(grad)
|
|
# ref backward path for hardtanh
|
|
mask = (x > -1) & (x < 1)
|
|
x_grad_ref = torch.where(mask, grad, z)
|
|
self.assertEqual(x.grad, x_grad_ref)
|
|
|
|
def test_batchnorm_nhwc_cpu(self):
|
|
def helper(self, mod, size, dtype, mixed_dtype=False, format=torch.channels_last, precision=None):
|
|
channels = size[1]
|
|
input = torch.randn(size, dtype=dtype, device='cpu', requires_grad=True)
|
|
input = input.contiguous(memory_format=format).to(dtype)
|
|
input.retain_grad()
|
|
grad = torch.randn(size, dtype=dtype, device='cpu')
|
|
grad = grad.contiguous(memory_format=format)
|
|
bn = mod(channels).cpu().to(dtype)
|
|
bn.weight.data.uniform_()
|
|
bn.bias.data.uniform_()
|
|
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_bn = mod(channels).cpu().to(dtype)
|
|
ref_bn.load_state_dict(bn.state_dict())
|
|
|
|
if mixed_dtype:
|
|
bn.float()
|
|
ref_bn.float()
|
|
|
|
out = bn(input)
|
|
out.backward(grad)
|
|
ref_out = ref_bn(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=format))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(bn.weight.grad, ref_bn.weight.grad, atol=precision, rtol=precision)
|
|
self.assertEqual(bn.bias.grad, ref_bn.bias.grad)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
# test NC11 and N1HW; test mixed dtype
|
|
for shape in [(4, 8, 10, 10), (4, 1, 9, 9), (4, 9, 1, 1)]:
|
|
for dtype in [torch.float, torch.bfloat16, torch.float16]:
|
|
for mixed_dtype in [False, True]:
|
|
if dtype == torch.float:
|
|
mixed_dtype = False
|
|
helper(self, nn.BatchNorm2d, shape, dtype, mixed_dtype, torch.channels_last)
|
|
|
|
precisons = {torch.float: 1e-4, torch.bfloat16: 1e-4, torch.float16: None}
|
|
for shape in [(4, 8, 2, 10, 10), (4, 1, 2, 9, 9), (4, 9, 1, 1, 1)]:
|
|
for dtype in [torch.float, torch.bfloat16, torch.float16]:
|
|
for mixed_dtype in [False, True]:
|
|
if dtype == torch.float:
|
|
mixed_dtype = False
|
|
helper(self, nn.BatchNorm3d, shape, dtype, mixed_dtype, torch.channels_last_3d, precisons[dtype])
|
|
|
|
def test_batchnorm_half_overflow(self):
|
|
def helper(self, mod, size, format):
|
|
channels = size[1]
|
|
input = torch.randn(size, dtype=torch.half, device='cpu', requires_grad=True)
|
|
input = input.contiguous(memory_format=format)
|
|
bn = mod(channels).cpu().to(torch.half)
|
|
out = bn(input)
|
|
|
|
ref_bn = mod(channels).cpu().to(torch.float)
|
|
ref_bn.load_state_dict(bn.to(torch.float).state_dict())
|
|
ref_out = ref_bn(input)
|
|
|
|
self.assertFalse(out.isinf().any())
|
|
self.assertFalse(out.isnan().any())
|
|
self.assertEqual(out, ref_out)
|
|
|
|
for format in [torch.contiguous_format, torch.channels_last]:
|
|
helper(self, nn.BatchNorm2d, (4, 80, 500, 500), format)
|
|
|
|
for format in [torch.contiguous_format, torch.channels_last_3d]:
|
|
helper(self, nn.BatchNorm3d, (4, 80, 20, 100, 100), format)
|
|
|
|
@parametrize_test(
|
|
'bn_module',
|
|
[
|
|
subtest(torch.nn.BatchNorm2d, name="BatchNorm2d"),
|
|
subtest(torch.nn.SyncBatchNorm, name="SyncBatchNorm"),
|
|
],
|
|
)
|
|
def test_batchnorm_non_contig_cpu(self, bn_module):
|
|
def helper(self, dtype):
|
|
input = torch.arange(6, dtype=torch.float).reshape(1, 3, 2, 1).cpu()
|
|
input = input.permute(0, 2, 1, 3)
|
|
|
|
bn = bn_module(2).cpu().float().eval()
|
|
bn.weight.data.uniform_()
|
|
bn.bias.data.uniform_()
|
|
|
|
ref_input = input.detach().clone().contiguous()
|
|
ref_bn = nn.BatchNorm2d(2).cpu().float().eval()
|
|
ref_bn.load_state_dict(bn.state_dict())
|
|
|
|
out = bn(input)
|
|
ref_out = ref_bn(ref_input)
|
|
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
|
|
input_bf = torch.arange(24, dtype=dtype).reshape(1, 3, 2, 4)
|
|
input_bf = input_bf.permute(0, 2, 1, 3)
|
|
input_f = input_bf.float()
|
|
bn_mix = bn_module(2).float().eval()
|
|
ref_bn_f = deepcopy(bn_mix)
|
|
out_bf = bn_mix(input_bf)
|
|
ref_out_bf = ref_bn_f(input_f)
|
|
self.assertEqual(ref_out_bf, out_bf.float(), atol=0.05, rtol=0.05)
|
|
|
|
helper(self, torch.bfloat16)
|
|
helper(self, torch.float16)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
@unittest.skipIf(not TEST_CUDNN, "needs cudnn")
|
|
def test_batchnorm_cudnn_nhwc(self):
|
|
def run_test(input, grad_output):
|
|
c = input.size(1)
|
|
mod = nn.BatchNorm2d(c).cuda().float()
|
|
mod.weight.data.uniform_()
|
|
mod.bias.data.uniform_()
|
|
ref_input = input.detach().clone().contiguous().requires_grad_(True)
|
|
ref_grad = grad.detach().clone().contiguous()
|
|
ref_mod = nn.BatchNorm2d(c).cuda().float()
|
|
ref_mod.load_state_dict(mod.state_dict())
|
|
out = mod(input)
|
|
out.backward(grad_output)
|
|
ref_out = ref_mod(ref_input)
|
|
ref_out.backward(ref_grad)
|
|
self.assertTrue(out.is_contiguous(memory_format=torch.channels_last))
|
|
self.assertTrue(ref_out.is_contiguous())
|
|
self.assertEqual(out, ref_out)
|
|
self.assertEqual(mod.weight.grad, ref_mod.weight.grad)
|
|
self.assertEqual(mod.bias.grad, ref_mod.bias.grad)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
input = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_()
|
|
|
|
grad = torch.randint(1, 10, (4, 8, 2, 2), dtype=torch.float32, device="cuda")
|
|
grad = grad.contiguous(memory_format=torch.channels_last)
|
|
run_test(input, grad)
|
|
# see #42588, grad is channels_last contiguous, but grad.suggest_memory_format (rightly) return "contiguous"
|
|
# not channels_last
|
|
input = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda")
|
|
input = input.contiguous(memory_format=torch.channels_last).detach().requires_grad_()
|
|
grad = torch.randint(1, 10, (2, 8, 8, 1), dtype=torch.float32, device="cuda")
|
|
grad = grad.permute(0, 2, 1, 3)
|
|
run_test(input, grad)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_batchnorm_cudnn_half(self):
|
|
# THNN
|
|
input = torch.randint(1, 10, (2, 3, 2, 2), dtype=torch.half, device="cuda", requires_grad=True)
|
|
m = nn.BatchNorm2d(3).half().cuda()
|
|
thnn_output = m(input)
|
|
thnn_output.sum().backward()
|
|
thnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(thnn_output, input)
|
|
# cuDNN
|
|
if TEST_CUDNN:
|
|
input.grad = None
|
|
m = m.float()
|
|
cudnn_output = m(input)
|
|
cudnn_output.sum().backward()
|
|
cudnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(cudnn_output, input)
|
|
self.assertEqual(cudnn_output, thnn_output)
|
|
self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_batchnorm_nonaffine_cuda_half_input(self):
|
|
input = torch.randn(16, 3, 24, 24, dtype=torch.half, device="cuda")
|
|
m = nn.BatchNorm2d(3, affine=False).cuda().float() # keep running stats in FP32
|
|
output = m(input)
|
|
self.assertEqualTypeString(output, input)
|
|
m.eval()
|
|
output = m(input)
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
def test_batchnorm_raises_error_if_less_than_one_value_per_channel(self):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.BatchNorm1d(10)(x)
|
|
|
|
def test_batchnorm_raises_error_if_running_mean_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, torch.rand(size), running_var)
|
|
|
|
def test_batchnorm_raises_error_if_running_var_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, torch.rand(size))
|
|
|
|
def test_batchnorm_raises_error_if_weight_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, running_var, weight=Parameter(torch.rand(size)))
|
|
|
|
def test_batchnorm_raises_error_if_bias_is_not_same_size_as_input(self):
|
|
input = torch.rand(2, 10)
|
|
running_mean = torch.rand(10)
|
|
running_var = torch.rand(10)
|
|
wrong_sizes = [9, 11]
|
|
for size in wrong_sizes:
|
|
with self.assertRaises(RuntimeError):
|
|
F.batch_norm(input, running_mean, running_var, bias=Parameter(torch.rand(size)))
|
|
|
|
def test_batchnorm_raises_error_if_running_var_or_running_mean_have_forward_grad(self):
|
|
args = (
|
|
torch.randn(3, 2, 5), # input
|
|
torch.randn(2), # running_mean
|
|
torch.randn(2), # running_var
|
|
)
|
|
kwargs = {'training': False, 'momentum': -1.2}
|
|
fn = partial(F.batch_norm, **kwargs)
|
|
|
|
for dual_indices in ((0,), (1,), (1, 2), (0, 1), (0, 1, 2),):
|
|
tangents = tuple(torch.rand_like(x) for x in args)
|
|
|
|
with fwAD.dual_level():
|
|
duals = [fwAD.make_dual(primal, tangent) if i in dual_indices else primal
|
|
for i, (primal, tangent) in enumerate(zip(args, tangents))]
|
|
msg = "batch_norm is not differentiable wrt running_mean and running_var"
|
|
# 0 needs to have forward grad because otherwise we won't even run batch_norm_jvp
|
|
if (1 in dual_indices or 2 in dual_indices) and 0 in dual_indices:
|
|
with self.assertRaisesRegex(RuntimeError, msg):
|
|
fn(*duals)
|
|
else:
|
|
fn(*duals)
|
|
|
|
def test_batchnorm_buffer_update_when_stats_are_not_tracked(self):
|
|
input_size = (32, 4)
|
|
# Instantiate BN with buffers that are not None
|
|
bn = nn.BatchNorm1d(input_size[1], track_running_stats=True)
|
|
# Use buffers for normalization but don't update them
|
|
bn.track_running_stats = False
|
|
# Store initial values
|
|
num_batches = bn.num_batches_tracked.clone()
|
|
running_mean = bn.running_mean.clone()
|
|
running_var = bn.running_var.clone()
|
|
# Forward random tensor
|
|
_ = bn(torch.rand(input_size))
|
|
# Ensure none of the buffers has been updated
|
|
self.assertTrue(torch.equal(num_batches, bn.num_batches_tracked))
|
|
self.assertTrue(torch.equal(running_mean, bn.running_mean))
|
|
self.assertTrue(torch.equal(running_var, bn.running_var))
|
|
|
|
@unittest.skipIf(not torch.cuda.is_available(), "CUDA not available")
|
|
def test_batchnorm_nhwc_cuda(self):
|
|
for dtype in (torch.half, torch.float):
|
|
(N, C, H, W) = 2, 64, 50, 50
|
|
model = torch.nn.BatchNorm2d(C, eps=1e-05, momentum=0.1, affine=True, track_running_stats=True)
|
|
model = model.eval().cuda().to(dtype)
|
|
inp1 = torch.randn(N, C, H, W, device=torch.device('cuda'), dtype=dtype)
|
|
inp2 = inp1.contiguous(memory_format=torch.channels_last)
|
|
out1 = model(inp1)
|
|
out2 = model(inp2)
|
|
self.assertTrue(torch.equal(out1, out2))
|
|
|
|
def test_batchnorm_load_state_dict(self):
|
|
bn = torch.nn.BatchNorm2d(3)
|
|
self.assertEqual(bn.state_dict()["num_batches_tracked"], torch.tensor(0))
|
|
|
|
bn.num_batches_tracked = torch.tensor(10)
|
|
self.assertEqual(bn.state_dict()["num_batches_tracked"], torch.tensor(10))
|
|
|
|
empty_dict = OrderedDict()
|
|
bn.load_state_dict(empty_dict, strict=False)
|
|
self.assertEqual(bn.state_dict()["num_batches_tracked"], torch.tensor(10))
|
|
|
|
# test that when `num_batches_tracked` is not in loaded state_dict,
|
|
# meta num_batches_tracked is still replaced with singleton 0 tensor
|
|
with torch.device('meta'):
|
|
meta_bn = torch.nn.BatchNorm2d(3)
|
|
self.assertTrue(meta_bn.num_batches_tracked.device == torch.device('meta'))
|
|
meta_bn.load_state_dict(empty_dict, assign=True, strict=False)
|
|
self.assertEqual(meta_bn.state_dict()["num_batches_tracked"], torch.tensor(0))
|
|
|
|
def test_batch_norm_update_stats(self):
|
|
input = torch.rand(0, 1)
|
|
running_mean = torch.rand(1)
|
|
running_var = torch.rand(1)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
re.escape("input tensor must have at least one element, but got input_sizes = [0, 1]")):
|
|
torch.batch_norm_update_stats(input=input, momentum=0.0, running_mean=running_mean, running_var=running_var)
|
|
|
|
def test_pairwise_distance(self):
|
|
input1 = torch.randn(4, 4, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(4, 4, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x, y: F.pairwise_distance(x, y), (input1, input2)))
|
|
|
|
# TODO: Create an OpInfo for pdist
|
|
def test_pdist(self):
|
|
for device, trans in itertools.product(device_(), [False, True]):
|
|
inp = torch.randn(4, 5, dtype=torch.double, device=device, requires_grad=True)
|
|
if trans:
|
|
inp = inp.transpose(0, 1)
|
|
for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]:
|
|
self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,)))
|
|
|
|
def test_pdist_zeros(self):
|
|
"""Test that grad is still valid when dist is 0"""
|
|
for device in device_():
|
|
inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True).repeat([2, 1])
|
|
for p in [0, 1, 2, 0.5, 1.5, 2.5, float('inf')]:
|
|
self.assertTrue(gradcheck(lambda x: F.pdist(x, p), (inp,)))
|
|
|
|
def test_pdist_empty_row(self):
|
|
for device in device_():
|
|
inp = torch.randn(1, 3, dtype=torch.double, device=device, requires_grad=True)
|
|
self.assertTrue(gradcheck(F.pdist, (inp,)))
|
|
|
|
def test_pdist_empty_col(self):
|
|
for device in device_():
|
|
inp = torch.randn(4, 0, dtype=torch.double, device=device, requires_grad=True)
|
|
self.assertTrue(gradcheck(F.pdist, (inp,)))
|
|
|
|
@unittest.expectedFailure
|
|
def test_pdist_cpu_gradgrad_unimplemented(self):
|
|
inp = torch.randn(4, 5, requires_grad=True)
|
|
gradgradcheck(F.pdist, (inp,))
|
|
|
|
@unittest.expectedFailure
|
|
def test_pdist_cuda_gradgrad_unimplemented(self):
|
|
inp = torch.randn(4, 5, device='cuda', requires_grad=True)
|
|
gradgradcheck(F.pdist, (inp,))
|
|
|
|
# Merge into OpInfo?
|
|
# test for backward in https://github.com/pytorch/pytorch/issues/15511
|
|
def test_pdist_large(self):
|
|
for device in device_():
|
|
def func(x):
|
|
return torch.pdist(x, p=2)
|
|
|
|
# shape[0] should be able to be (roughly) arbitrarily large, but the kernel
|
|
# is currently limited to smaller sizes (see issue above); this is just testing
|
|
# a floor.
|
|
shape = (1000, 1)
|
|
x = torch.randn(shape, device=device).requires_grad_()
|
|
output = torch.pdist(x, p=2)
|
|
# just run a single backward, as gradcheck/gradgradcheck is expensive here
|
|
output.sum().backward()
|
|
|
|
def test_cosine_embedding_loss_with_diff_type(self):
|
|
for device in device_():
|
|
input1 = torch.tensor([[2, 3, 4], [6, 2, 4]], dtype=torch.double, device=device)
|
|
input2 = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([1, -1], dtype=torch.int, device=device)
|
|
expected = torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
for dt1 in get_all_math_dtypes(device):
|
|
for dt2 in get_all_math_dtypes(device):
|
|
for dt3 in get_all_math_dtypes(device):
|
|
# dt3 is used as dtype for target = [1, -1], so let's skip unsigned type
|
|
if dt3 == torch.uint8:
|
|
continue
|
|
if dt1.is_complex or dt2.is_complex or dt3.is_complex:
|
|
continue
|
|
input1 = input1.to(dt1)
|
|
input2 = input2.to(dt2)
|
|
target = target.to(dt3)
|
|
result = torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_cosine_embedding_loss_error_on_diff_shapes(self):
|
|
for device in device_():
|
|
input1 = torch.empty((0, 0), dtype=torch.double, device=device)
|
|
input2 = torch.empty((0,), dtype=torch.double, device=device)
|
|
target = torch.empty((0,), dtype=torch.int, device=device)
|
|
with self.assertRaisesRegex(RuntimeError, ".*expects 2D.*"):
|
|
torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
|
|
def test_cosine_embedding_loss_error_on_nonexpandable_shapes(self):
|
|
for device in device_():
|
|
input1 = torch.empty((1, 5), dtype=torch.double, device=device)
|
|
input2 = torch.empty((1, 6), dtype=torch.double, device=device)
|
|
target = torch.ones((1,), dtype=torch.int, device=device)
|
|
with self.assertRaisesRegex(RuntimeError, ".*must match the size.*"):
|
|
torch.nn.functional.cosine_embedding_loss(input1, input2, target)
|
|
|
|
def test_kl_div_with_diff_type(self):
|
|
for device in device_():
|
|
input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device)
|
|
expected = torch.nn.functional.kl_div(input, target)
|
|
real_dtypes = (torch.float32, torch.float64, torch.float16)
|
|
for input_dtype, target_dtype in product(real_dtypes, repeat=2):
|
|
if (torch.device(device).type == 'cpu' and target_dtype == torch.float16):
|
|
continue
|
|
input = input.to(input_dtype)
|
|
target = target.to(target_dtype)
|
|
result = torch.nn.functional.kl_div(input, target)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_kl_div_with_diff_type_log_target(self):
|
|
for device in device_():
|
|
input = torch.tensor([[2, 3, 5], [3, 2, 1]], dtype=torch.double, device=device)
|
|
target = torch.tensor([[1, 2, 3], [4, 5, 6]], dtype=torch.double, device=device).log()
|
|
expected = torch.nn.functional.kl_div(input, target, log_target=True)
|
|
real_dtypes = (torch.float32, torch.float64, torch.float16)
|
|
for input_dtype, target_dtype in product(real_dtypes, repeat=2):
|
|
if (torch.device(device).type == 'cpu' and target_dtype == torch.float16):
|
|
continue
|
|
input = input.to(input_dtype)
|
|
target = target.to(target_dtype)
|
|
result = torch.nn.functional.kl_div(input, target, log_target=True)
|
|
self.assertEqual(result.item(), expected.item(), atol=0.001, rtol=0)
|
|
|
|
def test_kl_div_log_softmax_target(self):
|
|
for device in device_():
|
|
a = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device)
|
|
b = torch.tensor([[1.0, 2, 3], [5.0, 5, 5]], device=device)
|
|
self.assertEqual(
|
|
F.kl_div(F.log_softmax(a, 1), F.log_softmax(b, 1), reduction='none', log_target=True),
|
|
torch.zeros_like(a)
|
|
)
|
|
|
|
def test_cosine_embedding_loss_no_reduce(self):
|
|
input1 = torch.randn(15, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(15, 10, requires_grad=True, dtype=torch.double)
|
|
target = torch.randn(15, dtype=torch.double).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss(
|
|
x, y, z, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.cosine_embedding_loss(input1, input2, target, reduction='none'),
|
|
loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target, reduction='none'))
|
|
|
|
def test_cosine_embedding_loss_margin_no_reduce(self):
|
|
input1 = torch.randn(15, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(15, 10, requires_grad=True, dtype=torch.double)
|
|
target = torch.randn(15, dtype=torch.double).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.cosine_embedding_loss(
|
|
x, y, z, margin=0.5, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.cosine_embedding_loss(input1, input2, target, margin=0.5, reduction='none'),
|
|
loss_reference_fns['CosineEmbeddingLoss'](input1, input2, target,
|
|
margin=0.5, reduction='none'))
|
|
|
|
def test_cosine_embedding_loss_invalid_shape(self):
|
|
input1 = torch.randn(15, 10)
|
|
input2 = torch.randn(15, 10)
|
|
target = torch.randn(15, 1).sign()
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "1D target tensor expected"):
|
|
F.cosine_embedding_loss(input1, input2, target)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "1D target tensor expects 2D input tensors"):
|
|
F.cosine_embedding_loss(torch.randn(10), torch.randn(10), torch.randn(10))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "0D target tensor expects 1D input tensors"):
|
|
F.cosine_embedding_loss(torch.randn(2, 5), torch.randn(2, 5), torch.randn(()))
|
|
|
|
def test_margin_ranking_loss_no_reduce(self):
|
|
input1 = torch.randn(15, dtype=torch.double).mul_(10).requires_grad_()
|
|
input2 = torch.randn(15, dtype=torch.double).mul_(10).requires_grad_()
|
|
target = torch.randn(15, dtype=torch.double).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss(
|
|
x, y, z, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.margin_ranking_loss(input1, input2, target, reduction='none'),
|
|
loss_reference_fns['MarginRankingLoss'](input1, input2, target, reduction='none'))
|
|
|
|
def test_margin_ranking_loss_margin_no_reduce(self):
|
|
input1 = torch.randn(15, dtype=torch.double).mul_(10).requires_grad_()
|
|
input2 = torch.randn(15, dtype=torch.double).mul_(10).requires_grad_()
|
|
target = torch.randn(15, dtype=torch.double).sign()
|
|
self.assertTrue(gradcheck(lambda x, y, z: F.margin_ranking_loss(
|
|
x, y, z, margin=0.5, reduction='none'), (input1, input2, target)))
|
|
self.assertEqual(F.margin_ranking_loss(input1, input2, target, margin=0.5, reduction='none'),
|
|
loss_reference_fns['MarginRankingLoss'](input1, input2, target, margin=0.5, reduction='none'))
|
|
|
|
def test_triplet_margin_loss(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input3 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3))
|
|
|
|
def test_triplet_margin_loss_swap(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input3 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, swap=True), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True))
|
|
|
|
def test_triplet_margin_loss_no_reduce(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input3 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, reduction='none'), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, reduction='none'),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, reduction='none'))
|
|
|
|
def test_triplet_margin_loss_swap_no_reduce(self):
|
|
input1 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
input3 = torch.randn(5, 10, requires_grad=True, dtype=torch.double)
|
|
self.assertTrue(gradcheck(lambda x1, x2, x3: F.triplet_margin_loss(
|
|
x1, x2, x3, swap=True, reduction='none'), (input1, input2, input3)))
|
|
self.assertEqual(F.triplet_margin_loss(input1, input2, input3, swap=True, reduction='none'),
|
|
loss_reference_fns['TripletMarginLoss'](input1, input2, input3, swap=True, reduction='none'))
|
|
|
|
def test_pointwise_loss_target_grad_none_reduction(self):
|
|
i = torch.randn(5, 10)
|
|
t = torch.randn(5, 10, requires_grad=True)
|
|
self.assertEqual(F.mse_loss(i, t, reduction='none').size(), t.size())
|
|
self.assertEqual(F.l1_loss(i, t, reduction='none').size(), t.size())
|
|
|
|
def test_pointwise_loss_broadcast(self):
|
|
losses = {
|
|
'mse_loss': lambda x, y, r: F.mse_loss(x, y, reduction=r),
|
|
'l1_loss': lambda x, y, r: F.l1_loss(x, y, reduction=r),
|
|
'smooth_l1_loss': lambda x, y, r: F.smooth_l1_loss(x, y, reduction=r),
|
|
'huber_loss': lambda x, y, r: F.huber_loss(x, y, reduction=r),
|
|
}
|
|
|
|
input = torch.randn(2, 1, requires_grad=True, dtype=torch.double)
|
|
for fn in losses.values():
|
|
for requires_grad in [True, False]:
|
|
# When target.requires_grad=True, its impl is in Python, while the other is in TH.
|
|
target = torch.randn(2, 10, requires_grad=requires_grad, dtype=torch.double)
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
l = fn(input, target, reduction)
|
|
if reduction == 'none':
|
|
self.assertEqual(l.size(), target.size())
|
|
self.assertTrue(gradcheck(fn, (input, target, reduction)))
|
|
|
|
# https://github.com/pytorch/pytorch/issues/27692 reports
|
|
# that l1_loss get a wrong result for big batch size
|
|
def test_l1_loss_correct(self):
|
|
for dtype in [torch.float, torch.cfloat]:
|
|
for N in range(1, 50, 10):
|
|
input = torch.rand(N, 3, 1024, 1024, dtype=dtype)
|
|
self.assertEqual(
|
|
torch.nn.L1Loss()(input, torch.zeros_like(input)),
|
|
input.abs().mean())
|
|
|
|
def test_smoothl1loss_intergral_target(self):
|
|
def _input_grad(input, target, reduction):
|
|
output = F.smooth_l1_loss(input, target, reduction=reduction, beta=0.5)
|
|
output.sum().backward()
|
|
return input.grad
|
|
|
|
for device, dtype, reduction in product(device_(),
|
|
integral_types(),
|
|
('none', 'sum', 'mean')):
|
|
input = torch.randn(2, 2, device=device, requires_grad=True)
|
|
target = torch.randint(0, 9, (2, 2), device=device, dtype=dtype)
|
|
|
|
input_grad_with_float_target = _input_grad(input, target.float(), reduction)
|
|
|
|
input_grad = _input_grad(input.detach().clone().requires_grad_(True),
|
|
target,
|
|
reduction)
|
|
self.assertEqual(input_grad, input_grad_with_float_target)
|
|
|
|
def test_smoothl1loss_negative_beta_not_supported(self):
|
|
with self.assertRaises(RuntimeError):
|
|
F.smooth_l1_loss(torch.randn(2, 2), torch.randn(2, 2), beta=-1.0)
|
|
|
|
def test_huber_loss_invalid_delta(self):
|
|
def _test_huber_loss_delta_error_helper(delta):
|
|
input, target = torch.randn(2, 2), torch.randn(2, 2)
|
|
loss = torch.nn.HuberLoss(delta=delta)
|
|
with self.assertRaises(RuntimeError):
|
|
loss(input, target)
|
|
|
|
def test_huber_loss_negative_delta():
|
|
_test_huber_loss_delta_error_helper(delta=-0.5)
|
|
|
|
def test_huber_loss_zero_delta():
|
|
_test_huber_loss_delta_error_helper(delta=0.0)
|
|
|
|
test_huber_loss_negative_delta()
|
|
test_huber_loss_zero_delta()
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_cosine_similarity(self):
|
|
# Check cosine_similarity input/output shapes
|
|
input_size = (1, 3, 2, 1)
|
|
expected_size = (1, 2, 1)
|
|
input1 = torch.randn(input_size, requires_grad=True)
|
|
input2 = torch.randn(input_size, requires_grad=True)
|
|
self.assertEqual(F.cosine_similarity(input1, input2, dim=1).size(), expected_size)
|
|
|
|
# Check numerical precision, issue #18057
|
|
vv1 = torch.tensor([float(i) for i in range(84)]).unsqueeze(0)
|
|
vv2 = torch.tensor([float(i) for i in range(84)]).unsqueeze(0)
|
|
out = F.cosine_similarity(vv1, vv2)
|
|
self.assertLessEqual(out, 1.0)
|
|
|
|
# Check dividing by 0.
|
|
# previous behavior: <x,y>/max(eps, ||x|| * ||y||)
|
|
# current: <x/max(eps, ||x||), y/max(eps,||y||)>
|
|
# if f(x,y) is the cosine similarity, then
|
|
# df/dx = y/(||x|| * ||y||) - (x * <x,y> * ||y||/||x||)/(||x|| * ||y||)^2
|
|
# the tests below check division by zero in the backward formula when
|
|
# x := input2 = 0, y := input1 != 0.
|
|
# For these inputs the gradient wrt x simplifies to g(x,y) := y/(||x|| * ||y||)
|
|
# Previous test checks g(x,y) == y/eps,
|
|
# Current test checks g(x,y) == (y/||y||)/eps.
|
|
input1 = torch.randn(10).requires_grad_()
|
|
input2 = torch.zeros_like(input1).requires_grad_()
|
|
torch.cosine_similarity(input1, input2, 0).sum().backward()
|
|
self.assertEqual(input1.grad, torch.zeros_like(input1))
|
|
self.assertEqual(input2.grad, input1 / input1.norm() * 1e8)
|
|
|
|
# Check type promotion, issue #61454
|
|
input = torch.tensor(12.)
|
|
out = F.cosine_similarity(input.to(torch.int8), input, dim=-1)
|
|
self.assertEqual(out, 1.)
|
|
|
|
# Check broadcasting #109333
|
|
a = torch.ones(2, 3, dtype=torch.float)
|
|
b = torch.ones(1, 1, dtype=torch.float)
|
|
out = F.cosine_similarity(a, b)
|
|
self.assertEqual(out, torch.ones(2, dtype=torch.float))
|
|
|
|
a = torch.ones(2, 3, dtype=torch.float)
|
|
b = torch.ones(1, dtype=torch.float)
|
|
out = F.cosine_similarity(a, b)
|
|
self.assertEqual(out, torch.ones(2, dtype=torch.float))
|
|
|
|
|
|
def test_grid_sample_error_checking(self):
|
|
input = torch.empty(1, 1, 2, 2)
|
|
grid = torch.empty(1, 1, 1, 2)
|
|
|
|
# assert no error
|
|
F.grid_sample(input, grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "but got: 'garbage'"):
|
|
F.grid_sample(input, grid, mode='garbage', align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "but got: 'garbage'"):
|
|
F.grid_sample(input, grid, padding_mode='garbage', align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid to have size 1 in last dimension"):
|
|
F.grid_sample(input[0], grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid to have size 2 in last dimension"):
|
|
F.grid_sample(input, torch.empty(1, 1, 1, 1, 3), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid and input to have same batch size"):
|
|
F.grid_sample(input, torch.empty(2, 1, 1, 2), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected grid to have size 2 in last dimension"):
|
|
F.grid_sample(input, torch.empty(1, 1, 1, 3), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "expected input to have non-empty spatial dimensions"):
|
|
F.grid_sample(torch.empty(1, 1, 0, 2), grid, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, "bicubic interpolation only supports 4D input"):
|
|
F.grid_sample(torch.empty(1, 1, 2, 2, 2), torch.empty(1, 1, 1, 1, 3), mode='bicubic')
|
|
|
|
if TEST_CUDA:
|
|
with self.assertRaisesRegex(RuntimeError, "Expected all tensors to be on the same device"):
|
|
F.grid_sample(input.cuda(), grid, align_corners=False)
|
|
|
|
def test_affine_grid_error_checking(self):
|
|
# 2D affine
|
|
theta = torch.empty(1, 2, 3, dtype=torch.double)
|
|
size = torch.Size([1, 1, 2, 2])
|
|
|
|
# assert no error
|
|
F.affine_grid(theta, size, align_corners=False)
|
|
|
|
# check for warning for empty span along dimension
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Should not trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=False)
|
|
# Check no warning occurs
|
|
self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
# Should trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 1]), align_corners=True)
|
|
# Check warning occurs
|
|
self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected theta to have floating point type"):
|
|
F.affine_grid(theta.int(), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta[0], size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.unsqueeze(0), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 2D affine matrices of shape Nx2x3"):
|
|
F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False)
|
|
|
|
# 3D affine
|
|
theta = torch.empty(1, 3, 4, dtype=torch.double)
|
|
size = torch.Size([1, 1, 2, 2, 2])
|
|
|
|
# assert no error
|
|
F.affine_grid(theta, size, align_corners=False)
|
|
|
|
# check for warning for empty span along dimension
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Ensure warnings are being shown
|
|
warnings.simplefilter("always")
|
|
# Should not trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=False)
|
|
# Check no warning occurs
|
|
self.assertNotIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
# Should trigger warning
|
|
F.affine_grid(theta, torch.Size([1, 1, 3, 2, 1]), align_corners=True)
|
|
# Check warning occurs
|
|
self.assertIn('See the documentation of affine_grid for details.', ' '.join(map(str, w)))
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta[0], size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.unsqueeze(0), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.repeat(1, 2, 1), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(ValueError, "Expected a batch of 3D affine matrices of shape Nx3x4"):
|
|
F.affine_grid(theta.repeat(1, 1, 2), size, align_corners=False)
|
|
|
|
with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"):
|
|
F.affine_grid(theta, torch.Size([1, 2, 2]), align_corners=False)
|
|
|
|
with self.assertRaisesRegex(NotImplementedError, "affine_grid only supports 4D and 5D sizes"):
|
|
F.affine_grid(theta, torch.Size([1, 1, 2, 2, 2, 2]), align_corners=False)
|
|
|
|
@parametrize_test('device', ['cpu'] + (['cuda'] if TEST_CUDA else []))
|
|
@parametrize_test('nd', [2, 3])
|
|
def test_affine_grid_backward_cl_cf_consistency(self, device, nd):
|
|
# Test based on reported issue: https://github.com/pytorch/pytorch/issues/124154
|
|
|
|
theta = torch.rand([6, nd, nd + 1], requires_grad=True, device=device)
|
|
size = [6, 3, 4, 5] if nd == 2 else [6, 3, 4, 5, 5]
|
|
grid = torch.nn.functional.affine_grid(theta, size, align_corners=False)
|
|
|
|
grad_tensor = torch.rand(grid.shape, device=device)
|
|
|
|
memory_format_cl = torch.channels_last if nd == 2 else torch.channels_last_3d
|
|
grad_tensor_cl = grad_tensor.contiguous(memory_format=memory_format_cl)
|
|
|
|
assert theta.grad is None
|
|
grid.backward(grad_tensor_cl)
|
|
theta_grad_cl = theta.grad.clone().contiguous()
|
|
|
|
theta.grad.zero_()
|
|
grid.backward(grad_tensor)
|
|
theta_grad_cf = theta.grad
|
|
|
|
self.assertEqual(theta_grad_cf, theta_grad_cl)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_grid_sample(self):
|
|
# Backward pass of native C++ and CUDA kernels branch depending on whether input requires gradient,
|
|
# so we test both cases.
|
|
def test(N, C, H, W, mode, padding_mode, align_corners, input_requires_grad):
|
|
def test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners):
|
|
for grid_dim_contig_order in [(0, 1, 2, 3), (0, 3, 1, 2), (3, 0, 1, 2), (0, 2, 1, 3)]:
|
|
# grid_dim_contig_order specifies the dimension order that can
|
|
# make grid to be contiguous.
|
|
# i.e., grid.permute(grid_dim_contig_order) is contiguous.
|
|
# e.g., with grid_dim_contig_order=[0, 3, 1, 2], grid should be
|
|
# initialized with contiguous tensor of shape [N, 2, H, W]
|
|
# and permuted to [N, H, W, 2] afterwards.
|
|
grid_shape = [N, H, W, 2]
|
|
grid_init_shape = [grid_shape[d] for d in grid_dim_contig_order]
|
|
grid_fwd_permute = [None, None, None, None]
|
|
for i, d in enumerate(grid_dim_contig_order):
|
|
grid_fwd_permute[d] = i
|
|
|
|
def get_grid(device='cpu', data=None):
|
|
if data is not None:
|
|
assert list(data.shape) == grid_shape
|
|
data = data.permute(grid_dim_contig_order).to(device)
|
|
else:
|
|
data = torch.randn(grid_init_shape, device=device)
|
|
grid = data.permute(grid_fwd_permute)
|
|
assert grid.permute(grid_dim_contig_order).is_contiguous()
|
|
return grid
|
|
|
|
input_cpu = torch.randn(C, N, IH, IW).transpose(0, 1).requires_grad_(input_requires_grad)
|
|
grid_cpu = get_grid().requires_grad_()
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertTrue(out_cpu.size() == torch.Size([N, C, H, W]))
|
|
|
|
gradients = torch.randn_like(out_cpu)
|
|
out_cpu.backward(gradients)
|
|
|
|
|
|
# Compare against unvectorized CPU fallback
|
|
|
|
# NOTE [ grid_sample CPU fallback ]
|
|
# grid_sample uses AVX for 2d images, but that requires 32-bit indexing for
|
|
# 32-bit floats. So we also have a fallback that is used only for float tensors
|
|
# requiring 64-bit indexing. That requires too much memory to run on CI, so we
|
|
# also export the fallback and test it here to ensure feature parity with
|
|
# the vectorized version.
|
|
input_fallback = input_cpu.float().detach_().requires_grad_()
|
|
grid_fallback = grid_cpu.float().detach_().requires_grad_()
|
|
out_fallback = torch._grid_sampler_2d_cpu_fallback(
|
|
input_fallback, grid_fallback,
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners)
|
|
self.assertEqual(out_fallback, out_cpu.float(), atol=1e-5, rtol=5e-5)
|
|
|
|
out_fallback.backward(gradients.float())
|
|
if input_requires_grad:
|
|
self.assertEqual(input_fallback.grad, input_cpu.grad.float(), atol=1e-4, rtol=5e-5)
|
|
self.assertEqual(grid_fallback.grad, grid_cpu.grad.float(), atol=1e-4, rtol=5e-5)
|
|
|
|
if TEST_CUDA:
|
|
input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_(input_requires_grad)
|
|
grid_cuda = get_grid('cuda', grid_cpu.detach()).requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
out_cuda.backward(gradients.cuda())
|
|
if input_requires_grad:
|
|
self.assertEqual(input_cpu.grad, input_cuda.grad)
|
|
self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0)
|
|
|
|
# check that zero-dimensional input strides don't error out
|
|
base_input = torch.randn(N, C, 1, IW)
|
|
input_cpu = base_input.expand_as(input_cuda).requires_grad_(input_requires_grad)
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
|
|
input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_(input_requires_grad)
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
# test same size output
|
|
test_shape(N, C, H, W, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test larger output
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(IH + 1, 12)
|
|
W = random.randint(IW + 1, 12)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test smaller output
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(2, IH)
|
|
W = random.randint(2, IW)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test 1x1 inpput
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = 1
|
|
IW = 1
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
test_shape(N, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty grid
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, C, IH, IW, 0, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty channel
|
|
N = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, 0, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty batch
|
|
C = random.randint(2, 8)
|
|
IH = random.randint(2, 8)
|
|
IW = random.randint(2, 8)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(0, C, IH, IW, H, W, mode, padding_mode, align_corners)
|
|
|
|
for mode in ('bilinear', 'nearest', 'bicubic'):
|
|
for padding_mode in ('zeros', 'border', 'reflection'):
|
|
for align_corners in (True, False):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 11).view(1, 1, 2, 5)
|
|
grid = torch.tensor(
|
|
[[[-0.9, -4.1], [0, 0.2000], [1, -1], [-0.333, 1e-6], [0.5, 1.0]],
|
|
[[-1.0, -0.5], [0, 0.3333], [1, -1], [-0.200, 1e-6], [1.5, 0.5]]]).view(1, 2, 5, 2)
|
|
if mode == 'bilinear':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[0.0000, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 0.0000]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.0000, 6.5000000000, 1.2500, 4.6675000191, 4.6250],
|
|
[0.5000, 7.1665000916, 1.2500, 5.0000000000, 0.0000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1.2000, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 8.7500]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1.0000, 6.5000000000, 5.0000, 4.6675000191, 9.2500],
|
|
[1.0000, 7.1665000916, 5.0000, 5.0000000000, 10.0000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[3.4500, 6.0000000000, 5.0000, 4.8340, 9.0000],
|
|
[2.2500, 6.3332500450, 5.0000, 5.1000, 7.7500]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[3.0000004768, 6.5000000000, 5.0000, 4.6675000191, 9.2500],
|
|
[1.0000000000, 7.1665000916, 5.0000, 5.0000000000, 9.2500]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError(f"missing groundtruth test for padding mode '{padding_mode}'")
|
|
elif mode == 'nearest':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[0., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 0.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0., 8., 5., 7., 0.],
|
|
[1., 8., 5., 8., 0.]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 10.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 10.]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 9.]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[1., 8., 5., 7., 9.],
|
|
[1., 8., 5., 8., 9.]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError(f"missing groundtruth test for padding mode '{padding_mode}'")
|
|
elif mode == 'bicubic':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[-0.10424726, 7.1400003, 5.0000, 5.7842274, 9.0000],
|
|
[2.4492188, 7.4814040, 5.0000, 6.0277520, 0.0000]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.00000, 7.6287503, 1.0625, 5.5977230, 5.3270264],
|
|
[0.40625, 8.0288770, 1.0625, 5.9375067, -0.3515625]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[1.1520010, 6.0599990, 5.0000, 4.870930, 9.0000000],
|
|
[2.1328125, 6.4258375, 5.0000, 5.076003, 8.8671875]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[0.894531, 6.6050020, 4.625, 4.7138715, 9.800781],
|
|
[0.906250, 7.2822485, 4.625, 5.0000052, 10.00000]]).view(1, 1, 2, 5)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[3.1822524, 6.239998, 5.0000, 4.8709273, 9.00000],
|
|
[1.7812500, 6.703594, 5.0000, 5.0760007, 8.21875]]).view(1, 1, 2, 5)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[2.7993753, 6.6050020, 4.25, 4.7138715, 10.269531],
|
|
[0.8125000, 7.2822485, 4.25, 5.0000052, 9.332031]]).view(1, 1, 2, 5)
|
|
else:
|
|
raise AssertionError(f"missing groundtruth test for padding mode '{padding_mode}'")
|
|
|
|
else:
|
|
raise AssertionError(f"missing groundtruth test for interpolation mode '{mode}'")
|
|
output = F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(output, groundtruth, atol=1e-5, rtol=0,
|
|
msg=f"groundtruth comparison failed for mode={mode}, "
|
|
f"padding_mode={padding_mode}")
|
|
|
|
# See NOTE [ grid_sample CPU fallback ]
|
|
output = torch._grid_sampler_2d_cpu_fallback(
|
|
input.float(), grid.float(),
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners)
|
|
self.assertEqual(output, groundtruth.float(), atol=1e-5, rtol=0)
|
|
|
|
# explicit check for gradient edge cases
|
|
input = torch.arange(0., 5).expand((1, 1, 5, 5))
|
|
grid = torch.tensor(
|
|
[[[1.0, 1.0], [1.0, -1.0], [0.8, 0.8], [0.8, -0.8]],
|
|
[[-1.0, -1.0], [-1.0, 1.0], [-0.8, -0.8], [-0.8, 0.8]]]).view(1, 2, 4, 2).requires_grad_()
|
|
if mode == 'bilinear':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-8., -8.], [-8., 0.], [2., 0.], [2., 0.]],
|
|
[[2., 0.], [2., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-5., -5.], [-5., 5.], [-10., -10.], [-10., 10.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]],
|
|
[[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [2., 0.], [2., 0.]],
|
|
[[0., 0.], [0., 0.], [2., 0.], [2., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
raise AssertionError(f"missing gradient groundtruth test for padding mode '{padding_mode}'")
|
|
elif mode == 'nearest':
|
|
groundtruth = torch.tensor(
|
|
[[[[-0., -0.], [-0., 0.], [-0., -0.], [-0., 0.]],
|
|
[[0., 0.], [0., 0.], [0., 0.], [0., 0.]]]]).view(1, 2, 4, 2)
|
|
elif mode == 'bicubic':
|
|
if padding_mode == 'zeros':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[-4.5, -6.], [-4.5, 6.], [2.725679, 0.740878], [2.725679, -0.740878]],
|
|
[[1.5, 0.], [1.5, 0.], [1.927921, -0.05688], [1.927921, 0.05688]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-5.859375, -5.888672], [-5.859375, 5.888672], [-5.6250, -7.5000], [-5.6250, 7.5000]],
|
|
[[-0.234375, -0.263672], [-0.234375, 0.263672], [1.8750, 0.], [1.8750, 0.]]]]
|
|
).view(1, 2, 4, 2)
|
|
elif padding_mode == 'border':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]],
|
|
[[1.5, 0.], [1.5, 0.], [1.74, 0.], [1.74, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]],
|
|
[[-0.46875, 0.], [-0.46875, 0.], [1.8750, 0.], [1.8750, 0.]]]]).view(1, 2, 4, 2)
|
|
elif padding_mode == 'reflection':
|
|
if align_corners:
|
|
groundtruth = torch.tensor(
|
|
[[[[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]],
|
|
[[0., 0.], [0., 0.], [1.92, 0.], [1.92, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
groundtruth = torch.tensor(
|
|
[[[[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]],
|
|
[[0., 0.], [0., 0.], [1.875, 0.], [1.875, 0.]]]]).view(1, 2, 4, 2)
|
|
else:
|
|
raise AssertionError(f"missing gradient groundtruth test for padding mode '{padding_mode}'")
|
|
else:
|
|
raise AssertionError(f"missing gradient groundtruth test for interpolation mode '{mode}'")
|
|
for input_requires_grad in [False, True]:
|
|
input = input.requires_grad_(input_requires_grad)
|
|
F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners).sum().backward()
|
|
self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0,
|
|
msg=f"gradient groundtruth comparison failed for mode={mode}, "
|
|
f"padding_mode={padding_mode}, input_requires_grad={input_requires_grad}")
|
|
grid.grad.zero_()
|
|
|
|
# See NOTE [ grid_sample CPU fallback ]
|
|
torch._grid_sampler_2d_cpu_fallback(
|
|
input.float(), grid.float(),
|
|
F.GRID_SAMPLE_INTERPOLATION_MODES[mode],
|
|
F.GRID_SAMPLE_PADDING_MODES[padding_mode],
|
|
align_corners).sum().backward()
|
|
self.assertEqual(grid.grad, groundtruth, atol=1e-5, rtol=0)
|
|
|
|
# do gradcheck
|
|
N = random.randint(2, 8)
|
|
C = random.randint(2, 6)
|
|
H = random.randint(2, 8)
|
|
W = random.randint(2, 8)
|
|
input = torch.randn(N, C, H, W, requires_grad=True)
|
|
grid = torch.randn(N, H, W, 2, requires_grad=True)
|
|
|
|
for input_requires_grad in [False, True]:
|
|
input.requires_grad_(input_requires_grad)
|
|
self.assertTrue(gradcheck(
|
|
lambda inp, grd: F.grid_sample(inp, grd, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners),
|
|
(input, grid)))
|
|
test(N, C, H, W, mode, padding_mode, align_corners, input_requires_grad)
|
|
if TEST_CUDNN:
|
|
with cudnn.flags(enabled=False):
|
|
test(N, C, H, W, mode, padding_mode, align_corners, input_requires_grad)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_grid_sample_3d(self):
|
|
# Backward pass of native C++ and CUDA kernels branch depending on whether input requires gradient,
|
|
# so we test both cases.
|
|
def test(N, C, D, H, W, mode, padding_mode, align_corners, input_requires_grad):
|
|
def test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners):
|
|
input_cpu = torch.randn(C, N, ID, IH, IW).transpose(0, 1).requires_grad_(input_requires_grad)
|
|
grid_cpu = torch.randn(D, N, H, W, 3).transpose(0, 1).requires_grad_()
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertTrue(out_cpu.size() == torch.Size([N, C, D, H, W]))
|
|
|
|
gradients = torch.randn_like(out_cpu)
|
|
out_cpu.backward(gradients)
|
|
|
|
if TEST_CUDA:
|
|
input_cuda = input_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_(input_requires_grad)
|
|
grid_cuda = grid_cpu.detach().transpose(0, 1).cuda().transpose(0, 1).requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
out_cuda.backward(gradients.cuda())
|
|
if input_requires_grad:
|
|
self.assertEqual(input_cpu.grad, input_cuda.grad)
|
|
self.assertEqual(grid_cpu.grad, grid_cuda.grad, atol=5e-5, rtol=0)
|
|
|
|
# check that zero-dimensional input strides don't error out
|
|
base_input = torch.randn(N, C, 1, IH, IW)
|
|
input_cpu = base_input.expand_as(input_cuda).requires_grad_(input_requires_grad)
|
|
grid_cpu = torch.randn(N, D, H, W, 3, requires_grad=True)
|
|
out_cpu = F.grid_sample(input_cpu, grid_cpu, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
|
|
input_cuda = base_input.cuda().expand_as(input_cuda).requires_grad_(input_requires_grad)
|
|
grid_cuda = grid_cpu.detach().cuda().requires_grad_()
|
|
out_cuda = F.grid_sample(input_cuda, grid_cuda, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners)
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
|
|
# test same size output
|
|
test_shape(N, C, D, H, W, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test larger output
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(ID + 1, 10)
|
|
H = random.randint(IH + 1, 10)
|
|
W = random.randint(IW + 1, 10)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test smaller output
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(2, ID)
|
|
H = random.randint(2, IH)
|
|
W = random.randint(2, IW)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# test 1x1 inpput
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 7)
|
|
ID = 1
|
|
IH = 1
|
|
IW = 1
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
test_shape(N, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty grid
|
|
N = random.randint(2, 7)
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, C, ID, IH, IW, D, 0, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty channel
|
|
N = random.randint(2, 7)
|
|
ID = random.randint(2, 5)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(N, 0, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
# testing empty batch
|
|
C = random.randint(2, 5)
|
|
ID = random.randint(2, 7)
|
|
IH = random.randint(2, 7)
|
|
IW = random.randint(2, 7)
|
|
D = random.randint(3, ID + 2)
|
|
H = random.randint(3, IH + 2)
|
|
W = random.randint(3, IW + 2)
|
|
test_shape(0, C, ID, IH, IW, D, H, W, mode, padding_mode, align_corners)
|
|
|
|
for mode in ('bilinear', 'nearest'):
|
|
for padding_mode in ('zeros', 'border', 'reflection'):
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(2, 5)
|
|
C = random.randint(2, 4)
|
|
D = random.randint(2, 5)
|
|
H = random.randint(2, 5)
|
|
W = random.randint(2, 5)
|
|
input = torch.randn(N, C, D, H, W, requires_grad=True)
|
|
grid = torch.randn(N, D, H, W, 3, requires_grad=True)
|
|
self.assertTrue(gradcheck(
|
|
lambda inp, grid: F.grid_sample(inp, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners),
|
|
(input, grid)))
|
|
input = input.requires_grad_(False)
|
|
self.assertTrue(gradcheck(
|
|
lambda grid: F.grid_sample(input, grid, mode=mode, padding_mode=padding_mode,
|
|
align_corners=align_corners),
|
|
(grid,)))
|
|
|
|
for input_requires_grad in [False, True]:
|
|
test(N, C, D, H, W, mode, padding_mode, align_corners, input_requires_grad)
|
|
|
|
def test_grid_sample_nearest_neighbor_rounding_mode_consistency(self):
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
def normalize_indices(indices_unnormalized: torch.Tensor, dim_size: int, align_corners: bool):
|
|
if align_corners:
|
|
indices_normalized = 2 * indices_unnormalized / (dim_size - 1) - 1
|
|
else:
|
|
indices_normalized = (indices_unnormalized * 2 + 1) / dim_size - 1
|
|
return indices_normalized
|
|
|
|
test_dim_size = 10
|
|
non_test_dim_size = 9
|
|
step_size = 0.1
|
|
|
|
batch_size = 1
|
|
channel_size = 1
|
|
|
|
mode = 'nearest'
|
|
for device in device_list:
|
|
for padding_mode in ('zeros', 'border', 'reflection'):
|
|
for align_corners in (True, False):
|
|
# Unnormalized inquiry indices
|
|
inquiry_indices_unnormalized = torch.arange(
|
|
0,
|
|
test_dim_size - 1 + step_size, step_size,
|
|
dtype=torch.float32,
|
|
device=device
|
|
)
|
|
# Note that even though we are trying to create normalized indices
|
|
# which results in x.0 and x.5 indices after unnormalization,
|
|
# because of the numerical error,
|
|
# the rounding direction might not always be expected as designed.
|
|
# The best we could do is to ensure the rounding behaviors across
|
|
# different implementations for different dimensions are
|
|
# exactly the same.
|
|
inquiry_indices = normalize_indices(
|
|
indices_unnormalized=inquiry_indices_unnormalized,
|
|
dim_size=test_dim_size,
|
|
align_corners=align_corners
|
|
)
|
|
num_inqueries = inquiry_indices.shape[0]
|
|
inquiry_fixed_indices = torch.full((num_inqueries,), 0.5, dtype=torch.float32, device=device)
|
|
array_data = torch.rand(test_dim_size, dtype=torch.float32, device=device)
|
|
# 2D grid sample x-dim interpolation
|
|
# The input_tensor_2d_x is of shape
|
|
# [batch_size, channel_size, non_test_dim_size, test_dim_size]
|
|
input_tensor_2d_x = array_data.reshape(1, test_dim_size).repeat(
|
|
batch_size,
|
|
channel_size,
|
|
non_test_dim_size,
|
|
1
|
|
)
|
|
# The grid_tensor_2d_x is of shape
|
|
# [batch_size, 1, num_inqueries]
|
|
grid_tensor_2d_x = torch.cat(
|
|
tensors=(
|
|
inquiry_indices.reshape(num_inqueries, 1),
|
|
inquiry_fixed_indices.reshape(num_inqueries, 1),
|
|
),
|
|
dim=1
|
|
).repeat(batch_size, 1, 1, 1)
|
|
# The output_tensor_2d_x is of shape
|
|
# [batch_size, channel_size, 1, num_inqueries]
|
|
output_tensor_2d_x = F.grid_sample(
|
|
input=input_tensor_2d_x,
|
|
grid=grid_tensor_2d_x,
|
|
mode=mode,
|
|
padding_mode=padding_mode,
|
|
align_corners=align_corners,
|
|
)
|
|
# 2D grid sample y-dim interpolation
|
|
# The input_tensor_2d_y is of shape
|
|
# [batch_size, channel_size, test_dim_size, non_test_dim_size]
|
|
input_tensor_2d_y = torch.transpose(input_tensor_2d_x, 3, 2)
|
|
# The grid_tensor_2d_y is of shape
|
|
# [batch_size, 1, num_inqueries]
|
|
grid_tensor_2d_y = torch.index_select(
|
|
grid_tensor_2d_x,
|
|
-1,
|
|
torch.tensor([1, 0], dtype=torch.int64, device=device)
|
|
)
|
|
# The output_tensor_2d_y is of shape
|
|
# [batch_size, channel_size, 1, num_inqueries]
|
|
output_tensor_2d_y = F.grid_sample(
|
|
input=input_tensor_2d_y,
|
|
grid=grid_tensor_2d_y,
|
|
mode=mode,
|
|
padding_mode=padding_mode,
|
|
align_corners=align_corners,
|
|
)
|
|
self.assertEqual(output_tensor_2d_x[0, 0, 0, :], output_tensor_2d_y[0, 0, 0, :], atol=0, rtol=0)
|
|
# 3D grid sample x-dim interpolation
|
|
# The input_tensor_3d_x is of shape
|
|
# [batch_size, channel_size, non_test_dim_size, non_test_dim_size, test_dim_size]
|
|
input_tensor_3d_x = array_data.reshape(1, test_dim_size).repeat(
|
|
batch_size, channel_size, non_test_dim_size, non_test_dim_size, 1)
|
|
# The grid_tensor_3d_x is of shape
|
|
# [batch_size, 1, 1, num_inqueries]
|
|
grid_tensor_3d_x = torch.cat(
|
|
tensors=(
|
|
inquiry_indices.reshape(num_inqueries, 1),
|
|
inquiry_fixed_indices.reshape(num_inqueries, 1),
|
|
inquiry_fixed_indices.reshape(num_inqueries, 1),
|
|
),
|
|
dim=1
|
|
).repeat(batch_size, 1, 1, 1, 1)
|
|
# The output_tensor_3d_x is of shape
|
|
# [batch_size, channel_size, 1, 1, num_inqueries]
|
|
output_tensor_3d_x = F.grid_sample(
|
|
input=input_tensor_3d_x,
|
|
grid=grid_tensor_3d_x,
|
|
mode=mode,
|
|
padding_mode=padding_mode,
|
|
align_corners=align_corners,
|
|
)
|
|
self.assertEqual(output_tensor_2d_x[0, 0, 0, :], output_tensor_3d_x[0, 0, 0, 0, :], atol=0, rtol=0)
|
|
# 3D grid sample y-dim interpolation
|
|
# The input_tensor_3d_y is of shape
|
|
# [batch_size, channel_size, non_test_dim_size, test_dim_size, non_test_dim_size]
|
|
input_tensor_3d_y = torch.transpose(input_tensor_3d_x, 4, 3)
|
|
# The grid_tensor_3d_y is of shape
|
|
# [batch_size, 1, 1, num_inqueries]
|
|
grid_tensor_3d_y = torch.index_select(
|
|
grid_tensor_3d_x,
|
|
-1,
|
|
torch.tensor([1, 0, 2], dtype=torch.int64, device=device)
|
|
)
|
|
# The output_tensor_3d_y is of shape
|
|
# [batch_size, channel_size, 1, 1, num_inqueries]
|
|
output_tensor_3d_y = F.grid_sample(
|
|
input=input_tensor_3d_y,
|
|
grid=grid_tensor_3d_y,
|
|
mode=mode,
|
|
padding_mode=padding_mode,
|
|
align_corners=align_corners,
|
|
)
|
|
self.assertEqual(output_tensor_2d_x[0, 0, 0, :], output_tensor_3d_y[0, 0, 0, 0, :], atol=0, rtol=0)
|
|
# 3D grid sample z-dim interpolation
|
|
# The input_tensor_3d_z is of shape
|
|
# [batch_size, channel_size, non_test_dim_size, non_test_dim_size, test_dim_size]
|
|
input_tensor_3d_z = torch.transpose(input_tensor_3d_x, 4, 2)
|
|
# The grid_tensor_3d_z is of shape
|
|
# [batch_size, 1, 1, num_inqueries]
|
|
grid_tensor_3d_z = torch.index_select(
|
|
grid_tensor_3d_x,
|
|
-1,
|
|
torch.tensor([1, 2, 0], dtype=torch.int64, device=device)
|
|
)
|
|
# The output_tensor_3d_z is of shape
|
|
# [batch_size, channel_size, 1, 1, num_inqueries]
|
|
output_tensor_3d_z = F.grid_sample(
|
|
input=input_tensor_3d_z,
|
|
grid=grid_tensor_3d_z,
|
|
mode=mode,
|
|
padding_mode=padding_mode,
|
|
align_corners=align_corners,
|
|
)
|
|
self.assertEqual(output_tensor_2d_x[0, 0, 0, :], output_tensor_3d_z[0, 0, 0, 0, :], atol=0, rtol=0)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_affine_grid(self):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 7).view(1, 2, 3)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=True)
|
|
groundtruth = torch.tensor(
|
|
[[[0., -3.], [2., 5.]], [[4., 7.], [6., 15.]]]).view(1, 2, 2, 2)
|
|
self.assertEqual(output, groundtruth)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2]), align_corners=False)
|
|
groundtruth = torch.tensor(
|
|
[[[1.5, 1.5], [2.5, 5.5]], [[3.5, 6.5], [4.5, 10.5]]]).view(1, 2, 2, 2)
|
|
self.assertEqual(output, groundtruth)
|
|
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, H, W])
|
|
inp = torch.randn(N, 2, 3, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
self.assertTrue(gradcheck(
|
|
lambda inp: F.affine_grid(inp, sz, align_corners=align_corners),
|
|
(inp,), check_forward_ad=True))
|
|
|
|
# test CPU against CUDA
|
|
if TEST_CUDA:
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, H, W])
|
|
for align_corners in (True, False):
|
|
input_cpu = torch.randn(N, 2, 3, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners)
|
|
gradients = torch.randn(out_cpu.size())
|
|
out_cpu.backward(gradients)
|
|
input_gpu = input_cpu.detach().cuda().requires_grad_()
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners)
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
self.assertEqual(input_cpu.grad, input_gpu.grad)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_affine_grid_3d(self):
|
|
# test known input on CPU
|
|
input = torch.arange(1., 13).view(1, 3, 4)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=True)
|
|
groundtruth = torch.tensor(
|
|
[[[[[-2., -10., -18.], [0., 0., 0.]], [[2., 2., 2.], [4., 12., 20.]]],
|
|
[[[4., 4., 4.], [6., 14., 22.]], [[8., 16., 24.], [10., 26., 42.]]]]]).view(1, 2, 2, 2, 3)
|
|
self.assertEqual(output, groundtruth)
|
|
output = F.affine_grid(input, torch.Size([1, 1, 2, 2, 2]), align_corners=False)
|
|
groundtruth = torch.tensor(
|
|
[[[[[1., -1., -3.], [2., 4., 6.]], [[3., 5., 7.], [4., 10., 16.]]],
|
|
[[[4., 6., 8.], [5., 11., 17.]], [[6., 12., 18.], [7., 17., 27.]]]]]).view(1, 2, 2, 2, 3)
|
|
self.assertEqual(output, groundtruth)
|
|
|
|
for align_corners in (True, False):
|
|
# do gradcheck
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
D = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, D, H, W])
|
|
inp = torch.randn(N, 3, 4, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
self.assertTrue(gradcheck(
|
|
lambda inp: F.affine_grid(inp, sz, align_corners=align_corners),
|
|
(inp,), check_forward_ad=True))
|
|
|
|
# test CPU against CUDA
|
|
if TEST_CUDA:
|
|
N = random.randint(1, 8)
|
|
C = random.randint(1, 8)
|
|
D = random.randint(1, 8)
|
|
H = random.randint(1, 8)
|
|
W = random.randint(1, 8)
|
|
sz = torch.Size([N, C, D, H, W])
|
|
for align_corners in (True, False):
|
|
input_cpu = torch.randn(N, 3, 4, requires_grad=True)
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cpu = F.affine_grid(input_cpu, sz, align_corners=align_corners)
|
|
gradients = torch.randn(out_cpu.size())
|
|
out_cpu.backward(gradients)
|
|
input_gpu = input_cpu.detach().cuda().requires_grad_()
|
|
with warnings.catch_warnings(record=True):
|
|
warnings.simplefilter("always") # python2 requires this so other tests can trigger
|
|
out_cuda = F.affine_grid(input_gpu, sz, align_corners=align_corners)
|
|
out_cuda.backward(gradients.cuda())
|
|
self.assertEqual(out_cpu, out_cuda)
|
|
self.assertEqual(input_cpu.grad, input_gpu.grad)
|
|
|
|
def test_channel_shuffle_return_alias_of_self(self):
|
|
# gh-76616: nn.ChannelShuffle will return alias of self with an empty input tensor
|
|
groups = 3
|
|
input_tensor = torch.rand([0, 9, 4, 4])
|
|
output = torch.nn.ChannelShuffle(groups)(input_tensor)
|
|
torch.testing.assert_close(output, input_tensor)
|
|
|
|
@skipIfTorchDynamo("TorchDynamo fails here for unknown reasons")
|
|
def test_native_channel_shuffle_return_alias_of_self(self):
|
|
groups = 3
|
|
input_tensor = torch.rand([0, 9, 4, 4])
|
|
output = torch.native_channel_shuffle(input_tensor, groups)
|
|
torch.testing.assert_close(output, input_tensor)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_upsamplingLinear1d(self):
|
|
for align_corners in [True, False]:
|
|
for recompute_scale_factor in [True, False]:
|
|
kwargs = dict(
|
|
mode='linear', align_corners=align_corners, recompute_scale_factor=recompute_scale_factor
|
|
)
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs)
|
|
in_t = torch.ones(1, 1, 2)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
self.assertEqual(torch.ones(1, 1, out_size), out_t.data)
|
|
|
|
input = torch.randn(1, 1, 2, requires_grad=True)
|
|
if not recompute_scale_factor:
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), (input,))
|
|
else:
|
|
gradcheck(lambda x: F.interpolate(x, scale_factor=scale_factor, **kwargs), (input,))
|
|
|
|
def test_upsamplingLinear1d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='linear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9)
|
|
in_t_9[:, :, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5])
|
|
self.assertEqual(out_t_9[:, :, :15], out_t_5)
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_upsampling_not_recompute_scale_factor(self):
|
|
# test output against known input: result must match opencv
|
|
in_t = torch.arange(8.).view(1, 2, 2, 2)
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.32725, -0.08843, 0.37933, 0.79744],
|
|
[0.15039, 0.38921, 0.85697, 1.27508],
|
|
[1.08591, 1.32473, 1.79249, 2.21060],
|
|
[1.92213, 2.16095, 2.62871, 3.04682]],
|
|
|
|
[[3.67275, 3.91157, 4.37933, 4.79744],
|
|
[4.15039, 4.38921, 4.85697, 5.27508],
|
|
[5.08591, 5.32473, 5.79249, 6.21060],
|
|
[5.92213, 6.16095, 6.62871, 7.04682]]]])
|
|
if IS_PPC:
|
|
# Both OpenCV and PyTorch give a slightly different result on PPC
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.32725, -0.08843, 0.37933, 0.79744],
|
|
[0.15039, 0.38921, 0.85697, 1.27508],
|
|
[1.08591, 1.32473, 1.79249, 2.21060],
|
|
[1.92212, 2.16094, 2.62870, 3.04681]],
|
|
|
|
[[3.67275, 3.91157, 4.37933, 4.79743],
|
|
[4.15039, 4.38921, 4.85697, 5.27508],
|
|
[5.08591, 5.32473, 5.79249, 6.21059],
|
|
[5.92212, 6.16094, 6.62870, 7.04680]]]])
|
|
out_t = F.interpolate(in_t, scale_factor=2.3, mode='bicubic', align_corners=False, recompute_scale_factor=False)
|
|
torch.set_printoptions(precision=5)
|
|
self.assertEqual(out_t, expected_out_t, atol=1e-4, rtol=0)
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='bicubic', align_corners=align_corners)
|
|
# test float scale factor up & downsampling
|
|
for device in device_list:
|
|
for scale_factor in [0.6, 1.6, 2.3]:
|
|
in_t = torch.ones(2, 2, 2, 2).to(device)
|
|
out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs)
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
self.assertEqual(torch.ones(2, 2, out_size, out_size), out_t.data, atol=1e-5, rtol=0)
|
|
|
|
input = torch.randn(2, 2, 2, 2, requires_grad=True)
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
def test_upsamplingBilinear2d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='bilinear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9, 9)
|
|
in_t_9[:, :, :4, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5, :5])
|
|
self.assertEqual(out_t_9[:, :, :15, :15], out_t_5)
|
|
|
|
def test_upsamplingTrilinear3d_spatial_invariance(self):
|
|
m = nn.Upsample(scale_factor=3, mode='trilinear', align_corners=False)
|
|
in_t_9 = torch.zeros(1, 1, 9, 9, 9)
|
|
in_t_9[:, :, :4, :4, :4].normal_()
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t_9 = m(in_t_9)
|
|
out_t_5 = m(in_t_9[:, :, :5, :5, :5])
|
|
self.assertEqual(out_t_9[:, :, :15, :15, :15], out_t_5)
|
|
|
|
def test_upsampling_small_scale(self):
|
|
m = torch.nn.Upsample(scale_factor=0.5, mode="bilinear")
|
|
in_t = torch.arange(1, 5, dtype=torch.get_default_dtype()).reshape(1, 1, 2, 2)
|
|
out_t = m(in_t)
|
|
expected_out_t = torch.tensor([[[[2.5]]]])
|
|
self.assertEqual(expected_out_t, out_t)
|
|
|
|
def test_upsampling_bfloat16(self, dtype=torch.bfloat16):
|
|
def helper(size, scale_factor, mode, device, memory_format=torch.contiguous_format):
|
|
input = torch.randn(size, device=device, dtype=dtype).to(memory_format=memory_format).detach().requires_grad_(True)
|
|
inputf = input.to(torch.float32).to(memory_format=torch.contiguous_format).detach().requires_grad_(True)
|
|
m = nn.Upsample(scale_factor=scale_factor, mode=mode)
|
|
|
|
outf = m(inputf)
|
|
out = m(input)
|
|
self.assertEqual(out.to(torch.float32), outf, atol=0.05, rtol=0)
|
|
|
|
ginput = torch.randn(out.shape, device=device, dtype=dtype).to(memory_format=memory_format)
|
|
ginputf = ginput.to(torch.float32).to(memory_format=torch.contiguous_format)
|
|
out.backward(ginput)
|
|
outf.backward(ginputf)
|
|
self.assertEqual(input.grad.to(torch.float32), inputf.grad, atol=0.01, rtol=0.01)
|
|
|
|
for device in ['cpu']:
|
|
helper([3, 20, 11, 7], 2, 'nearest', device)
|
|
helper([3, 20, 11, 7], 2, 'nearest', device, torch.channels_last)
|
|
helper([3, 20, 11, 7, 3], 2, 'nearest', device)
|
|
helper([3, 20, 30], 2, 'linear', device)
|
|
helper([3, 20, 11, 7], 2, 'bilinear', device)
|
|
helper([3, 20, 11, 7], 2, 'bilinear', device, torch.channels_last)
|
|
helper([1, 3, 11, 7], 2, 'bicubic', device)
|
|
helper([1, 3, 11, 7], 2, 'bicubic', device, torch.channels_last)
|
|
helper([3, 20, 11, 7, 3], 2, 'trilinear', device)
|
|
|
|
helper([3, 5, 5], 257., 'nearest', device)
|
|
helper([3, 20, 11, 7], 20, 'nearest', device)
|
|
helper([3, 20, 11, 7, 3], 20, 'nearest', device)
|
|
helper([1, 2, 11, 7], 257, 'nearest', device, torch.channels_last)
|
|
helper([1, 2, 2000, 2000], 1 / 377., 'nearest', device)
|
|
helper([1, 2, 2000, 2000], 1 / 257., 'nearest', device, torch.channels_last)
|
|
helper([3, 2, 11, 7, 3], 20, 'nearest', device, torch.channels_last_3d)
|
|
helper([3, 5, 5], 10, 'linear', device)
|
|
helper([3, 5, 5], 257, 'linear', device)
|
|
helper([1, 2, 11, 7], 257, 'bilinear', device)
|
|
helper([1, 2, 11, 7], 257, 'bilinear', device, torch.channels_last)
|
|
helper([1, 3, 11, 7], 10, 'bicubic', device)
|
|
helper([1, 3, 11, 7], 10, 'bicubic', device, torch.channels_last)
|
|
helper([1, 1, 11, 7], 257, 'bicubic', device)
|
|
helper([3, 2, 11, 7, 3], 20, 'trilinear', device)
|
|
helper([3, 2, 11, 7, 3], 20, 'trilinear', device, torch.channels_last_3d)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA unavailable")
|
|
def test_interpolate_illegal_memory_access(self):
|
|
in_s = 45
|
|
out_s = 14
|
|
|
|
input = torch.ones((1, 1, in_s), device='cuda', requires_grad=True)
|
|
# note we allocated grad_output to be larger so out of bound access
|
|
# would be visible in grad_input
|
|
grad = torch.ones((1, 1, out_s * 2), device='cuda', requires_grad=True)
|
|
grad = grad[:, :, :out_s]
|
|
|
|
input_ref = input.detach().cpu().requires_grad_()
|
|
grad_ref = grad.cpu()
|
|
|
|
out = F.interpolate(input, size=(out_s,), mode='nearest')
|
|
out.backward(grad)
|
|
|
|
out_ref = F.interpolate(input_ref, size=(out_s,), mode='nearest')
|
|
out_ref.backward(grad_ref)
|
|
|
|
self.assertEqual(out_ref, out)
|
|
self.assertEqual(input_ref.grad, input.grad)
|
|
|
|
def test_interpolate_undefined_behavior_casting(self):
|
|
x = torch.ones([1, 1, 16, 16])
|
|
self.assertRaises(RuntimeError, lambda: F.interpolate(x, scale_factor=-1e20, mode="bilinear"))
|
|
self.assertRaises(RuntimeError, lambda: F.interpolate(x, scale_factor=1e20, mode="bilinear"))
|
|
|
|
def test_interpolate_buffer_overflow(self):
|
|
# Test buffer overflow issue due to inaccurate floating point
|
|
# representation for integer values. See issue below for details.
|
|
# https://github.com/pytorch/pytorch/issues/88939
|
|
|
|
def helper(size, dtype, mode, device, is_channels_last):
|
|
input = torch.ones(size, dtype=dtype, device=device)
|
|
if is_channels_last:
|
|
if len(size) == 3:
|
|
input = input.transpose(1, 2).contiguous().transpose(1, 2)
|
|
elif len(size) == 4:
|
|
input = input.to(memory_format=torch.channels_last)
|
|
else:
|
|
input = input.to(memory_format=torch.channels_last_3d)
|
|
output1 = F.interpolate(input, 2, mode=mode, align_corners=True)
|
|
# reset the corner value and expect the output is changed as well
|
|
# the output won't be changed on buffer overflow
|
|
input[(-1,) * len(size)] = 0.5
|
|
output2 = F.interpolate(input, 2, mode=mode, align_corners=True)
|
|
self.assertNotEqual(output1, output2)
|
|
|
|
size_dtype_list = []
|
|
# We set the size larger than the floating point exactly representable range
|
|
# float: exact representable range (-2**24,2**24)
|
|
size_dtype_list.append(([1, 10, 2**24 + 4], torch.float))
|
|
size_dtype_list.append(([1, 10, 2, 2**24 + 4], torch.float))
|
|
size_dtype_list.append(([1, 10, 2, 2, 2**24 + 4], torch.float))
|
|
# bfloat16: exact representable range (-2**8, 2**8)
|
|
size_dtype_list.append(([1, 10, 2**8 + 4], torch.bfloat16))
|
|
size_dtype_list.append(([1, 10, 2, 2**8 + 4], torch.bfloat16))
|
|
size_dtype_list.append(([1, 10, 2, 2, 2**8 + 4], torch.bfloat16))
|
|
# half: exact representable range (-2**11, 2**11)
|
|
size_dtype_list.append(([1, 10, 2**11 + 4], torch.half))
|
|
size_dtype_list.append(([1, 10, 2, 2**11 + 4], torch.half))
|
|
size_dtype_list.append(([1, 10, 2, 2, 2**11 + 4], torch.half))
|
|
|
|
# TODO: turn on cuda test after buffer overflow issue is fixed in cuda kernel
|
|
# devices = ['cpu'] + (['cuda'] if torch.cuda.is_available() else [])
|
|
devices = ['cpu']
|
|
|
|
for mode in ('linear', 'bilinear', 'bicubic', 'trilinear'):
|
|
for size_dtype in size_dtype_list:
|
|
size, dtype = size_dtype
|
|
if (
|
|
mode == 'linear' and len(size) != 3
|
|
or (mode == 'bilinear' and len(size) != 4)
|
|
or (mode == 'bicubic' and len(size) != 4)
|
|
or (mode == 'trilinear' and len(size) != 5)
|
|
):
|
|
continue
|
|
for device in devices:
|
|
if (
|
|
device == 'cpu' and dtype == torch.half
|
|
or (device == 'cuda' and dtype == torch.bfloat16)
|
|
):
|
|
# no half precision support on cpu or bfloat16 on cuda yet
|
|
continue
|
|
for is_channels_last in (True, False):
|
|
helper(size, dtype, mode, device, is_channels_last)
|
|
|
|
|
|
@set_default_dtype(torch.double)
|
|
def test_interpolate(self):
|
|
def _test_interpolate_non_integer_size_warning(in_t, out_size, dim, **kwargs):
|
|
test_sizes = [float(out_size),
|
|
torch.tensor(out_size, dtype=torch.float)]
|
|
for size in test_sizes:
|
|
self.assertRaisesRegex(TypeError,
|
|
"(expected size to be one of int or).*",
|
|
F.interpolate, in_t, size=(size,) * dim, **kwargs)
|
|
|
|
def _test_interpolate_helper(in_t, scale_factor, layer):
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
dim = len(in_t.shape) - 2
|
|
out_shape = [1, 1] + [out_size] * dim
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = layer(in_t)
|
|
self.assertEqual(torch.ones(out_shape), out_t)
|
|
|
|
self.assertEqual(
|
|
F.interpolate(in_t, (out_size,) * dim, **kwargs),
|
|
F.interpolate(in_t, scale_factor=scale_factor, **kwargs))
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t], nondet_tol=GRADCHECK_NONDET_TOL)
|
|
gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [in_t], nondet_tol=GRADCHECK_NONDET_TOL)
|
|
_test_interpolate_non_integer_size_warning(in_t, out_size, dim, **kwargs)
|
|
|
|
def _make_input(dim, device):
|
|
size = [1, 1]
|
|
size += [2] * dim
|
|
return torch.ones(size, requires_grad=True, device=device)
|
|
|
|
device_list = ['cpu']
|
|
if TEST_CUDA:
|
|
device_list.append('cuda')
|
|
|
|
for device in device_list:
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
for mode in ['nearest', 'area']:
|
|
kwargs = dict(mode=mode)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
for input in [_make_input(1, device), _make_input(2, device), _make_input(3, device)]:
|
|
_test_interpolate_helper(input, scale_factor, m)
|
|
|
|
for align_corners in [True, False]:
|
|
kwargs = dict(mode='linear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(1, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='bilinear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(2, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='bicubic', align_corners=align_corners)
|
|
|
|
def m(t):
|
|
return F.interpolate(t, scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(2, device), scale_factor, m)
|
|
|
|
kwargs = dict(mode='trilinear', align_corners=align_corners)
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs).to(device)
|
|
_test_interpolate_helper(_make_input(3, device), scale_factor, m)
|
|
|
|
def test_linear_broadcasting(self):
|
|
m = nn.Linear(5, 8)
|
|
inp = torch.randn(2, 3, 5)
|
|
expected = m(inp.view(6, 5)).view(2, 3, 8)
|
|
self.assertEqual(expected, m(inp))
|
|
|
|
def test_linear_raise_on_scalar_input(self):
|
|
# This used to cause an int underflow issue when reshaping the input
|
|
# see https://github.com/pytorch/pytorch/issues/119161
|
|
m = nn.Linear(1, 1)
|
|
inp = torch.ones(1).squeeze()
|
|
with self.assertRaisesRegex(RuntimeError, ".*both arguments.*1D.*"):
|
|
m(inp)
|
|
|
|
@parametrize_test('device', ['cpu'] + (['cuda'] if TEST_CUDA else []))
|
|
@parametrize_test('bias', [
|
|
subtest(False, name='nobias'), subtest(True, name='bias')])
|
|
@parametrize_test('weight_layout', [
|
|
subtest(torch.strided, name='weightStrided'),
|
|
subtest(torch.sparse_coo, name='weightCOO'),
|
|
subtest(torch.sparse_csr, name='weightCSR'),
|
|
subtest(torch.sparse_csc, name='weightCSC'),
|
|
# TODO: addmm: computation on CPU is not implemented for Strided + Strided @ SparseBsr
|
|
# subtest(torch.sparse_bsr, name='weightBSR'),
|
|
# subtest(torch.sparse_bsc, name='weightBSC'),
|
|
])
|
|
def test_linear_autograd(self, device, bias, weight_layout):
|
|
module = nn.Linear(4, 4, bias=bias, device=device)
|
|
if weight_layout == torch.strided:
|
|
pass
|
|
elif weight_layout == torch.sparse_csr:
|
|
module.weight = nn.Parameter(module.weight.to_sparse_csr())
|
|
elif weight_layout == torch.sparse_csc:
|
|
module.weight = nn.Parameter(module.weight.to_sparse_csc())
|
|
elif weight_layout == torch.sparse_bsr:
|
|
module.weight = nn.Parameter(module.weight.to_sparse_bsr((2, 2)))
|
|
elif weight_layout == torch.sparse_bsc:
|
|
module.weight = nn.Parameter(module.weight.to_sparse_bsc((2, 2)))
|
|
elif weight_layout == torch.sparse_coo:
|
|
module.weight = nn.Parameter(module.weight.to_sparse_coo())
|
|
else:
|
|
raise AssertionError
|
|
|
|
inp = torch.randn(4, requires_grad=True, device=device)
|
|
res = module(inp)
|
|
if bias:
|
|
expected = (torch.einsum("i,ji->j", inp, module.weight.to_dense())) + module.bias
|
|
else:
|
|
expected = (torch.einsum("i,ji->j", inp, module.weight.to_dense()))
|
|
self.assertEqual(res, expected)
|
|
|
|
grad_output = torch.randn(4, device=device)
|
|
grads = torch.autograd.grad(res, [module.weight, inp], grad_output)
|
|
grads_expected = torch.autograd.grad(expected, [module.weight, inp], grad_output)
|
|
|
|
self.assertEqual(grads_expected[0].layout, weight_layout)
|
|
|
|
for g, ge in zip(grads, grads_expected):
|
|
self.assertEqual(g, ge)
|
|
|
|
def test_bilinear(self):
|
|
module = nn.Bilinear(10, 10, 8)
|
|
input1 = torch.randn(4, 10, requires_grad=True)
|
|
input2 = torch.randn(4, 10, requires_grad=True)
|
|
grad_output = torch.randn(4, 8)
|
|
res = module(input1, input2)
|
|
expected = (torch.einsum("bi,kij,bj->bk", input1, module.weight, input2) +
|
|
module.bias)
|
|
self.assertEqual(res, expected)
|
|
grads = torch.autograd.grad(res, [module.weight, module.bias, input1, input2], grad_output)
|
|
grads_expected = torch.autograd.grad(expected, [module.weight, module.bias, input1, input2], grad_output)
|
|
for g, ge in zip(grads, grads_expected):
|
|
self.assertEqual(g, ge)
|
|
|
|
def test_bilinear_non_contiguous(self):
|
|
module = nn.Bilinear(7, 7, 5)
|
|
input1 = torch.randn(4, 7, 10, requires_grad=True)
|
|
input2 = torch.randn(4, 7, 10, requires_grad=True)
|
|
input1_tp = input1.transpose(1, 2)
|
|
input2_tp = input2.transpose(1, 2)
|
|
|
|
grad_output = torch.randn(4, 10, 5)
|
|
|
|
def run(input1_tp, input2_tp):
|
|
input1.grad = input2.grad = None
|
|
output = module(input1_tp, input2_tp)
|
|
output.backward(grad_output)
|
|
|
|
return output.data, input1.grad.data, input2.grad.data
|
|
|
|
out_nc, g1_nc, g2_nc = run(input1_tp, input2_tp)
|
|
input1_tp = input1_tp.contiguous()
|
|
input2_tp = input2_tp.contiguous()
|
|
out, g1, g2 = run(input1_tp, input2_tp)
|
|
|
|
self.assertEqual(out, out_nc)
|
|
self.assertEqual(g1, g1_nc)
|
|
self.assertEqual(g2, g2_nc)
|
|
|
|
def test_bilinear_no_bias(self):
|
|
module = nn.Bilinear(10, 10, 8, dtype=torch.double)
|
|
module_no_bias = nn.Bilinear(10, 10, 8, False, dtype=torch.double)
|
|
|
|
module.bias.data.zero_()
|
|
module.weight.data.copy_(module_no_bias.weight)
|
|
|
|
input1 = torch.randn(4, 10, requires_grad=True, dtype=torch.double)
|
|
input2 = torch.randn(4, 10, requires_grad=True, dtype=torch.double)
|
|
grad_output = torch.randn(4, 8, dtype=torch.double)
|
|
|
|
def run(net):
|
|
input1.grad = input2.grad = None
|
|
output = net(input1, input2)
|
|
output.backward(grad_output)
|
|
|
|
return output.data, input1.grad.data, input2.grad.data
|
|
|
|
out, g1, g2 = run(module)
|
|
out_nb, g1_nb, g2_nb = run(module_no_bias)
|
|
|
|
self.assertEqual(out, out_nb)
|
|
self.assertEqual(g1, g1_nb)
|
|
self.assertEqual(g2, g2_nb)
|
|
|
|
_assertGradAndGradgradChecks(self,
|
|
lambda x1, x2: F.bilinear(x1, x2, module_no_bias.weight, module_no_bias.bias),
|
|
(input1, input2))
|
|
|
|
def test_bilinear_broadcasting(self):
|
|
m = nn.Bilinear(5, 6, 8)
|
|
input1 = torch.randn(2, 3, 5)
|
|
input2 = torch.randn(2, 3, 6)
|
|
expected = m(input1.view(6, 5), input2.view(6, 6)).view(2, 3, 8)
|
|
self.assertEqual(expected, m(input1, input2))
|
|
|
|
def test_fold_invalid_arg(self):
|
|
# input.size(1) not divisible by \prod(kernel_size)
|
|
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3))
|
|
with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"):
|
|
fold(torch.randn(1, 5, 9))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"be divisible by the product of kernel_size"):
|
|
fold(torch.randn(1, 19, 9))
|
|
|
|
# input.size(2) not matching the total number of sliding blocks
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3))
|
|
fold(torch.randn(1, 6, 10))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2))
|
|
fold(torch.randn(1, 6, 5))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"match the calculated number of sliding blocks"):
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 3), stride=(2, 2), dilation=(1, 2), padding=(2, 0))
|
|
fold(torch.randn(1, 6, 5)) # should be 4 * 1 = 4 sliding blocks
|
|
|
|
fold = nn.Fold(output_size=(4, 5), kernel_size=(2, 2), stride=1, dilation=8, padding=0)
|
|
with self.assertRaisesRegex(RuntimeError, r"calculated shape of the array of sliding blocks as"):
|
|
fold(torch.randn(1, 12, 12))
|
|
|
|
def test_unfold_invalid_arg(self):
|
|
# input wrong dimension
|
|
|
|
unfold = nn.Unfold(kernel_size=(2, 3))
|
|
|
|
# calculated output shape is too small
|
|
with self.assertRaisesRegex(RuntimeError, r"its components must be at least one"):
|
|
unfold = nn.Unfold(kernel_size=(2, 3))
|
|
unfold(torch.randn(1, 2, 2, 2))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"its components must be at least one"):
|
|
unfold = nn.Unfold(kernel_size=(5, 3), padding=(1, 1))
|
|
unfold(torch.randn(1, 2, 2, 3))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, r"its components must be at least one"):
|
|
unfold = nn.Unfold(kernel_size=(1, 3), padding=(1, 1), dilation=(1, 2))
|
|
unfold(torch.randn(1, 2, 2, 2))
|
|
|
|
def test_softmin(self):
|
|
x = torch.randn(2, 16)
|
|
self.assertEqual(F.softmin(x, 1), F.softmax(-x, 1))
|
|
self.assertEqual(F.softmin(x, 0), F.softmax(-x, 0))
|
|
|
|
def test_adaptive_log_softmax(self):
|
|
# args validation
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 15], div_value=2.)
|
|
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 15, 10], div_value=2.)
|
|
|
|
with self.assertRaises(ValueError):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 25], div_value=2.)
|
|
|
|
with self.assertRaisesRegex(ValueError, "cutoffs should be a sequence of unique,"):
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 20], div_value=2.)
|
|
|
|
# not raise
|
|
_ = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 19], div_value=2.)
|
|
|
|
# input shapes
|
|
with self.assertRaisesRegex(RuntimeError, r"Input and target should have the same size"):
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 5, 10])
|
|
asfm(x, y)
|
|
|
|
# out-of-bound targets
|
|
with self.assertRaisesRegex(RuntimeError, r"Target values should be in"):
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 20])
|
|
asfm(x, y)
|
|
|
|
# cluster sizes
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(2, 16)
|
|
y = torch.tensor([0, 17])
|
|
|
|
self.assertEqual(asfm.head.weight.size(), (5 + 3, 16)) # 5 targets in head, 3 clusters, dimensionality 16
|
|
self.assertEqual(asfm.tail[0][1].weight.size(), (5, 8)) # 5 targets in this cluster, dimensionality 8
|
|
self.assertEqual(asfm.tail[1][1].weight.size(), (5, 4))
|
|
self.assertEqual(asfm.tail[2][1].weight.size(), (5, 2))
|
|
self.assertEqual(asfm(x, y).output.size(), (2, ))
|
|
|
|
# test no_batch_dim support
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(16, 20, [5, 10, 15], div_value=2.)
|
|
x = torch.randn(1, 16)
|
|
y = torch.tensor([17])
|
|
x2 = x.squeeze(0)
|
|
y2 = y.squeeze(0)
|
|
self.assertEqual(asfm(x, y).output.squeeze(0), asfm(x2, y2).output)
|
|
|
|
# log_probs actually returns log_proba
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 4, [2], div_value=2.)
|
|
x = torch.randn(4, 8)
|
|
logprob_out = asfm.log_prob(x)
|
|
|
|
self.assertEqual(torch.exp(logprob_out).data.sum(1), torch.ones(4))
|
|
|
|
# forward returns the same thing as log_probs
|
|
for v in [0, 1, 2, 3]:
|
|
y = torch.full((4,), v, dtype=torch.long)
|
|
out, loss = asfm(x, y)
|
|
|
|
self.assertEqual(out, logprob_out.gather(1, y.unsqueeze(1)).squeeze())
|
|
self.assertEqual(loss, F.nll_loss(logprob_out, y))
|
|
|
|
# predict
|
|
x = torch.randn(64, 8).abs_()
|
|
|
|
# argmax in shortlist
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
asfm.head.weight.data[asfm.shortlist_size:, :].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
# argmax outside of shortlist
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
asfm.head.weight.data[:asfm.shortlist_size, :].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
# half of the argmax in shortlist, half in clusters
|
|
asfm = nn.AdaptiveLogSoftmaxWithLoss(8, 10, [4, 8], div_value=2., head_bias=True)
|
|
asfm.head.weight.data.abs_()
|
|
asfm.head.bias.data.abs_()
|
|
|
|
x[:32, :asfm.shortlist_size].zero_()
|
|
x[32:, asfm.shortlist_size:].zero_()
|
|
|
|
asfm.head.weight.data[:asfm.shortlist_size, asfm.shortlist_size:].zero_()
|
|
asfm.head.weight.data[asfm.shortlist_size:, :asfm.shortlist_size].zero_()
|
|
|
|
out = asfm.predict(x)
|
|
self.assertEqual(out, asfm.log_prob(x).argmax(dim=1))
|
|
|
|
def test_cross_entropy_loss(self, dtype=torch.bfloat16):
|
|
loss_cpu = nn.CrossEntropyLoss().cpu()
|
|
inputf = torch.randn(15, 10, device="cpu", dtype=torch.float, requires_grad=True)
|
|
input = inputf.to(dtype).detach().requires_grad_(True)
|
|
target = torch.empty(15, dtype=torch.long).random_(10)
|
|
|
|
outf = loss_cpu(inputf, target)
|
|
out = loss_cpu(input, target)
|
|
self.assertEqual(out, outf.to(dtype=dtype), atol=1e-1, rtol=0)
|
|
|
|
outf.backward()
|
|
out.backward()
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype=dtype), atol=1e-1, rtol=0)
|
|
|
|
def test_cross_entropy_loss_precision(self):
|
|
# Regression test for #55657
|
|
loss_cpu = nn.CrossEntropyLoss().cpu()
|
|
inputf = torch.randn(128, 2, 768, 768, device="cpu", dtype=torch.float)
|
|
inputd = inputf.double()
|
|
target = torch.randint(2, (128, 768, 768), dtype=torch.long)
|
|
|
|
outf = loss_cpu(inputf, target)
|
|
outd = loss_cpu(inputd, target)
|
|
self.assertEqual(outf, outd, exact_dtype=False)
|
|
|
|
def test_cross_entropy_loss_zero_div(self):
|
|
# Test for issue #73165
|
|
input_1 = torch.rand([5, 0], dtype=torch.float32)
|
|
input_2 = torch.rand([5, 0], dtype=torch.float32)
|
|
torch.nn.CrossEntropyLoss()(input_1, input_2)
|
|
|
|
@unittest.skipIf(not torch.cuda.is_available(), "CUDA not available")
|
|
def test_convert_sync_batchnorm(self):
|
|
module = torch.nn.Sequential(
|
|
torch.nn.BatchNorm1d(100),
|
|
torch.nn.InstanceNorm1d(100)
|
|
).cuda()
|
|
|
|
# necessary to have an anchor point for comparison, in case the
|
|
# convert_sync_batchnorm updates in place
|
|
comp_module = torch.nn.Sequential(
|
|
torch.nn.BatchNorm1d(100),
|
|
torch.nn.InstanceNorm1d(100)
|
|
).cuda()
|
|
comp_module.load_state_dict(module.state_dict())
|
|
|
|
sync_bn_module = torch.nn.SyncBatchNorm.convert_sync_batchnorm(module)
|
|
children = list(sync_bn_module.children())
|
|
self.assertEqual(children[0].__class__, torch.nn.SyncBatchNorm)
|
|
self.assertEqual(children[1].__class__, torch.nn.InstanceNorm1d)
|
|
|
|
for layer, converted_layer in zip(comp_module.children(), sync_bn_module.children()):
|
|
for key in layer.state_dict().keys():
|
|
self.assertEqual(layer.state_dict()[key].device, converted_layer.state_dict()[key].device)
|
|
self.assertEqual(layer.state_dict()[key], converted_layer.state_dict()[key])
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA not available")
|
|
def test_sync_batchnorm_backward_elemt(self):
|
|
device = 'cuda'
|
|
saved_input = torch.rand(2, 3, 2, 1, device=device)
|
|
grad_output = torch.rand(2, 3, 2, 1, device=device)
|
|
mean = torch.rand(3, device=device)
|
|
invstd = torch.rand(3, device=device)
|
|
weight = torch.rand(3, device=device)
|
|
sum_dy = torch.rand(3, device=device)
|
|
sum_dy_xmu = torch.rand(3, device=device)
|
|
count_tensor = torch.tensor([5, 5, 5], dtype=torch.int32, device=device)
|
|
|
|
gI_contiguous = torch.batch_norm_backward_elemt(
|
|
grad_output,
|
|
saved_input,
|
|
mean,
|
|
invstd,
|
|
weight,
|
|
sum_dy,
|
|
sum_dy_xmu,
|
|
count_tensor
|
|
)
|
|
|
|
# Test batch_norm_backward_elemt gives the same answer for all
|
|
# combinations of contiguous as channels_last input
|
|
for a, b in [
|
|
(torch.channels_last, torch.contiguous_format),
|
|
(torch.contiguous_format, torch.channels_last),
|
|
(torch.channels_last, torch.channels_last),
|
|
]:
|
|
gI_actual = torch.batch_norm_backward_elemt(
|
|
grad_output.contiguous(memory_format=a),
|
|
saved_input.contiguous(memory_format=b),
|
|
mean,
|
|
invstd,
|
|
weight,
|
|
sum_dy,
|
|
sum_dy_xmu,
|
|
count_tensor
|
|
)
|
|
self.assertEqual(gI_actual, gI_contiguous)
|
|
|
|
@unittest.skipIf(not TEST_CUDA, "CUDA not available")
|
|
def test_sync_batchnorm_accuracy_cuda(self):
|
|
# The target of this test is to test the functionality and accuracy of
|
|
# those single-GPU cuda kernels used in SyncBatchNorm
|
|
# They are:
|
|
# fwd: torch.batch_norm_stats, torch.batch_norm_gather_stats_with_counts, torch.batch_norm_elemt
|
|
# bwd: torch.batch_norm_backward_reduce, torch.batch_norm_backward_elemt
|
|
|
|
def _batch_norm_stats(data, memory_format, mean_axes):
|
|
mean1, _ = torch.batch_norm_stats(data, 1e-5)
|
|
mean2, _ = torch.batch_norm_stats(data.to(memory_format=memory_format), 1e-5)
|
|
mean_ref = torch.mean(data, mean_axes, keepdim=False)
|
|
|
|
self.assertEqual(mean_ref, mean1)
|
|
self.assertEqual(mean_ref, mean2)
|
|
|
|
_batch_norm_stats(torch.randn(1, 96, 112, 112, dtype=torch.float, device='cuda'), torch.channels_last, (0, 2, 3))
|
|
_batch_norm_stats(torch.randn(1, 96, 112, 112, 112, dtype=torch.float, device='cuda'), torch.channels_last_3d, (0, 2, 3, 4))
|
|
|
|
def test_flatten(self):
|
|
tensor_input = torch.randn(2, 1, 2, 3)
|
|
|
|
# Flatten Tensor
|
|
|
|
flatten = nn.Flatten(start_dim=1, end_dim=-1)
|
|
tensor_output = flatten(tensor_input)
|
|
self.assertEqual(tensor_output.size(), torch.Size([2, 6]))
|
|
|
|
def test_unflatten(self):
|
|
tensor_input = torch.randn(2, 50)
|
|
|
|
# Unflatten Tensor (unflattened_size as a tuple of ints and list of ints)
|
|
|
|
for us in ((2, 5, 5), [2, 5, 5]):
|
|
unflatten = nn.Unflatten(dim=1, unflattened_size=us)
|
|
tensor_output = unflatten(tensor_input)
|
|
self.assertEqual(tensor_output.size(), torch.Size([2, 2, 5, 5]))
|
|
|
|
# Unflatten NamedTensor
|
|
|
|
unflatten = nn.Unflatten(dim='features', unflattened_size=(('C', 2), ('H', 5), ('W', 5)))
|
|
named_tensor_input = tensor_input.refine_names('N', 'features')
|
|
named_tensor_output = unflatten(named_tensor_input)
|
|
self.assertEqual(named_tensor_output.size(), torch.Size([2, 2, 5, 5]))
|
|
|
|
def test_unflatten_invalid_arg(self):
|
|
# Wrong type for unflattened_size (tuple of floats)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of ints, but found element of type float at pos 2"):
|
|
nn.Unflatten(dim=1, unflattened_size=(2, 5, 5.0))
|
|
|
|
# Wrong type for unflattened_size (list of lists and list of tuples)
|
|
for us in ([['C', 2], ['W', 5], ['H', 5]], [('C', 2), ('W', 5), ('H', 5)]):
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be a tuple of tuples, but found type list"):
|
|
nn.Unflatten(dim='features', unflattened_size=us)
|
|
|
|
# Wrong type for unflattened_size (tuple of lists)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of tuples, but found element of type list at pos 0"):
|
|
nn.Unflatten(dim='features', unflattened_size=(['C', 2], ['W', 5], ['H', 5]))
|
|
|
|
# Wrong type for unflattened_size (tuple of dicts)
|
|
|
|
with self.assertRaisesRegex(
|
|
TypeError,
|
|
r"unflattened_size must be tuple of tuples, but found element of type dict at pos 0"):
|
|
nn.Unflatten(dim='features', unflattened_size=({'C': 2}, {'W': 5}, {'H': 5}))
|
|
|
|
def test_layer_norm_grads_with_create_graph_flag(self):
|
|
atol = 1e-5
|
|
rtol = 1e-3
|
|
|
|
x = torch.randn((4, 4, 16), requires_grad=True)
|
|
layer_norm = nn.LayerNorm((16,), 1e-5, True)
|
|
with torch.no_grad():
|
|
layer_norm.weight = torch.nn.Parameter(0.1 * torch.ones_like(layer_norm.weight))
|
|
|
|
grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0]
|
|
grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0]
|
|
|
|
self.assertEqual(grads1, grads2, rtol=rtol, atol=atol)
|
|
|
|
if TEST_CUDA:
|
|
x = x.to('cuda')
|
|
layer_norm = layer_norm.to('cuda')
|
|
|
|
grads1 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=False)[0]
|
|
grads2 = torch.autograd.grad(layer_norm(x).sum(), x, create_graph=True)[0]
|
|
|
|
self.assertEqual(grads1, grads2, rtol=rtol, atol=atol)
|
|
|
|
def test_layer_norm_eps(self):
|
|
# test for https://github.com/pytorch/pytorch/issues/108072
|
|
x = torch.Tensor([[[2.0, 2.0], [14.0, 14.0]], [[2.0, 2.0], [14.0, 14.0]]])
|
|
ln = torch.nn.LayerNorm(2, eps=1e-6, elementwise_affine=False)
|
|
self.assertEqual(ln.forward(x), torch.zeros_like(x))
|
|
|
|
def test_padding_list(self):
|
|
# Padding can be a list, or tuple (regression test for gh-54452)
|
|
x = torch.randn(4, 8, 32, 32)
|
|
net = torch.nn.ConvTranspose2d(8, 16, kernel_size=3, padding=[3, 3])
|
|
y = net(x)
|
|
|
|
net = torch.nn.ConvTranspose2d(8, 16, kernel_size=3, padding=(3, 3))
|
|
y = net(x)
|
|
|
|
def test_fractional_max_pool2d_invalid_output_ratio(self):
|
|
arg_1 = [2, 1]
|
|
arg_2 = [0.5, 0.5, 0.6]
|
|
arg_class = torch.nn.FractionalMaxPool2d(kernel_size=arg_1, output_ratio=arg_2,)
|
|
arg_3_0_tensor = torch.rand([20, 16, 50, 32], dtype=torch.float32)
|
|
arg_3_0 = arg_3_0_tensor.clone()
|
|
arg_3 = [arg_3_0,]
|
|
|
|
with self.assertRaisesRegex(ValueError,
|
|
"fractional_max_pool2d requires output_ratio to either be a single Int or tuple of Ints."):
|
|
res = arg_class(*arg_3)
|
|
|
|
def test_max_pool1d_invalid_output_size(self):
|
|
arg_1 = 3
|
|
arg_2 = 255
|
|
arg_3 = False
|
|
arg_class = torch.nn.MaxPool1d(kernel_size=arg_1, stride=arg_2, return_indices=arg_3)
|
|
arg_4_0 = torch.as_tensor([[0.3204]])
|
|
arg_4 = [arg_4_0,]
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
res = arg_class(*arg_4)
|
|
|
|
def test_pickle_module_no_weights_only_warning(self):
|
|
with warnings.catch_warnings(record=True) as w:
|
|
pickle.loads(pickle.dumps(torch.nn.Linear(10, 10)))
|
|
self.assertEqual(len(w), 0)
|
|
|
|
class TestFusionEval(TestCase):
|
|
@set_default_dtype(torch.double)
|
|
@given(X=hu.tensor(shapes=((5, 3, 5, 5),), dtype=np.double),
|
|
running_mean=hu.tensor(shapes=(6,), dtype=np.double),
|
|
running_var=hu.tensor(shapes=(6,), dtype=np.double))
|
|
def test_fuse_module_eval_numerics(self, X, running_mean, running_var):
|
|
inputs, _ = X
|
|
|
|
iC, oC = inputs.shape[1], len(running_mean[0])
|
|
inputs = torch.from_numpy(inputs)
|
|
kernel_size = (3, 3)
|
|
|
|
conv_ref = torch.nn.Conv2d(iC, oC, bias=True, kernel_size=kernel_size)
|
|
bn_ref = torch.nn.BatchNorm2d(oC)
|
|
bn_ref.running_mean = torch.from_numpy(running_mean[0])
|
|
bn_ref.running_var = torch.from_numpy(running_var[0])
|
|
|
|
conv_ref.eval()
|
|
bn_ref.eval()
|
|
|
|
Y_ref = bn_ref(conv_ref(inputs))
|
|
conv_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref,
|
|
bn_ref)
|
|
Y_hat = conv_bn_fused(inputs)
|
|
|
|
self.assertEqual(Y_ref, Y_hat, msg="Conv+BN fusion results are off")
|
|
|
|
na_bn_ref = torch.nn.BatchNorm2d(oC, affine=False)
|
|
na_bn_ref.running_mean = torch.from_numpy(running_mean[0])
|
|
na_bn_ref.running_var = torch.from_numpy(running_var[0])
|
|
na_bn_ref.eval()
|
|
|
|
Y_ref = na_bn_ref(conv_ref(inputs))
|
|
conv_na_bn_fused = torch.nn.utils.fusion.fuse_conv_bn_eval(conv_ref,
|
|
na_bn_ref)
|
|
Y_hat = conv_na_bn_fused(inputs)
|
|
|
|
self.assertEqual(Y_ref, Y_hat, msg="Conv+BN(non-affine) fusion results are off")
|
|
|
|
|
|
class TestConstantPadNd(TestCase):
|
|
def test_constant_pad_nd(self):
|
|
a = torch.tensor([[1, 2], [3, 4]])
|
|
res = torch.constant_pad_nd(a, [1, 2, 1, 0], 9)
|
|
expected = torch.tensor([
|
|
[9, 9, 9, 9, 9],
|
|
[9, 1, 2, 9, 9],
|
|
[9, 3, 4, 9, 9]
|
|
])
|
|
self.assertEqual(res, expected)
|
|
|
|
def test_preserves_memory_format(self):
|
|
nchw_tensor = torch.rand((1, 2, 5, 3))
|
|
nchw_padded = torch.constant_pad_nd(nchw_tensor, [1, 2], 0.5)
|
|
self.assertTrue(nchw_padded.is_contiguous(memory_format=torch.contiguous_format))
|
|
|
|
nhwc_tensor = nchw_tensor.contiguous(memory_format=torch.channels_last)
|
|
nhwc_padded = torch.constant_pad_nd(nhwc_tensor, [1, 2], 0.5)
|
|
self.assertTrue(nhwc_padded.is_contiguous(memory_format=torch.channels_last))
|
|
|
|
|
|
class TestAddRelu(TestCase):
|
|
def test_add_relu(self):
|
|
a = torch.rand((7, 11))
|
|
b = torch.rand((7, 11))
|
|
a = a.float()
|
|
b = b.float()
|
|
a = a * -10
|
|
a = a + 5
|
|
add_res = a + b
|
|
relu_res = torch.relu(add_res)
|
|
add_relu_res = torch._VF._add_relu(a, b)
|
|
|
|
self.assertEqual(add_relu_res, relu_res)
|
|
|
|
def test_add_relu_broadcasting(self):
|
|
a = torch.rand((1, 32))
|
|
b = 1
|
|
b_scalar = torch.ones(1, 32)
|
|
res = torch._VF._add_relu(a, b)
|
|
broadcasted_res = torch._VF._add_relu(a, b_scalar)
|
|
|
|
self.assertEqual(broadcasted_res, res)
|
|
|
|
|
|
def add_test(test, decorator=None):
|
|
def add(test_name, fn):
|
|
if hasattr(TestNN, test_name):
|
|
raise RuntimeError('Found two tests with the same name: ' + test_name)
|
|
if decorator is not None:
|
|
fn = decorator(fn)
|
|
setattr(TestNN, test_name, fn)
|
|
|
|
test_name = test.get_name()
|
|
if not hasattr(test, 'test_cpu') or test.test_cpu:
|
|
add(test_name, lambda self, test=test: test(self))
|
|
cuda_test_name = test_name + '_cuda'
|
|
# With dtype enable, it's good enough to test against three floating types
|
|
kwargs = {}
|
|
if 'extra_args' in get_function_arglist(test.test_cuda):
|
|
kwargs['extra_args'] = test.extra_args
|
|
|
|
if 'dtype' in get_function_arglist(test.test_cuda):
|
|
if tf32_is_not_fp32() and test.with_tf32:
|
|
|
|
def with_tf32_off(self, test=test, kwargs=kwargs):
|
|
with tf32_off():
|
|
test.test_cuda(self, dtype=torch.float, **kwargs)
|
|
|
|
add(cuda_test_name + '_fp32', with_tf32_off)
|
|
|
|
def with_tf32_on(self, test=test, kwargs=kwargs):
|
|
with tf32_on(self, test.tf32_precision):
|
|
test.test_cuda(self, dtype=torch.float, **kwargs)
|
|
|
|
add(cuda_test_name + '_tf32', with_tf32_on)
|
|
else:
|
|
add(cuda_test_name + '_float', lambda self,
|
|
test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.float, **kwargs))
|
|
add(cuda_test_name + '_double', lambda self,
|
|
test=test, kwargs=kwargs: test.test_cuda(self, dtype=torch.double, **kwargs))
|
|
|
|
def test_half(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.half, **kwargs)
|
|
if getattr(test, 'check_half', True):
|
|
add(cuda_test_name + '_half', test_half)
|
|
|
|
def test_bfloat16(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.bfloat16, **kwargs)
|
|
if getattr(test, 'check_bfloat16', True):
|
|
add(cuda_test_name + '_bfloat16', test_bfloat16)
|
|
|
|
def test_cfloat(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.cfloat, **kwargs)
|
|
|
|
def test_cdouble(self, test=test, kwargs=kwargs):
|
|
test.test_cuda(self, dtype=torch.cdouble, **kwargs)
|
|
if getattr(test, 'check_complex', False):
|
|
add(cuda_test_name + '_cfloat', test_cfloat)
|
|
add(cuda_test_name + '_cdouble', test_cdouble)
|
|
|
|
else:
|
|
def with_tf32_off(self, test=test, kwargs=kwargs):
|
|
with tf32_off():
|
|
test.test_cuda(self, **kwargs)
|
|
|
|
if tf32_is_not_fp32() and test.with_tf32:
|
|
add(cuda_test_name + '_fp32', with_tf32_off)
|
|
|
|
def with_tf32_on(self, test=test, kwargs=kwargs):
|
|
with tf32_on(self, test.tf32_precision):
|
|
test.test_cuda(self, **kwargs)
|
|
|
|
add(cuda_test_name + '_tf32', with_tf32_on)
|
|
else:
|
|
add(cuda_test_name, with_tf32_off)
|
|
|
|
for test_params in module_tests + new_module_tests:
|
|
# TODO: CUDA is not implemented yet
|
|
if 'constructor' not in test_params:
|
|
name = test_params.pop('module_name')
|
|
test_params['constructor'] = getattr(nn, name)
|
|
decorator = test_params.pop('decorator', None)
|
|
test = NewModuleTest(**test_params)
|
|
add_test(test, decorator)
|
|
if 'check_eval' in test_params:
|
|
# create a new test that is identical but that sets module.training to False
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'eval' if desc is None else desc + '_eval'
|
|
|
|
def gen_eval_constructor(constructor):
|
|
def eval_constructor(*args, **kwargs):
|
|
cons = constructor(*args, **kwargs)
|
|
cons.training = False
|
|
return cons
|
|
eval_constructor.__name__ = constructor.__name__
|
|
return eval_constructor
|
|
|
|
test_params['constructor'] = gen_eval_constructor(test_params['constructor'])
|
|
test = NewModuleTest(**test_params)
|
|
add_test(test, decorator)
|
|
if 'check_with_long_tensor' in test_params:
|
|
fullname = test_params.get('fullname', None)
|
|
if fullname:
|
|
test_params['fullname'] = fullname + '_with_long_tensor'
|
|
else:
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'with_long_tensor' if desc is None else desc + '_with_long_tensor'
|
|
|
|
def double_equivalent_of_long_tensor(size):
|
|
return torch.randint(-1000, 1000, size=size).double()
|
|
|
|
def apply_to_cons(t):
|
|
if t.is_floating_point():
|
|
if isinstance(t, Parameter):
|
|
return Parameter(double_equivalent_of_long_tensor(t.size()))
|
|
elif isinstance(t, torch.Tensor):
|
|
return double_equivalent_of_long_tensor(t.size())
|
|
else:
|
|
return t
|
|
|
|
def gen_long_tensor_constructor(constructor):
|
|
def long_tensor_constructor(*args, **kwargs):
|
|
cons = constructor(*args, **kwargs)
|
|
cons._apply(apply_to_cons)
|
|
return cons
|
|
long_tensor_constructor.__name__ = constructor.__name__
|
|
return long_tensor_constructor
|
|
|
|
def gen_long_tensor_input(input_size):
|
|
def input_func():
|
|
return double_equivalent_of_long_tensor(input_size)
|
|
return input_func
|
|
|
|
def reference_fn(i, p, m):
|
|
# For bad reasons this would create LongTensors that requires gradients
|
|
# Remove requires_grad to avoid this
|
|
for p in m.parameters():
|
|
p.requires_grad_(False)
|
|
m._apply(lambda t: t.long())
|
|
input = i.long()
|
|
out = m.forward(input)
|
|
return out
|
|
|
|
test_params['constructor'] = gen_long_tensor_constructor(test_params['constructor'])
|
|
test_params['input_fn'] = gen_long_tensor_input(test_params['input_size'])
|
|
test_params['reference_fn'] = reference_fn
|
|
test_params['check_forward_only'] = True
|
|
# Currently we don't support conv2d/conv3d for LongTensor in CUDA
|
|
test_params['test_cuda'] = False
|
|
test = NewModuleTest(**test_params)
|
|
|
|
add_test(test, decorator)
|
|
|
|
for test_params in criterion_tests:
|
|
if 'constructor' not in test_params:
|
|
name = test_params.pop('module_name')
|
|
test_params['constructor'] = getattr(nn, name)
|
|
test = CriterionTest(**test_params)
|
|
decorator = test_params.pop('decorator', None)
|
|
add_test(test, decorator)
|
|
if 'check_sum_reduction' in test_params:
|
|
desc = test_params.get('desc', None)
|
|
test_params['desc'] = 'sum_reduction' if desc is None else desc + '_sum_reduction'
|
|
|
|
def gen_sum_reduction_constructor(constructor):
|
|
def sum_reduction_constructor(*args, **kwargs):
|
|
cons = constructor(*args, reduction='sum', **kwargs)
|
|
return cons
|
|
sum_reduction_constructor.__name__ = constructor.__name__
|
|
return sum_reduction_constructor
|
|
|
|
test_params['constructor'] = gen_sum_reduction_constructor(test_params['constructor'])
|
|
test = CriterionTest(**test_params)
|
|
add_test(test, decorator)
|
|
|
|
|
|
class UnpoolingNet(nn.Module):
|
|
def __init__(self, pool, unpool):
|
|
super().__init__()
|
|
self.pool = pool
|
|
self.unpool = unpool
|
|
|
|
def forward(self, input):
|
|
return self.unpool(*self.pool(input))
|
|
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool1d(2, return_indices=True),
|
|
nn.MaxUnpool1d(2)),
|
|
input_size=(1, 1, 4),
|
|
fullname='MaxUnpool1d_net',
|
|
default_dtype=torch.double,))
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool2d(2, return_indices=True),
|
|
nn.MaxUnpool2d(2)),
|
|
input_size=(1, 1, 2, 4),
|
|
fullname='MaxUnpool2d_net',
|
|
default_dtype=torch.double,))
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool3d(2, return_indices=True),
|
|
nn.MaxUnpool3d(2)),
|
|
input_size=(1, 1, 2, 4, 6),
|
|
fullname='MaxUnpool3d_net',
|
|
check_gradgrad=False,
|
|
default_dtype=torch.double,))
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool1d(2, return_indices=True),
|
|
nn.MaxUnpool1d(2)),
|
|
input_size=(1, 4),
|
|
reference_fn=single_batch_reference_fn,
|
|
fullname='MaxUnpool1d_net_no_batch_dim',
|
|
default_dtype=torch.double,))
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool2d(2, return_indices=True),
|
|
nn.MaxUnpool2d(2)),
|
|
input_size=(1, 2, 4),
|
|
reference_fn=single_batch_reference_fn,
|
|
fullname='MaxUnpool2d_net_no_batch_dim',
|
|
default_dtype=torch.double,))
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: UnpoolingNet(
|
|
nn.MaxPool3d(2, return_indices=True),
|
|
nn.MaxUnpool3d(2)),
|
|
input_size=(1, 2, 4, 6),
|
|
reference_fn=single_batch_reference_fn,
|
|
fullname='MaxUnpool3d_net_no_batch_dim',
|
|
check_gradgrad=False,
|
|
default_dtype=torch.double,))
|
|
|
|
class _AdaptiveLogSoftmaxWithLoss(nn.AdaptiveLogSoftmaxWithLoss):
|
|
def __call__(self, input):
|
|
t = torch.tensor([0, 1, 4, 8]).to(input.device)
|
|
return nn.AdaptiveLogSoftmaxWithLoss.__call__(self, input, t).output
|
|
|
|
add_test(NewModuleTest(
|
|
constructor=lambda: _AdaptiveLogSoftmaxWithLoss(16, 10, [2, 6]),
|
|
input_size=(4, 16),
|
|
fullname='AdaptiveLogSoftmax',
|
|
with_tf32=True,
|
|
tf32_precision=0.005,
|
|
default_dtype=torch.double))
|
|
|
|
|
|
# The following are helpers for TestNN.test_affine_*
|
|
if torch.cuda.is_available():
|
|
def device_():
|
|
return ['cpu', 'cuda']
|
|
else:
|
|
def device_():
|
|
return ['cpu']
|
|
|
|
|
|
def angle_rad_():
|
|
return [r * math.pi * 2 for r in [0.0, 0.5, 0.25, 0.125, random.random()]]
|
|
|
|
|
|
def axis_vector_():
|
|
t = (random.random(), random.random(), random.random())
|
|
l = sum(x ** 2 for x in t) ** 0.5
|
|
|
|
return [(1.0, 0.0, 0.0), (0.0, 1.0, 0.0), (0.0, 0.0, 1.0), tuple(x / l for x in t)]
|
|
|
|
|
|
def input_size2d_():
|
|
return [[1, 1, 3, 5], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 3, 4]]
|
|
|
|
|
|
def output_size2d_():
|
|
return [[1, 1, 5, 3], [1, 1, 3, 5], [1, 1, 4, 3], [1, 1, 5, 5], [1, 1, 6, 6]]
|
|
|
|
|
|
def input_size2dsq_():
|
|
return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 6, 6]]
|
|
|
|
|
|
def output_size2dsq_():
|
|
return [[1, 1, 2, 2], [1, 1, 3, 3], [1, 1, 4, 4], [1, 1, 5, 5], [1, 1, 6, 6]]
|
|
|
|
|
|
def input_size3d_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 2, 3, 4], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 3, 4, 5]]
|
|
|
|
|
|
def input_size3dsq_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def output_size3dsq_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 4, 4, 4], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def output_size3d_():
|
|
return [[1, 1, 2, 2, 2], [1, 1, 3, 3, 3], [1, 1, 3, 4, 5], [1, 1, 4, 3, 2], [1, 1, 5, 5, 5], [1, 1, 6, 6, 6]]
|
|
|
|
|
|
def _buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad):
|
|
input_center = [(x - 1) / 2.0 for x in input_size]
|
|
output_center = [(x - 1) / 2.0 for x in output_size]
|
|
|
|
s = math.sin(angle_rad)
|
|
c = math.cos(angle_rad)
|
|
|
|
intrans_ary = np.array([
|
|
[1, 0, input_center[2]],
|
|
[0, 1, input_center[3]],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
inscale_ary = np.array([
|
|
[input_center[2], 0, 0],
|
|
[0, input_center[3], 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
rotation_ary = np.array([
|
|
[c, -s, 0],
|
|
[s, c, 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outscale_ary = np.array([
|
|
[1.0 / output_center[2], 0, 0],
|
|
[0, 1.0 / output_center[3], 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outtrans_ary = np.array([
|
|
[1, 0, -output_center[2]],
|
|
[0, 1, -output_center[3]],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
reorder_ary = np.array([
|
|
[0, 1, 0],
|
|
[1, 0, 0],
|
|
[0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
transform_ary = np.dot(np.dot(np.dot(np.dot(
|
|
intrans_ary,
|
|
inscale_ary),
|
|
rotation_ary.T),
|
|
outscale_ary),
|
|
outtrans_ary)
|
|
grid_ary = np.dot(np.dot(np.dot(reorder_ary, rotation_ary.T), outscale_ary), outtrans_ary)
|
|
|
|
transform_tensor = torch.from_numpy(rotation_ary).to(device, torch.float32)
|
|
transform_tensor = transform_tensor[:2].unsqueeze(0)
|
|
|
|
return transform_tensor, transform_ary, grid_ary
|
|
|
|
|
|
def _buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector):
|
|
input_center = [(x - 1) / 2.0 for x in input_size]
|
|
output_center = [(x - 1) / 2.0 for x in output_size]
|
|
|
|
s = math.sin(angle_rad)
|
|
c = math.cos(angle_rad)
|
|
c1 = 1 - c
|
|
|
|
intrans_ary = np.array([
|
|
[1, 0, 0, input_center[2]],
|
|
[0, 1, 0, input_center[3]],
|
|
[0, 0, 1, input_center[4]],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
inscale_ary = np.array([
|
|
[input_center[2], 0, 0, 0],
|
|
[0, input_center[3], 0, 0],
|
|
[0, 0, input_center[4], 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
l, m, n = axis_vector
|
|
scipyRotation_ary = np.array([
|
|
[l * l * c1 + c, m * l * c1 - n * s, n * l * c1 + m * s, 0],
|
|
[l * m * c1 + n * s, m * m * c1 + c, n * m * c1 - l * s, 0],
|
|
[l * n * c1 - m * s, m * n * c1 + l * s, n * n * c1 + c, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
z, y, x = axis_vector
|
|
torchRotation_ary = np.array([
|
|
[x * x * c1 + c, y * x * c1 - z * s, z * x * c1 + y * s, 0],
|
|
[x * y * c1 + z * s, y * y * c1 + c, z * y * c1 - x * s, 0],
|
|
[x * z * c1 - y * s, y * z * c1 + x * s, z * z * c1 + c, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outscale_ary = np.array([
|
|
[1.0 / output_center[2], 0, 0, 0],
|
|
[0, 1.0 / output_center[3], 0, 0],
|
|
[0, 0, 1.0 / output_center[4], 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
outtrans_ary = np.array([
|
|
[1, 0, 0, -output_center[2]],
|
|
[0, 1, 0, -output_center[3]],
|
|
[0, 0, 1, -output_center[4]],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
reorder_ary = np.array([
|
|
[0, 0, 1, 0],
|
|
[0, 1, 0, 0],
|
|
[1, 0, 0, 0],
|
|
[0, 0, 0, 1],
|
|
], dtype=np.float64)
|
|
|
|
transform_ary = np.dot(np.dot(np.dot(np.dot(
|
|
intrans_ary,
|
|
inscale_ary),
|
|
np.linalg.inv(scipyRotation_ary)),
|
|
outscale_ary),
|
|
outtrans_ary)
|
|
grid_ary = np.dot(np.dot(np.dot(reorder_ary, np.linalg.inv(scipyRotation_ary)), outscale_ary), outtrans_ary)
|
|
|
|
transform_tensor = torch.from_numpy(torchRotation_ary).to(device, torch.float32)
|
|
transform_tensor = transform_tensor[:3].unsqueeze(0)
|
|
|
|
return transform_tensor, transform_ary, grid_ary
|
|
# end TestNN.test_affine_* helpers
|
|
|
|
|
|
class TestNNDeviceType(NNTestCase):
|
|
def _test_InstanceNorm_general(self, cls, input, device, dtype=torch.float):
|
|
# default case track_running_stats=False
|
|
b, c = input.size(0), input.size(1)
|
|
input_var = input.to(device=device, dtype=dtype).requires_grad_()
|
|
|
|
IN = cls(c, eps=0).to(device, dtype)
|
|
|
|
output = IN(input_var)
|
|
out_reshaped = output.view(b * c, -1)
|
|
|
|
mean = out_reshaped.mean(1)
|
|
var = out_reshaped.var(1, unbiased=False)
|
|
|
|
self.assertEqual(torch.abs(mean.data).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), 1, atol=1e-5, rtol=0)
|
|
|
|
# check that eval mode doesn't change behavior
|
|
grad_out = torch.randn_like(output)
|
|
res1 = output.data.clone()
|
|
output.backward(grad_out)
|
|
grad1 = input_var.grad.data.clone()
|
|
|
|
IN.eval()
|
|
output = IN(input_var)
|
|
input_var.grad = None
|
|
output.backward(grad_out)
|
|
res2 = output.data
|
|
grad2 = input_var.grad.data
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
# If track_running_stats=True and momentum=1, running_mean/var should be
|
|
# equal to mean/var of the input (with unbias correction)
|
|
IN = cls(c, momentum=1, eps=0, track_running_stats=True).to(device, dtype)
|
|
|
|
output = IN(input_var)
|
|
|
|
input_reshaped = input_var.transpose(1, 0).reshape(c, -1)
|
|
mean = input_reshaped.mean(1)
|
|
|
|
input_reshaped = input_var.transpose(1, 0).reshape(c, b, -1)
|
|
var = input_reshaped.var(2, unbiased=True)[:, :]
|
|
|
|
self.assertEqual(torch.abs(mean.data - IN.running_mean).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var.data.mean(1) - IN.running_var).mean(), 0, atol=1e-5, rtol=0)
|
|
|
|
# in eval mode, adding X * std to a channel in input should make the
|
|
# corresponding channel in output have mean X
|
|
IN.eval()
|
|
delta = IN.running_var.sqrt() * torch.arange(c, device=device, dtype=dtype)
|
|
delta = delta.view(-1, *[1 for _ in range(2, input.dim())])
|
|
output = IN(input_var + delta)
|
|
self.assertEqual(output.transpose(0, 1).reshape(c, -1).mean(1), torch.arange(c, dtype=dtype))
|
|
|
|
def _test_InstanceNorm_cuda_half(self, cls, input, device):
|
|
# THNN
|
|
input = input.to(device=device, dtype=torch.half).random_(1, 10).requires_grad_(True)
|
|
m = cls(input.size(1), affine=True, track_running_stats=True).to(device, torch.half)
|
|
thnn_output = m(input)
|
|
thnn_output.sum().backward()
|
|
thnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(thnn_output, input)
|
|
# cuDNN
|
|
if TEST_CUDNN:
|
|
input.grad = None
|
|
m = m.float()
|
|
cudnn_output = m(input)
|
|
cudnn_output.sum().backward()
|
|
cudnn_input_grad = input.grad.data.clone()
|
|
self.assertEqualTypeString(cudnn_output, input)
|
|
self.assertEqual(cudnn_output, thnn_output, atol=1e-4, rtol=0)
|
|
self.assertEqual(cudnn_input_grad, thnn_input_grad, atol=1e-3, rtol=0)
|
|
|
|
def _test_LayerNorm_general(self, device, dtype=torch.float):
|
|
for i in range(2, 6):
|
|
shape = torch.randint(3, 6, (i,), dtype=torch.long).tolist()
|
|
x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
normalized_ndim = random.randint(1, i - 1) # inclusive
|
|
normalized_shape = shape[-normalized_ndim:]
|
|
unnormalized_shape = shape[:-normalized_ndim]
|
|
|
|
# test that LN normalizes to mean 0 and stddev 1
|
|
ln = nn.LayerNorm(normalized_shape, eps=0).to(device, dtype)
|
|
ln.weight.data.fill_(1)
|
|
ln.bias.data.fill_(0)
|
|
output = ln(x)
|
|
out_reshaped = output.view(*(unnormalized_shape + [-1]))
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
|
|
delta = 1e-1 if (dtype == torch.bfloat16 or dtype == torch.half) else 1e-5
|
|
self.assertEqual(torch.abs(mean.data).mean(), 0, atol=delta, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), 1, atol=delta, rtol=0)
|
|
|
|
# test that LN applies weight and bias correctly
|
|
scale, bias = torch.empty(2).uniform_(0.2, 2).tolist()
|
|
ln.weight.data.fill_(scale)
|
|
ln.bias.data.fill_(bias)
|
|
output = ln(x)
|
|
out_reshaped = output.view(*(unnormalized_shape + [-1]))
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
self.assertEqual(torch.abs(mean.data).mean(), bias, atol=delta, rtol=0)
|
|
self.assertEqual(torch.abs(var.data).mean(), scale ** 2, atol=delta, rtol=0)
|
|
|
|
bad_norm_shape_input_shape = {
|
|
(): (),
|
|
(2, 3): (3,),
|
|
(2,): (1, 2, 3),
|
|
(10,): (2, 3),
|
|
10: (2, 3),
|
|
}
|
|
for norm_shape, input_shape in bad_norm_shape_input_shape.items():
|
|
ln = nn.LayerNorm(norm_shape)
|
|
input = torch.empty(input_shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
self.assertRaises(RuntimeError, lambda: ln(input))
|
|
|
|
def _test_LayerNorm_cuda_half(self, device):
|
|
input = torch.empty(2, 3, 3, 2, device=device, dtype=torch.half).random_(1, 10).requires_grad_(True)
|
|
m = nn.LayerNorm([3, 2]).to(device, torch.half)
|
|
output = m(input)
|
|
output.sum().backward()
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
def _test_LayerNorm_cpu_mixed_dtype(self, device, dtype):
|
|
for elementwise_affine in [True, False]:
|
|
# layer norm input shape is normalized to m x n, cpu vectorized on n,
|
|
# so make sure n exceeds vector length
|
|
input = torch.empty(2, 3, 11, 3, device=device, dtype=dtype).random_(1, 10)
|
|
m = nn.LayerNorm([11, 3], elementwise_affine=elementwise_affine).to(device, dtype)
|
|
|
|
# fp32
|
|
m_fp32 = deepcopy(m).to(device, torch.float)
|
|
x_fp32 = input.clone().detach().float().requires_grad_()
|
|
out_fp32 = m_fp32(x_fp32)
|
|
out_fp32.sum().backward()
|
|
|
|
# bf16/half
|
|
m_bf16 = deepcopy(m)
|
|
x_bf16 = input.clone().detach().requires_grad_()
|
|
out_bf16 = m_bf16(x_bf16)
|
|
out_bf16.sum().backward()
|
|
|
|
# bf16/half mixed type
|
|
m_mix = deepcopy(m).to(device, torch.float)
|
|
x_mix = input.clone().detach().requires_grad_()
|
|
out_mix = m_mix(x_mix)
|
|
out_mix.sum().backward()
|
|
self.assertEqual(out_fp32.to(dtype=dtype), out_bf16)
|
|
self.assertEqual(out_fp32.to(dtype=dtype), out_mix)
|
|
self.assertEqual(x_fp32.grad.to(dtype=dtype), x_bf16.grad, atol=1e-1, rtol=1e-1)
|
|
self.assertEqual(x_fp32.grad.to(dtype=dtype), x_mix.grad, atol=1e-1, rtol=1e-1)
|
|
|
|
def _test_GroupNorm_general(self, device, dtype=torch.float):
|
|
good_shape_g = {
|
|
(1, 2, 3, 4): 2,
|
|
(2, 3, 10): 3,
|
|
(3, 1, 1, 1, 2): 1,
|
|
(2, 6, 4, 2, 2): 3,
|
|
(1, 256, 1, 1): 32,
|
|
}
|
|
for shape_g, grad in product(good_shape_g.items(), [True, False]):
|
|
shape, g = shape_g
|
|
x = torch.empty(*shape, device=device, dtype=dtype).uniform_(0, 10)
|
|
x.requires_grad_(grad)
|
|
b = shape[0]
|
|
c = shape[1]
|
|
|
|
# test that GN normalizes to mean 0 and stddev 1
|
|
gn = nn.GroupNorm(g, c, eps=0).to(device, dtype)
|
|
gn.weight.data.fill_(1)
|
|
gn.bias.data.fill_(0)
|
|
output = gn(x)
|
|
out_reshaped = output.view(b, g, -1)
|
|
mean = out_reshaped.mean(-1)
|
|
var = out_reshaped.var(-1, unbiased=False)
|
|
self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var).mean(), 1, atol=1e-5, rtol=0)
|
|
|
|
output.backward(torch.randn_like(output))
|
|
if output.is_cuda:
|
|
torch.cuda.synchronize()
|
|
|
|
# test that GN applies weight and bias correctly
|
|
scale = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2)
|
|
bias = torch.empty(c, device=device, dtype=dtype).uniform_(0.2, 2)
|
|
gn.weight.data.copy_(scale)
|
|
gn.bias.data.copy_(bias)
|
|
output = gn(x)
|
|
out_reshaped = output.view(b, c, -1)
|
|
out_normed = (out_reshaped - bias.view(c, 1)) / scale.view(c, 1)
|
|
out_normed_reshaped = out_normed.view(b, g, -1)
|
|
mean = out_normed_reshaped.mean(-1)
|
|
var = out_normed_reshaped.var(-1, unbiased=False)
|
|
self.assertEqual(torch.abs(mean).mean(), 0, atol=1e-5, rtol=0)
|
|
self.assertEqual(torch.abs(var).mean(), 1, atol=1e-5, rtol=0)
|
|
|
|
bad_shape_g = {
|
|
(1, 2, 3, 4): 3,
|
|
(2, 3, 10): 2,
|
|
(3, 1, 1, 1, 2): 10,
|
|
(2, 6, 4, 2, 2): 4,
|
|
}
|
|
for shape, g in bad_shape_g.items():
|
|
with self.assertRaises(ValueError):
|
|
gn = nn.GroupNorm(g, shape[1])
|
|
|
|
def _test_GroupNorm_cuda_half(self):
|
|
input = torch.zeros(2, 4, 3, 2, requires_grad=True).cuda().half().random_(1, 10)
|
|
m = nn.GroupNorm(2, 4).to("cuda", torch.half)
|
|
output = m(input)
|
|
output.sum().backward()
|
|
self.assertEqualTypeString(output, input)
|
|
|
|
def _test_GroupNorm_cpu_mixed_dtype(self):
|
|
def helper(self, size, groups, memory_format, dtype):
|
|
channels = size[1]
|
|
input = torch.randn(size).cpu().to(dtype=dtype)
|
|
input_bf1 = input.contiguous(memory_format=memory_format).detach().requires_grad_(True)
|
|
input_bf2 = input_bf1.clone().detach().requires_grad_(True)
|
|
input_f = input_bf1.float().detach().requires_grad_(True)
|
|
m_bf = nn.GroupNorm(groups, channels).cpu().to(dtype=dtype)
|
|
m_f = deepcopy(m_bf).float()
|
|
m_f2 = deepcopy(m_f)
|
|
# bfloat16 input and bfloat16 parameters
|
|
out = m_bf(input_bf1)
|
|
# bfloat16 input and float parameters
|
|
out2 = m_f(input_bf2)
|
|
# float input and float parameters
|
|
out3 = m_f2(input_f)
|
|
self.assertEqual(out, out2, atol=5e-3, rtol=5e-3)
|
|
self.assertEqual(out2.float(), out3, atol=5e-3, rtol=5e-3)
|
|
grad_out = torch.randn(out2.shape).cpu().to(dtype=dtype)
|
|
grad_out_bf1 = grad_out.contiguous(memory_format=memory_format).detach().requires_grad_(True)
|
|
grad_out_bf2 = grad_out_bf1.clone().detach().requires_grad_(True)
|
|
grad_out_f = grad_out_bf2.clone().float().detach().requires_grad_(True)
|
|
# bfloat16/half input grad and float parameters
|
|
out2.backward(grad_out_bf2, retain_graph=True)
|
|
# float input grad and float parameters
|
|
out3.backward(grad_out_f, retain_graph=True)
|
|
# bfloat16/half input grad and bfloat16/half parameters
|
|
out.backward(grad_out_bf1, retain_graph=True)
|
|
# Need higher tolerances atol=1e-4 and rtol=1e-4 on macos
|
|
self.assertEqual(m_f.weight.grad, m_f2.weight.grad, atol=1e-4, rtol=1e-4)
|
|
self.assertEqual(m_f.bias.grad, m_f2.bias.grad, atol=1e-5, rtol=1e-5)
|
|
self.assertEqual(input_bf2.grad.float(), input_f.grad, atol=5e-5, rtol=5e-3)
|
|
# Full bf16/half has lower precision compared with mixed bf16/half and fp32.
|
|
# Use Amp to keep module parameters in acc dtype, i.e. float, for better numerical stability
|
|
atol = None
|
|
rtol = None
|
|
if dtype == torch.bfloat16:
|
|
atol = 1e-2
|
|
rtol = 1.2e-1
|
|
else:
|
|
assert dtype == torch.half
|
|
atol = 5e-3
|
|
rtol = 1.5e-2
|
|
self.assertEqual(m_bf.weight.grad, m_f.weight.grad.to(dtype=dtype), atol=atol, rtol=rtol)
|
|
self.assertEqual(m_bf.bias.grad, m_f.bias.grad.to(dtype=dtype), atol=atol, rtol=rtol)
|
|
self.assertEqual(input_bf1.grad, input_bf2.grad, atol=atol, rtol=rtol)
|
|
|
|
cl_formats = {4: torch.channels_last, 5: torch.channels_last_3d}
|
|
for dtype in [torch.bfloat16, torch.half]:
|
|
for shape, g in [((1, 8, 4, 3), 2), ((1, 8, 3, 4), 4),
|
|
((4, 40, 40, 40), 2), ((4, 8, 40, 40), 4),
|
|
((1, 8, 40, 40), 4), ((1, 8, 40, 40), 2),
|
|
((1, 8, 50, 50), 2), ((1, 8, 50, 50), 4),
|
|
((1, 40, 50, 50), 2), ((1, 9, 3, 4, 5), 3),
|
|
((1, 60, 10, 10, 10), 3), ((1, 9, 10, 50, 50), 3),
|
|
((1, 60, 10, 50, 50), 3), ((1, 8, 65, 55), 2),
|
|
((1, 3, 65, 55), 1), ((1, 3, 20, 20), 1)]:
|
|
for is_cl in [False, True]:
|
|
format = cl_formats[len(shape)] if is_cl else torch.contiguous_format
|
|
helper(self, shape, g, format, dtype)
|
|
|
|
def _test_module_empty_inputs(self, module, inputs):
|
|
for _inp in inputs:
|
|
_inp.requires_grad_(True)
|
|
out = module(*inputs)
|
|
gO = torch.rand_like(out)
|
|
out.backward(gO)
|
|
|
|
for p in module.parameters():
|
|
if p.requires_grad:
|
|
self.assertEqual(p.grad, torch.zeros_like(p.grad))
|
|
|
|
for _inp in inputs:
|
|
self.assertEqual(_inp.grad, torch.zeros_like(_inp))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@expectedFailureMPS # Unsupported Border padding mode https://github.com/pytorch/pytorch/issues/125098
|
|
@tf32_on_and_off()
|
|
@bf32_on_and_off()
|
|
def test_affine_2d_rotate0(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
input_size = [1, 1, 3, 3]
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = [1, 1, 5, 5]
|
|
angle_rad = 0.
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary.mean(), gridsample_ary.mean())
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@expectedFailureMPS # Unsupported Border padding mode https://github.com/pytorch/pytorch/issues/125098
|
|
@tf32_on_and_off(0.001)
|
|
@bf32_on_and_off(0.001)
|
|
def test_affine_2d_rotate90(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for input_size2dsq, output_size2dsq in \
|
|
itertools.product(input_size2dsq_(), output_size2dsq_()):
|
|
input_size = input_size2dsq
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = output_size2dsq
|
|
angle_rad = 0.25 * math.pi * 2
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=True))
|
|
|
|
if input_size2dsq == output_size2dsq:
|
|
self.assertEqual(scipy_ary.mean(), input_ary.mean())
|
|
self.assertEqual(scipy_ary[0, 0], input_ary[0, 0, 0, -1])
|
|
self.assertEqual(scipy_ary[0, -1], input_ary[0, 0, -1, -1])
|
|
self.assertEqual(scipy_ary[-1, -1], input_ary[0, 0, -1, 0])
|
|
self.assertEqual(scipy_ary[-1, 0], input_ary[0, 0, 0, 0])
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary.mean(), gridsample_ary.mean())
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@expectedFailureMPS # Unsupported Border padding mode https://github.com/pytorch/pytorch/issues/125098
|
|
@tf32_on_and_off(0.005)
|
|
@bf32_on_and_off(0.005)
|
|
def test_affine_2d_rotate45(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
input_size = [1, 1, 3, 3]
|
|
input_ary = np.array(np.zeros(input_size), dtype=np.float32)
|
|
input_ary[0, 0, 0, :] = 0.5
|
|
input_ary[0, 0, 2, 2] = 1.0
|
|
output_size = [1, 1, 3, 3]
|
|
angle_rad = 0.125 * math.pi * 2
|
|
|
|
transform_tensor, transform_ary, offset = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
offset=offset,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest("60GB", "cpu")
|
|
@largeTensorTest("16GB", "cuda")
|
|
def test_avg_pool_large_tensor(self, device):
|
|
# test for https://github.com/pytorch/pytorch/issues/113833
|
|
a = torch.randn(128, 256, 256, 256, dtype=torch.half, device=device, requires_grad=True)
|
|
a_cpu = a.detach().cpu().float()
|
|
m = torch.nn.AvgPool2d(2)
|
|
o = m(a)
|
|
a_cpu.requires_grad = True
|
|
o.sum().backward()
|
|
o_cpu = m(a_cpu)
|
|
o_cpu.sum().backward()
|
|
# workaround for memory usage overhead of assertEqual
|
|
self.assertTrue(torch.allclose(a.grad.cpu(), a_cpu.grad.half()))
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest("48GB", "cpu")
|
|
@largeTensorTest("48GB", "cuda")
|
|
def test_avg_pool_large_tensor2(self, device):
|
|
# test for https://github.com/pytorch/pytorch/issues/129785
|
|
out_size = [2048, 64, 104, 79]
|
|
size = [2048, 64, 209, 159]
|
|
inp = torch.randn(size, device=device, requires_grad=True, dtype=torch.float)
|
|
inp_cpu = inp.detach().cpu()
|
|
m = torch.nn.AvgPool2d([2, 2], [2, 2], [0, 0], False, True, None)
|
|
o = m(inp)
|
|
inp_cpu.requires_grad = True
|
|
o.sum().backward()
|
|
o_cpu = m(inp_cpu)
|
|
o_cpu.sum().backward()
|
|
self.assertEqual(o.shape, out_size)
|
|
self.assertEqual(o_cpu.shape, out_size)
|
|
# reduce memory usage
|
|
self.assertEqual(inp.grad.sum(), inp_cpu.grad.sum())
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@expectedFailureMPS # Unsupported Border padding mode https://github.com/pytorch/pytorch/issues/125098
|
|
@tf32_on_and_off(0.005)
|
|
@bf32_on_and_off(0.005)
|
|
def test_affine_2d_rotateRandom(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for angle_rad, input_size2d, output_size2d in \
|
|
itertools.product(angle_rad_(), input_size2d_(), output_size2d_()):
|
|
|
|
input_size = input_size2d
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32).round(3)
|
|
output_size = output_size2d
|
|
|
|
input_ary[0, 0, 0, 0] = 2
|
|
input_ary[0, 0, 0, -1] = 4
|
|
input_ary[0, 0, -1, 0] = 6
|
|
input_ary[0, 0, -1, -1] = 8
|
|
|
|
transform_tensor, transform_ary, grid_ary = \
|
|
_buildEquivalentAffineTransforms2d(device, input_size, output_size, angle_rad)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
affine_tensor = affine_tensor.to('cpu')
|
|
|
|
for r in range(affine_tensor.size(1)):
|
|
for c in range(affine_tensor.size(2)):
|
|
grid_out = np.dot(grid_ary, [r, c, 1])
|
|
self.assertEqual(affine_tensor[0, r, c], grid_out[:2], exact_dtype=False)
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
@unittest.skipIf((not TEST_NUMPY) or (not TEST_SCIPY) or (scipy.__version__ < '1.0.0'),
|
|
"Scipy v1.0 and/or numpy not found")
|
|
@expectedFailureMPS # aten::grid_sampler_3d not implemented https://github.com/pytorch/pytorch/issues/77764
|
|
@tf32_on_and_off(0.005)
|
|
@bf32_on_and_off(0.005)
|
|
def test_affine_3d_rotateRandom(self, device):
|
|
# scipy before 1.0.0 do not support homogeneous coordinate
|
|
# scipy.ndimage.affine_transform, so we need to skip.
|
|
for angle_rad, axis_vector, input_size3d, output_size3d in \
|
|
itertools.product(angle_rad_(), axis_vector_(), input_size3d_(), output_size3d_()):
|
|
input_size = input_size3d
|
|
input_ary = np.array(np.random.random(input_size), dtype=np.float32)
|
|
output_size = output_size3d
|
|
|
|
input_ary[0, 0, 0, 0, 0] = 2
|
|
input_ary[0, 0, 0, 0, -1] = 3
|
|
input_ary[0, 0, 0, -1, 0] = 4
|
|
input_ary[0, 0, 0, -1, -1] = 5
|
|
input_ary[0, 0, -1, 0, 0] = 6
|
|
input_ary[0, 0, -1, 0, -1] = 7
|
|
input_ary[0, 0, -1, -1, 0] = 8
|
|
input_ary[0, 0, -1, -1, -1] = 9
|
|
|
|
transform_tensor, transform_ary, grid_ary = \
|
|
_buildEquivalentAffineTransforms3d(device, input_size, output_size, angle_rad, axis_vector)
|
|
|
|
scipy_ary = torch.from_numpy(scipy.ndimage.affine_transform(
|
|
input_ary[0, 0],
|
|
transform_ary,
|
|
output_shape=output_size[2:],
|
|
order=1,
|
|
mode='nearest',
|
|
prefilter=False))
|
|
|
|
affine_tensor = torch.nn.functional.affine_grid(
|
|
transform_tensor,
|
|
torch.Size(output_size),
|
|
align_corners=True
|
|
)
|
|
|
|
gridsample_ary = torch.nn.functional.grid_sample(
|
|
torch.tensor(input_ary, device=device).to(device),
|
|
affine_tensor,
|
|
padding_mode='border',
|
|
align_corners=True
|
|
).to('cpu')
|
|
|
|
affine_tensor = affine_tensor.to('cpu')
|
|
|
|
for i in range(affine_tensor.size(1)):
|
|
for r in range(affine_tensor.size(2)):
|
|
for c in range(affine_tensor.size(3)):
|
|
grid_out = np.dot(grid_ary, [i, r, c, 1])
|
|
self.assertEqual(affine_tensor[0, i, r, c], grid_out[:3], exact_dtype=False)
|
|
|
|
self.assertEqual(scipy_ary, gridsample_ary.reshape_as(scipy_ary))
|
|
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.float, torch.half)
|
|
def test_batchnorm_large_batch(self, device, dtype):
|
|
bn = nn.BatchNorm2d(1).to(device, dtype)
|
|
data = torch.rand(880801, 1, 1, 1, device=device, dtype=dtype)
|
|
out = bn(data).sum().backward()
|
|
|
|
@dtypesIfCUDA(torch.float, torch.double, torch.half, torch.complex128)
|
|
@dtypesIfMPS(torch.float, torch.half, torch.complex64)
|
|
@dtypes(torch.float, torch.double, torch.bfloat16, torch.complex128)
|
|
def test_conv_empty_input(self, device, dtype):
|
|
def help(input, conv, memory_format):
|
|
ref_out = conv(input)
|
|
conv_cl = conv.to(memory_format=memory_format)
|
|
out_cl = conv_cl(input)
|
|
self.assertEqual(ref_out, out_cl)
|
|
input_cl = input.to(memory_format=memory_format)
|
|
out_cl2 = conv(input_cl)
|
|
self.assertEqual(out_cl, out_cl2)
|
|
out_cl3 = conv_cl(input_cl)
|
|
self.assertEqual(out_cl, out_cl3)
|
|
|
|
# channels_last case
|
|
input2d = torch.randn((0, 4, 20, 20)).to(device=device, dtype=dtype)
|
|
conv2d = torch.nn.Conv2d(4, 4, 3, 1).to(device=device, dtype=dtype)
|
|
help(input2d, conv2d, torch.channels_last)
|
|
# channels_last_3d case
|
|
input3d = torch.randn((0, 4, 20, 20, 20)).to(device=device, dtype=dtype)
|
|
conv3d = torch.nn.Conv3d(4, 4, 3, 1).to(device=device, dtype=dtype)
|
|
help(input3d, conv3d, torch.channels_last_3d)
|
|
# non-contiguous case
|
|
weight = torch.rand(4, 8, 3, 3)[:, ::2, :, :].to(device=device, dtype=dtype)
|
|
bias = torch.rand(4).to(device=device, dtype=dtype)
|
|
out = F.conv2d(input2d, weight, bias, (1, 1), 0, (1, 1), 1)
|
|
weight = weight.contiguous()
|
|
out_ref = F.conv2d(input2d, weight, bias, (1, 1), 0, (1, 1), 1)
|
|
self.assertEqual(out_ref, out)
|
|
# sigfpe reported in https://github.com/pytorch/pytorch/issues/94125
|
|
with self.assertRaises(RuntimeError):
|
|
inp = torch.empty([1, 1, 1, 0], dtype=dtype, device=device)
|
|
weight = torch.empty([1, 0, 1], dtype=dtype, device=device)
|
|
torch._C._nn.slow_conv3d(inp, weight, 1)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, re.escape("2D kernel_size expected")):
|
|
torch._C._nn.thnn_conv2d(torch.rand([1, 1, 1, 1]), kernel_size=[], padding=[1, 1], stride=[1, 1],
|
|
weight=torch.rand([1, 1]))
|
|
with self.assertRaisesRegex(RuntimeError, re.escape("2D stride expected")):
|
|
torch._C._nn.thnn_conv2d(torch.rand([1, 1, 1, 1]), kernel_size=[1, 1], padding=[1, 1], stride=[],
|
|
weight=torch.rand([1, 1]))
|
|
with self.assertRaisesRegex(RuntimeError, re.escape("2D padding expected")):
|
|
torch._C._nn.thnn_conv2d(torch.rand([1, 1, 1, 1]), kernel_size=[1, 1], padding=[], stride=[1, 1],
|
|
weight=torch.rand([1, 1]))
|
|
|
|
def test_InstanceNorm1d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
d = random.randint(8, 10)
|
|
|
|
input = torch.rand(b, c, d)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm1d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm1d, input, device)
|
|
|
|
def test_InstanceNorm2d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
w = random.randint(3, 6)
|
|
h = random.randint(6, 8)
|
|
|
|
input = torch.rand(b, c, h, w)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm2d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm2d, input, device)
|
|
|
|
def test_InstanceNorm3d_general(self, device):
|
|
b = random.randint(3, 5)
|
|
c = random.randint(3, 5)
|
|
w = random.randint(2, 5)
|
|
h = random.randint(2, 5)
|
|
d = random.randint(2, 5)
|
|
|
|
input = torch.rand(b, c, h, w, d)
|
|
self._test_InstanceNorm_general(nn.InstanceNorm3d, input, device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_InstanceNorm_cuda_half(nn.InstanceNorm3d, input, device)
|
|
|
|
@parametrize_test("instance_norm_cls", [nn.InstanceNorm1d, nn.InstanceNorm2d, nn.InstanceNorm3d], name_fn=lambda c: c.__name__)
|
|
@parametrize_test("no_batch_dim", [True, False])
|
|
@parametrize_test("affine", [True, False])
|
|
def test_instancenorm_raises_error_if_input_channels_is_not_num_features(self, device, instance_norm_cls, no_batch_dim, affine):
|
|
inst_norm = instance_norm_cls(4, affine=affine)
|
|
size = [2] * inst_norm._get_no_batch_dim()
|
|
if not no_batch_dim:
|
|
size = [3] + size
|
|
t = torch.randn(size)
|
|
if affine:
|
|
with self.assertRaisesRegex(ValueError, "expected input's size at dim="):
|
|
inst_norm(t)
|
|
else:
|
|
with warnings.catch_warnings(record=True) as w:
|
|
inst_norm(t)
|
|
self.assertIn("which is not used because affine=False", str(w[0].message))
|
|
|
|
def test_instancenorm_raises_error_if_less_than_one_value_per_channel(self, device):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.InstanceNorm1d(10)(x).to(device)
|
|
|
|
def test_instancenorm_raises_error_for_single_spatial_element_during_training(self, device):
|
|
BATCH_SIZE = 10
|
|
NUM_CHANNELS = 3
|
|
norms = [torch.nn.InstanceNorm1d, torch.nn.InstanceNorm2d, torch.nn.InstanceNorm3d]
|
|
for i, norm in enumerate(norms):
|
|
m = norm(NUM_CHANNELS, track_running_stats=True)
|
|
m.to(device)
|
|
|
|
# Create an appropriately-sized input with a single spatial element.
|
|
input = torch.randn(BATCH_SIZE, NUM_CHANNELS, *[1 for _ in range(i + 1)],
|
|
device=device)
|
|
with self.assertRaises(ValueError):
|
|
m(input)
|
|
|
|
# Single spatial element should be fine in eval.
|
|
m.eval()
|
|
m(input)
|
|
|
|
def test_LayerNorm_general(self, device):
|
|
self._test_LayerNorm_general(device)
|
|
|
|
if self.device_type == 'cuda' or self.device_type == 'cpu':
|
|
for dtype in [torch.half, torch.bfloat16]:
|
|
self._test_LayerNorm_general(device, dtype=dtype)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_LayerNorm_cuda_half(device)
|
|
|
|
if self.device_type == 'cpu':
|
|
for dtype in [torch.half, torch.bfloat16]:
|
|
self._test_LayerNorm_cpu_mixed_dtype(device, dtype=dtype)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_LayerNorm_numeric(self, device):
|
|
def layer_norm_ref(X, gamma, beta, normalized_shape, eps):
|
|
feature_size = np.prod(normalized_shape)
|
|
X_view = X.view(-1, feature_size)
|
|
mean = X_view.mean(dim=-1, keepdim=True)
|
|
var = X_view.var(dim=-1, unbiased=False, keepdim=True)
|
|
Y = (X_view - mean) / torch.sqrt(var + eps)
|
|
Y = Y * gamma.view(-1) + beta.view(-1)
|
|
return Y.view(*X.size())
|
|
|
|
normalized_shape = [256, 256, 144]
|
|
layer_norm = nn.LayerNorm(normalized_shape).float().to(device)
|
|
X = torch.rand(2, *normalized_shape, dtype=torch.float32,
|
|
device=device)
|
|
|
|
Y = layer_norm(X)
|
|
Y_ref = layer_norm_ref(X, layer_norm.weight.data, layer_norm.bias.data,
|
|
normalized_shape, layer_norm.eps)
|
|
self.assertEqual(Y, Y_ref, rtol=0, atol=1e-5)
|
|
|
|
if self.device_type == 'cuda':
|
|
layer_norm.cpu()
|
|
Y_cpu = layer_norm(X.cpu())
|
|
self.assertEqual(Y_cpu, Y, rtol=0, atol=1e-5)
|
|
|
|
@onlyCPU
|
|
def test_glu_bfloat16(self, device):
|
|
def test_dtype(fn, input, dtype):
|
|
input = input.detach().clone().to(dtype=dtype).requires_grad_(True)
|
|
input2 = input.detach().clone().float().requires_grad_(True)
|
|
out = fn(input)
|
|
out.sum().backward()
|
|
out2 = fn(input2)
|
|
out2.sum().backward()
|
|
self.assertEqual(out.dtype, dtype)
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
self.assertEqual(out, out2, exact_dtype=False)
|
|
self.assertEqual(input.grad, input2.grad, atol=1e-2, rtol=0, exact_dtype=False)
|
|
|
|
def func(device):
|
|
return torch.nn.GLU(dim=-1).to(device)
|
|
|
|
shapes = [[1, 3, 1, 6], [1, 3, 1, 128], [1, 3, 256, 256]]
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device)
|
|
test_dtype(func(device), x, torch.bfloat16)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_GroupNorm_general(self, device):
|
|
self._test_GroupNorm_general(device)
|
|
|
|
if self.device_type == 'cuda':
|
|
self._test_GroupNorm_cuda_half()
|
|
|
|
if self.device_type == 'cpu':
|
|
self._test_GroupNorm_cpu_mixed_dtype()
|
|
|
|
def test_GroupNorm_raises_error_if_one_value_per_group(self, device):
|
|
x = torch.rand(10)[None, :, None]
|
|
with self.assertRaises(ValueError):
|
|
torch.nn.GroupNorm(10, 10)(x).to(device)
|
|
|
|
def test_GroupNorm_empty(self, device):
|
|
mod = torch.nn.GroupNorm(2, 4).to(device)
|
|
inp = torch.randn(0, 4, 2, 2, device=device)
|
|
_test_module_empty_input(self, mod, inp)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
_test_module_empty_input(self, mod, inp)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_GroupNorm_memory_format(self, device):
|
|
# Tests for regression reported in https://github.com/pytorch/pytorch/issues/92166
|
|
|
|
def helper(input_format, grad_format, B=2, C=4, W=4, H=4):
|
|
import copy
|
|
net_orig = torch.nn.GroupNorm(B, C).to(device=device)
|
|
net = copy.deepcopy(net_orig)
|
|
x_orig = torch.rand(B, C, W, H, device=device, requires_grad=True)
|
|
grad_orig = torch.rand(B, C, W, H, device=device)
|
|
x = x_orig.clone().detach().to(memory_format=input_format).requires_grad_(True)
|
|
grad = grad_orig.detach().to(memory_format=grad_format)
|
|
|
|
y = net(x)
|
|
y.backward(grad)
|
|
|
|
y_orig = net_orig(x_orig)
|
|
y_orig.backward(grad_orig)
|
|
|
|
self.assertEqual(y, y_orig)
|
|
self.assertEqual(x.grad, x_orig.grad)
|
|
|
|
for input_format in [torch.contiguous_format, torch.channels_last]:
|
|
for grad_format in [torch.contiguous_format, torch.channels_last]:
|
|
helper(input_format, grad_format)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_GroupNorm_numeric(self, device):
|
|
def group_norm_ref(X, gamma, beta, groups, channels, eps):
|
|
batch_size = X.size()[0]
|
|
X_view = X.view(batch_size, groups, -1)
|
|
mean = X_view.mean(dim=-1, keepdim=True)
|
|
var = X_view.var(dim=-1, unbiased=False, keepdim=True)
|
|
Y = ((X_view - mean) / torch.sqrt(var + eps)).view(
|
|
batch_size, channels, -1)
|
|
Y = Y * gamma.view(channels, 1) + beta.view(channels, 1)
|
|
return Y.view(*X.size())
|
|
|
|
batch_size = 1
|
|
groups = 2
|
|
channels = 8
|
|
group_norm = nn.GroupNorm(groups, channels).float().to(device)
|
|
X = torch.rand(batch_size, channels, 256, 256, 72,
|
|
dtype=torch.float32, device=device)
|
|
|
|
Y = group_norm(X)
|
|
Y_ref = group_norm_ref(
|
|
X, group_norm.weight.data, group_norm.bias.data, groups,
|
|
channels, group_norm.eps)
|
|
self.assertEqual(Y, Y_ref, rtol=0, atol=1e-5)
|
|
|
|
if self.device_type == 'cuda':
|
|
group_norm.cpu()
|
|
Y_cpu = group_norm(X.cpu())
|
|
self.assertEqual(Y_cpu, Y, rtol=0, atol=1e-5)
|
|
|
|
@onlyNativeDeviceTypes
|
|
@dtypes(torch.float64, torch.complex128)
|
|
def test_pad(self, device, dtype):
|
|
# Assert assertion errors are raised for invalid circular padding values
|
|
inputs = torch.randn(1, 1, 4, device=device, dtype=dtype, requires_grad=True)
|
|
# Should raise error when trying to wrap around more than once
|
|
self.assertRaises(RuntimeError, lambda: F.pad(inputs, (5, 4), mode='circular'))
|
|
self.assertRaises(RuntimeError, lambda: F.pad(inputs, (3, 6), mode='circular'))
|
|
# Should raise error when negative padding results in negative output shape
|
|
self.assertRaises(RuntimeError, lambda: F.pad(inputs, (-3, -2), mode='circular'))
|
|
|
|
# assert that relfection padding errors when pad >= input size
|
|
expected_err_msg = r"Padding size should be less than the corresponding input dimension"
|
|
inputs = torch.randn(1, 1, 2, 3, device=device, dtype=dtype)
|
|
self.assertRaisesRegex(RuntimeError, expected_err_msg,
|
|
lambda: F.pad(inputs, (1, 1, 3, 0), mode='reflect'))
|
|
inputs = torch.randn(1, 1, 2, device=device, dtype=dtype)
|
|
self.assertRaisesRegex(RuntimeError, expected_err_msg,
|
|
lambda: F.pad(inputs, (2, 1), mode='reflect'))
|
|
|
|
inputs = torch.rand(1, 3, 4, 4, device=device, dtype=dtype)
|
|
# assert that pad doesn't return a view into the input tensor
|
|
for mode in 'constant', 'reflect', 'replicate', 'circular':
|
|
out = F.pad(inputs, (0, 0, 0, 0), mode=mode)
|
|
out.fill_(4)
|
|
self.assertTrue(torch.all(torch.abs(inputs) < 2))
|
|
|
|
out = F.pad(inputs, (0, 0, -1, -1), mode=mode)
|
|
out.fill_(4)
|
|
self.assertTrue(torch.all(torch.abs(inputs) < 2))
|
|
|
|
@onlyNativeDeviceTypes
|
|
@dtypes(torch.float64, torch.complex128)
|
|
def test_ReplicationPad_empty(self, device, dtype):
|
|
for mod, inp in [
|
|
(torch.nn.ReplicationPad1d(3), torch.randn(0, 3, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReplicationPad2d(3), torch.randn(0, 3, 10, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReplicationPad3d(3), torch.randn(0, 3, 10, 10, 10, device=device, dtype=dtype))]:
|
|
_test_module_empty_input(self, mod, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 2D or 3D'):
|
|
mod = torch.nn.ReplicationPad1d(2)
|
|
inp = torch.randn(3, 0, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'):
|
|
mod = torch.nn.ReplicationPad2d((2, 2, 2, 2))
|
|
inp = torch.randn(43, 0, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 4D or 5D'):
|
|
mod = torch.nn.ReplicationPad3d((2, 2, 2, 2, 2, 2))
|
|
inp = torch.randn(3, 0, 10, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'padding size is expected to be 2'):
|
|
torch._C._nn.replication_pad1d(torch.randn([2]), padding=[])
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'padding size is expected to be 4'):
|
|
torch._C._nn.replication_pad2d(torch.randn([2]), padding=[])
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'padding size is expected to be 6'):
|
|
torch._C._nn.replication_pad3d(torch.randn([2]), padding=[])
|
|
|
|
@expectedFailureMPS # Correctness issue https://github.com/pytorch/pytorch/issues/135447
|
|
def test_ReplicationPad1d_large(self, device):
|
|
shapes = ([2, 65736, 4], [65736, 2, 4])
|
|
pl, pr = 3, 4
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad1d((pl, pr))
|
|
|
|
# forward
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pl : -pr], x)
|
|
|
|
left_padding = out[:, :, : pl]
|
|
self.assertEqual(left_padding, x[:, :, :1].expand_as(left_padding))
|
|
right_padding = out[:, :, -pr :]
|
|
self.assertEqual(right_padding, x[:, :, -1:].expand_as(right_padding))
|
|
|
|
# backward
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1 : -1], g[:, :, pl + 1 : -pr - 1])
|
|
|
|
self.assertEqual(x.grad[:, :, 0], g[:, :, : pl + 1].sum(-1))
|
|
self.assertEqual(x.grad[:, :, -1], g[:, :, -pr - 1:].sum(-1))
|
|
|
|
@expectedFailureMPS # Correctness issue https://github.com/pytorch/pytorch/issues/135447
|
|
def test_ReplicationPad2d_large(self, device):
|
|
shapes = ([2, 65736, 4, 4], [65736, 2, 4, 4])
|
|
pl, pr, pt, pb = 3, 4, 5, 6
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad2d((pl, pr, pt, pb))
|
|
|
|
# forward center, edge
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pt : -pb, pl : -pr], x)
|
|
|
|
left_padding = out[:, :, pt : -pb, : pl]
|
|
self.assertEqual(left_padding, x[:, :, :, :1].expand_as(left_padding))
|
|
right_padding = out[:, :, pt : -pb, -pr :]
|
|
self.assertEqual(right_padding, x[:, :, :, -1:].expand_as(right_padding))
|
|
top_padding = out[:, :, : pt, pl : -pr]
|
|
self.assertEqual(top_padding, x[:, :, :1, :].expand_as(top_padding))
|
|
bottom_padding = out[:, :, -pb : , pl : -pr]
|
|
self.assertEqual(bottom_padding, x[:, :, -1:, :].expand_as(bottom_padding))
|
|
|
|
# forward corner
|
|
tl_padding = out[:, :, : pt + 1, : pl + 1]
|
|
self.assertEqual(tl_padding, x[:, :, :1, :1].expand_as(tl_padding))
|
|
tr_padding = out[:, :, : pt + 1, -pr - 1:]
|
|
self.assertEqual(tr_padding, x[:, :, :1, -1:].expand_as(tr_padding))
|
|
bl_padding = out[:, :, -pb - 1:, : pl + 1]
|
|
self.assertEqual(bl_padding, x[:, :, -1:, :1].expand_as(bl_padding))
|
|
br_padding = out[:, :, -pb - 1:, -pr - 1:]
|
|
self.assertEqual(br_padding, x[:, :, -1:, -1:].expand_as(br_padding))
|
|
|
|
# backward center, edge
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1:-1, 1:-1], g[:, :, pt + 1 : -pb - 1, pl + 1 : -pr - 1])
|
|
|
|
self.assertEqual(x.grad[:, :, 1:-1, 0], g[:, :, pt + 1 : -pb - 1, : pl + 1].sum(-1))
|
|
self.assertEqual(x.grad[:, :, 1:-1, -1], g[:, :, pt + 1 : -pb - 1, -pr - 1 :].sum(-1))
|
|
self.assertEqual(x.grad[:, :, 0, 1:-1], g[:, :, : pt + 1, pl + 1 : -pr - 1].sum(-2))
|
|
self.assertEqual(x.grad[:, :, -1, 1:-1], g[:, :, -pb - 1 :, pl + 1 : -pr - 1].sum(-2))
|
|
|
|
# backward corner
|
|
self.assertEqual(x.grad[:, :, 0, 0], g[:, :, : pt + 1, : pl + 1].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, 0, -1], g[:, :, : pt + 1, -pr - 1 :].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, -1, 0], g[:, :, -pb - 1 :, : pl + 1].sum((-2, -1)))
|
|
self.assertEqual(x.grad[:, :, -1, -1], g[:, :, -pb - 1 :, -pr - 1 :].sum((-2, -1)))
|
|
|
|
@largeTensorTest("6GB")
|
|
def test_ReplicationPad3d_large(self, device):
|
|
shapes = ([1, 65736, 2, 2, 2], [65736, 1, 2, 2, 2])
|
|
pl, pr, pt, pbt, pf, pbk = 3, 4, 5, 6, 7, 8
|
|
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
model = torch.nn.ReplicationPad3d((pl, pr, pt, pbt, pf, pbk))
|
|
|
|
# forward center
|
|
out = model(x)
|
|
self.assertEqual(out[:, :, pf : -pbk, pt : -pbt, pl : -pr], x)
|
|
|
|
# backward center
|
|
g = torch.randn_like(out)
|
|
out.backward(g)
|
|
self.assertEqual(x.grad[:, :, 1:-1, 1:-1, 1:-1], g[:, :, pf + 1 : -pbk - 1, pt + 1 : -pbt - 1, pl + 1 : -pr - 1])
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_Bilinear_empty(self, device):
|
|
mod = torch.nn.Bilinear(20, 30, 40).to(device)
|
|
inp1 = torch.randn(0, 10, 20, requires_grad=True, device=device)
|
|
inp2 = torch.randn(0, 10, 30, requires_grad=True, device=device)
|
|
|
|
output = mod(inp1, inp2)
|
|
output.sum().backward()
|
|
|
|
self.assertEqual(inp1, torch.zeros_like(inp1))
|
|
self.assertEqual(inp2, torch.zeros_like(inp2))
|
|
|
|
self.assertEqual(inp1.grad, torch.zeros_like(inp1))
|
|
self.assertEqual(inp2.grad, torch.zeros_like(inp2))
|
|
|
|
@expectedFailureMeta # RuntimeError: cannot reshape tensor of 0 elements into shape [1, 0, -1]
|
|
@onlyNativeDeviceTypes
|
|
def test_TransformerEncoderLayer_empty(self, device):
|
|
for training in (True, False):
|
|
for batch_first, input_shape in [(True, (0, 10, 512)),
|
|
(False, (10, 0, 512))]:
|
|
input = torch.rand(*input_shape, device=device, dtype=torch.double)
|
|
encoder_layer = nn.TransformerEncoderLayer(
|
|
d_model=512, nhead=8, batch_first=batch_first, dtype=torch.double).to(device)
|
|
if not training:
|
|
encoder_layer = encoder_layer.eval()
|
|
with torch.no_grad():
|
|
_test_module_empty_input(self, encoder_layer, input, check_size=False, inference=True)
|
|
if batch_first and not TEST_WITH_CROSSREF:
|
|
with torch.no_grad():
|
|
# A NestedTensor with no tensors inside it doesn't have dim 3 (or dim
|
|
# 2, for that matter) so it can't hit the fast path, nor can we give a
|
|
# result.
|
|
with self.assertRaisesRegex(
|
|
AssertionError, 'MultiheadAttention does not support NestedTensor outside'):
|
|
nt = torch.nested.nested_tensor([], device=device)
|
|
_test_module_empty_input(self, encoder_layer, nt, check_size=False, inference=True)
|
|
|
|
nt = torch.nested.nested_tensor([torch.rand(0, 512, device=device, dtype=torch.double)], device=device)
|
|
_test_module_empty_input(self, encoder_layer, nt, check_size=False, inference=True)
|
|
else:
|
|
_test_module_empty_input(self, encoder_layer, input, check_size=False)
|
|
|
|
@expectedFailureMeta # RuntimeError: cannot reshape tensor of 0 elements into shape [1, 0, -1]
|
|
@onlyNativeDeviceTypes
|
|
def test_TransformerEncoder_empty(self, device):
|
|
for batch_first, input_shape in [(True, (0, 10, 512)),
|
|
(False, (10, 0, 512))]:
|
|
input = torch.rand(*input_shape, device=device, dtype=torch.double)
|
|
encoder_layer = nn.TransformerEncoderLayer(d_model=512, nhead=8, batch_first=batch_first, dtype=torch.double).to(device)
|
|
transformer_encoder = nn.TransformerEncoder(encoder_layer, num_layers=6).to(device)
|
|
_test_module_empty_input(self, transformer_encoder, input, check_size=False)
|
|
|
|
@expectedFailureMeta # RuntimeError: cannot reshape tensor of 0 elements into shape [1, 0, -1]
|
|
@onlyNativeDeviceTypes
|
|
def test_TransformerDecoderLayer_empty(self, device):
|
|
for batch_first, memory_shape, tgt_shape in [(True, (0, 10, 512), (0, 20, 512)),
|
|
(False, (10, 0, 512), (20, 0, 512))]:
|
|
memory = torch.rand(*memory_shape, device=device, dtype=torch.double)
|
|
tgt = torch.rand(*tgt_shape, requires_grad=True, device=device, dtype=torch.double)
|
|
decoder_layer = nn.TransformerDecoderLayer(d_model=512, nhead=8, batch_first=batch_first, dtype=torch.double).to(device)
|
|
self._test_module_empty_inputs(decoder_layer, [tgt, memory])
|
|
|
|
@expectedFailureMeta # RuntimeError: cannot reshape tensor of 0 elements into shape [1, 0, -1]
|
|
@onlyNativeDeviceTypes
|
|
def test_TransformerDecoder_empty(self, device):
|
|
for batch_first, memory_shape, tgt_shape in [(True, (0, 10, 512), (0, 20, 512)),
|
|
(False, (10, 0, 512), (20, 0, 512))]:
|
|
memory = torch.rand(*memory_shape, device=device, dtype=torch.double)
|
|
tgt = torch.rand(*tgt_shape, requires_grad=True, device=device, dtype=torch.double)
|
|
decoder_layer = nn.TransformerDecoderLayer(d_model=512, nhead=8, batch_first=batch_first, dtype=torch.double).to(device)
|
|
transformer_decoder = nn.TransformerDecoder(decoder_layer, num_layers=6).to(device)
|
|
self._test_module_empty_inputs(transformer_decoder, [tgt, memory])
|
|
|
|
@expectedFailureMeta # RuntimeError: cannot reshape tensor of 0 elements into shape [1, 0, -1]
|
|
@onlyNativeDeviceTypes
|
|
def test_Transformer_empty(self, device):
|
|
for batch_first, src_shape, tgt_shape in [(True, (10, 0, 512), (20, 0, 512))]:
|
|
transformer_model = nn.Transformer(nhead=16, num_encoder_layers=12, dtype=torch.double).to(device)
|
|
src = torch.rand(*src_shape, requires_grad=True, device=device, dtype=torch.double)
|
|
tgt = torch.rand(*tgt_shape, requires_grad=True, device=device, dtype=torch.double)
|
|
self._test_module_empty_inputs(transformer_model, [src, tgt])
|
|
|
|
@onlyNativeDeviceTypes
|
|
@dtypes(torch.float32, torch.complex64)
|
|
def test_ReflectionPad_empty(self, device, dtype):
|
|
for mod, inp in [
|
|
(torch.nn.ReflectionPad1d(2), torch.randn(0, 3, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReflectionPad2d(2), torch.randn(0, 3, 10, 10, device=device, dtype=dtype)),
|
|
(torch.nn.ReflectionPad3d(3), torch.randn(0, 3, 10, 10, 10, device=device, dtype=dtype))]:
|
|
_test_module_empty_input(self, mod, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, '2D or 3D'):
|
|
mod = torch.nn.ReflectionPad1d(2)
|
|
inp = torch.randn(3, 0, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, '3D or 4D'):
|
|
mod = torch.nn.ReflectionPad2d(2)
|
|
inp = torch.randn(3, 0, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, '4D or 5D'):
|
|
mod = torch.nn.ReflectionPad3d(3)
|
|
inp = torch.randn(3, 0, 10, 10, 10, device=device, dtype=dtype)
|
|
mod(inp)
|
|
|
|
@onlyCUDA # Test if CPU and GPU results match
|
|
def test_ReflectionPad2d_large(self, device):
|
|
shapes = ([2, 65736, 6, 6], [65736, 2, 6, 6])
|
|
pad = (1, 2, 3, 4)
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
ref_x = x.detach().cpu().requires_grad_()
|
|
|
|
out = F.pad(x, pad, mode='reflect')
|
|
ref_out = F.pad(ref_x, pad, mode='reflect')
|
|
|
|
self.assertEqual(out, ref_out)
|
|
|
|
g = torch.randn_like(out)
|
|
ref_g = g.cpu()
|
|
|
|
out.backward(g)
|
|
ref_out.backward(ref_g)
|
|
|
|
self.assertEqual(x.grad, ref_x.grad)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_LocalResponseNorm_empty(self, device):
|
|
mod = torch.nn.LocalResponseNorm(2).to(device)
|
|
inp = torch.ones(0, 5, 24, 24, device=device)
|
|
_test_module_empty_input(self, mod, inp, check_size=False)
|
|
|
|
@onlyCUDA # Test if CPU and GPU results match
|
|
def test_ReflectionPad3d_large(self, device):
|
|
shapes = ([2, 1000, 7, 7, 7], [1000, 2, 7, 7, 7])
|
|
pad = (1, 2, 3, 4, 5, 6)
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
ref_x = x.detach().cpu().requires_grad_()
|
|
|
|
out = F.pad(x, pad, mode='reflect')
|
|
ref_out = F.pad(ref_x, pad, mode='reflect')
|
|
|
|
self.assertEqual(out, ref_out)
|
|
|
|
g = torch.randn_like(out)
|
|
ref_g = g.cpu()
|
|
|
|
out.backward(g)
|
|
ref_out.backward(ref_g)
|
|
|
|
self.assertEqual(x.grad, ref_x.grad)
|
|
|
|
@onlyNativeDeviceTypes
|
|
@dtypes(torch.float, torch.double)
|
|
def test_MarginLoss_empty(self, device, dtype):
|
|
for mod, x, y in [
|
|
(torch.nn.MultiMarginLoss().to(device),
|
|
torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype),
|
|
torch.ones(0, device=device).type(torch.long)),
|
|
(torch.nn.MultiLabelMarginLoss().to(device),
|
|
torch.randn(0, 10, requires_grad=True, device=device, dtype=dtype),
|
|
torch.ones(0, 10, device=device).type(torch.long))]:
|
|
|
|
out = mod(x, y)
|
|
out.sum().backward()
|
|
|
|
self.assertEqual(x, torch.zeros_like(x))
|
|
self.assertEqual(x.grad, torch.zeros_like(x))
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected'):
|
|
x = torch.randn(0, requires_grad=True, device=device, dtype=dtype)
|
|
y = torch.ones(10, device=device).type(torch.long)
|
|
mod(x, y)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected'):
|
|
x = torch.randn(10, 0, requires_grad=True, device=device, dtype=dtype)
|
|
y = torch.ones(10, 0, device=device).type(torch.long)
|
|
mod(x, y)
|
|
|
|
@onlyCUDA
|
|
def test_MarginLoss_warnings(self, device):
|
|
model = torch.nn.Linear(128, 22, device=device)
|
|
loss = torch.nn.MultiMarginLoss()
|
|
x = torch.rand((56, 128), device=device)
|
|
targets = torch.randint(22, (56,), device=device)
|
|
f = io.StringIO()
|
|
with contextlib.redirect_stderr(f):
|
|
out = model(x)
|
|
l = loss(out, targets)
|
|
l.backward()
|
|
self.assertTrue(len(f.getvalue()) == 0)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_Unfold_empty(self, device):
|
|
inp = torch.randn(0, 3, 3, 4, device=device)
|
|
unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device)
|
|
_test_module_empty_input(self, unfold, inp, check_size=False)
|
|
|
|
with self.assertRaisesRegex(RuntimeError, 'Expected 3D or 4D'):
|
|
inp = torch.randn(3, 0, 3, 4, device=device)
|
|
unfold = torch.nn.Unfold(kernel_size=(2, 3)).to(device)
|
|
unfold(inp)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.float, torch.double)
|
|
@tf32_on_and_off(0.005)
|
|
def test_rnn_fused(self, device, dtype):
|
|
|
|
def copy_rnn(rnn1, rnn2):
|
|
for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights):
|
|
for x, y in zip(x_layer, y_layer):
|
|
x.data.copy_(y.data)
|
|
|
|
def check_rnn_grads(rnn1, rnn2):
|
|
for x_layer, y_layer in zip(rnn1.all_weights, rnn2.all_weights):
|
|
for x, y in zip(x_layer, y_layer):
|
|
self.assertEqual(x.grad, y.grad, atol=5e-5, rtol=0)
|
|
|
|
input_size = 10
|
|
hidden_size = 6
|
|
num_layers = 2
|
|
seq_length = 7
|
|
batch = 6
|
|
input_val = torch.randn(seq_length, batch, input_size, dtype=dtype)
|
|
grad_output = torch.randn(seq_length, batch, hidden_size, dtype=dtype)
|
|
hx_val = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
grad_hy = torch.randn(num_layers, batch, hidden_size, dtype=dtype)
|
|
with torch.backends.cudnn.flags(enabled=False, allow_tf32=None):
|
|
for module in (nn.GRU, nn.LSTM):
|
|
for bias in (True, False):
|
|
rnn = module(input_size, hidden_size, num_layers, bias=bias).to(dtype)
|
|
rnn_device = module(input_size, hidden_size, num_layers, bias=bias).to(device, dtype)
|
|
copy_rnn(rnn, rnn_device)
|
|
|
|
is_lstm = isinstance(rnn, nn.LSTM)
|
|
if is_lstm:
|
|
hx = (hx_val.clone().requires_grad_(True),
|
|
hx_val.clone().add(1).requires_grad_(True))
|
|
hx_device = (hx_val.clone().to(device).requires_grad_(True),
|
|
hx_val.clone().to(device).add(1).requires_grad_(True))
|
|
else:
|
|
hx = hx_val.clone().requires_grad_(True)
|
|
hx_device = hx_val.clone().to(device).requires_grad_(True)
|
|
|
|
inp = input_val.clone().requires_grad_(True)
|
|
inp_cu = input_val.clone().to(device).requires_grad_(True)
|
|
output1, hy1 = rnn(inp, hx)
|
|
output2, hy2 = rnn_device(inp_cu, hx_device)
|
|
if is_lstm:
|
|
torch.autograd.backward(
|
|
[output1, hy1[0], hy1[1]], [grad_output, grad_hy, grad_hy + 1]
|
|
)
|
|
torch.autograd.backward(
|
|
[output2, hy2[0], hy2[1]],
|
|
[grad_output.to(device), grad_hy.to(device), (grad_hy + 1).to(device)]
|
|
)
|
|
else:
|
|
torch.autograd.backward([output1, hy1], [grad_output, grad_hy])
|
|
torch.autograd.backward([output2, hy2], [grad_output.to(device), grad_hy.to(device)])
|
|
|
|
self.assertEqual(output1, output2)
|
|
self.assertEqual(hy1, hy2)
|
|
|
|
check_rnn_grads(rnn, rnn_device)
|
|
self.assertEqual(inp.grad, inp_cu.grad)
|
|
if is_lstm:
|
|
self.assertEqual(hx[0].grad, hx_device[0].grad)
|
|
self.assertEqual(hx[1].grad, hx_device[1].grad)
|
|
else:
|
|
self.assertEqual(hx.grad, hx_device.grad)
|
|
|
|
@dtypes(torch.double)
|
|
@dtypesIfMPS(torch.float)
|
|
def test_BatchNorm_empty(self, device, dtype):
|
|
mod = torch.nn.BatchNorm2d(3).to(device)
|
|
inp = torch.randn(0, 3, 2, 2, device=device, dtype=dtype)
|
|
_test_module_empty_input(self, mod, inp)
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
_test_module_empty_input(self, mod, inp)
|
|
|
|
self.assertEqual(mod.running_mean, torch.tensor([0., 0, 0], device=device))
|
|
self.assertEqual(mod.running_var, torch.tensor([1., 1, 1], device=device))
|
|
self.assertEqual(mod.weight.grad, torch.tensor([0., 0, 0], device=device))
|
|
self.assertEqual(mod.bias.grad, torch.tensor([0., 0, 0], device=device))
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest('16GB')
|
|
def test_prelu_backward_32bit_indexing(self, device):
|
|
m = torch.nn.PReLU().cuda().half()
|
|
input_ = torch.ones((1024, 1024, 1024, 2), dtype=torch.half, device=device)
|
|
output = m(input_)
|
|
output.backward(input_)
|
|
|
|
def test_linear_empty(self, device):
|
|
mod = torch.nn.Linear(7, 7).to(device)
|
|
inp = torch.randn(0, 7, device=device)
|
|
_test_module_empty_input(self, mod, inp)
|
|
|
|
def test_one_hot(self, device):
|
|
# cuda throws device assert for invalid data
|
|
# xla & mps ignore out of bound indices
|
|
if (
|
|
self.device_type != 'cuda'
|
|
and self.device_type != 'xla'
|
|
and self.device_type != 'mps'
|
|
):
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, -1, 0], device=device), -1)
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 3)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device))
|
|
expected = torch.tensor([[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1],
|
|
[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -1)
|
|
expected = torch.tensor([[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1],
|
|
[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), 6)
|
|
expected = torch.tensor([[0, 0, 0, 1, 0, 0],
|
|
[0, 0, 0, 0, 1, 0],
|
|
[0, 1, 0, 0, 0, 0],
|
|
[1, 0, 0, 0, 0, 0]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor([[3, 4], [1, 0]], device=device))
|
|
expected = torch.tensor([[[0, 0, 0, 1, 0],
|
|
[0, 0, 0, 0, 1]],
|
|
[[0, 1, 0, 0, 0],
|
|
[1, 0, 0, 0, 0]]], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.tensor(4, device=device))
|
|
expected = torch.tensor([0, 0, 0, 0, 1], device=device)
|
|
self.assertEqual(t, expected)
|
|
|
|
t = torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device), 100)
|
|
expected = torch.empty([4, 0, 100], dtype=torch.long)
|
|
self.assertEqual(t, expected)
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.empty([4, 0], dtype=torch.long, device=device))
|
|
|
|
with self.assertRaises(RuntimeError):
|
|
torch.nn.functional.one_hot(torch.tensor([3, 4, 1, 0], device=device), -2)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::rrelu_with_noise https://github.com/pytorch/pytorch/issues/77764
|
|
def test_nn_empty(self, device):
|
|
# One off tests to ensure scalars from nn.yaml are properly applied
|
|
def verify_scalars(input, output):
|
|
self.assertEqual(input.shape, output.shape)
|
|
self.assertEqual(0, output.numel())
|
|
|
|
for input_shape in [(0), (0, 2)]:
|
|
for module in [torch.nn.ELU, torch.nn.Hardtanh, torch.nn.LeakyReLU, torch.nn.LogSigmoid,
|
|
torch.nn.RReLU, torch.nn.Softshrink, torch.nn.Softplus, torch.nn.Sigmoid,
|
|
torch.nn.Tanh]:
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
m = module()
|
|
output = m(input)
|
|
verify_scalars(input, output)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::rrelu_with_noise https://github.com/pytorch/pytorch/issues/77764
|
|
def test_nn_scalars(self, device):
|
|
# One off tests to ensure scalars from nn.yaml are properly applied
|
|
def verify_scalars(input, output):
|
|
if input.dim() == 0:
|
|
self.assertEqual((), output.shape)
|
|
else:
|
|
self.assertNotEqual((), output.shape)
|
|
output.sum().backward()
|
|
self.assertEqual(input.shape, input.grad.shape)
|
|
|
|
for input_shape in [(5, 6), ()]:
|
|
for module in [torch.nn.ELU, torch.nn.Hardtanh, torch.nn.LeakyReLU, torch.nn.LogSigmoid,
|
|
torch.nn.RReLU, torch.nn.Softshrink, torch.nn.Softplus, torch.nn.Sigmoid,
|
|
torch.nn.Tanh]:
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
m = module()
|
|
output = m(input)
|
|
verify_scalars(input, output)
|
|
|
|
def test_nn_scalars_reductions(self, device):
|
|
# One off tests to ensure scalars from nn.yaml are properly applied
|
|
def verify_reduction_scalars(input, reduction, output):
|
|
if reduction != 'none' or input.dim() == 0:
|
|
self.assertEqual((), output.shape)
|
|
else:
|
|
self.assertNotEqual((), output.shape)
|
|
output.sum().backward()
|
|
self.assertEqual(input.shape, input.grad.shape)
|
|
|
|
for input_shape in [(5, 6), ()]:
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
for module in [torch.nn.BCELoss, torch.nn.L1Loss, torch.nn.MSELoss,
|
|
torch.nn.SmoothL1Loss, torch.nn.SoftMarginLoss]:
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
target = torch.empty(input_shape, device=device).random_(2)
|
|
sigmoid = nn.Sigmoid()
|
|
|
|
input = torch.randn(input_shape, device=device, requires_grad=True)
|
|
m = module(reduction=reduction)
|
|
output = m(sigmoid(input), target)
|
|
verify_reduction_scalars(input, reduction, output)
|
|
|
|
# verify that bogus reduction strings are errors
|
|
@onlyNativeDeviceTypes
|
|
def test_invalid_reduction_strings(self, device):
|
|
input = torch.randn(3, 5, requires_grad=True, device=device)
|
|
cinput = torch.randn(3, 5, requires_grad=True, device=device, dtype=torch.cfloat)
|
|
target = torch.tensor([1, 0, 4], device=device)
|
|
var = torch.ones(size=input.size(), requires_grad=True, device=device)
|
|
|
|
for reduction in ['none', 'invalid']:
|
|
def v(fn):
|
|
if reduction == 'invalid':
|
|
self.assertRaises(ValueError, lambda: fn())
|
|
else:
|
|
fn()
|
|
|
|
v(lambda: F.nll_loss(input, target, reduction=reduction))
|
|
v(lambda: F.cross_entropy(input, target, reduction=reduction))
|
|
|
|
v(lambda: F.kl_div(input, input, reduction=reduction))
|
|
v(lambda: F.huber_loss(input, input, reduction=reduction))
|
|
v(lambda: F.smooth_l1_loss(input, input, reduction=reduction))
|
|
v(lambda: F.l1_loss(input, input, reduction=reduction))
|
|
v(lambda: F.l1_loss(cinput, cinput, reduction=reduction))
|
|
v(lambda: F.mse_loss(input, input, reduction=reduction))
|
|
v(lambda: F.hinge_embedding_loss(input, input, reduction=reduction))
|
|
v(lambda: F.poisson_nll_loss(input, input, reduction=reduction))
|
|
v(lambda: F.gaussian_nll_loss(input, input, var, reduction=reduction))
|
|
v(lambda: F.binary_cross_entropy(torch.sigmoid(input), input.gt(0).to(torch.get_default_dtype()), reduction=reduction))
|
|
v(lambda: F.binary_cross_entropy_with_logits(input, input, reduction=reduction))
|
|
|
|
zeros = torch.zeros_like(input).to(torch.int64)
|
|
v(lambda: F.multilabel_soft_margin_loss(input, zeros, reduction=reduction))
|
|
|
|
v(lambda: F.triplet_margin_loss(input, input, input, reduction=reduction))
|
|
v(lambda: F.triplet_margin_with_distance_loss(input, input, input, reduction=reduction))
|
|
v(lambda: F.margin_ranking_loss(input, input, input.sign(), reduction=reduction))
|
|
v(lambda: F.cosine_embedding_loss(input, input, input[:, 0].sign(), reduction=reduction))
|
|
|
|
log_probs = torch.randn(50, 16, 20, requires_grad=True, device=device).log_softmax(2)
|
|
targets = torch.randint(1, 20, (16, 30), dtype=torch.long, device=device)
|
|
input_lengths = torch.full((16,), 50, dtype=torch.long, device=device)
|
|
target_lengths = torch.randint(10, 30, (16,), dtype=torch.long, device=device)
|
|
v(lambda: F.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction=reduction))
|
|
|
|
# FIXME: should we allow derivatives on these?
|
|
v(lambda: F.soft_margin_loss(input, input.sign().detach(), reduction=reduction))
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_smooth_l1_loss_vs_huber_loss(self, device):
|
|
def _make_test_tensor(shape, contiguous=True):
|
|
if contiguous:
|
|
test_tensor = torch.randn(shape, device=device)
|
|
else:
|
|
# Select every other element in the innermost dimension to
|
|
# make it non-contiguous.
|
|
doubled_shape = list(shape)
|
|
doubled_shape[-1] *= 2
|
|
test_tensor = torch.randn(doubled_shape, device=device)
|
|
test_tensor = test_tensor[..., ::2]
|
|
return test_tensor
|
|
|
|
def _test_smooth_l1_loss_vs_huber_loss_helper(input, target, beta, require_equal):
|
|
for reduction in ['mean', 'sum', 'none']:
|
|
smooth_l1 = torch.nn.SmoothL1Loss(beta=beta, reduction=reduction)
|
|
# beta hyper-parameter is called delta for Huber
|
|
huber = torch.nn.HuberLoss(delta=beta, reduction=reduction)
|
|
smooth_l1_loss = smooth_l1(input, target)
|
|
huber_loss = huber(input, target)
|
|
|
|
if require_equal:
|
|
self.assertEqual(smooth_l1_loss, huber_loss)
|
|
else:
|
|
# Huber loss should be larger than smooth L1 loss by a factor of beta.
|
|
self.assertEqual(smooth_l1_loss * beta, huber_loss)
|
|
|
|
def _test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta, require_equal):
|
|
# Test the non-vectorized case.
|
|
shape = (2, 2)
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape),
|
|
target=_make_test_tensor(shape),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
# Test the vectorized case (innermost dim > 32).
|
|
shape = (64, 64)
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape),
|
|
target=_make_test_tensor(shape),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
# Test the non-contiguous case.
|
|
_test_smooth_l1_loss_vs_huber_loss_helper(input=_make_test_tensor(shape, contiguous=False),
|
|
target=_make_test_tensor(shape, contiguous=False),
|
|
beta=beta,
|
|
require_equal=require_equal)
|
|
|
|
def test_equal_when_beta_is_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=1.0, require_equal=True)
|
|
|
|
def test_unequal_when_beta_is_less_than_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=0.5, require_equal=False)
|
|
|
|
def test_unequal_when_beta_is_greater_than_one():
|
|
_test_smooth_l1_loss_vs_huber_loss_multi_input_helper(beta=1.5, require_equal=False)
|
|
|
|
test_equal_when_beta_is_one()
|
|
test_unequal_when_beta_is_less_than_one()
|
|
test_unequal_when_beta_is_greater_than_one()
|
|
|
|
@onlyCPU
|
|
def test_smooth_l1_loss_bfloat16(self, device):
|
|
def test_dtype(fn, input, target, dtype):
|
|
input = input.detach().clone().to(dtype=dtype).requires_grad_(True)
|
|
input2 = input.detach().clone().float().requires_grad_(True)
|
|
target = target.detach().clone().to(dtype=dtype)
|
|
target2 = target.detach().clone().float()
|
|
out = fn(input, target)
|
|
out.sum().backward()
|
|
out2 = fn(input2, target2)
|
|
out2.sum().backward()
|
|
self.assertEqual(out.dtype, dtype)
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
self.assertEqual(out, out2, exact_dtype=False)
|
|
self.assertEqual(input.grad, input2.grad, exact_dtype=False)
|
|
|
|
def func(device):
|
|
return nn.SmoothL1Loss().to(device=device)
|
|
|
|
shapes = [[1, 3, 1, 6], [1, 3, 1, 128], [1, 3, 128, 128]]
|
|
for shape in shapes:
|
|
x = torch.randn(shape, device=device, requires_grad=True)
|
|
t = torch.randn(shape, device=device)
|
|
test_dtype(func(device), x, t, torch.bfloat16)
|
|
|
|
# We don't want to make propagating NaN a hard requirement on ops, but for
|
|
# these easy ones, we should make them do so.
|
|
# MPS: NotImplementedError: aten::rrelu_with_noise_ https://github.com/pytorch/pytorch/issues/77764
|
|
# MPS: NotImplementedError: aten::hardshrink.out https://github.com/pytorch/pytorch/issues/77764
|
|
@expectedFailureMPS
|
|
def test_nonlinearity_propagate_nan(self, device):
|
|
def test(nonlinearity, *args, **kwargs):
|
|
x = torch.tensor([nan], device=device)
|
|
fn = getattr(F, nonlinearity)
|
|
try:
|
|
self.assertTrue(math.isnan(fn(x, *args, **kwargs).item()))
|
|
except Exception as e:
|
|
if 'not implemented' not in str(e):
|
|
raise
|
|
|
|
test('relu')
|
|
test('relu', inplace=True)
|
|
test('relu6')
|
|
test('elu')
|
|
test('selu')
|
|
test('celu')
|
|
test('rrelu')
|
|
test('rrelu', inplace=True)
|
|
test('hardtanh')
|
|
test('tanh')
|
|
test('sigmoid')
|
|
test('logsigmoid')
|
|
test('hardshrink')
|
|
test('tanhshrink')
|
|
test('softsign')
|
|
test('softmin', 0)
|
|
test('softmax', 0)
|
|
test('log_softmax', 0)
|
|
test('leaky_relu', 0.2)
|
|
test('threshold', 3, 2)
|
|
test('threshold', 3, 2, inplace=True)
|
|
|
|
@expectedFailureMPS # TypeError: float64 the MPS framework doesn't support float64
|
|
@parametrize_test("mode", ["nearest-exact", "nearest"])
|
|
def test_upsamplingNearest1d(self, device, mode):
|
|
# Forward AD does not support XLA because XLA tensors don't have storage
|
|
check_forward_ad = torch.device(device).type != 'xla'
|
|
|
|
m = nn.Upsample(size=4, mode=mode)
|
|
in_t = torch.ones(1, 1, 2, device=device, dtype=torch.double)
|
|
in_uint8_t = torch.ones(1, 1, 2, dtype=torch.uint8, device=device)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
out_uint8_t = m(in_uint8_t)
|
|
self.assertEqual(torch.ones(1, 1, 4, device=device, dtype=torch.double), out_t.data)
|
|
self.assertEqual(torch.ones(1, 1, 4, dtype=torch.uint8, device=device), out_uint8_t.data)
|
|
|
|
# Checks upsampling
|
|
input = torch.randn(1, 1, 2, requires_grad=True, device=device, dtype=torch.double)
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_fwd_over_rev=check_forward_ad)
|
|
|
|
# Checks downsampling
|
|
input = torch.randn(1, 1, 20, requires_grad=True, device=device, dtype=torch.double)
|
|
gradcheck(lambda x: F.interpolate(x, 11, mode=mode), [input], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_fwd_over_rev=check_forward_ad)
|
|
|
|
# consistency CUDA/CPU check
|
|
if torch.device(device).type == 'cuda':
|
|
input_cuda = torch.randn(1, 1, 20, device=device, dtype=torch.double)
|
|
input_cpu = input_cuda.cpu()
|
|
output_cuda = F.interpolate(input_cuda, 4, mode=mode)
|
|
output_cpu = F.interpolate(input_cpu, 4, mode=mode)
|
|
self.assertEqual(output_cuda.cpu(), output_cpu)
|
|
|
|
output_cuda = F.interpolate(input_cuda, 24, mode=mode)
|
|
output_cpu = F.interpolate(input_cpu, 24, mode=mode)
|
|
self.assertEqual(output_cuda.cpu(), output_cpu)
|
|
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearest1d_correctness(self, device, isize, osize):
|
|
# Here we check if output matches OpenCV's INTER_NEAREST-like result
|
|
in_t = torch.arange(isize, dtype=torch.float, device=device).unsqueeze(0).unsqueeze(0)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, ), recompute_scale_factor=False, mode="nearest"
|
|
)
|
|
# compute expected output as OpenCV
|
|
expected_out = torch.zeros(osize, dtype=torch.float).unsqueeze(0).unsqueeze(0)
|
|
scale = 1.0 * isize / osize
|
|
for o in range(osize):
|
|
i_f32 = o * scale
|
|
i = int(i_f32)
|
|
expected_out[0, 0, o] = in_t[0, 0, i]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
def test_upsamplingNearestExact1d_rescale(self, device):
|
|
# Checks https://github.com/pytorch/pytorch/issues/62237
|
|
isize = 20
|
|
in_t = torch.arange(isize, dtype=torch.float, device=device).unsqueeze(0).unsqueeze(0)
|
|
# for s in [1.00001, 0.99999]: # 0.9999 case is broken
|
|
# See issue: https://github.com/pytorch/pytorch/issues/62396
|
|
for s in [1.00001, ]:
|
|
out_t = F.interpolate(
|
|
in_t, scale_factor=s, recompute_scale_factor=False, mode="nearest-exact"
|
|
)
|
|
expected_out = in_t
|
|
self.assertEqual(out_t, expected_out, msg=f"scale: {s}")
|
|
|
|
# checks data duplication if output_size == 2 * input_size
|
|
# for s in [2.00001, 1.99999]: # 1.99999 case is broken
|
|
# See issue: https://github.com/pytorch/pytorch/issues/62396
|
|
for s in [2.00001, ]:
|
|
out_t = F.interpolate(
|
|
in_t, scale_factor=s, recompute_scale_factor=False, mode="nearest-exact"
|
|
)
|
|
# input is [[[0, 1, 2, 3, ..., 9]]]
|
|
# expected out is [[[0, 0, 1, 1, 2, 2, ..., 9, 9]]]
|
|
expected_out = in_t.repeat_interleave(2, dim=-1)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@skipIfMps # Partially passes https://github.com/pytorch/pytorch/issues/134430
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearestExact1d_correctness(self, device, isize, osize):
|
|
# Here we check if output matches Scikit-Image/Scipy-like result
|
|
# Checks https://github.com/pytorch/pytorch/issues/34808
|
|
in_t = torch.arange(isize, dtype=torch.float, device=device).unsqueeze(0).unsqueeze(0)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, ), recompute_scale_factor=False, mode="nearest-exact"
|
|
)
|
|
# compute expected output as scikit-image/scipy
|
|
expected_out = torch.zeros(osize, dtype=torch.float).unsqueeze(0).unsqueeze(0)
|
|
scale = 1.0 * isize / osize
|
|
for o in range(osize):
|
|
i_f32 = (o + 0.5) * scale
|
|
i = int(i_f32)
|
|
expected_out[0, 0, o] = in_t[0, 0, i]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@parametrize_test("mode", ["nearest", "nearest-exact"])
|
|
def test_upsamplingNearest2d(self, device, memory_format, mode):
|
|
# Forward AD does not support XLA because XLA tensors don't have storage
|
|
check_forward_ad = torch.device(device).type != 'xla'
|
|
|
|
in_t = torch.ones(1, 2, 2, 2, device=device, dtype=torch.double).contiguous(memory_format=memory_format)
|
|
in_uint8_t = torch.ones(1, 2, 2, 2, dtype=torch.uint8, device=device).contiguous(memory_format=memory_format)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = F.interpolate(in_t, size=4, mode=mode)
|
|
out_uint8_t = F.interpolate(in_uint8_t, size=4, mode=mode)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4, device=device, dtype=torch.double), out_t)
|
|
self.assertEqual(torch.ones(1, 2, 4, 4, dtype=torch.uint8, device=device), out_uint8_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
# test forward when input's height is not same as width
|
|
in_t = torch.ones(1, 2, 2, 1, device=device, dtype=torch.double).contiguous(memory_format=memory_format).requires_grad_()
|
|
out_t = F.interpolate(in_t, size=(4, 2), mode=mode)
|
|
self.assertEqual(torch.ones(1, 2, 4, 2, device=device, dtype=torch.double), out_t)
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
out_t.backward(torch.randn_like(out_t))
|
|
self.assertTrue(in_t.grad.is_contiguous(memory_format=memory_format))
|
|
|
|
# test backward when input's height is not same as width
|
|
input = torch.ones(
|
|
1, 2, 2, 1, requires_grad=True, device=device,
|
|
dtype=torch.double).contiguous(memory_format=memory_format)
|
|
gradcheck(lambda x: F.interpolate(x, size=(4, 2), mode=mode), [input], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, size=(4, 2), mode=mode), [input], check_fwd_over_rev=check_forward_ad)
|
|
|
|
input = torch.randn(
|
|
1, 2, 2, 2, requires_grad=True, device=device,
|
|
dtype=torch.double).contiguous(memory_format=memory_format)
|
|
self.assertEqual(
|
|
F.interpolate(input, 4, mode=mode),
|
|
F.interpolate(input, scale_factor=2, mode=mode))
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_fwd_over_rev=check_forward_ad)
|
|
|
|
# Assert that cpu and cuda handle channels_last memory format in the same way
|
|
# https://github.com/pytorch/pytorch/issues/54590
|
|
if torch.device(device).type == 'cuda':
|
|
for shapes, scale_factor in product([
|
|
(2, 2, 3, 4), (2, 3, 4, 5), (3, 1, 2, 2), (1, 5, 3, 2)
|
|
], [0.5, 1.5, 2]):
|
|
a_cuda = torch.randn(
|
|
*shapes, device=device,
|
|
dtype=torch.double).contiguous(memory_format=memory_format).requires_grad_()
|
|
a_cpu = a_cuda.detach().cpu().requires_grad_()
|
|
|
|
out_cuda = F.interpolate(a_cuda, scale_factor=scale_factor, mode=mode)
|
|
out_cpu = F.interpolate(a_cpu, scale_factor=scale_factor, mode=mode)
|
|
|
|
self.assertEqual(out_cpu.cuda(), out_cuda)
|
|
|
|
g_cuda = torch.randn_like(out_cuda)
|
|
g_cpu = g_cuda.cpu()
|
|
|
|
out_cuda.backward(g_cuda)
|
|
out_cpu.backward(g_cpu)
|
|
|
|
self.assertEqual(a_cuda.grad, a_cpu.grad)
|
|
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearest2d_correctness(self, device, memory_format, isize, osize):
|
|
# Here we check if output matches OpenCV's INTER_NEAREST-like result
|
|
in_t = torch.arange(isize * isize, dtype=torch.float, device=device).reshape(1, 1, isize, isize)
|
|
in_t = in_t.contiguous(memory_format=memory_format)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, osize), recompute_scale_factor=False, mode="nearest"
|
|
)
|
|
# compute expected output as OpenCV
|
|
expected_out = torch.zeros(1, 1, osize, osize, dtype=torch.float)
|
|
scale = 1.0 * isize / osize
|
|
for o1 in range(osize):
|
|
i1_f32 = o1 * scale
|
|
i1 = int(i1_f32)
|
|
for o2 in range(osize):
|
|
i2_f32 = o2 * scale
|
|
i2 = int(i2_f32)
|
|
expected_out[0, 0, o1, o2] = in_t[0, 0, i1, i2]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@skipIfMps # Partially passes https://github.com/pytorch/pytorch/issues/134430
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearestExact2d_correctness(self, device, memory_format, isize, osize):
|
|
# Here we check if output matches Scikit-Image/Scipy-like result
|
|
# Checks https://github.com/pytorch/pytorch/issues/34808
|
|
in_t = torch.arange(isize * isize, dtype=torch.float, device=device).reshape(1, 1, isize, isize)
|
|
in_t = in_t.contiguous(memory_format=memory_format)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, osize), recompute_scale_factor=False, mode="nearest-exact"
|
|
)
|
|
# compute expected output as Scikit-Image/Scipy
|
|
expected_out = torch.zeros(1, 1, osize, osize, dtype=torch.float)
|
|
scale = 1.0 * isize / osize
|
|
for o1 in range(osize):
|
|
i1_f32 = (o1 + 0.5) * scale
|
|
i1 = int(i1_f32)
|
|
for o2 in range(osize):
|
|
i2_f32 = (o2 + 0.5) * scale
|
|
i2 = int(i2_f32)
|
|
expected_out[0, 0, o1, o2] = in_t[0, 0, i1, i2]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last_3d])
|
|
@parametrize_test("mode", ["nearest", "nearest-exact"])
|
|
def test_upsamplingNearest3d(self, device, memory_format, mode):
|
|
# Forward AD does not support XLA because XLA tensors don't have storage
|
|
check_forward_ad = torch.device(device).type != 'xla'
|
|
|
|
m = nn.Upsample(size=4, mode=mode)
|
|
in_t = torch.ones(1, 2, 2, 2, 2, device=device, dtype=torch.double).contiguous(memory_format=memory_format).requires_grad_()
|
|
in_uint8_t = torch.ones(
|
|
1, 2, 2, 2, 2, dtype=torch.uint8, device=device
|
|
).contiguous(memory_format=memory_format)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
out_uint8_t = m(in_uint8_t)
|
|
expected_output = torch.ones(1, 2, 4, 4, 4, device=device, dtype=torch.double)
|
|
self.assertEqual(expected_output, out_t)
|
|
self.assertEqual(expected_output.to(torch.uint8), out_uint8_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
out_t.backward(torch.randn_like(out_t))
|
|
self.assertTrue(in_t.grad.is_contiguous(memory_format=memory_format))
|
|
|
|
input = torch.randn(
|
|
1, 2, 2, 2, 2, requires_grad=True, device=device, dtype=torch.double
|
|
).contiguous(memory_format=memory_format)
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [input], check_fwd_over_rev=check_forward_ad)
|
|
|
|
# Assert that cpu and cuda handle channels_last memory format in the same way
|
|
# https://github.com/pytorch/pytorch/issues/54590
|
|
if torch.device(device).type == 'cuda':
|
|
a = torch.ones(
|
|
2, 2, 2, 3, 4, device=device, requires_grad=True, dtype=torch.double
|
|
).contiguous(memory_format=torch.channels_last_3d)
|
|
# make the data asymmetric; ensure that cuda/cpu handle channels_last appropriately.
|
|
a[1][1][1][2][2] = a[1][1][1][2][3] = 0
|
|
|
|
out_cuda = torch.nn.functional.interpolate(a, scale_factor=2, mode=mode)
|
|
out_cpu = torch.nn.functional.interpolate(a.to('cpu'), scale_factor=2, mode=mode)
|
|
self.assertEqual(out_cpu, out_cuda.to('cpu'))
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode=mode), [a], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [a], check_fwd_over_rev=check_forward_ad)
|
|
|
|
gradcheck(lambda x: F.interpolate(x, 4, mode=mode), [a.to('cuda')], check_forward_ad=check_forward_ad)
|
|
gradgradcheck(lambda x: F.interpolate(x, 4, mode=mode), [a.to('cuda')], check_fwd_over_rev=check_forward_ad)
|
|
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last_3d])
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearest3d_correctness(self, device, memory_format, isize, osize):
|
|
# Here we check if output matches OpenCV's INTER_NEAREST-like result
|
|
in_t = torch.arange(isize * isize * isize, dtype=torch.float, device=device)
|
|
in_t = in_t.reshape(1, 1, isize, isize, isize)
|
|
in_t = in_t.contiguous(memory_format=memory_format)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, osize, osize), recompute_scale_factor=False, mode="nearest"
|
|
)
|
|
# compute expected output as OpenCV
|
|
expected_out = torch.zeros(1, 1, osize, osize, osize, dtype=torch.float)
|
|
scale = 1.0 * isize / osize
|
|
for o1 in range(osize):
|
|
i1_f32 = o1 * scale
|
|
i1 = int(i1_f32)
|
|
for o2 in range(osize):
|
|
i2_f32 = o2 * scale
|
|
i2 = int(i2_f32)
|
|
for o3 in range(osize):
|
|
i3_f32 = o3 * scale
|
|
i3 = int(i3_f32)
|
|
expected_out[0, 0, o1, o2, o3] = in_t[0, 0, i1, i2, i3]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::_upsample_nearest_exact3d.out https://github.com/pytorch/pytorch/issues/77764
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last_3d])
|
|
@parametrize_test("isize, osize", [(20, 11), (10, 15)])
|
|
def test_upsamplingNearestExact3d_correctness(self, device, memory_format, isize, osize):
|
|
# Here we check if output matches Scikit-Image/Scipy-like result
|
|
# Checks https://github.com/pytorch/pytorch/issues/34808
|
|
in_t = torch.arange(isize * isize * isize, dtype=torch.float, device=device)
|
|
in_t = in_t.reshape(1, 1, isize, isize, isize)
|
|
in_t = in_t.contiguous(memory_format=memory_format)
|
|
out_t = F.interpolate(
|
|
in_t, size=(osize, osize, osize), recompute_scale_factor=False, mode="nearest-exact"
|
|
)
|
|
# compute expected output as Scikit-Image/Scipy
|
|
expected_out = torch.zeros(1, 1, osize, osize, osize, dtype=torch.float)
|
|
scale = 1.0 * isize / osize
|
|
for o1 in range(osize):
|
|
i1_f32 = (o1 + 0.5) * scale
|
|
i1 = int(i1_f32)
|
|
for o2 in range(osize):
|
|
i2_f32 = (o2 + 0.5) * scale
|
|
i2 = int(i2_f32)
|
|
for o3 in range(osize):
|
|
i3_f32 = (o3 + 0.5) * scale
|
|
i3 = int(i3_f32)
|
|
expected_out[0, 0, o1, o2, o3] = in_t[0, 0, i1, i2, i3]
|
|
expected_out = expected_out.to(device=device)
|
|
self.assertEqual(out_t, expected_out)
|
|
|
|
@parametrize_test("antialias", [True, False])
|
|
@parametrize_test("align_corners", [True, False])
|
|
@parametrize_test("mode", ["bilinear", "bicubic"])
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@onlyNativeDeviceTypes
|
|
def test_upsamplingBiMode2d(self, device, antialias, align_corners, mode, memory_format):
|
|
# Forward AD does not support XLA because XLA tensors don't have storage
|
|
check_forward_ad = torch.device(device).type != 'xla'
|
|
|
|
kwargs = dict(mode=mode, align_corners=align_corners, antialias=antialias)
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
in_t = torch.ones(
|
|
2, 3, 8, 8, device=device,
|
|
dtype=torch.double).contiguous(memory_format=memory_format).requires_grad_()
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = F.interpolate(in_t, scale_factor=scale_factor, **kwargs)
|
|
expected_out = torch.ones(2, 3, out_size, out_size, device=device, dtype=torch.double)
|
|
self.assertEqual(expected_out, out_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
out_t.backward(torch.randn_like(out_t))
|
|
self.assertTrue(in_t.grad.is_contiguous(memory_format=memory_format))
|
|
|
|
if torch.device(device).type == 'cuda':
|
|
# Bilinear backward is nondeterministic because of atomicAdd usage
|
|
nondet_tol = 1e-5
|
|
else:
|
|
nondet_tol = 0.0
|
|
|
|
input = torch.randn(
|
|
2, 3, 8, 8, device=device,
|
|
dtype=torch.double).contiguous(memory_format=memory_format).requires_grad_()
|
|
gradcheck(
|
|
lambda x: F.interpolate(x, out_size, **kwargs),
|
|
[input],
|
|
check_forward_ad=check_forward_ad, nondet_tol=nondet_tol
|
|
)
|
|
gradgradcheck(
|
|
lambda x: F.interpolate(x, out_size, **kwargs),
|
|
[input],
|
|
check_fwd_over_rev=check_forward_ad, nondet_tol=nondet_tol
|
|
)
|
|
|
|
# Assert that cpu and cuda give same results
|
|
if torch.device(device).type == 'cuda':
|
|
for shapes in [
|
|
(2, 2, 3, 4), (2, 3, 4, 5), (3, 1, 2, 2), (1, 5, 3, 2)
|
|
]:
|
|
a_cuda = torch.randn(
|
|
*shapes, device=device, dtype=torch.double
|
|
).contiguous(memory_format=memory_format).requires_grad_()
|
|
a_cpu = a_cuda.detach().cpu().requires_grad_()
|
|
|
|
with warnings.catch_warnings(record=True):
|
|
out_cuda = F.interpolate(a_cuda, scale_factor=scale_factor, **kwargs)
|
|
out_cpu = F.interpolate(a_cpu, scale_factor=scale_factor, **kwargs)
|
|
|
|
self.assertEqual(out_cpu, out_cuda.cpu())
|
|
|
|
g_cuda = torch.randn_like(out_cuda)
|
|
g_cpu = g_cuda.cpu()
|
|
|
|
out_cuda.backward(g_cuda)
|
|
out_cpu.backward(g_cpu)
|
|
|
|
self.assertEqual(a_cuda.grad, a_cpu.grad)
|
|
|
|
@parametrize_test("antialias", [True, False])
|
|
@parametrize_test("num_channels", [3, 5])
|
|
@parametrize_test("mode", ["nearest", "nearest-exact", "bilinear", "bicubic"])
|
|
@parametrize_test("dtype", integral_types() + floating_types())
|
|
@onlyNativeDeviceTypes
|
|
def test_upsamplingBiMode2d_nonsupported_dtypes(self, device, antialias, num_channels, mode, dtype):
|
|
x = torch.ones(1, num_channels, 32, 32, dtype=dtype, device=device)
|
|
|
|
should_raise_runtime_error = True
|
|
|
|
if "nearest" in mode:
|
|
if antialias:
|
|
raise SkipTest("Nearest mode does not have antialiasing")
|
|
if dtype in (torch.uint8, ) + floating_types():
|
|
should_raise_runtime_error = False
|
|
|
|
elif mode in ("bilinear", "bicubic"):
|
|
if dtype in floating_types() or (device == "cpu" and dtype == torch.uint8):
|
|
should_raise_runtime_error = False
|
|
|
|
if should_raise_runtime_error:
|
|
with self.assertRaisesRegex(RuntimeError, "not implemented for"):
|
|
F.interpolate(x, (12, 12), mode=mode, antialias=antialias)
|
|
else:
|
|
_ = F.interpolate(x, (12, 12), mode=mode, antialias=antialias)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::_upsample_bilinear2d_aa.out https://github.com/pytorch/pytorch/issues/77764
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
def test_upsamplingBilinear2d_aa_correctness(self, device, memory_format):
|
|
# NOTE: We expand the batch dim such that `b*c` is above the maximum
|
|
# size of CUDA grid z-dimension (2**16)
|
|
shape = [23000, 3, 8, 8]
|
|
t_in = torch.arange(3 * 8 * 8, dtype=torch.float, device=device).reshape(1, *shape[1:])
|
|
t_in = t_in.expand(shape)
|
|
t_in = t_in.contiguous(memory_format=memory_format)
|
|
# This expected result is obtain using PIL.Image.resize
|
|
# for c in range(3):
|
|
# a_in = t_in.numpy()[0, c, ...]
|
|
# pil_in = Image.fromarray(a_in)
|
|
# pil_out = pil_in.resize((2, 2), resample=Image.LINEAR)
|
|
expected_out = torch.tensor([
|
|
17.035713, 20.25, 42.75, 45.964287, 81.03572, 84.25,
|
|
106.75, 109.96428, 145.0357, 148.25, 170.75, 173.9643
|
|
], device=device, dtype=t_in.dtype).reshape(1, 3, 2, 2)
|
|
t_out = F.interpolate(t_in, size=(2, 2), mode="bilinear", align_corners=False, antialias=True)
|
|
self.assertEqual(expected_out.expand([*shape[:2], 2, 2]), t_out)
|
|
|
|
# Partially passes. NotImplementedError: aten::upsample_bicubic2d.out https://github.com/pytorch/pytorch/issues/77764
|
|
@skipIfMps
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@parametrize_test("mode", ["bilinear", "bicubic"])
|
|
@parametrize_test("antialias", [True, False])
|
|
@parametrize_test("align_corners", [True, False])
|
|
@parametrize_test("num_channels", [3, 5])
|
|
@parametrize_test("output_size", [32, 600])
|
|
@parametrize_test("check_as_unsqueezed_3d_tensor", [True, False])
|
|
@parametrize_test("non_contig", [False, "sliced", "restrided"])
|
|
@parametrize_test("batch_size", [1, 5])
|
|
def test_upsamplingBiMode2d_consistency(
|
|
self,
|
|
device,
|
|
memory_format,
|
|
mode,
|
|
antialias,
|
|
align_corners,
|
|
num_channels,
|
|
output_size,
|
|
check_as_unsqueezed_3d_tensor,
|
|
non_contig,
|
|
batch_size,
|
|
):
|
|
# Check output value consistency between resized_input_uint8 and resized input_float
|
|
if torch.device(device).type == "cuda":
|
|
raise SkipTest("CUDA implementation is not yet supporting uint8")
|
|
|
|
torch.manual_seed(0)
|
|
|
|
# - input range is set to [30, 220] for bicubic mode, because the bicubic kernel may create
|
|
# [intermediate] values outside of the [0, 255] range, which need
|
|
# to be clipped in uint8 path, but not in float path. This isn't
|
|
# an issue with bilinear kernel.
|
|
input_range = (30, 220) if mode == "bicubic" else (0, 256)
|
|
input_ui8 = torch.randint(*input_range, size=(batch_size, num_channels, 400, 400), dtype=torch.uint8, device=device)
|
|
input_ui8 = input_ui8.contiguous(memory_format=memory_format)
|
|
|
|
if non_contig == "sliced":
|
|
input_ui8 = input_ui8[:, :, 10:-10, 10:-10]
|
|
elif non_contig == "restrided":
|
|
input_ui8 = input_ui8[:, :, ::2, ::2]
|
|
|
|
if batch_size == 1 and check_as_unsqueezed_3d_tensor:
|
|
input_ui8 = input_ui8[0, ...]
|
|
input_ui8 = input_ui8[None, ...]
|
|
|
|
input_f32 = input_ui8.float()
|
|
|
|
output_f32 = F.interpolate(
|
|
input_f32, size=(output_size, output_size), mode=mode, align_corners=align_corners, antialias=antialias
|
|
).round().clip(0, 255)
|
|
output_ui8 = F.interpolate(
|
|
input_ui8, size=(output_size, output_size), mode=mode, align_corners=align_corners, antialias=antialias
|
|
)
|
|
|
|
if non_contig is False:
|
|
self.assertTrue(input_ui8.is_contiguous(memory_format=memory_format))
|
|
|
|
# FIXME if-clause shows the current behaviour which is definitely unexpected.
|
|
# Ideally we want to fix it such that both the ui8 and f32 outputs are also channels_last
|
|
# See for more details: https://github.com/pytorch/pytorch/pull/100373
|
|
if batch_size == 1 and check_as_unsqueezed_3d_tensor and memory_format == torch.channels_last:
|
|
self.assertTrue(output_ui8.is_contiguous())
|
|
self.assertTrue(output_f32.is_contiguous())
|
|
else:
|
|
self.assertTrue(output_ui8.is_contiguous(memory_format=memory_format))
|
|
self.assertTrue(output_f32.is_contiguous(memory_format=memory_format))
|
|
|
|
if mode == "bilinear":
|
|
torch.testing.assert_close(output_f32, output_ui8.float(), rtol=0, atol=1)
|
|
else:
|
|
diff = (output_f32 - output_ui8.float()).abs()
|
|
self.assertLess(diff.max(), 15)
|
|
|
|
threshold = 2
|
|
percent = 3
|
|
self.assertLess((diff > threshold).float().mean(), percent / 100)
|
|
|
|
threshold = 5
|
|
percent = 1
|
|
self.assertLess((diff > threshold).float().mean(), percent / 100)
|
|
|
|
self.assertLess(diff.mean(), 0.4)
|
|
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
@parametrize_test("align_corners", [True, False])
|
|
@parametrize_test("input_size, output_size", [(399, 437), (403, 377)])
|
|
def test_upsamplingBiLinear2d_consistency_interp_size_bug(self, device, memory_format, align_corners, input_size, output_size):
|
|
# Non-regression test for https://github.com/pytorch/pytorch/pull/101403
|
|
|
|
if torch.device(device).type == "cuda":
|
|
raise SkipTest("CUDA implementation is not yet supporting uint8")
|
|
|
|
mode = "bilinear"
|
|
input_ui8 = torch.randint(0, 256, size=(1, 3, input_size, input_size), dtype=torch.uint8, device=device)
|
|
input_ui8 = input_ui8.contiguous(memory_format=memory_format)
|
|
input_f32 = input_ui8.float()
|
|
|
|
output_f32 = F.interpolate(
|
|
input_f32, size=(output_size, output_size), mode=mode, align_corners=align_corners, antialias=False
|
|
).round().to(torch.uint8)
|
|
output_ui8 = F.interpolate(
|
|
input_ui8, size=(output_size, output_size), mode=mode, align_corners=align_corners, antialias=False
|
|
)
|
|
torch.testing.assert_close(output_f32, output_ui8, atol=1, rtol=0)
|
|
|
|
def test_upsamplingBicubic2d_correctness(self, device):
|
|
# test output against known input: align_corners=False result must match opencv
|
|
in_t = torch.arange(8., device=device).view(1, 2, 2, 2)
|
|
expected_out_t = torch.tensor(
|
|
[[[[-0.31641, 0.01562, 0.56250, 0.89453],
|
|
[0.34766, 0.67969, 1.22656, 1.55859],
|
|
[1.44141, 1.77344, 2.32031, 2.65234],
|
|
[2.10547, 2.43750, 2.98438, 3.31641]],
|
|
|
|
[[3.68359, 4.01562, 4.56250, 4.89453],
|
|
[4.34766, 4.67969, 5.22656, 5.55859],
|
|
[5.44141, 5.77344, 6.32031, 6.65234],
|
|
[6.10547, 6.43750, 6.98438, 7.31641]]]], device=device)
|
|
out_t = F.interpolate(in_t, scale_factor=2, mode='bicubic', align_corners=False)
|
|
torch.set_printoptions(precision=5)
|
|
self.assertEqual(out_t, expected_out_t, atol=1e-5, rtol=0)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::_upsample_bicubic2d_aa.out https://github.com/pytorch/pytorch/issues/77764
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last])
|
|
def test_upsamplingBicubic2d_aa_correctness(self, device, memory_format):
|
|
t_in = torch.arange(3 * 8 * 8, dtype=torch.float, device=device).reshape(1, 3, 8, 8)
|
|
t_in = t_in.contiguous(memory_format=memory_format)
|
|
# This expected result is obtain using PIL.Image.resize
|
|
# for c in range(3):
|
|
# a_in = t_in.numpy()[0, c, ...]
|
|
# pil_in = Image.fromarray(a_in)
|
|
# pil_out = pil_in.resize((2, 2), resample=Image.BICUBIC)
|
|
expected_out = torch.tensor([
|
|
15.1205635, 18.760439, 44.23956, 47.879436, 79.12056, 82.76044,
|
|
108.23956, 111.87944, 143.12057, 146.76044, 172.23956, 175.87943
|
|
], device=device, dtype=t_in.dtype).reshape(1, 3, 2, 2)
|
|
t_out = F.interpolate(t_in, size=(2, 2), mode="bicubic", align_corners=False, antialias=True)
|
|
self.assertEqual(expected_out, t_out)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::upsample_trilinear3d.out https://github.com/pytorch/pytorch/issues/77764
|
|
@parametrize_test("align_corners", [True, False])
|
|
@parametrize_test("memory_format", [torch.contiguous_format, torch.channels_last_3d])
|
|
def test_upsamplingTrilinear3d(self, device, align_corners, memory_format):
|
|
kwargs = dict(mode='trilinear', align_corners=align_corners)
|
|
|
|
# test float scale factor up & downsampling
|
|
for scale_factor in [0.5, 1.5, 2]:
|
|
m = nn.Upsample(scale_factor=scale_factor, **kwargs)
|
|
in_t = torch.ones(1, 2, 4, 4, 4, device=device, dtype=torch.double)
|
|
in_t = in_t.contiguous(memory_format=memory_format).requires_grad_()
|
|
out_size = int(math.floor(in_t.shape[-1] * scale_factor))
|
|
with warnings.catch_warnings(record=True) as w:
|
|
out_t = m(in_t)
|
|
expected_out = torch.ones(1, 2, out_size, out_size, out_size, device=device, dtype=torch.double)
|
|
self.assertEqual(expected_out, out_t)
|
|
# Assert that memory format is carried through to the output
|
|
self.assertTrue(out_t.is_contiguous(memory_format=memory_format))
|
|
|
|
grad_out = torch.randn_like(out_t).contiguous(memory_format=memory_format)
|
|
in_t.grad = None
|
|
out_t.backward(grad_out)
|
|
grad_in = in_t.grad
|
|
self.assertTrue(grad_in.is_contiguous(memory_format=memory_format))
|
|
|
|
if memory_format == torch.channels_last_3d:
|
|
# check if grad inputs CF and CL match
|
|
in_t.grad = None
|
|
out_t.backward(grad_out.contiguous())
|
|
self.assertEqual(in_t.grad, grad_in)
|
|
|
|
input = torch.randn(1, 2, 4, 4, 4, requires_grad=True, dtype=torch.double)
|
|
self.assertEqual(
|
|
F.interpolate(input, (out_size, out_size, out_size), **kwargs),
|
|
F.interpolate(input, scale_factor=scale_factor, **kwargs))
|
|
gradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
gradgradcheck(lambda x: F.interpolate(x, out_size, **kwargs), [input])
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half)
|
|
@largeTensorTest('40GB')
|
|
def test_upsampling_64bit_indexing_channels_last(self, device, dtype):
|
|
x = torch.rand((32, 64, 512, 512), dtype=dtype, device=device)
|
|
out = torch.nn.functional.interpolate(x.to(memory_format=torch.channels_last), scale_factor=2, mode='nearest')
|
|
out_ref = torch.nn.functional.interpolate(x, scale_factor=2, mode='nearest')
|
|
del x
|
|
self.assertTrue(torch.allclose(out, out_ref))
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half)
|
|
@largeTensorTest('40GB')
|
|
def test_replicatepad_64bit_indexing(self, device, dtype):
|
|
conv = torch.nn.Conv1d(128, 128, 3, 1, 1, padding_mode="replicate", device=device, dtype=dtype)
|
|
x = torch.randn(size=(256 * 448 * 2, 128, 96), dtype=dtype, device=device)
|
|
y = conv(x)
|
|
torch.mean(y).backward()
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half)
|
|
@largeTensorTest('40GB')
|
|
def test_upsamplingnearest2d_backward_64bit_indexing(self, device, dtype):
|
|
x = torch.randn(size=(36, 128, 512, 512), device=device, dtype=dtype).requires_grad_()
|
|
y = F.interpolate(x, scale_factor=2, mode="nearest")
|
|
y.backward(torch.randn_like(y))
|
|
|
|
def _slow_masked_softmax(self, input, mask):
|
|
exp = torch.exp(input)
|
|
exp = exp * mask
|
|
s = exp.sum(dim=3, keepdim=True).expand(exp.size())
|
|
return exp / s
|
|
|
|
def test_masked_softmax_mask_types(self, device):
|
|
# Test that mask type 0 (LxL attention mask), mask type 1 (BxL padding mask),
|
|
# and mask type 2 (generic BxHxLxL mask) are processed correctly on the
|
|
# fast path and the results match explicit slow calculation.
|
|
sizes = [(1, 1, 32), (3, 16, 310), (12, 4, 1024), (4, 2, 1200)]
|
|
|
|
for (B, num_heads, L) in sizes:
|
|
|
|
# mask_type == 0 => attention mask of shape LxL
|
|
src_mask_orig = torch.randint(0, 2, (L, L)).bool()
|
|
src_mask = src_mask_orig.reshape(1, 1, L, L).expand(B, num_heads, L, L).bool()
|
|
|
|
# mask_type == 1 => padding mask of shape BxL
|
|
src_key_padding_mask_orig = torch.randint(0, 2, (B, L)).bool()
|
|
src_key_padding_mask = src_key_padding_mask_orig.reshape(B, 1, 1, L).expand(B, num_heads, L, L).bool()
|
|
|
|
# mask_type == 2 => shape BxHxLxL
|
|
generic_mask = torch.randint(0, 2, (B, num_heads, L, L)).bool()
|
|
masks = [(src_mask_orig, src_mask, 0),
|
|
(src_key_padding_mask_orig, src_key_padding_mask, 1),
|
|
(generic_mask, generic_mask, 2)
|
|
]
|
|
for dim in [0, 3]:
|
|
for mask_orig, mask, mask_type in masks:
|
|
if (self.device_type == "cuda") and (num_heads % 2) and (mask_type == 1):
|
|
# CUDA path doesn't support padding mask when the number of heads is odd
|
|
continue
|
|
input = torch.randn((B, num_heads, L, L))
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda()
|
|
mask = mask.cuda()
|
|
mask_orig = mask_orig.cuda()
|
|
native_res = torch._masked_softmax(input, mask_orig, dim, mask_type)
|
|
mask = ~mask
|
|
|
|
def slow_masked_softmax(input, mask):
|
|
exp = torch.exp(input)
|
|
exp = exp * mask
|
|
s = exp.sum(dim=dim, keepdim=True).expand(exp.size())
|
|
return exp / s
|
|
|
|
pt_res = slow_masked_softmax(input, mask)
|
|
pt_res = torch.nan_to_num(pt_res)
|
|
|
|
mask_not = mask.logical_not()
|
|
# In result, should only fill the entirely masked out rows since those are non-deterministic (*may* be 0)
|
|
# Converts rows with all True's to False
|
|
mask_out = mask_not.all(dim, keepdim=True).expand(mask_not.shape)
|
|
self.assertEqual(
|
|
pt_res.masked_fill(mask_out, 0),
|
|
native_res.masked_fill(mask_out, 0),
|
|
exact_dtype=True
|
|
)
|
|
|
|
@onlyCUDA
|
|
@gcIfJetson
|
|
def test_masked_softmax_devices_parity(self):
|
|
# Test that softmax with mask type 0 (LxL attention mask), mask type 1 (BxL padding mask),
|
|
# and mask type 2 (BxHxLxL generic mask) gives the same result on CPU and on CUDA.
|
|
|
|
sizes = [(1, 1, 32), (3, 16, 310), (12, 4, 1024), (4, 2, 1200)]
|
|
for (B, num_heads, L) in sizes:
|
|
# mask_type == 0 => attention mask of shape LxL
|
|
src_mask = torch.randint(0, 2, (L, L)).bool()
|
|
# mask_type == 1 => padding mask of shape BxL
|
|
src_key_padding_mask = torch.randint(0, 2, (B, L)).bool()
|
|
# mask_type == 2 => generic mask of shape BxHxLxL
|
|
generic_mask = torch.randint(0, 2, (B, num_heads, L, L)).bool()
|
|
masks = [(src_mask, 0), (src_key_padding_mask, 1), (generic_mask, 2)]
|
|
input = torch.randn((B, num_heads, L, L))
|
|
for dim in [0, 3]:
|
|
for mask, mask_type in masks:
|
|
if (num_heads % 2) and (mask_type == 1):
|
|
# CUDA path doesn't support padding mask when the number of heads is odd
|
|
continue
|
|
|
|
def softmax_on_device(mask, input, device):
|
|
# Compute softmax on a given device
|
|
input_device = input.to(device)
|
|
mask_device = mask.to(device)
|
|
softmax_res = torch._masked_softmax(input_device, mask_device, dim, mask_type)
|
|
if mask_type == 0:
|
|
mask_expanded = mask_device.reshape(1, 1, L, L).expand(B, num_heads, L, L).bool()
|
|
elif mask_type == 1:
|
|
mask_expanded = mask_device.reshape(B, 1, 1, L).expand(B, num_heads, L, L).bool()
|
|
else:
|
|
mask_expanded = mask_device
|
|
# In result, should only fill the entirely masked out rows since those are non-deterministic (*may* be 0)
|
|
# Fill rows with all True's with 0
|
|
mask_out = mask_expanded.all(dim, keepdim=True).expand(mask_expanded.shape)
|
|
softmax_res = softmax_res.masked_fill(mask_out, 0)
|
|
return softmax_res
|
|
|
|
cpu_res = softmax_on_device(mask, input, "cpu")
|
|
cuda_res = softmax_on_device(mask, input, "cuda")
|
|
self.assertEqual(cpu_res, cuda_res, exact_dtype=True)
|
|
|
|
def test_masked_softmax(self, device):
|
|
sizes = [(1, 1, 32), (3, 16, 310), (12, 4, 1024), (4, 2, 1200)]
|
|
for (B, num_heads, L) in sizes:
|
|
for dim in [0, 3]:
|
|
input = torch.randn((B, num_heads, L, L))
|
|
mask = torch.randint(0, 2, (B, L))
|
|
mask = mask.reshape(B, 1, 1, L).expand(B, num_heads, L, L).bool()
|
|
mask_type = 1 # BxL => src_key_padding_mask
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda()
|
|
mask = mask.cuda()
|
|
native_res = torch._masked_softmax(input, mask, dim, mask_type)
|
|
mask = ~mask
|
|
|
|
def slow_masked_softmax(input, mask):
|
|
exp = torch.exp(input)
|
|
exp = exp * mask
|
|
s = exp.sum(dim=dim, keepdim=True).expand(exp.size())
|
|
return exp / s
|
|
|
|
pt_res = slow_masked_softmax(input, mask)
|
|
pt_res = torch.nan_to_num(pt_res)
|
|
|
|
mask_not = mask.logical_not()
|
|
# In result, should only fill the entirely masked out rows since those are non-deterministic (*may* be 0)
|
|
# Converts rows with all True's to False
|
|
mask_out = mask_not.all(dim, keepdim=True).expand(mask_not.shape)
|
|
self.assertEqual(
|
|
pt_res.masked_fill(mask_out, 0),
|
|
native_res.masked_fill(mask_out, 0),
|
|
exact_dtype=True
|
|
)
|
|
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
@precisionOverride({torch.bfloat16: 2e-2, torch.half: 3e-3})
|
|
def test_masked_softmax_lowp(self, dtype):
|
|
sizes = [(1, 1, 32), (3, 16, 310), (12, 4, 1024), (4, 2, 1200)]
|
|
for (B, num_heads, L) in sizes:
|
|
for dim in [0, 3]:
|
|
input_lowp = torch.randn((B, num_heads, L, L), dtype=dtype).requires_grad_()
|
|
input_ref = input_lowp.float().detach().requires_grad_()
|
|
mask = torch.randint(0, 2, (B, L))
|
|
mask = mask.reshape(B, 1, 1, L).expand(B, num_heads, L, L).bool()
|
|
|
|
for mask_type in [1, 2]:
|
|
res_ref = torch._masked_softmax(input_ref, mask, dim, mask_type)
|
|
res = torch._masked_softmax(input_lowp, mask, dim, mask_type)
|
|
self.assertEqual(res_ref.to(dtype), res)
|
|
|
|
grad_lowp = torch.randn_like(res_ref).to(dtype=dtype)
|
|
grad_ref = grad_lowp.float()
|
|
|
|
res_ref.backward(grad_ref)
|
|
res.backward(grad_lowp)
|
|
self.assertEqual(input_ref.grad.to(dtype), input_lowp.grad)
|
|
|
|
def _test_masked_softmax_helper(self, input, dim, mask, mask_type):
|
|
input_ref = input.detach().clone().requires_grad_()
|
|
result = torch._masked_softmax(input, mask, dim, mask_type)
|
|
|
|
expected = torch._softmax(input_ref.masked_fill(mask, float('-inf')), dim, False)
|
|
grad = torch.randn_like(expected).to(dtype=expected.dtype)
|
|
|
|
result.backward(grad)
|
|
expected.backward(grad)
|
|
|
|
# Make sure the optional argument works as well
|
|
if dim == input.dim() - 1:
|
|
input_ref_default = input.detach().clone().requires_grad_()
|
|
result_default = torch._masked_softmax(input_ref_default, mask, None, mask_type)
|
|
result_default.backward(grad)
|
|
self.assertEqual(result, result_default)
|
|
self.assertEqual(input.grad, input_ref_default.grad)
|
|
|
|
# In result, should only fill the entirely masked out rows since those are non-deterministic (*may* be 0)
|
|
# Converts rows with all True's to False
|
|
mask_out = mask.all(dim, keepdim=True).expand(mask.shape)
|
|
self.assertEqual(result.masked_fill(mask_out, 0), expected.masked_fill(mask_out, 0))
|
|
|
|
self.assertEqual(input.grad, torch.nan_to_num(input_ref.grad))
|
|
self.assertEqual(input.grad, input.grad.masked_fill(mask, 0.0))
|
|
|
|
def test_masked_softmax_grad(self, device):
|
|
shapes = [(1, 1, 32), (3, 16, 310), (12, 4, 1024), (4, 2, 1200)]
|
|
for shape in shapes:
|
|
dims = [0, len(shape) - 1] if len(shape) > 0 else [0]
|
|
for dim in dims:
|
|
for mask_type in [1, 2]: # 1 = BxL => src_key_padding_mask
|
|
input = torch.randn(shape, requires_grad=True)
|
|
mask = torch.randint(0, 2, shape).bool()
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda().detach().requires_grad_()
|
|
mask = mask.cuda()
|
|
self._test_masked_softmax_helper(input, dim, mask, mask_type)
|
|
|
|
# In this test, the forward pass is expected to produce nan's because when dim=0, we only have unspecified values
|
|
def test_masked_softmax_forward_with_nans(self, device):
|
|
dim = 0
|
|
shapes = [(4, 5), (50, 100), (1500, 1200)]
|
|
for (x, y) in shapes:
|
|
for mask_type in [1, 2]: # 1 = BxL => src_key_padding_mask
|
|
input = torch.randn((x, y), requires_grad=True)
|
|
mask = torch.tensor([i % 2 for i in range(y)]).expand((x, y)).bool()
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda().detach().requires_grad_()
|
|
mask = mask.cuda()
|
|
self._test_masked_softmax_helper(input, dim, mask, mask_type)
|
|
|
|
@onlyCUDA
|
|
def test_masked_softmax_transformer_layout(self, device):
|
|
B = 211
|
|
num_heads = 16
|
|
L = 42
|
|
input = torch.randn((B, num_heads, L, L))
|
|
dim = input.dim() - 1
|
|
mask = torch.randint(0, 2, (B, L))
|
|
mask_type = 1 # BxL => src_key_padding_mask
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda()
|
|
mask = mask.cuda()
|
|
mask = mask.bool()
|
|
native_res = torch._masked_softmax(input, mask, dim, mask_type)
|
|
mask = mask.reshape(B, 1, 1, L).expand(B, num_heads, L, L)
|
|
mask = ~mask
|
|
mask = mask.float()
|
|
|
|
pt_res = self._slow_masked_softmax(input, mask)
|
|
self.assertEqual(pt_res, native_res, exact_dtype=True)
|
|
|
|
@onlyCUDA
|
|
def test_masked_softmax_TxT_layout(self, device):
|
|
B = 211
|
|
num_heads = 16
|
|
L = 42
|
|
input = torch.randn((B, num_heads, L, L))
|
|
dim = input.dim() - 1
|
|
mask = torch.randint(0, 2, (L, L))
|
|
mask_type = 0 # LxL => src_mask
|
|
if (self.device_type == "cuda"):
|
|
input = input.cuda()
|
|
mask = mask.cuda()
|
|
mask = mask.bool()
|
|
native_res = torch._masked_softmax(input, mask, dim, mask_type)
|
|
mask = mask.expand(B, num_heads, L, L)
|
|
mask = ~mask
|
|
mask = mask.float()
|
|
|
|
pt_res = self._slow_masked_softmax(input, mask)
|
|
self.assertEqual(pt_res, native_res, exact_dtype=True)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_log_softmax_cpu(self, device, dtype):
|
|
for dim in [0, 1]:
|
|
inputf = torch.rand(200, 200, device=device, dtype=torch.float, requires_grad=True)
|
|
input = inputf.to(dtype).detach().requires_grad_(True)
|
|
outf = F.log_softmax(inputf, dim=dim)
|
|
out = F.log_softmax(input, dim=dim)
|
|
self.assertEqual(out, outf.to(dtype=dtype), atol=0.1, rtol=0)
|
|
|
|
out.sum().backward()
|
|
outf.sum().backward()
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0.1, rtol=0)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_softmax_cpu(self, device, dtype):
|
|
for dim in [0, 1]:
|
|
inputf = torch.rand(200, 200, device=device, dtype=torch.float, requires_grad=True)
|
|
input = inputf.to(dtype).detach().requires_grad_(True)
|
|
outf = F.softmax(inputf, dim=dim)
|
|
out = F.softmax(input, dim=dim)
|
|
self.assertEqual(out, outf.to(dtype), atol=1e-3, rtol=0)
|
|
|
|
out.sum().backward()
|
|
outf.sum().backward()
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype), atol=1e-3, rtol=0)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float)
|
|
@dtypes(torch.float)
|
|
def test_softmax_results(self, device, dtype):
|
|
# Non-even sizes and non-zero shifts test fallback paths in vectorized kernel
|
|
# Note: dim1 > 1024 is needed to exercise the vectorized (non-persistent) path, (16, 30576) is BERT-esque
|
|
sizes = [(0, 10), (32, 20), (10, 0), (31, 20), (32, 21), (31, 23), (32, 1536), (31, 2048), (33, 2049), (16, 30576)]
|
|
shifts = [(0, 0), (1, 0), (0, 1), (1, 1)]
|
|
for fn in [F.softmax, F.log_softmax]:
|
|
for size in sizes:
|
|
for shift in shifts:
|
|
input = torch.rand(size, device=device, dtype=dtype)
|
|
# Note: With the largest tests we can hit upper limit of fp16 when we
|
|
# sum, so scale the input down to stay in a nicer range.
|
|
if dtype == torch.float16:
|
|
input = input / 100.
|
|
input = input[shift[0]:, shift[1]:]
|
|
# Note; Don't want to bprop back through slice op
|
|
input = input.detach().requires_grad_(True)
|
|
ref_input = input.clone().cpu().detach().requires_grad_(True)
|
|
for dim in [0, 1]:
|
|
ref_output = fn(ref_input, dtype=torch.float, dim=dim)
|
|
output = fn(input, dtype=torch.float, dim=dim)
|
|
grad_output = torch.rand(size, device=device, dtype=dtype)
|
|
grad_output = grad_output[shift[0]:, shift[1]:]
|
|
ref_grad_output = grad_output.clone().cpu().detach()
|
|
grad_input, = torch.autograd.grad(output, input, grad_outputs=(grad_output), create_graph=True)
|
|
ref_grad_input, = torch.autograd.grad(ref_output, ref_input,
|
|
grad_outputs=(ref_grad_output), create_graph=True)
|
|
grad_input.sum().backward()
|
|
ref_grad_input.sum().backward()
|
|
|
|
self.assertEqual(output, ref_output)
|
|
self.assertEqual(grad_input, ref_grad_input)
|
|
self.assertEqual(input.grad, ref_input.grad)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.float, torch.half)
|
|
@largeTensorTest("20GB")
|
|
@largeTensorTest("64GB", "cpu")
|
|
def test_warp_softmax_64bit_indexing(self, device, dtype):
|
|
def run_test(*shape):
|
|
x = torch.randn(shape, device="cuda", dtype=torch.float16, requires_grad=True)
|
|
y = F.log_softmax(x, dim=-1, dtype=dtype)
|
|
y.backward(y)
|
|
with torch.no_grad():
|
|
xx = x.cpu().requires_grad_()
|
|
yy = F.log_softmax(xx.float(), dim=-1).to(dtype)
|
|
yy.backward(yy)
|
|
# workaround to reduce memory usage vs. self.assertEqual, see #84944
|
|
rtol, atol = torch.testing._comparison.get_tolerances(dtype, rtol=None, atol=None)
|
|
self.assertTrue(torch.allclose(y.cpu(), yy, rtol=rtol, atol=atol))
|
|
# x is half
|
|
rtol, _ = torch.testing._comparison.get_tolerances(torch.half, rtol=None, atol=None)
|
|
self.assertTrue(torch.allclose(x.grad.cpu(), xx.grad, rtol=rtol, atol=1e-3))
|
|
|
|
run_test(1100000000, 2) # Illegal memory access https://github.com/pytorch/pytorch/issues/52715
|
|
run_test(2200000000, 1) # invalid configuration argument https://github.com/pytorch/pytorch/issues/52716
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half)
|
|
@largeTensorTest("20GB")
|
|
@largeTensorTest("2GB", "cpu")
|
|
@precisionOverride({torch.half: 0.001})
|
|
def test_softmax_64bit_indexing(self, device, dtype):
|
|
def run_test(*shape):
|
|
x = torch.ones(shape, device=device, dtype=dtype, requires_grad=True)
|
|
y = F.log_softmax(x, dim=-1, dtype=dtype)
|
|
y.backward(y)
|
|
self.assertEqual(y[0], y[-1])
|
|
self.assertEqual(x.grad[0], x.grad[-1])
|
|
|
|
run_test(1024 * 256 + 1, 8192) # https://github.com/pytorch/pytorch/issues/84144
|
|
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.half)
|
|
def test_log_softmax_big(self, device, dtype):
|
|
def _test_helper(shape):
|
|
# generate a tensor with big numbers that are exactly representable in dtype
|
|
# and are at a constant offset from tensor with small numbers
|
|
# the logsoftmax of a small and big tensors should be equal
|
|
x_small = torch.randint(100, shape, dtype=dtype, device=device)
|
|
offset = 1.5e3 if dtype == torch.half else 1e7
|
|
x_big = x_small + offset
|
|
self.assertEqual(F.log_softmax(x_small, -1), F.log_softmax(x_big, -1))
|
|
_test_helper((16, 4))
|
|
if self.device_type == 'cuda':
|
|
# test non-persistent softmax kernel
|
|
_test_helper((4, 1536))
|
|
|
|
def test_save_lstm_compatibility(self, device):
|
|
# Test that saving an LSTM in PyTorch 1.7 and older can still be
|
|
# loaded in newer versions of PyTorch.
|
|
model = nn.LSTM(2, 3)
|
|
x = torch.randn(32, 5, 2)
|
|
expected = model(x)
|
|
|
|
# Get a state dict for PyTorch 1.7 LSTM. Before PyTorch 1.8, proj_size
|
|
# didn't exist.
|
|
assert model.proj_size == 0
|
|
state_dict = model.__dict__
|
|
del state_dict['proj_size']
|
|
|
|
# load a model
|
|
loaded_model = nn.LSTM(2, 3)
|
|
loaded_model.__setstate__(state_dict)
|
|
result = loaded_model(x)
|
|
self.assertEqual(result, expected)
|
|
|
|
@onlyCUDA
|
|
@tf32_on_and_off(0.005)
|
|
def test_grid_sample_large(self, device):
|
|
def issue_35202():
|
|
input_tensor = torch.rand(1, 1, 480, 640, dtype=torch.float, device=device, requires_grad=True)
|
|
coords = torch.tensor([[-10059144, 67680944], [67680944, 67680944]], dtype=torch.float, device=device)
|
|
coords = coords.unsqueeze(0).unsqueeze(0).repeat(1, 1, 1, 1)
|
|
result = torch.nn.functional.grid_sample(input_tensor, coords)
|
|
self.assertEqual(result, torch.tensor([[[[0., 0.]]]], dtype=torch.float, device=device))
|
|
result.backward(torch.ones_like(result))
|
|
torch.cuda.synchronize()
|
|
issue_35202()
|
|
|
|
def issue_24823_1(dtype):
|
|
image = torch.arange(27, 0, -1, dtype=dtype, device=device).view(1, 1, 3, 3, 3)
|
|
image.requires_grad_()
|
|
grid = torch.nn.functional.affine_grid(
|
|
torch.tensor([[[1, 0, 0, 0], [0, 1, 0, 0], [0, 0, 1, 0]]], dtype=dtype, device=device),
|
|
(1, 1, 3, 3, 3))
|
|
grid[:, 1, 1, 1, 0] = float('inf')
|
|
result = torch.nn.functional.grid_sample(image, grid, padding_mode='zeros')
|
|
tol_override = {'atol': 0.005, 'rtol': 0} if dtype == torch.half else {}
|
|
self.assertEqual(result, torch.tensor([[[[[27., 26., 25.], [24., 23., 22.], [21., 20., 19.]],
|
|
[[18., 17., 16.], [15., 0., 13.], [12., 11., 10.]],
|
|
[[9., 8., 7.], [6., 5., 4.], [3., 2., 1.]]]]],
|
|
device=device, dtype=dtype), **tol_override)
|
|
result.backward(torch.ones_like(result))
|
|
expected_grad = torch.ones_like(image)
|
|
expected_grad[0, 0, 1, 1, 1] = 0
|
|
self.assertEqual(image.grad, expected_grad, atol=0.005, rtol=0)
|
|
issue_24823_1(torch.half)
|
|
issue_24823_1(torch.float)
|
|
issue_24823_1(torch.double)
|
|
|
|
def issue_24823_2():
|
|
param = torch.tensor([[[-1.0e+20, 0.0, 0.0], [0.0, -1.0e+20, 0.0]]], dtype=torch.float, device=device)
|
|
img = torch.zeros((1, 1, 4, 4), dtype=torch.float, device=device, requires_grad=True)
|
|
grid = torch.nn.functional.affine_grid(param, img.size())
|
|
result = torch.nn.functional.grid_sample(img, grid)
|
|
self.assertEqual(result, torch.zeros(1, 1, 4, 4, device=device, dtype=torch.float))
|
|
result.backward(torch.ones_like(result))
|
|
torch.cuda.synchronize()
|
|
issue_24823_2()
|
|
|
|
@dtypes(torch.float, torch.double)
|
|
@largeTensorTest(lambda self, device, dtype:
|
|
# Compute sum of the large tensor sizes:
|
|
# (im.numel() + small_image.numel() + small_image.grad.numel() +
|
|
# large_view.grad.numel()) * sizeof(dtype)
|
|
32769 * (65536 + 3 * 65536 / 128) *
|
|
torch.tensor([], dtype=dtype).element_size())
|
|
def test_grid_sample_large_index_2d(self, device, dtype):
|
|
# Test 64-bit indexing with grid_sample (gh-41656)
|
|
# Try accessing the corners, there should be no segfault
|
|
coords = torch.tensor([[[-1., -1.],
|
|
[+1., -1.]],
|
|
|
|
[[-1., +1.],
|
|
[+1., +1.]]], device=device, dtype=dtype)
|
|
coords = coords.expand(1, 2, 2, 2)
|
|
im = torch.zeros([1, 1, 32769, 65536], device=device, dtype=dtype)
|
|
|
|
# Compare sampling with large strides to the same op on a contiguous tensor
|
|
coords = torch.rand(1, 4, 4, 2, device=device, dtype=dtype)
|
|
large_view = im[..., 127::128]
|
|
small_image = torch.rand_like(large_view)
|
|
large_view[...] = small_image
|
|
large_view.requires_grad, small_image.requires_grad = True, True
|
|
self.assertTrue(
|
|
sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31,
|
|
msg="View must use 64-bit indexing")
|
|
for mode, padding_mode, align_corners in itertools.product(
|
|
('nearest', 'bilinear', 'bicubic'), ('zeros', 'border', 'reflection'), (True, False)):
|
|
a = F.grid_sample(
|
|
small_image, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
a.sum().backward()
|
|
|
|
b = F.grid_sample(
|
|
large_view, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
b.sum().backward()
|
|
|
|
self.assertEqual(a, b)
|
|
self.assertEqual(small_image.grad, large_view.grad)
|
|
|
|
small_image.grad.zero_()
|
|
large_view.grad.zero_()
|
|
|
|
@dtypes(torch.float, torch.double)
|
|
@largeTensorTest(lambda self, device, dtype:
|
|
# Compute sum of the large tensor sizes:
|
|
# (im.numel() + small_image.numel() + small_image.grad.numel() +
|
|
# large_view.grad.numel()) * sizeof(dtype)
|
|
2 * 32769 * (32768 + 3 * 32768 / 128) *
|
|
torch.tensor([], dtype=dtype).element_size())
|
|
def test_grid_sample_large_index_3d(self, device, dtype):
|
|
# Test 64-bit indexing with grid_sample (gh-41656)
|
|
# Try accessing the corners, there should be no segfault
|
|
coords = torch.full((1, 2, 2, 2, 3), 1., device=device, dtype=dtype)
|
|
im = torch.zeros([1, 1, 2, 32769, 32768], device=device, dtype=dtype)
|
|
|
|
result = F.grid_sample(im, coords, align_corners=False)
|
|
self.assertEqual(result, torch.zeros((1, 1, 2, 2, 2), device=device, dtype=dtype))
|
|
|
|
# Compare sampling with large strides to the same op on a contiguous tensor
|
|
coords = torch.rand(1, 1, 4, 4, 3, device=device, dtype=dtype)
|
|
large_view = im[..., 127::128]
|
|
small_image = torch.rand_like(large_view)
|
|
large_view[...] = small_image
|
|
small_image.requires_grad, large_view.requires_grad = True, True
|
|
self.assertTrue(
|
|
sum(i * s for i, s in zip(large_view.size(), large_view.stride())) >= 2 ** 31,
|
|
msg="View must use 64-bit indexing")
|
|
for mode, padding_mode, align_corners in itertools.product(
|
|
('nearest', 'bilinear'), ('zeros', 'border', 'reflection'), (True, False)):
|
|
a = F.grid_sample(
|
|
small_image, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
a.sum().backward()
|
|
|
|
b = F.grid_sample(
|
|
large_view, coords, mode=mode,
|
|
padding_mode=padding_mode, align_corners=align_corners)
|
|
b.sum().backward()
|
|
|
|
self.assertEqual(a, b)
|
|
self.assertEqual(small_image.grad, large_view.grad)
|
|
|
|
small_image.grad.zero_()
|
|
large_view.grad.zero_()
|
|
|
|
@onlyCUDA
|
|
def test_grid_sample_half_precision(self):
|
|
def helper(shape_in, shape_out, align_corners):
|
|
for mode in ('bilinear', 'nearest', 'bicubic'):
|
|
if len(shape_in) != 4 and mode == 'bicubic':
|
|
continue
|
|
data = torch.randn(shape_in, device='cuda', dtype=torch.half)
|
|
grid = torch.rand(shape_out, device='cuda', dtype=torch.half) * 2.0 - 1.0
|
|
|
|
out_half = F.grid_sample(data, grid, mode=mode, padding_mode='zeros', align_corners=align_corners)
|
|
out_double = F.grid_sample(data.double(), grid.double(), mode=mode, padding_mode='zeros',
|
|
align_corners=align_corners)
|
|
|
|
self.assertEqual(out_half, out_double.half(), msg=f"grid_sample with mode = {mode} doesn't match")
|
|
|
|
helper((32, 64, 16, 16), (32, 8, 8, 2), True)
|
|
helper((32, 64, 16, 16, 16), (32, 8, 8, 8, 3), True)
|
|
helper((32, 64, 16, 16), (32, 8, 8, 2), False)
|
|
helper((32, 64, 16, 16, 16), (32, 8, 8, 8, 3), False)
|
|
|
|
@onlyCUDA
|
|
def test_grid_sample_bfloat16_precision(self):
|
|
def helper(shape_in, shape_out, align_corners):
|
|
for mode in ('bilinear', 'nearest', 'bicubic'):
|
|
if len(shape_in) != 4 and mode == 'bicubic':
|
|
continue
|
|
data = torch.randn(shape_in, device='cuda', dtype=torch.bfloat16)
|
|
grid = torch.rand(shape_out, device='cuda', dtype=torch.bfloat16) * 2.0 - 1.0
|
|
|
|
out_half = F.grid_sample(data, grid, mode=mode, padding_mode='zeros', align_corners=align_corners)
|
|
out_double = F.grid_sample(data.double(), grid.double(), mode=mode, padding_mode='zeros',
|
|
align_corners=align_corners)
|
|
|
|
self.assertEqual(out_half, out_double.bfloat16(), msg=f"grid_sample with mode = {mode} doesn't match")
|
|
|
|
helper((32, 64, 16, 16), (32, 8, 8, 2), True)
|
|
helper((32, 64, 16, 16, 16), (32, 8, 8, 8, 3), True)
|
|
helper((32, 64, 16, 16), (32, 8, 8, 2), False)
|
|
helper((32, 64, 16, 16, 16), (32, 8, 8, 8, 3), False)
|
|
|
|
def _test_gumbel_softmax_st_shapes(self, device, dtype, shape, dim, count_expected):
|
|
logits = torch.randn(shape, dtype=torch.float, device=device)
|
|
logits = logits.to(dtype)
|
|
|
|
y_draw = F.gumbel_softmax(logits, hard=True, dim=dim)
|
|
|
|
# All values positive
|
|
self.assertGreaterEqual(y_draw.min(), 0)
|
|
# Shape unchanged
|
|
self.assertTrue(y_draw.shape == logits.shape)
|
|
# One choice per draw
|
|
self.assertEqual(y_draw.sum(), count_expected, atol=torch.finfo(y_draw.dtype).eps, rtol=0)
|
|
|
|
def _test_gumbel_softmax_straight_through(self, device, dtype):
|
|
num_draws = 100
|
|
|
|
logits = torch.tensor([[0.2, 0.8, 0.1]], device=device)
|
|
logits = logits.reshape([1, 3])
|
|
logits = logits.to(dtype).requires_grad_()
|
|
probs = logits.softmax(dim=-1)
|
|
|
|
counts = torch.zeros_like(logits)
|
|
for _ in range(num_draws):
|
|
y_draw = F.gumbel_softmax(logits, hard=True)
|
|
counts = counts + y_draw
|
|
|
|
# All values positive
|
|
self.assertGreaterEqual(y_draw.min(), 0)
|
|
# Each experiment should result in 1 draw.
|
|
self.assertEqual(counts.sum(), num_draws, atol=torch.finfo(counts.dtype).eps, rtol=0)
|
|
|
|
# check results is asymptotically as expected.
|
|
expected = probs * num_draws
|
|
# ~z is approximately N(0,1) for unbiased count
|
|
z = (counts - expected) / (expected * (1 - probs)).sqrt()
|
|
# A (lazy) approximate 99% two-sided test:
|
|
# occurs with prob alpha~>=0.01 if unbiased
|
|
self.assertLess(z.abs().max().item(), 2.58)
|
|
|
|
def _test_gumbel_softmax_grad(self, device, dtype):
|
|
# "hard" and "not hard" should propagate same gradient.
|
|
logits_soft = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True)
|
|
logits_hard = torch.zeros(10, 10, dtype=dtype, device=device, requires_grad=True)
|
|
|
|
seed = torch.random.get_rng_state()
|
|
y_soft = F.gumbel_softmax(logits_soft, hard=False)
|
|
torch.random.set_rng_state(seed)
|
|
y_hard = F.gumbel_softmax(logits_hard, hard=True)
|
|
|
|
y_soft.sum().backward()
|
|
y_hard.sum().backward()
|
|
|
|
# 2eps = 1x addition + 1x subtraction.
|
|
tol = 2 * torch.finfo(dtype).eps
|
|
self.assertEqual(logits_soft.grad, logits_hard.grad, atol=tol, rtol=0)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypesIfMPS(torch.float)
|
|
@dtypes(torch.float, torch.double)
|
|
def test_gumbel_softmax(self, device, dtype):
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=0, count_expected=1)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5], dim=-1, count_expected=1)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4], dim=1, count_expected=5)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=1, count_expected=5 * 3)
|
|
self._test_gumbel_softmax_st_shapes(device, dtype, shape=[5, 4, 3], dim=-1, count_expected=5 * 4)
|
|
self._test_gumbel_softmax_straight_through(device, dtype)
|
|
self._test_gumbel_softmax_grad(device, dtype)
|
|
|
|
def _test_rnn_retain_variables(self, device, dtype):
|
|
rnns = [nn.LSTM(10, 20, num_layers=2).to(device, dtype),
|
|
nn.GRU(10, 20, num_layers=2).to(device, dtype),
|
|
nn.RNN(10, 20, num_layers=2).to(device, dtype)]
|
|
for rnn in rnns:
|
|
input = torch.randn(5, 6, 10, device=device, dtype=dtype, requires_grad=True)
|
|
output = rnn(input)
|
|
output[0].sum().backward(retain_graph=True)
|
|
grads = [input.grad.data.clone()] + [p.grad.data.clone() for p in rnn.parameters()]
|
|
for _ in range(4):
|
|
rnn.zero_grad()
|
|
input.grad.data.zero_()
|
|
output[0].sum().backward(retain_graph=True)
|
|
grads2 = [input.grad.data] + [p.grad.data for p in rnn.parameters()]
|
|
self.assertEqual(grads, grads2)
|
|
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypesIfMPS(torch.half, torch.float)
|
|
@dtypes(torch.double)
|
|
def test_rnn_retain_variables(self, device, dtype):
|
|
self._test_rnn_retain_variables(device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_rnn_retain_variables(device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.double)
|
|
def test_lstmcell_backward_only_one_output_grad(self, device, dtype):
|
|
# checks that undefined gradients doen't hamper the backward
|
|
# see #11872
|
|
l = torch.nn.LSTMCell(2, 3).to(device).to(dtype=dtype)
|
|
s = torch.randn(1, 2, device=device, dtype=dtype, requires_grad=True)
|
|
for i in range(2):
|
|
out = l(s)[i]
|
|
out.sum().backward()
|
|
self.assertFalse(s.grad is None or s.grad.abs().sum().item() == 0)
|
|
|
|
def _test_rnn_mod(self, mod, inp):
|
|
def flatten_out(mod, inp):
|
|
out = mod(inp)
|
|
return tuple([t if isinstance(t, torch.Tensor) else tt for t in out for tt in t])
|
|
gradcheckfunc = partial(flatten_out, mod)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
gradcheck(gradcheckfunc, inp, check_batched_grad=False)
|
|
gradgradcheck(gradcheckfunc, inp, check_batched_grad=False)
|
|
|
|
if inp.is_cuda and not TEST_WITH_ROCM:
|
|
# Assert that we have good error message around unsupported CuDNN double backward
|
|
# NB: we trigger double backward using .backward() instead of autograd.grad due to
|
|
# https://github.com/pytorch/pytorch/issues/37874
|
|
with torch.backends.cudnn.flags(enabled=True):
|
|
result = gradcheckfunc(inp)
|
|
result[0].sum().backward(create_graph=True)
|
|
grad0 = next(mod.parameters()).grad
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
"please disable the CuDNN backend temporarily"):
|
|
grad0.sum().backward()
|
|
|
|
# Here we avoid the backward(create_graph=True) memory leak
|
|
# described in https://github.com/pytorch/pytorch/issues/7343
|
|
for param in mod.parameters():
|
|
param.grad = None
|
|
inp.grad = None
|
|
|
|
# Merge into OpInfo?
|
|
@skipMeta # LSTM cell reuses output which was resized
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
@dtypes(torch.double)
|
|
def test_LSTM_grad_and_gradgrad(self, device, dtype):
|
|
hsize = 4
|
|
inp = torch.rand(1, 3, hsize, device=device, dtype=dtype, requires_grad=True)
|
|
for bias in [True, False]:
|
|
mod = torch.nn.LSTM(hsize, hsize, bias=bias).to(device).to(dtype)
|
|
self._test_rnn_mod(mod, inp)
|
|
|
|
@skipMeta # GRU cell reuses output which was resized
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
@dtypes(torch.double)
|
|
def test_GRU_grad_and_gradgrad(self, device, dtype):
|
|
hsize = 4
|
|
inp = torch.rand(1, 3, hsize, device=device, dtype=dtype, requires_grad=True)
|
|
for bias in [True, False]:
|
|
mod = torch.nn.GRU(hsize, hsize, bias=bias).to(device).to(dtype)
|
|
self._test_rnn_mod(mod, inp)
|
|
|
|
@skipMeta
|
|
@dtypes(torch.float32, torch.bfloat16)
|
|
@onlyCPU
|
|
def test_LSTM_differentiable_backward_using_oneDNN(self, dtype):
|
|
batch = 10
|
|
seq_len = 12
|
|
input = 3
|
|
Net = nn.LSTM(input, 3, 20, batch_first=True)
|
|
import copy
|
|
Net_clone = copy.deepcopy(Net)
|
|
x = torch.rand(batch, seq_len, input)
|
|
x1 = x.clone().requires_grad_(True)
|
|
x2 = x.clone().requires_grad_(True)
|
|
|
|
torch._C._set_mkldnn_enabled(False)
|
|
out1, _ = Net(x1)
|
|
der_out1 = torch.autograd.grad(out1, x1,
|
|
grad_outputs=torch.ones_like(out1),
|
|
retain_graph=True,
|
|
create_graph=True)[0]
|
|
loss1 = der_out1.sum()
|
|
loss1.backward(retain_graph=True)
|
|
|
|
torch._C._set_mkldnn_enabled(True)
|
|
out2, _ = Net(x2)
|
|
der_out2 = torch.autograd.grad(out2, x2,
|
|
grad_outputs=torch.ones_like(out2),
|
|
retain_graph=True,
|
|
create_graph=True)[0]
|
|
loss2 = der_out2.sum()
|
|
loss2.backward(retain_graph=True)
|
|
assert torch.allclose(der_out1, der_out2)
|
|
assert torch.allclose(x1.grad, x2.grad)
|
|
|
|
@onlyCUDA
|
|
def test_upsamplingNearest1d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@onlyCUDA
|
|
def test_upsamplingNearest2d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@onlyCUDA
|
|
@gcIfJetson
|
|
def test_upsamplingNearest3d_launch_config(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(2**25, 1, 1, 1, 1, device=device)
|
|
out = m(inp)
|
|
inp_ref = inp.cpu()
|
|
out_ref = m(inp_ref)
|
|
self.assertEqual(out_ref, out)
|
|
|
|
@unittest.expectedFailure
|
|
@skipIfRocm
|
|
@onlyCUDA
|
|
def test_upsamplingNearest2d_launch_fail(self, device):
|
|
m = nn.Upsample(scale_factor=2)
|
|
# launch grid_y == 2**16 (larger than maximum y-dimension limit 65535)
|
|
inp = torch.rand(1, 1, 2**15, 2**8, device=device)
|
|
out = m(inp)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfNotRocm
|
|
def test_upsamplingNearest2d_launch_rocm(self, device):
|
|
# test_upsamplingNearest2d_launch_fail should run OK on ROCm
|
|
m = nn.Upsample(scale_factor=2)
|
|
inp = torch.rand(1, 1, 2**15, 2**8, device=device)
|
|
out = m(inp)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfCudnnVersionLessThan(7600)
|
|
def test_CTCLoss_cudnn(self, device):
|
|
def _helper(zero_infinity):
|
|
target_lengths = [30, 25, 20]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (sum(target_lengths),), dtype=torch.int)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.float, device=device).log_softmax(2).requires_grad_()
|
|
|
|
log_probs_ref = log_probs.detach().clone().requires_grad_()
|
|
|
|
with torch.backends.cudnn.flags(enabled=True):
|
|
res = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, zero_infinity=zero_infinity)
|
|
res.backward()
|
|
|
|
expected = ctcloss_reference(log_probs, targets.cuda(), input_lengths, target_lengths).float()
|
|
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
res2 = torch.nn.functional.ctc_loss(log_probs_ref, targets.cuda().long(), input_lengths, target_lengths,
|
|
zero_infinity=zero_infinity)
|
|
res2.backward()
|
|
|
|
self.assertEqual(res, expected)
|
|
self.assertEqual(res2, res)
|
|
self.assertEqual(log_probs.grad, log_probs_ref.grad)
|
|
|
|
_helper(zero_infinity=True)
|
|
_helper(zero_infinity=False)
|
|
|
|
def _CTCLoss_gen_losses(self, device, input_length, vocab_size, target_length, reduction, use_module_form):
|
|
batch_size = 1
|
|
log_probs = torch.randn(input_length, batch_size, vocab_size, dtype=torch.float, device=device) \
|
|
.log_softmax(2).requires_grad_()
|
|
targets = torch.randint(low=1, high=vocab_size - 1, size=(batch_size, target_length),
|
|
dtype=torch.int, device=device)
|
|
input_lengths = batch_size * [input_length]
|
|
target_lengths = batch_size * [target_length]
|
|
|
|
log_probs_no_bd = log_probs.squeeze(1).detach().clone().requires_grad_()
|
|
targets_no_bd = targets.squeeze(0).detach().clone()
|
|
input_lengths_no_bd = torch.tensor(input_length)
|
|
target_lengths_no_bd = torch.tensor(target_length)
|
|
|
|
# currently only length 2 and 1 right now, but left flexible for additional potential cases
|
|
log_probs_refs = [log_probs.detach().clone().requires_grad_() for _ in range(2)]
|
|
log_probs_no_bd_refs = [log_probs_no_bd.detach().clone().requires_grad_() for _ in range(1)]
|
|
|
|
losses = []
|
|
losses_no_bd = []
|
|
|
|
has_cuda = torch.cuda.is_available()
|
|
has_cudnn = has_cuda and 'cuda' in device and self.has_cudnn()
|
|
# cudnn requires a cpu target
|
|
if has_cuda and has_cudnn:
|
|
targets = targets.cpu()
|
|
targets_no_bd = targets_no_bd.cpu()
|
|
|
|
ctc_loss = (
|
|
nn.CTCLoss(reduction=reduction, zero_infinity=True)
|
|
if use_module_form
|
|
else partial(torch.nn.functional.ctc_loss, reduction=reduction, zero_infinity=True)
|
|
)
|
|
|
|
with torch.backends.cudnn.flags(enabled=has_cudnn):
|
|
# batched case. log_probs.shape = (T, N, C), targets = (N, S), input_lengths/target_lengths = (N,)
|
|
losses.append(ctc_loss(log_probs_refs[0], targets, input_lengths, target_lengths))
|
|
# batched case. input.shape = (T, N, C), targets = (S,), input_lengths/target_lengths = (N,)
|
|
losses.append(ctc_loss(log_probs_refs[1], targets_no_bd, input_lengths, target_lengths))
|
|
# unbatched case. input.shape = (T, C), targets = (S,), input_lengths/target_lengths = (N,)
|
|
losses_no_bd.append(ctc_loss(log_probs_no_bd_refs[0], targets_no_bd,
|
|
input_lengths_no_bd, target_lengths_no_bd))
|
|
|
|
for loss in losses + losses_no_bd:
|
|
loss.backward()
|
|
|
|
return losses, losses_no_bd, log_probs_refs, log_probs_no_bd_refs
|
|
|
|
def _assertEqual_list(self, expected, list_to_compare, atol=None, rtol=None):
|
|
for ele in list_to_compare:
|
|
self.assertEqual(expected, ele, atol=atol, rtol=rtol)
|
|
|
|
@expectedFailureMPS # NotImplementedError: aten::_ctc_loss https://github.com/pytorch/pytorch/issues/77764
|
|
@parametrize_test("reduction", ['none', 'mean', 'sum'])
|
|
@parametrize_test("use_module_form", [True, False])
|
|
def test_CTCLoss_no_batch_dim(self, device, reduction, use_module_form):
|
|
input_length = 40
|
|
vocab_size = 3
|
|
target_length = 12
|
|
|
|
args = self._CTCLoss_gen_losses(device, input_length, vocab_size, target_length, reduction, use_module_form)
|
|
losses, losses_no_bd, log_probs_refs, log_probs_no_bd_refs = args
|
|
|
|
# test output values
|
|
self._assertEqual_list(losses[0], losses[1:], atol=1e-4, rtol=0)
|
|
self._assertEqual_list(losses[0].squeeze(0), losses_no_bd, atol=1e-4, rtol=0)
|
|
|
|
# test gradient values
|
|
self._assertEqual_list(log_probs_refs[0].grad, [t.grad for t in log_probs_refs[1:]], atol=1e-4, rtol=0)
|
|
self._assertEqual_list(
|
|
log_probs_refs[0].grad.squeeze(1),
|
|
[t.grad for t in log_probs_no_bd_refs],
|
|
atol=1e-4,
|
|
rtol=0,
|
|
)
|
|
|
|
# checking the output's shape
|
|
# batch dim case should be (N,). no batch dim case should be ()
|
|
self._assertEqual_list((1,) if reduction == 'none' else (), [loss.shape for loss in losses])
|
|
self._assertEqual_list((), [loss.shape for loss in losses_no_bd])
|
|
|
|
# checking the gradient's shape
|
|
# batch dim case should have shape (T, N, C). no batch dim case should have shape (T, C)
|
|
self._assertEqual_list((input_length, 1, vocab_size), [t.grad.shape for t in log_probs_refs])
|
|
self._assertEqual_list((input_length, vocab_size), [t.grad.shape for t in log_probs_no_bd_refs])
|
|
|
|
def _ordered_sequence(self, device, dtype):
|
|
"""Create ordered list of random sequences"""
|
|
seqs = [torch.empty(random.randint(1, 6), device=device, dtype=dtype)
|
|
for _ in range(5)]
|
|
seqs = [s.random_(-128, 128) for s in seqs]
|
|
ordered = sorted(seqs, key=len, reverse=True)
|
|
return ordered
|
|
|
|
def _padded_sequence(self, device, dtype):
|
|
"""Create Tensor of random padded sequences"""
|
|
ordered = self._ordered_sequence(device, dtype)
|
|
lengths = [len(i) for i in ordered]
|
|
padded_tensor = rnn_utils.pad_sequence(ordered)
|
|
return padded_tensor, lengths
|
|
|
|
@onlyCUDA
|
|
def test_device_mask(self, device):
|
|
for enforce_sorted in [True, False]:
|
|
padded, lengths = self._padded_sequence('cpu', torch.float)
|
|
packed = rnn_utils.pack_padded_sequence(
|
|
padded, lengths, enforce_sorted=enforce_sorted)
|
|
self.assertFalse(packed.is_cuda)
|
|
packed = packed.to(device)
|
|
self.assertTrue(packed.is_cuda)
|
|
unpacked, _ = rnn_utils.pad_packed_sequence(packed)
|
|
self.assertTrue(unpacked.is_cuda)
|
|
self.assertEqual(unpacked.dtype, torch.float)
|
|
|
|
@onlyCUDA
|
|
def test_overwrite_module_params_on_conversion_cpu_device(self, device):
|
|
# Test that under the current default settings
|
|
# (`torch.__future__.get_overwrite_module_params_on_conversion() == False`),
|
|
# a view to a module's parameters is not pointing to the same storage as
|
|
# its base variable after converting the module to a different device.
|
|
m = nn.Linear(20, 10)
|
|
mw = m.weight[:]
|
|
m.to(device)
|
|
with torch.no_grad():
|
|
# Without using `torch.no_grad()`, this will leak CUDA memory.
|
|
# (Issue is filed at https://github.com/pytorch/pytorch/issues/21875)
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0].device.type == "cpu")
|
|
self.assertTrue(mw._base[0][0].device.type == "cuda")
|
|
|
|
try:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(True)
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# a view to a module's parameters is still pointing to the same storage as
|
|
# its base variable after converting the module to a different device.
|
|
m = nn.Linear(20, 10)
|
|
mw = m.weight[:]
|
|
m.to(device)
|
|
with torch.no_grad():
|
|
mw[0][0] = 5
|
|
self.assertTrue(mw[0][0] == mw._base[0][0])
|
|
|
|
# Test that if `torch.__future__.get_overwrite_module_params_on_conversion() == True`,
|
|
# `cpu_module.to("cuda")` doesn't preserve previous references to
|
|
# `cpu_module`'s parameters or gradients.
|
|
m = nn.Linear(20, 10)
|
|
m.weight.grad = torch.randn(10, 20)
|
|
weight_ref = m.weight
|
|
weight_grad_ref = m.weight.grad
|
|
m.to(device)
|
|
self.assertNotEqual(weight_ref.device, m.weight.device)
|
|
self.assertNotEqual(weight_grad_ref.device, m.weight.grad.device)
|
|
finally:
|
|
torch.__future__.set_overwrite_module_params_on_conversion(False)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.half, torch.float)
|
|
def test_softmax(self, device, dtype):
|
|
input = torch.rand(32, 100, device=device, dtype=dtype, requires_grad=True)
|
|
inputf = input.to(torch.float).detach().requires_grad_(True)
|
|
out = F.softmax(input, dim=-1, dtype=torch.float)
|
|
outf = F.softmax(inputf, dim=-1)
|
|
# should be bitwise equal
|
|
self.assertEqual(out, outf, atol=0, rtol=0)
|
|
gO = torch.empty_like(outf).uniform_()
|
|
out.backward(gO)
|
|
outf.backward(gO)
|
|
# should be bitwise equal
|
|
self.assertEqual(input.grad, inputf.grad.to(dtype), atol=0, rtol=0)
|
|
|
|
def _test_batchnorm_grad(self, device, dtype=torch.double):
|
|
bs, n_feat, size_feat = 4, 5, 6
|
|
input = torch.arange(bs * n_feat * size_feat, device=device,
|
|
requires_grad=True, dtype=dtype).view(bs, n_feat, size_feat)
|
|
weight = torch.arange(1, n_feat + 1, device=device, requires_grad=True, dtype=dtype)
|
|
bias = torch.arange(n_feat, device=device, requires_grad=True, dtype=dtype)
|
|
running_mean = 1 - torch.arange(n_feat, device=device, dtype=dtype)
|
|
running_var = 2 * torch.arange(n_feat, device=device, dtype=dtype)
|
|
for training in [False, True]:
|
|
_assertGradAndGradgradChecks(self, F.batch_norm, (input, running_mean, running_var, weight, bias,
|
|
training, 0.1, 0.0001))
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
def test_batchnorm_grad(self, device):
|
|
self._test_batchnorm_grad(device)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_grad(device)
|
|
|
|
@onlyCUDA
|
|
def test_layernorm_half_precision(self):
|
|
width = 128
|
|
input = torch.rand(1, 5, width, device="cuda", dtype=torch.half) * 0.1
|
|
normalized_shape = (width,)
|
|
weight = torch.ones(width, device="cuda", dtype=torch.half)
|
|
bias = torch.zeros(width, device="cuda", dtype=torch.half)
|
|
eps = 1e-5
|
|
|
|
output_fp16 = torch.layer_norm(input, normalized_shape, weight, bias, eps)
|
|
output_fp32 = torch.layer_norm(input.float(), normalized_shape, weight.float(), bias.float(), eps).half()
|
|
self.assertEqual(output_fp16, output_fp32, atol=0, rtol=0)
|
|
|
|
@onlyCUDA
|
|
def test_layernorm_weight_bias(self):
|
|
width = 128
|
|
input = torch.rand(1, 5, width, device="cuda", dtype=torch.float32) * 0.1
|
|
normalized_shape = (width,)
|
|
data = torch.randn(width, device="cuda", dtype=torch.float32)
|
|
weight = torch.ones(width, device="cuda", dtype=torch.float32)
|
|
bias = torch.zeros(width, device="cuda", dtype=torch.float32)
|
|
eps = 1e-5
|
|
|
|
out_none_weight = torch.layer_norm(input, normalized_shape, None, data, eps)
|
|
out_one_weight = torch.layer_norm(input, normalized_shape, weight, data, eps)
|
|
self.assertEqual(out_none_weight, out_one_weight)
|
|
|
|
out_none_bias = torch.layer_norm(input, normalized_shape, data, None, eps)
|
|
out_zero_bias = torch.layer_norm(input, normalized_shape, data, bias, eps)
|
|
self.assertEqual(out_none_bias, out_zero_bias)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
def test_hardsigmoid_grad(self, device):
|
|
inputs = (torch.randn(4, 16, 16, device=device, dtype=torch.double) - 0.5) * 10
|
|
inputs.requires_grad = True
|
|
self.assertTrue(gradcheck(F.hardsigmoid, (inputs,)))
|
|
|
|
# currently fails on XLA
|
|
@onlyNativeDeviceTypes
|
|
def test_hardswish_grad(self, device):
|
|
inputs = (torch.randn(4, 16, 16, device=device, dtype=torch.double) - 0.5) * 10
|
|
inputs.requires_grad = True
|
|
self.assertTrue(gradcheck(F.hardswish, (inputs,)))
|
|
|
|
|
|
def _test_batchnorm_eval(self, ndim, device, dtype, module_dtype=None):
|
|
module_dtype = module_dtype or dtype
|
|
module = nn.BatchNorm1d(3).to(device, module_dtype)
|
|
module.eval()
|
|
|
|
data = torch.rand([3] * ndim, device=device, dtype=dtype, requires_grad=True)
|
|
grad = torch.rand([3] * ndim, device=device, dtype=dtype)
|
|
|
|
# 1st pass
|
|
res1 = module(data)
|
|
res1.backward(grad)
|
|
grad1 = data.grad.clone()
|
|
|
|
# 2nd pass
|
|
if data.grad is not None:
|
|
data.grad.data.zero_()
|
|
|
|
res2 = module(data)
|
|
res2.backward(grad)
|
|
grad2 = data.grad.clone()
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
# track_running_stats=False
|
|
module = nn.BatchNorm1d(3, track_running_stats=False).to(device, module_dtype)
|
|
|
|
data = torch.rand(4, 3, device=device, dtype=dtype, requires_grad=True)
|
|
grad = torch.rand(4, 3, device=device, dtype=dtype)
|
|
|
|
# 1st pass
|
|
res1 = module(data)
|
|
res1.backward(grad)
|
|
grad1 = data.grad.clone()
|
|
|
|
# set eval
|
|
module.eval()
|
|
|
|
# 2nd pass
|
|
if data.grad is not None:
|
|
data.grad.data.zero_()
|
|
|
|
res2 = module(data)
|
|
res2.backward(grad)
|
|
grad2 = data.grad.clone()
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.bfloat16)
|
|
def test_batchnorm_eval(self, device, dtype):
|
|
self._test_batchnorm_eval(2, device, dtype)
|
|
self._test_batchnorm_eval(3, device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_eval(2, device, dtype)
|
|
self._test_batchnorm_eval(3, device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_batchnorm_eval_mixed(self, device, dtype):
|
|
# Test bfloat16 input with float module
|
|
self._test_batchnorm_eval(2, device, dtype, torch.float)
|
|
self._test_batchnorm_eval(3, device, dtype, torch.float)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_eval(2, device, dtype, torch.float)
|
|
self._test_batchnorm_eval(3, device, dtype, torch.float)
|
|
|
|
def _test_batchnorm_affine(self, ndim, device, dtype, module_dtype=None):
|
|
# Compare affine against no-op weights and bias
|
|
module_dtype = module_dtype or dtype
|
|
module = nn.BatchNorm1d(3, affine=False).to(device, module_dtype)
|
|
module_affine = nn.BatchNorm1d(3, affine=True).to(device, module_dtype)
|
|
with torch.no_grad():
|
|
module_affine.weight.fill_(1.0)
|
|
module_affine.bias.zero_()
|
|
|
|
data = torch.rand([3] * ndim, device=device, dtype=dtype, requires_grad=True)
|
|
grad = torch.ones_like(data, requires_grad=False)
|
|
|
|
# With weights all ones and bias all zeros
|
|
res1 = module_affine(data)
|
|
res1.backward(grad)
|
|
grad1 = data.grad.clone()
|
|
data.grad.zero_()
|
|
|
|
# Without any weights or bias
|
|
res2 = module(data)
|
|
res2.backward(grad)
|
|
grad2 = data.grad
|
|
|
|
self.assertEqual(res1, res2)
|
|
self.assertEqual(grad1, grad2)
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.bfloat16)
|
|
def test_batchnorm_affine(self, device, dtype):
|
|
self._test_batchnorm_affine(2, device, dtype)
|
|
self._test_batchnorm_affine(3, device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_affine(2, device, dtype)
|
|
self._test_batchnorm_affine(3, device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_batchnorm_affine_mixed(self, device, dtype):
|
|
cudnn_enabled = [False]
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
# TODO: Test fails with cudnn, see gh-62034
|
|
# cudnn_enabled = [False, True]
|
|
pass
|
|
|
|
# Test bfloat16 input with float module
|
|
for enabled in cudnn_enabled:
|
|
with torch.backends.cudnn.flags(enabled=enabled):
|
|
self._test_batchnorm_affine(2, device, dtype, torch.float)
|
|
self._test_batchnorm_affine(3, device, dtype, torch.float)
|
|
|
|
def _test_batchnorm_simple_average(self, device, dtype, module_dtype=None):
|
|
module_dtype = module_dtype or dtype
|
|
module = nn.BatchNorm1d(3, momentum=None).to(dtype=module_dtype, device=device)
|
|
zeros = torch.zeros(3, dtype=module_dtype, device=device)
|
|
ones = torch.ones(3, dtype=module_dtype, device=device)
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
data1 = torch.rand(4, 3, dtype=dtype, device=device)
|
|
data2 = torch.rand(4, 3, dtype=dtype, device=device)
|
|
|
|
# 1st pass
|
|
res1 = module(data1)
|
|
running_mean1 = module.running_mean.clone()
|
|
running_var1 = module.running_var.clone()
|
|
self.assertNotEqual(running_mean1, zeros)
|
|
self.assertNotEqual(running_var1, ones)
|
|
|
|
# reset stats
|
|
module.reset_running_stats()
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
# 2nd pass
|
|
res2 = module(data2)
|
|
running_mean2 = module.running_mean.clone()
|
|
running_var2 = module.running_var.clone()
|
|
self.assertNotEqual(running_mean2, zeros)
|
|
self.assertNotEqual(running_var2, ones)
|
|
|
|
# reset stats
|
|
module.reset_running_stats()
|
|
self.assertEqual(module.running_mean, zeros)
|
|
self.assertEqual(module.running_var, ones)
|
|
|
|
# 3rd (combined) pass
|
|
res3 = module(data1)
|
|
res4 = module(data2)
|
|
self.assertEqual(res3, res1)
|
|
self.assertEqual(res4, res2)
|
|
self.assertEqual(module.running_mean, (running_mean1 + running_mean2) / 2)
|
|
self.assertEqual(module.running_var, (running_var1 + running_var2) / 2)
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.float, torch.bfloat16)
|
|
def test_batchnorm_simple_average(self, device, dtype):
|
|
self._test_batchnorm_simple_average(device, dtype)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_simple_average(device, dtype)
|
|
|
|
@onlyCUDA
|
|
@dtypes(torch.bfloat16, torch.half)
|
|
def test_batchnorm_simple_average_mixed(self, device, dtype):
|
|
self._test_batchnorm_simple_average(device, dtype, torch.float)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_simple_average(device, dtype, torch.float)
|
|
|
|
@onlyNativeDeviceTypes
|
|
@dtypes(torch.float, torch.double)
|
|
def test_grid_sample_nan_inf(self, device, dtype):
|
|
input = torch.zeros([1, 1, 3, 3], device=device, dtype=dtype)
|
|
grid = torch.tensor([[[[nan, 0], [0, inf]]]], device=device, dtype=dtype)
|
|
for padding_mode in ('reflection', 'border', 'zeros'):
|
|
sample = torch.nn.functional.grid_sample(input=input, grid=grid, mode='nearest',
|
|
padding_mode=padding_mode, align_corners=False)
|
|
self.assertEqual(sample, torch.zeros([1, 1, 1, 2], device=device, dtype=dtype))
|
|
|
|
@expectedFailureMPS # NotImplementedError aten::_ctc_loss https://github.com/pytorch/pytorch/issues/77764
|
|
def test_CTCLoss_empty_target(self, device):
|
|
target_lengths = [0, 0, 0]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (0,), dtype=torch.long, device=device)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2)
|
|
loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((loss >= 0).all().item())
|
|
self.assertEqual(-log_probs.sum(0)[:, 0], loss)
|
|
|
|
target_lengths = [0, 9, 0]
|
|
input_lengths = [50, 50, 50]
|
|
targets = torch.randint(1, 15, (9,), dtype=torch.long, device=device)
|
|
log_probs = torch.randn(50, 3, 15, dtype=torch.double, device=device).log_softmax(2)
|
|
loss = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue((loss >= 0).all().item())
|
|
self.assertEqual(-log_probs.sum(0)[[0, 2], 0], loss[[0, 2]])
|
|
|
|
# Merge into OpInfo?
|
|
@skipCUDAIf(True, """Test is flaky on Linux and Windows, typical error message:
|
|
https://github.com/pytorch/pytorch/issues/34870""")
|
|
@expectedFailureMPS # NotImplementedError aten::_ctc_loss https://github.com/pytorch/pytorch/issues/77764
|
|
def test_ctc_loss(self, device):
|
|
batch_size = 64
|
|
num_labels = 101
|
|
target_length = 15
|
|
gradcheck_input_size = 10
|
|
|
|
ZERO_NONE = 0
|
|
ZERO_SOME = 1
|
|
ZERO_ALL = 2
|
|
|
|
# input_length, vary_lengths, zero_lengths
|
|
tests = [(150, False, ZERO_NONE),
|
|
(150, True, ZERO_NONE),
|
|
(50, True, ZERO_SOME),
|
|
(50, True, ZERO_ALL)]
|
|
|
|
if 'cuda' in device:
|
|
tests += [(50, False, ZERO_NONE),
|
|
(50, True, ZERO_NONE),
|
|
(150, True, ZERO_SOME),
|
|
(150, True, ZERO_ALL)]
|
|
|
|
for input_length, vary_lengths, zero_mode in tests:
|
|
targets = torch.randint(1, num_labels, (batch_size, target_length),
|
|
device=device, dtype=torch.long)
|
|
x = torch.randn(gradcheck_input_size, dtype=torch.double, device=device, requires_grad=True)
|
|
tile_factors = torch.randn(input_length * batch_size * num_labels // gradcheck_input_size + 1,
|
|
device=device)
|
|
input_lengths = [(torch.randint(input_length // 2, input_length + 1, ()).item()
|
|
if vary_lengths or i == 0 else input_length) for i in range(batch_size)]
|
|
if zero_mode == ZERO_ALL:
|
|
target_lengths = [0 for _ in range(batch_size)]
|
|
else:
|
|
target_lengths = [(torch.randint(target_length // 2, target_length + 1, ()).item()
|
|
if vary_lengths else target_length) for _ in range(batch_size)]
|
|
if zero_mode == ZERO_SOME:
|
|
idxes = torch.randint(0, batch_size, (10,))
|
|
for i in idxes:
|
|
target_lengths[i] = 0
|
|
|
|
def ctc_after_softmax(x):
|
|
x_full = ((x[:, None] * tile_factors[None, :]).view(-1)[:input_length * batch_size * num_labels]
|
|
.view(input_length, batch_size, num_labels))
|
|
log_probs = torch.log_softmax(x_full, 2)
|
|
return torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths)
|
|
|
|
gradcheck(ctc_after_softmax, [x])
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm(msg="skipped Cudnn test on ROCm")
|
|
@skipCUDAIfCudnnVersionLessThan(7600)
|
|
def test_ctc_loss_cudnn(self, device):
|
|
batch_size = 16
|
|
input_length = 30
|
|
num_labels = 101
|
|
target_length = 15
|
|
targets = torch.randint(1, num_labels, (batch_size * target_length,),
|
|
device='cuda', dtype=torch.long)
|
|
log_probs = torch.log_softmax(torch.randn(input_length, batch_size, num_labels, device='cuda', dtype=torch.float), 2)
|
|
log_probs.requires_grad_()
|
|
|
|
input_lengths = batch_size * [input_length]
|
|
target_lengths = batch_size * [target_length]
|
|
grad_out = torch.randn(batch_size, device='cuda', dtype=torch.float)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
loss_native = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
grad_native, = torch.autograd.grad(loss_native, log_probs, grad_out)
|
|
loss_cudnn = torch.nn.functional.ctc_loss(log_probs, targets.to('cpu', torch.int32),
|
|
input_lengths, target_lengths, reduction='none')
|
|
self.assertTrue("Cudnn" in str(loss_cudnn.grad_fn))
|
|
grad_cudnn, = torch.autograd.grad(loss_cudnn, log_probs, grad_out)
|
|
self.assertEqual(grad_cudnn, grad_native, atol=1e-4, rtol=0)
|
|
|
|
@onlyCUDA
|
|
@skipCUDAIfRocm(msg="skipped Cudnn test on ROCm")
|
|
@skipCUDAIfCudnnVersionLessThan(8000)
|
|
def test_ctc_loss_cudnn_tensor(self, device):
|
|
batch_size = 16
|
|
input_length = 30
|
|
num_labels = 101
|
|
target_length = 15
|
|
targets = torch.randint(1, num_labels, (batch_size * target_length,),
|
|
device='cuda', dtype=torch.long)
|
|
log_probs = torch.log_softmax(torch.randn(input_length, batch_size, num_labels, device='cuda', dtype=torch.float), 2)
|
|
log_probs.requires_grad_()
|
|
|
|
input_lengths = batch_size * [input_length]
|
|
input_lengths = torch.linspace(start=15, end=input_length, steps=batch_size, dtype=torch.long, device='cuda')
|
|
target_lengths = torch.tensor(batch_size * [target_length], dtype=torch.long, device='cuda')
|
|
grad_out = torch.randn(batch_size, device='cuda', dtype=torch.float)
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
loss_native = torch.nn.functional.ctc_loss(log_probs, targets, input_lengths, target_lengths, reduction='none')
|
|
grad_native, = torch.autograd.grad(loss_native, log_probs, grad_out)
|
|
loss_cudnn = torch.nn.functional.ctc_loss(log_probs,
|
|
targets.to('cuda', torch.int32),
|
|
input_lengths.to('cuda', torch.int32),
|
|
target_lengths.to('cuda', torch.int32),
|
|
reduction='none')
|
|
self.assertTrue("Cudnn" in str(loss_cudnn.grad_fn))
|
|
grad_cudnn, = torch.autograd.grad(loss_cudnn, log_probs, grad_out)
|
|
self.assertEqual(grad_cudnn, grad_native, atol=1e-4, rtol=0)
|
|
|
|
@expectedFailureMPS # RuntimeError: LSTM with projections is not currently supported with MPS.
|
|
@dtypesIfCUDA(torch.half, torch.float, torch.double)
|
|
@dtypes(torch.float)
|
|
@tf32_on_and_off(0.005)
|
|
@skipIfTorchDynamo("TorchDynamo fails here for unknown reasons")
|
|
def test_variable_sequence(self, device, dtype):
|
|
def pad(var, length):
|
|
if var.size(0) == length:
|
|
return var
|
|
return torch.cat([var, var.new_zeros(length - var.size(0), *var.size()[1:])])
|
|
|
|
def maybe_index_tuple(maybe_tuple_of_tensors, index):
|
|
if maybe_tuple_of_tensors is None:
|
|
return None
|
|
return tuple(maybe_tuple_of_tensors[j][:, index:index + 1, :].contiguous()
|
|
for j in range(2))
|
|
|
|
def check_lengths(lengths, enforce_sorted, use_default_hiddens, proj_size):
|
|
input_size = 3
|
|
hidden_size = 4
|
|
num_layers = 2
|
|
bidirectional = True
|
|
|
|
max_length = max(lengths)
|
|
x_leaf = torch.randn(max_length, len(lengths), input_size, device=device,
|
|
dtype=dtype, requires_grad=True)
|
|
num_directions = 2 if bidirectional else 1
|
|
lstm = nn.LSTM(input_size, hidden_size, bidirectional=bidirectional,
|
|
num_layers=num_layers, proj_size=proj_size).to(device, dtype)
|
|
lstm2 = deepcopy(lstm).to(device, dtype)
|
|
x = x_leaf
|
|
|
|
hidden0 = None
|
|
if not use_default_hiddens:
|
|
real_hidden_size = hidden_size if proj_size == 0 else proj_size
|
|
hidden0 = (torch.randn(num_directions * num_layers, len(lengths), real_hidden_size,
|
|
device=device, dtype=dtype),
|
|
torch.randn(num_directions * num_layers, len(lengths), hidden_size,
|
|
device=device, dtype=dtype))
|
|
|
|
# Compute sequences separately
|
|
seq_outs = []
|
|
seq_hiddens = []
|
|
for i, l in enumerate(lengths):
|
|
hidden_i = maybe_index_tuple(hidden0, i)
|
|
out, hid = lstm2(x[:l, i:i + 1], hidden_i)
|
|
out_pad = pad(out, max_length)
|
|
seq_outs.append(out_pad)
|
|
seq_hiddens.append(hid)
|
|
seq_out = torch.cat(seq_outs, 1)
|
|
seq_hidden = tuple(torch.cat(hids, 1) for hids in zip(*seq_hiddens))
|
|
|
|
# Use packed format
|
|
packed = rnn_utils.pack_padded_sequence(x, lengths, enforce_sorted=enforce_sorted)
|
|
packed_out, packed_hidden = lstm(packed, hidden0)
|
|
unpacked, unpacked_len = rnn_utils.pad_packed_sequence(packed_out)
|
|
|
|
# Check forward
|
|
prec = dtype2prec_DONTUSE[dtype]
|
|
self.assertEqual(packed_hidden, seq_hidden, atol=prec, rtol=0)
|
|
self.assertEqual(unpacked, seq_out, atol=prec, rtol=0)
|
|
self.assertEqual(unpacked_len, lengths, atol=prec, rtol=0)
|
|
|
|
# Check backward
|
|
seq_out.sum().backward()
|
|
grad_x = x_leaf.grad.data.clone()
|
|
x_leaf.grad.data.zero_()
|
|
unpacked.sum().backward()
|
|
|
|
self.assertEqual(x_leaf.grad, grad_x, atol=dtype2prec_DONTUSE[dtype], rtol=0)
|
|
for p1, p2 in zip(lstm.parameters(), lstm2.parameters()):
|
|
prec = dtype2prec_DONTUSE[dtype]
|
|
if dtype == torch.float16:
|
|
prec = 4e-2
|
|
self.assertEqual(p1.grad, p2.grad, atol=prec, rtol=0)
|
|
|
|
tests = [
|
|
# enforce_sorted, lengths
|
|
[True, [5]],
|
|
[False, [5]],
|
|
[True, [10, 10, 6, 2, 2, 1, 1]],
|
|
[False, [10, 10, 6, 2, 2, 1, 1]],
|
|
[False, [2, 1, 3, 2, 10, 5, 3]],
|
|
]
|
|
|
|
for enforce_sorted, seq_lens, in tests:
|
|
for use_default_hiddens in (True, False):
|
|
for proj_size in [0, 2]:
|
|
check_lengths(seq_lens, enforce_sorted, use_default_hiddens, proj_size)
|
|
|
|
def _test_batchnorm_update_stats(self, device, dtype=torch.float):
|
|
module = nn.BatchNorm1d(3).to(device, dtype)
|
|
|
|
data = torch.rand(4, 3, device=device, dtype=dtype)
|
|
|
|
# training pass
|
|
old_running_mean = module.running_mean.clone()
|
|
old_running_var = module.running_var.clone()
|
|
old_num_batches_tracked = module.num_batches_tracked.clone()
|
|
module(data)
|
|
self.assertNotEqual(old_running_mean, module.running_mean)
|
|
self.assertNotEqual(old_running_var, module.running_var)
|
|
self.assertEqual(old_num_batches_tracked + 1, module.num_batches_tracked)
|
|
|
|
# eval pass
|
|
module.eval()
|
|
old_running_mean = module.running_mean.clone()
|
|
old_running_var = module.running_var.clone()
|
|
old_num_batches_tracked = module.num_batches_tracked.clone()
|
|
module(data)
|
|
self.assertEqual(old_running_mean, module.running_mean)
|
|
self.assertEqual(old_running_var, module.running_var)
|
|
self.assertEqual(old_num_batches_tracked, module.num_batches_tracked)
|
|
|
|
def test_batchnorm_update_stats(self, device):
|
|
self._test_batchnorm_update_stats(device)
|
|
|
|
if self.device_type == 'cuda' and self.has_cudnn():
|
|
with torch.backends.cudnn.flags(enabled=False):
|
|
self._test_batchnorm_update_stats(device)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.bfloat16, torch.float16)
|
|
def test_activations_bfloat16_half_cpu(self, device, dtype):
|
|
def test_helper(fn, device, inp_dims, prec=None):
|
|
torch.manual_seed(37)
|
|
# bfloat16/half compute
|
|
fn = fn.to(dtype=dtype)
|
|
input = torch.randn(inp_dims, dtype=dtype, device=device, requires_grad=True)
|
|
out = fn(input)
|
|
grad_input = torch.randn_like(out, dtype=dtype, device=device)
|
|
out.backward(grad_input)
|
|
|
|
# fp32 compute
|
|
input2 = input.detach().clone().float().requires_grad_(True)
|
|
out2 = fn.float()(input2)
|
|
grad_input2 = grad_input.detach().clone().float()
|
|
out2.backward(grad_input2)
|
|
|
|
self.assertEqual(out.dtype, dtype)
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
self.assertEqual(out, out2.to(dtype=dtype), atol=prec, rtol=prec)
|
|
self.assertEqual(input.grad.data, input2.grad.data.to(dtype=dtype), atol=prec, rtol=prec)
|
|
|
|
shapes = [[1, 3, 1, 6], [1, 3, 1, 128], [1, 3, 256, 256]]
|
|
for shape in shapes:
|
|
test_helper(torch.nn.LogSigmoid(), device, shape)
|
|
test_helper(torch.nn.Hardsigmoid(), device, shape)
|
|
test_helper(torch.nn.Hardshrink(), device, shape)
|
|
test_helper(torch.nn.Softshrink(), device, shape)
|
|
test_helper(torch.nn.Hardswish(), device, shape)
|
|
test_helper(torch.nn.Softplus(), device, shape)
|
|
test_helper(torch.nn.SiLU(), device, shape)
|
|
test_helper(torch.nn.Hardtanh(), device, shape)
|
|
test_helper(torch.nn.Mish(), device, shape)
|
|
test_helper(torch.nn.ELU(), device, shape)
|
|
test_helper(torch.nn.PReLU(), device, shape)
|
|
test_helper(torch.nn.GLU(), device, shape, prec=1e-2)
|
|
test_helper(torch.nn.Threshold(0.1, 20), device, shape)
|
|
test_helper(torch.nn.GELU(), device, shape)
|
|
test_helper(torch.nn.Hardtanh(), device, shape)
|
|
test_helper(torch.nn.LeakyReLU(), device, shape)
|
|
|
|
@onlyCUDA
|
|
def test_activations_bfloat16(self, device):
|
|
_test_bfloat16_ops(self, torch.nn.ReLU(), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.Threshold(0.1, 20), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.ELU(), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.Softplus(), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.Hardshrink(), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.Softshrink(), device, inp_dims=(5), prec=1e-2)
|
|
_test_bfloat16_ops(self, torch.nn.LeakyReLU(), device, inp_dims=(5), prec=1e-2)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_softmax_bfloat16(self, device):
|
|
for dim in [0, 1, 2, 3]:
|
|
_test_bfloat16_ops(self, torch.nn.Softmax(dim=dim), device, inp_dims=(16, 33, 15, 16), prec=1e-2)
|
|
# test softmax with large input value which casues exp() to overflow
|
|
_test_bfloat16_ops(self, torch.nn.Softmax(dim=dim), device, inp_dims=(16, 33, 15, 16), prec=0.05, scale_factor=1000.0)
|
|
|
|
def test_nll_loss_mismatched_batch(self, device):
|
|
x = torch.randn((10, 3), requires_grad=True, device=device)
|
|
# t should have size (10,)
|
|
t = torch.zeros((3,), dtype=torch.int64, device=device)
|
|
with self.assertRaisesRegex(ValueError, 'Expected.*batch_size'):
|
|
F.nll_loss(x, t)
|
|
|
|
def test_nll_loss_out_of_bounds_ignore_index(self, device):
|
|
x = torch.randn(6, 3, requires_grad=True, device=device)
|
|
t = torch.tensor([0, 1, 255, 0, 1, 2], dtype=torch.int64, device=device)
|
|
for reduction in ['mean', 'none']:
|
|
F.nll_loss(x, t, ignore_index=255, reduction=reduction).sum().backward()
|
|
|
|
def test_nll_loss_invalid_target_dim(self, device):
|
|
x = torch.randn((10, 3), device=device)
|
|
t = torch.zeros((10, 2), dtype=torch.int64, device=device)
|
|
with self.assertRaisesRegex(RuntimeError, "1D target tensor expected"):
|
|
F.nll_loss(x, t)
|
|
|
|
def test_nll_loss_invalid_weights(self, device):
|
|
x = torch.randn((10, 3), device=device)
|
|
t = torch.empty(10, dtype=torch.int64, device=device).random_(0, 3)
|
|
invalid_weights = [
|
|
torch.randn(4, device=device),
|
|
torch.randn(1, 3, device=device),
|
|
]
|
|
msg = "weight tensor should be defined either for all 3 classes or no classes"
|
|
for weight in invalid_weights:
|
|
with self.assertRaisesRegex(RuntimeError, msg):
|
|
F.nll_loss(x, t, weight=weight)
|
|
|
|
# Ref: https://github.com/pytorch/pytorch/issue/85005
|
|
@onlyCUDA
|
|
@largeTensorTest("120GB", "cpu")
|
|
@largeTensorTest("45GB", "cuda")
|
|
@parametrize_test("reduction", ("none", "mean", "sum"))
|
|
def test_nll_loss_large_tensor(self, device, reduction):
|
|
shape = [int(2 ** 16), int(2 ** 16) + 1]
|
|
|
|
input = torch.randn(shape, device=device, dtype=torch.float32, requires_grad=True)
|
|
labels = torch.randint(shape[0], (shape[0],), dtype=torch.long, device=device)
|
|
|
|
out = F.nll_loss(input, labels, reduction=reduction)
|
|
|
|
with torch.no_grad():
|
|
input_cpu = input.cpu().float().requires_grad_()
|
|
labels_cpu = labels.cpu()
|
|
out_cpu = F.nll_loss(input_cpu, labels_cpu, reduction=reduction)
|
|
# workaround to reduce memory usage vs. self.assertEqual, see #84944
|
|
rtol, atol = torch.testing._comparison.get_tolerances(torch.float32, rtol=None, atol=None)
|
|
if reduction == "sum":
|
|
orig_rtol, orig_atol = rtol, atol
|
|
rtol, atol = 7 * rtol, 3 * atol
|
|
with torch.no_grad():
|
|
self.assertTrue(torch.allclose(out.cpu(), out_cpu, rtol=rtol, atol=atol))
|
|
if reduction == "sum":
|
|
rtol, atol = orig_rtol, orig_atol
|
|
|
|
if reduction != "none":
|
|
out.backward()
|
|
out_cpu.backward()
|
|
with torch.no_grad():
|
|
self.assertTrue(torch.allclose(input.grad.cpu(), input_cpu.grad, rtol=rtol, atol=atol))
|
|
|
|
# Ref: https://github.com/pytorch/pytorch/issue/108345
|
|
@onlyCUDA
|
|
@largeTensorTest("20GB", "cpu")
|
|
@largeTensorTest("20GB", "cuda")
|
|
@parametrize_test("reduction", ("none", "mean", "sum"))
|
|
def test_cross_entropy_64bit(self, device, reduction):
|
|
labels = torch.zeros(190, 50, dtype=torch.long, device=device)
|
|
logits = torch.ones(190, 229000, 50, dtype=torch.float, device=device)
|
|
loss = torch.nn.functional.cross_entropy(logits, labels)
|
|
loss_cpu = torch.nn.functional.cross_entropy(logits.cpu(), labels.cpu())
|
|
print(logits.numel(), labels.numel(), loss.numel())
|
|
self.assertTrue(torch.allclose(loss_cpu, loss.cpu(), rtol=1e-4, atol=1e-4))
|
|
|
|
def _nll_loss_helper(self, input_size, reduction, expected, device, dtype):
|
|
input = torch.rand(input_size, requires_grad=True, device=device, dtype=dtype)
|
|
num_channels = input_size[1]
|
|
target_size = (input_size[0], ) + tuple(input_size[2:])
|
|
target = torch.randint(num_channels, target_size, device=device)
|
|
|
|
output = F.nll_loss(input, target, reduction=reduction)
|
|
self.assertEqual(output, expected, exact_dtype=False)
|
|
|
|
output.sum().backward()
|
|
self.assertEqual(input.grad.size(), input.size())
|
|
|
|
@dtypesIfMPS(torch.half, torch.float)
|
|
@dtypes(torch.float)
|
|
def test_nll_loss_empty_tensor_reduction_none(self, device, dtype):
|
|
self._nll_loss_helper([0, 3], "none", torch.empty([0], device=device), device, dtype)
|
|
self._nll_loss_helper([0, 3, 5, 7], "none", torch.empty([0, 5, 7], device=device), device, dtype)
|
|
self._nll_loss_helper([2, 3, 0, 7], "none", torch.empty([2, 0, 7], device=device), device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 0], "none", torch.empty([2, 5, 0], device=device), device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "none", torch.empty([2, 5, 7, 0], device=device), device, dtype)
|
|
|
|
@dtypesIfMPS(torch.half, torch.float)
|
|
@dtypes(torch.float)
|
|
def test_nll_loss_empty_tensor_reduction_mean(self, device, dtype):
|
|
nan = torch.tensor(float('nan'), device=device)
|
|
self._nll_loss_helper([0, 3], "mean", nan, device, dtype)
|
|
self._nll_loss_helper([0, 3, 5, 7], "mean", nan, device, dtype)
|
|
self._nll_loss_helper([2, 3, 0, 7], "mean", nan, device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 0], "mean", nan, device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "mean", nan, device, dtype)
|
|
|
|
@dtypesIfMPS(torch.half, torch.float)
|
|
@dtypes(torch.float)
|
|
def test_nll_loss_empty_tensor_reduction_sum(self, device, dtype):
|
|
zero = torch.tensor(0, device=device)
|
|
self._nll_loss_helper([0, 3], "sum", zero, device, dtype)
|
|
self._nll_loss_helper([0, 3, 5, 7], "sum", zero, device, dtype)
|
|
self._nll_loss_helper([2, 3, 0, 7], "sum", zero, device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 0], "sum", zero, device, dtype)
|
|
self._nll_loss_helper([2, 3, 5, 7, 0], "sum", zero, device, dtype)
|
|
|
|
def test_nll_loss_total_weight_is_zero(self, device):
|
|
|
|
def helper(input_size):
|
|
input = torch.ones(input_size, requires_grad=True, device=device)
|
|
num_channels = input_size[1]
|
|
target_size = (input_size[0], ) + tuple(input_size[2:])
|
|
target = torch.zeros(target_size, dtype=torch.long, device=device)
|
|
weight = torch.zeros([num_channels], device=device)
|
|
self.assertEqual(F.nll_loss(input, target, weight, reduction="sum").item(), 0.)
|
|
self.assertEqual(F.nll_loss(input, target, weight, reduction="mean").item(), float("nan"))
|
|
self.assertEqual(F.nll_loss(input, target, weight, reduction="none"), torch.zeros(target.shape, device=device))
|
|
|
|
helper([2, 3])
|
|
helper([2, 3, 5, 7])
|
|
helper([2, 3, 5, 7, 9])
|
|
|
|
def test_nll_loss_all_ignored(self, device):
|
|
|
|
def helper(input_size):
|
|
input = torch.ones(input_size, device=device)
|
|
num_channels = input_size[1]
|
|
target_size = (input_size[0], ) + tuple(input_size[2:])
|
|
target = torch.zeros(target_size, dtype=torch.long, device=device)
|
|
self.assertEqual(F.nll_loss(input, target, ignore_index=0, reduction="sum").item(), 0)
|
|
self.assertEqual(F.nll_loss(input, target, ignore_index=0, reduction="mean").item(), float("nan"))
|
|
self.assertEqual(F.nll_loss(input, target, ignore_index=0, reduction="none"), torch.zeros(target.shape, device=device))
|
|
|
|
helper([2, 3])
|
|
helper([2, 3, 5, 7])
|
|
helper([2, 3, 5, 7, 9])
|
|
|
|
def test_nll_loss_byte_target_matches_long(self, device):
|
|
N, C = 10, 4
|
|
input = torch.randn(N, C, device=device, requires_grad=True)
|
|
target = torch.empty(N, dtype=torch.long, device=device).random_(0, C)
|
|
|
|
def compute_result_and_gradient(reduction, target_dtype):
|
|
input_ = input.detach()
|
|
input_.requires_grad_()
|
|
|
|
prob = F.log_softmax(input_, dim=-1)
|
|
loss = nn.NLLLoss(reduction=reduction)
|
|
result = loss(prob, target.to(target_dtype))
|
|
result.sum().backward()
|
|
|
|
return result, input_.grad
|
|
|
|
for reduction in ["none", "mean", "sum"]:
|
|
result_long, grad_long = compute_result_and_gradient(reduction, torch.long)
|
|
result_byte, grad_byte = compute_result_and_gradient(reduction, torch.uint8)
|
|
self.assertEqual(result_long, result_byte)
|
|
self.assertEqual(grad_long, grad_byte)
|
|
|
|
@onlyCUDA
|
|
@skipIfRocm
|
|
@dtypes(torch.float16, torch.float32)
|
|
def test_cross_entropy_loss_2d_out_of_bounds_class_index(self, device, dtype):
|
|
# Test for issue #117532
|
|
# Run in a different process to prevent the device-side assert from affecting other tests
|
|
stderr = TestCase.runWithPytorchAPIUsageStderr(f"""\
|
|
#!/usr/bin/env python3
|
|
|
|
import torch
|
|
import torch.nn.functional as F
|
|
from torch.testing._internal.common_utils import (run_tests, TestCase)
|
|
|
|
class TestThatContainsCUDAAssert(TestCase):
|
|
def test_cross_entropy_loss_2d_out_of_bounds_class_index(self):
|
|
device = '{str(device)}'
|
|
dtype = {str(dtype).strip("'")}
|
|
ignore_index = 255
|
|
b = 10
|
|
n_classes = 3
|
|
w = 768
|
|
h = 1024
|
|
pred = torch.randn(b, n_classes, w, h, dtype=dtype, device=device)
|
|
labels = torch.zeros(b, w, h, dtype=torch.int64, device=device)
|
|
labels[5, 200, 200] = ignore_index
|
|
# Set invalid class index
|
|
labels[5, 200, 200] = 254
|
|
|
|
x = F.cross_entropy(
|
|
pred, labels, reduction="none", ignore_index=ignore_index
|
|
)
|
|
torch.cuda.synchronize()
|
|
|
|
|
|
if __name__ == '__main__':
|
|
run_tests()
|
|
""")
|
|
self.assertIn('CUDA error: device-side assert triggered', stderr)
|
|
|
|
|
|
|
|
def test_cross_entropy_loss_prob_target_all_reductions(self, device):
|
|
# Test with k-dimensional loss.
|
|
for k in range(5):
|
|
N, C = 5, 4
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
weight = torch.randn(C, device=device).abs()
|
|
|
|
for reduction, w in product(['none', 'mean', 'sum'], [None, weight]):
|
|
m = torch.nn.CrossEntropyLoss(weight=w, reduction=reduction)
|
|
output = m(input, target)
|
|
output_ref = loss_reference_fns['CrossEntropyLoss'](
|
|
input, target, reduction=reduction, weight=w)
|
|
self.assertEqual(output, output_ref)
|
|
|
|
def test_cross_entropy_loss_prob_target_unit_weights(self, device):
|
|
# Test with k-dimensional loss.
|
|
for k in range(5):
|
|
N, C = 5, 4
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
# Ensure result with unit weights is equivalent to result without weights.
|
|
m = torch.nn.CrossEntropyLoss(reduction=reduction)
|
|
unit_weight = torch.ones(C, device=device, dtype=target.dtype)
|
|
m_unit = torch.nn.CrossEntropyLoss(weight=unit_weight, reduction=reduction)
|
|
output = m(input, target)
|
|
output_unit = m_unit(input, target)
|
|
self.assertEqual(output, output_unit)
|
|
|
|
@parametrize_test('reduction', ['none', 'mean', 'sum'])
|
|
@parametrize_test('weighted', [False, True])
|
|
def test_cross_entropy_loss_prob_target_no_batch_dim(self, device, reduction, weighted):
|
|
C = 5
|
|
input = torch.randn(C, device=device).log_softmax(dim=-1)
|
|
target = torch.randn(C, device=device).softmax(dim=-1)
|
|
weight = torch.randn(C, device=device) if weighted else None
|
|
m = nn.CrossEntropyLoss(reduction=reduction, weight=weight)
|
|
loss_no_batch = m(input, target)
|
|
loss_batch = m(input.unsqueeze(0), target.unsqueeze(0))
|
|
if reduction == 'none':
|
|
loss_batch = loss_batch.squeeze(0)
|
|
self.assertEqual(loss_no_batch, loss_batch)
|
|
|
|
def test_cross_entropy_loss_index_target_unit_weights(self, device):
|
|
# Test with k-dimensional loss.
|
|
for k in range(5):
|
|
N, C = 5, 4
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = torch.empty(N, *other_dims, dtype=torch.long, device=device).random_(0, C)
|
|
|
|
for reduction in ['none', 'mean', 'sum']:
|
|
# Ensure result with unit weights is equivalent to result without weights.
|
|
m = torch.nn.CrossEntropyLoss(reduction=reduction)
|
|
unit_weight = torch.ones(C, device=device, dtype=input.dtype)
|
|
m_unit = torch.nn.CrossEntropyLoss(weight=unit_weight, reduction=reduction)
|
|
output = m(input, target)
|
|
output_unit = m_unit(input, target)
|
|
self.assertEqual(output, output_unit)
|
|
|
|
def test_cross_entropy_loss_one_hot_target(self, device):
|
|
# Test with k-dimensional loss.
|
|
for k in range(5):
|
|
N, C = 5, 4
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = torch.empty(N, *other_dims, dtype=torch.long, device=device).random_(0, C)
|
|
weight = torch.randn(C, device=device).abs()
|
|
|
|
# Get one-hot representation of the target.
|
|
target_one_hot = F.one_hot(target, num_classes=C).to(input.dtype)
|
|
# Need to put the C dim at index 1.
|
|
target_one_hot = target_one_hot.permute(0, -1, *range(1, target_one_hot.dim() - 1))
|
|
|
|
for reduction, w in product(['none', 'mean', 'sum'], [None, weight]):
|
|
# Skip this case for now because soft and hard label CE are not consistent
|
|
# in the way they apply class weights (see issue #61309).
|
|
if reduction == 'mean' and weight is not None:
|
|
continue
|
|
|
|
# Ensure loss computed with class indices matches loss
|
|
# computed with one-hot class probs.
|
|
m = torch.nn.CrossEntropyLoss(weight=w, reduction=reduction)
|
|
output = m(input, target)
|
|
output_one_hot = m(input, target_one_hot)
|
|
self.assertEqual(output, output_one_hot)
|
|
|
|
def test_cross_entropy_label_smoothing_errors(self, device):
|
|
N, C = 3, 4
|
|
input_args = [
|
|
(torch.randn((N, C), device=device), torch.arange(0, C, device=device)),
|
|
(torch.randn((N, C), device=device), torch.randn(N, C, device=device))
|
|
]
|
|
for input_arg in input_args:
|
|
loss = nn.CrossEntropyLoss(label_smoothing=1.2)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r"label_smoothing must be between 0\.0"):
|
|
loss(*input_arg)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
@set_default_dtype(torch.double)
|
|
def test_cross_entropy_label_smoothing_consistent_index_target_and_probs(self, device):
|
|
N, C = 10, 4
|
|
ks = range(5)
|
|
reductions = ['none', 'mean', 'sum']
|
|
label_smoothings = [0.05, 0.15]
|
|
|
|
for k, reduction, label_smoothing in product(ks, reductions, label_smoothings):
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = torch.empty(N, *other_dims, dtype=torch.long, device=device).random_(0, C)
|
|
|
|
# construct target probablity that should have the same result as label_smoothing
|
|
target_proba = F.one_hot(target, num_classes=C)
|
|
# Need to put the C dim at index 1.
|
|
target_proba = target_proba.permute(0, -1, *range(1, target_proba.dim() - 1))
|
|
target_mask = (target_proba == 1)
|
|
target_proba = target_proba.to(dtype=input.dtype)
|
|
|
|
# y_k^ls = y_k * (1 - label_smoothing) + label_smoothing / n_classes
|
|
# Get one-hot representation of the target.
|
|
target_proba.masked_fill_(target_mask, 1 - label_smoothing + label_smoothing / C)
|
|
target_proba.masked_fill_(~target_mask, label_smoothing / C)
|
|
|
|
loss = nn.CrossEntropyLoss(reduction=reduction)
|
|
output_with_prob = loss(input, target_proba)
|
|
|
|
loss = nn.CrossEntropyLoss(
|
|
reduction=reduction, label_smoothing=label_smoothing)
|
|
output_with_index = loss(input, target)
|
|
|
|
self.assertEqual(output_with_prob, output_with_index,
|
|
rtol=1e-07, atol=1e-05)
|
|
|
|
def test_cross_entropy_label_smoothing_with_probs(self, device):
|
|
N, C = 10, 4
|
|
ks = range(5)
|
|
reductions = ['none', 'mean', 'sum']
|
|
label_smoothings = [0.05, 0.15]
|
|
|
|
# Test with k-dimensional loss.
|
|
for k, label_smoothing in product(ks, label_smoothings):
|
|
other_dims = [torch.randint(2, 5, size=(1,)).item() for _ in range(k)]
|
|
input = torch.randn(N, C, *other_dims, device=device, requires_grad=True)
|
|
target = F.log_softmax(torch.randn(N, C, *other_dims, device=device), dim=1)
|
|
|
|
for reduction in reductions:
|
|
# use with label_smoothing
|
|
loss = nn.CrossEntropyLoss(reduction=reduction, label_smoothing=label_smoothing)
|
|
output_with_smoothing = loss(input, target)
|
|
|
|
# manually smoothing target
|
|
# class_proba^ls = class_proba * (1 - label_smoothing) +
|
|
# label_smoothing / n_classes
|
|
target_with_smoothing = target * (1 - label_smoothing) + label_smoothing / C
|
|
loss = nn.CrossEntropyLoss(reduction=reduction)
|
|
output_with_manual_smoothing = loss(input, target_with_smoothing)
|
|
|
|
self.assertEqual(output_with_smoothing, output_with_manual_smoothing)
|
|
|
|
|
|
def test_cross_entropy_label_smoothing_weight_ignore_indices(self, device):
|
|
reductions = ['none', 'sum', 'mean']
|
|
label_smoothings = [0.05, 0.15]
|
|
|
|
wgt = torch.tensor([0.3, 0.6], device=device)
|
|
inp1 = torch.tensor([[0.3, 0.4], [1, 2]], device=device)
|
|
inp2 = torch.tensor([[0.3, 0.6], [1, 2]], device=device)
|
|
|
|
targ_default_ignore_index = torch.tensor([-100, 1], device=device)
|
|
targ_negative_ignore_index = torch.tensor([-2, 1], device=device)
|
|
targ_positive_ignore_index = torch.tensor([2, 1], device=device)
|
|
|
|
for reduction, label_smoothing, weight in product(reductions, label_smoothings, (None, wgt)):
|
|
def check_equal(loss, inp_targ_1, inp_targ_2):
|
|
inp1, targ1 = inp_targ_1
|
|
inp2, targ2 = inp_targ_2
|
|
l1 = loss(inp1, targ1)
|
|
l2 = loss(inp2, targ2)
|
|
self.assertEqual(l1, l2)
|
|
|
|
# Default ignore_index
|
|
loss = nn.CrossEntropyLoss(reduction=reduction,
|
|
label_smoothing=label_smoothing,
|
|
weight=weight)
|
|
check_equal(loss, (inp1, targ_default_ignore_index), (inp2, targ_default_ignore_index))
|
|
if reduction != 'none':
|
|
# Check that we correctly tally the denominator for `mean`
|
|
# i.e. we don't count the ignored_idx at all.
|
|
check_equal(loss, (inp1, targ_default_ignore_index), (inp2[1:], targ_default_ignore_index[1:]))
|
|
|
|
# negative ignore_index
|
|
loss = nn.CrossEntropyLoss(reduction=reduction,
|
|
label_smoothing=label_smoothing,
|
|
ignore_index=-2,
|
|
weight=weight)
|
|
check_equal(loss, (inp1, targ_negative_ignore_index), (inp2, targ_negative_ignore_index))
|
|
if reduction != 'none':
|
|
# Check that we correctly tally the denominator for `mean`
|
|
# i.e. we don't count the ignored_idx at all.
|
|
check_equal(loss, (inp1, targ_negative_ignore_index), (inp2[1:], targ_negative_ignore_index[1:]))
|
|
|
|
# positive ignore_index
|
|
loss = nn.CrossEntropyLoss(reduction=reduction,
|
|
label_smoothing=label_smoothing,
|
|
ignore_index=2,
|
|
weight=weight)
|
|
check_equal(loss, (inp1, targ_positive_ignore_index), (inp2, targ_positive_ignore_index))
|
|
if reduction != 'none':
|
|
# Check that we correctly tally the denominator for `mean`
|
|
# i.e. we don't count the ignored_idx at all.
|
|
check_equal(loss, (inp1, targ_positive_ignore_index), (inp2[1:], targ_positive_ignore_index[1:]))
|
|
|
|
# Ref: https://github.com/pytorch/pytorch/issues/85005
|
|
@onlyCUDA
|
|
@largeTensorTest("45GB", "cpu")
|
|
@largeTensorTest("70GB", "cuda")
|
|
@parametrize_test("reduction", ("none", "mean", "sum"))
|
|
def test_cross_entropy_large_tensor(self, device, reduction):
|
|
logits = torch.randn(int(2 ** 16), int(2 ** 16) + 1, dtype=torch.float32, device='cuda', requires_grad=True)
|
|
labels = torch.zeros(logits.size(0), dtype=torch.long, device='cuda')
|
|
loss = F.cross_entropy(logits, labels, reduction=reduction)
|
|
if reduction != "none":
|
|
loss.backward()
|
|
|
|
with torch.no_grad():
|
|
logits_cpu = logits.cpu().detach().requires_grad_()
|
|
labels_cpu = labels.cpu().detach()
|
|
loss_cpu = F.cross_entropy(logits_cpu, labels_cpu, reduction=reduction)
|
|
if reduction != "none":
|
|
loss_cpu.backward()
|
|
|
|
# workaround to reduce memory usage vs. self.assertEqual, see #84944
|
|
rtol, atol = torch.testing._comparison.get_tolerances(torch.float32, rtol=None, atol=None)
|
|
self.assertTrue(torch.allclose(loss.cpu(), loss_cpu, rtol=rtol, atol=atol))
|
|
if reduction != "none":
|
|
self.assertTrue(torch.allclose(logits.grad.cpu(), logits_cpu.grad, rtol=rtol, atol=atol))
|
|
|
|
def test_smoothl1loss_backward_zero_beta(self, device):
|
|
input = torch.randn(300, 256, requires_grad=True, device=device)
|
|
target = input.detach()
|
|
|
|
loss = F.smooth_l1_loss(input, target, beta=0.0, reduction='sum')
|
|
loss.backward()
|
|
|
|
grad_max_abs = input.grad.abs().max().item()
|
|
self.assertLessEqual(grad_max_abs, 1.0)
|
|
|
|
def test_softshrink_negative(self, device):
|
|
input = torch.randn(5, device=device, requires_grad=True)
|
|
m = torch.nn.Softshrink(-1)
|
|
with self.assertRaisesRegex(RuntimeError,
|
|
r'lambda must be greater or equal to 0, but found to be -1\.'):
|
|
m(input)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
def test_fold(self, device):
|
|
def test_dtype(fn, input, dtype):
|
|
input = input.detach().clone().to(dtype=dtype).requires_grad_(True)
|
|
input2 = input.detach().clone().float().requires_grad_(True)
|
|
out = fn(input)
|
|
out.sum().backward()
|
|
out2 = fn(input2)
|
|
out2.sum().backward()
|
|
self.assertEqual(out.dtype, dtype)
|
|
self.assertEqual(input.grad.dtype, dtype)
|
|
self.assertEqual(out, out2.to(dtype=dtype), atol=0.05, rtol=0)
|
|
self.assertEqual(input.grad, input2.grad.to(dtype=dtype))
|
|
|
|
def func(x):
|
|
return F.fold(x, output_size=(4, 5), kernel_size=(2, 2))
|
|
|
|
seeds = (44, 83, 71, 25, 999)
|
|
for sd in seeds:
|
|
torch.manual_seed(sd)
|
|
x = torch.randn(1, 12, 12, device=device, requires_grad=True, dtype=torch.double)
|
|
gradcheck(func, [x], check_forward_ad=True)
|
|
gradgradcheck(func, [x], check_fwd_over_rev=True)
|
|
if device == 'cpu':
|
|
test_dtype(func, x, torch.bfloat16)
|
|
|
|
|
|
def test_logsigmoid_out(self, device):
|
|
# this isn't actually documented, but was broken previously:
|
|
# https://github.com/pytorch/pytorch/issues/36499
|
|
x = torch.randn(2, 3, device=device).t()
|
|
empty_out = torch.randn(0, device=device)
|
|
self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=empty_out))
|
|
|
|
noncontig_out = torch.randn(2, 3, device=device).t()
|
|
self.assertEqual(F.logsigmoid(x), F.logsigmoid(x, out=noncontig_out))
|
|
|
|
# Check that clip_grad_norm_ raises an error if the total norm of the
|
|
# parameters' gradients is non-finite
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
def test_clip_grad_norm_error_if_nonfinite(self, device):
|
|
norms_pos = [0.1, 1, 2, 3.5, inf]
|
|
norms_neg = [-0.1, -1, -2, -3.5]
|
|
norms_except_0 = norms_pos + norms_neg
|
|
norms_all = norms_except_0 + [0]
|
|
|
|
# Each entry in test_cases has the following values, in this order:
|
|
#
|
|
# grad_only_one_elem If True, only one element of the parameter's
|
|
# gradient is set to the scalar grad, and the
|
|
# rest of the elements are 0. If False, all grad
|
|
# elements are equal to the scalar.
|
|
#
|
|
# prefix_finite_grad_param If True, prefix a parameter that has a grad
|
|
# of 1.
|
|
#
|
|
# scalars Scalars to use as the parameter's grad, through
|
|
# multiplication
|
|
#
|
|
# norms_nonfinite Norm types that should produce nonfinite total norm
|
|
#
|
|
# norms_finite Norm types that should produce finite total norm
|
|
test_cases = [
|
|
# Test errors from an infinite grad
|
|
(False, False, [inf, -inf], norms_except_0, [0]),
|
|
(False, True, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
(True, False, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
(True, True, [inf, -inf], norms_pos, norms_neg + [0]),
|
|
|
|
# Test errors from a NaN grad
|
|
(False, False, [nan], norms_except_0, [0]),
|
|
(False, True, [nan], norms_except_0, [0]),
|
|
(True, False, [nan], norms_except_0, [0]),
|
|
(True, True, [nan], norms_except_0, [0]),
|
|
|
|
# Test a grad that should never error
|
|
(False, False, [2e22, -2e22], [], norms_all),
|
|
(False, True, [2e22, -2e22], [], norms_all),
|
|
(True, False, [2e22, -2e22], [], norms_all),
|
|
(True, True, [2e22, -2e22], [], norms_all),
|
|
|
|
# Test a grad that will overflow to inf for only some norm orders
|
|
(False, False, [2e200, -2e200], [3.5, 2, -2, -3.5], [inf, 1, 0.1, 0, -1, -0.1]),
|
|
(False, True, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
(True, False, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
(True, True, [2e200, -2e200], [3.5, 2], norms_neg + [inf, 1, 0.1, 0]),
|
|
]
|
|
|
|
def gen_parameters(scalar, grad_only_one_elem, prefix_finite_grad_param):
|
|
param = torch.ones(10, dtype=torch.float64, device=device, requires_grad=True)
|
|
|
|
if grad_only_one_elem:
|
|
param[1].mul(scalar).sum().backward()
|
|
else:
|
|
param.mul(scalar).sum().backward()
|
|
|
|
if prefix_finite_grad_param:
|
|
prefix_param = torch.ones(1, dtype=torch.float64, device=device, requires_grad=True)
|
|
prefix_param.mul(1).sum().backward()
|
|
parameters = [prefix_param, param]
|
|
else:
|
|
parameters = [param]
|
|
|
|
return parameters
|
|
|
|
def run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, is_norm_nonfinite):
|
|
msg = (
|
|
f'norm_type: {norm_type}, ',
|
|
f'error_if_nonfinite: {error_if_nonfinite}, '
|
|
f'scalar: {scalar}, '
|
|
f'grad_only_one_elem: {grad_only_one_elem}, '
|
|
f'prefix_finite_grad_param: {prefix_finite_grad_param}, '
|
|
f'is_norm_nonfinite: {is_norm_nonfinite}')
|
|
|
|
parameters = gen_parameters(scalar, grad_only_one_elem, prefix_finite_grad_param)
|
|
|
|
# Should only throw an error if the total norm is expected to be
|
|
# nonfinite and `error_if_nonfinite=True`
|
|
if is_norm_nonfinite and error_if_nonfinite:
|
|
error_msg = f'The total norm of order {float(norm_type)} for gradients'
|
|
|
|
grads_before = [p.grad.clone() for p in parameters]
|
|
|
|
with self.assertRaisesRegex(RuntimeError, error_msg, msg=msg):
|
|
clip_grad_norm_(parameters, 1, norm_type=norm_type, error_if_nonfinite=True)
|
|
|
|
# Grad should not change if error is thrown
|
|
grads_after = [p.grad for p in parameters]
|
|
self.assertEqual(grads_before, grads_after, msg=msg)
|
|
else:
|
|
clip_grad_norm_(parameters, 1, norm_type=norm_type, error_if_nonfinite=error_if_nonfinite)
|
|
|
|
for grad_only_one_elem, prefix_finite_grad_param, scalars, norms_nonfinite, norms_finite in test_cases:
|
|
for error_if_nonfinite in [False, True]:
|
|
for norm_type, scalar in product(norms_nonfinite, scalars):
|
|
run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, True)
|
|
|
|
for norm_type, scalar in product(norms_finite, scalars):
|
|
run_test_case(norm_type, error_if_nonfinite, scalar, grad_only_one_elem, prefix_finite_grad_param, False)
|
|
|
|
@onlyCUDA
|
|
@deviceCountAtLeast(2)
|
|
@parametrize_test('foreach', (False, True))
|
|
def test_clip_grad_norm_multi_device(self, devices, foreach):
|
|
class TestModel(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.layer1 = nn.Linear(10, 10)
|
|
self.layer2 = nn.Linear(10, 10)
|
|
|
|
test_model = TestModel()
|
|
test_model.layer1.to(devices[0])
|
|
test_model.layer2.to(devices[1])
|
|
ref_model = TestModel().to(devices[0])
|
|
for norm_type in [2., math.inf]:
|
|
for p in test_model.parameters():
|
|
p.grad = torch.ones_like(p)
|
|
for p in ref_model.parameters():
|
|
p.grad = torch.ones_like(p)
|
|
norm = clip_grad_norm_(test_model.parameters(), 0.5, norm_type=norm_type, foreach=foreach)
|
|
expected = clip_grad_norm_(ref_model.parameters(), 0.5, norm_type=norm_type, foreach=foreach)
|
|
self.assertEqual(norm, expected)
|
|
for p, pe in zip(test_model.parameters(), ref_model.parameters()):
|
|
self.assertEqual(p.grad.to(devices[0]), pe.grad)
|
|
|
|
def test_elu_inplace_overlap(self, device):
|
|
dtype = torch.bfloat16 if device != 'mps:0' else torch.float16
|
|
x = torch.randn((1, 6), dtype=dtype, device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.elu(x, inplace=True)
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.elu_(x)
|
|
|
|
# Merge into OpInfo?
|
|
@onlyNativeDeviceTypes
|
|
def test_elu_inplace_with_neg_alpha(self, device):
|
|
a = torch.tensor([-1., 1.], device=device, requires_grad=True)
|
|
b = torch.nn.functional.elu_(a.clone(), alpha=-2)
|
|
with self.assertRaisesRegex(RuntimeError, "call out-of-place version"):
|
|
b.backward(torch.ones(2, device=device))
|
|
|
|
a = torch.tensor([-1., 1.], device=device, requires_grad=True)
|
|
b = torch.nn.functional.celu_(a.clone(), alpha=-2)
|
|
with self.assertRaisesRegex(RuntimeError, "call out-of-place version"):
|
|
b.backward(torch.ones(2, device=device))
|
|
|
|
@expectedFailureMeta # https://github.com/pytorch/pytorch/issues/54897
|
|
def test_hardswish_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.hardswish(x, inplace=True)
|
|
|
|
def test_silu_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.silu(x, inplace=True)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_mish_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.mish(x, inplace=True)
|
|
|
|
def test_softplus_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.softplus(x, out=x)
|
|
|
|
@expectedFailureMPS # TypeError: the MPS framework doesn't support float64
|
|
def test_softplus_low_threshold(self, device):
|
|
# Ensure gradients are computed correctly with a low threshold.
|
|
model = torch.nn.Softplus(threshold=1).double()
|
|
input = torch.tensor(0.9, device=device, dtype=torch.double,
|
|
requires_grad=True)
|
|
output = model(input)
|
|
torch.autograd.gradcheck(model, input)
|
|
|
|
def test_softshrink_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.softshrink(x, out=x)
|
|
|
|
def test_leaky_relu_inplace_overlap(self, device):
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.leaky_relu(x, inplace=True)
|
|
with self.assertRaisesRegex(RuntimeError, 'unsupported operation'):
|
|
F.leaky_relu_(x)
|
|
|
|
# Merge into OpInfo?
|
|
@expectedFailureMPS # NotImplementedError: aten::rrelu_with_noise_ https://github.com/pytorch/pytorch/issues/77764
|
|
def test_leaky_relu_inplace_with_neg_slope(self, device):
|
|
a = torch.tensor([-1., 1.], device=device, requires_grad=True)
|
|
b = torch.nn.functional.leaky_relu_(a.clone(), -2)
|
|
with self.assertRaisesRegex(RuntimeError, "call out-of-place version"):
|
|
b.backward(torch.ones(2, device=device))
|
|
|
|
a = torch.tensor([-1., 1.], device=device, requires_grad=True)
|
|
b = torch.nn.functional.rrelu_(a.clone(), -5.0, 1.0)
|
|
with self.assertRaisesRegex(RuntimeError, "call out-of-place version"):
|
|
b.backward(torch.ones(2, device=device))
|
|
|
|
# Merge into OpInfo?
|
|
def test_leaky_relu_inplace_with_zero_slope(self, device):
|
|
a = torch.tensor([-2., 0., 2.], device=device, requires_grad=True)
|
|
b = torch.nn.functional.leaky_relu_(a.clone(), 0.0)
|
|
b.backward(torch.ones(3, device=device))
|
|
expected = torch.tensor([0., 0., 1.], device=device)
|
|
self.assertEqual(a.grad, expected)
|
|
|
|
dtype = torch.bfloat16 if device != 'mps:0' else torch.float16
|
|
a_bf16 = torch.tensor([-2., 0., 2.], device=device, dtype=dtype, requires_grad=True)
|
|
b_bf16 = torch.nn.functional.leaky_relu_(a_bf16.clone(), 0.0)
|
|
b_bf16.backward(torch.ones(3, device=device))
|
|
expected_bf16 = torch.tensor([0., 0., 1.], device=device, dtype=dtype)
|
|
self.assertEqual(a_bf16.grad, expected_bf16)
|
|
|
|
@onlyCPU
|
|
def test_softshrink(self, device):
|
|
x = torch.tensor([[1.21, 0.56, 0.5001, 0.4999, 1.2357, -0.4999, -0.5001, -1.154,
|
|
0.254, -0.24, -0.225, 0.104, 0.002, -0.001, 0.0574, 1.2344,
|
|
0.1748, -0.1797, -0.8125, 0.2051, -1.1328, 1.2344, -0.1562, 2.3554,
|
|
-0.1953, 0.0304, -0.3613, -1.3047, 1.0312, 0.1436, -0.6953, 0.5664,
|
|
-0.5820, -0.3301, 0.8203, 0.6133, 0.5938],
|
|
[-0.8203, -1.2344, -0.5234, 2.5312, -0.4551, -0.6875, -1.5547, -0.2217,
|
|
-0.3027, 2.6406, 1.3047, 0.2344, -1.6719, 0.2773, -1.3516, 3.4575,
|
|
0.4414, 0.2656, 2.1094, -1.5156, 1.2344, -0.4336, 0.6797, -3.5486,
|
|
0.9766, -0.4062, 1.4844, 0.7500, -1.7578, 0.7461, 1.6094, 8.5458,
|
|
0.3730, -0.3477, -1.0625, 0.3848, 0.0557]], device=device)
|
|
expected = torch.tensor([[0.71, 0.06, 0.0001, 0., 0.7357, 0., -0.0001, -0.654,
|
|
0., 0., 0., 0., 0., 0., 0., 0.7344,
|
|
0., 0., -0.3125, 0., -0.6328, 0.7344, 0., 1.8554,
|
|
0., 0., 0., -0.8047, 0.5312, 0., -0.1953, 0.0664,
|
|
-0.0820, 0.0, 0.3203, 0.1133, 0.0938],
|
|
[-0.3203, -0.7344, -0.0234, 2.0312, 0.0, -0.1875, -1.0547, 0.,
|
|
0.0, 2.1406, 0.8047, 0., -1.1719, 0., -0.8516, 2.9575,
|
|
0., 0., 1.6094, -1.0156, 0.7344, 0., 0.1797, -3.0486,
|
|
0.4766, 0., 0.9844, 0.2500, -1.2578, 0.2461, 1.1094, 8.0458,
|
|
0., 0., -0.5625, 0., 0.]])
|
|
softshrink = torch.nn.Softshrink()
|
|
out = softshrink(x)
|
|
self.assertEqual(out, expected, atol=1e-2, rtol=0)
|
|
|
|
def test_threshold_inplace_overlap(self, device):
|
|
# Inplace threshold is okay, because it is idempotent
|
|
x = torch.randn((1, 6), device=device).expand((6, 6))
|
|
F.threshold(x, 0.5, 0.5, inplace=True)
|
|
F.threshold_(x, 0.5, 0.5)
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_triplet_margin_with_distance_loss_default_parity(self, device):
|
|
# Test for `nn.TripletMarginWithDistanceLoss` and
|
|
# `F.triplet_margin_with_distance_loss`. Checks
|
|
# for parity against the respective non-distance-agnostic
|
|
# implementations of triplet margin loss (``nn.TripletMarginLoss`
|
|
# and `F.triplet_margin_loss`) under *default args*.
|
|
|
|
for extra_args in \
|
|
itertools.product((0.5, 1, 1.5), (True, False), ('none', 'mean', 'sum')):
|
|
kwargs = {'margin': extra_args[0], 'swap': extra_args[1], 'reduction': extra_args[2]}
|
|
|
|
anchor = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
positive = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
negative = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
|
|
# Test forward, functional
|
|
expected = F.triplet_margin_loss(anchor, positive, negative, **kwargs)
|
|
actual = F.triplet_margin_with_distance_loss(anchor, positive, negative, **kwargs)
|
|
self.assertEqual(actual, expected, rtol=1e-6, atol=1e-6)
|
|
|
|
# Test forward, module
|
|
loss_ref = nn.TripletMarginLoss(**kwargs)
|
|
loss_op = nn.TripletMarginWithDistanceLoss(**kwargs)
|
|
self.assertEqual(loss_op(anchor, positive, negative),
|
|
loss_ref(anchor, positive, negative),
|
|
rtol=1e-6, atol=1e-6)
|
|
|
|
# Test backward
|
|
self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss(
|
|
a, p, n, **kwargs), (anchor, positive, negative)))
|
|
self.assertTrue(gradcheck(lambda a, p, n: loss_op(a, p, n),
|
|
(anchor, positive, negative)))
|
|
|
|
@onlyNativeDeviceTypes
|
|
def test_triplet_margin_with_distance_loss(self, device):
|
|
# Test for parity between `nn.TripletMarginWithDistanceLoss` and
|
|
# `F.triplet_margin_with_distance_loss`.
|
|
|
|
pairwise_distance = nn.PairwiseDistance()
|
|
|
|
def cosine_distance(x, y):
|
|
return 1.0 - F.cosine_similarity(x, y)
|
|
|
|
distance_functions = (pairwise_distance, cosine_distance,
|
|
lambda x, y: 1.0 - F.cosine_similarity(x, y))
|
|
|
|
reductions = ('mean', 'none', 'sum')
|
|
margins = (1.0, 1.5, 0.5)
|
|
swaps = (True, False)
|
|
|
|
for distance_fn, reduction, margin, swap \
|
|
in itertools.product(distance_functions, reductions, margins, swaps):
|
|
anchor = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
positive = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
negative = torch.randn(5, 10, device=device, requires_grad=True, dtype=torch.double)
|
|
|
|
# Test backward
|
|
self.assertTrue(gradcheck(lambda a, p, n: F.triplet_margin_with_distance_loss(
|
|
a, p, n, distance_function=distance_fn, reduction=reduction, margin=margin, swap=swap),
|
|
(anchor, positive, negative)))
|
|
loss_op = nn.TripletMarginWithDistanceLoss(distance_function=distance_fn,
|
|
reduction=reduction, margin=margin, swap=swap)
|
|
self.assertTrue(gradcheck(lambda a, p, n: loss_op(
|
|
a, p, n), (anchor, positive, negative)))
|
|
traced_loss_op = torch.jit.trace(loss_op, (anchor, positive, negative))
|
|
self.assertTrue(gradcheck(lambda a, p, n: traced_loss_op(
|
|
a, p, n), (anchor, positive, negative)))
|
|
|
|
# Test forward parity
|
|
functional = F.triplet_margin_with_distance_loss(anchor, positive, negative,
|
|
distance_function=distance_fn,
|
|
reduction=reduction, margin=margin, swap=swap)
|
|
modular = loss_op(anchor, positive, negative)
|
|
traced = traced_loss_op(anchor, positive, negative)
|
|
self.assertEqual(functional, modular, atol=1e-6, rtol=1e-6)
|
|
self.assertEqual(traced, modular, atol=1e-6, rtol=1e-6)
|
|
|
|
@dtypesIfMPS(torch.cfloat, torch.float)
|
|
@dtypes(torch.cfloat, torch.cdouble, torch.float)
|
|
def test_to_complex(self, device, dtype):
|
|
m = nn.Linear(3, 5).to(device)
|
|
self.assertIs(m, m.to(device))
|
|
m.to(dtype)
|
|
self.assertIs(m.weight.dtype, dtype)
|
|
with warnings.catch_warnings(record=True) as w:
|
|
# Trigger warning
|
|
m.to(torch.cfloat)
|
|
# Check warning occurs
|
|
self.assertEqual(len(w), 1)
|
|
self.assertTrue("Complex modules are a new feature" in str(w[-1].message))
|
|
|
|
@skipMeta
|
|
@dtypesIfMPS(torch.float32)
|
|
@dtypes(torch.float32, torch.float64)
|
|
def test_module_to_empty(self, device, dtype):
|
|
class MyModule(nn.Module):
|
|
def __init__(self, in_features, out_features, device=None, dtype=None):
|
|
super().__init__()
|
|
factory_kwargs = {"device": device, "dtype": dtype}
|
|
self.weight = nn.Parameter(torch.randn(in_features, out_features, **factory_kwargs))
|
|
|
|
def forward(self, x):
|
|
return x @ self.weight
|
|
|
|
# Test meta module instantiation.
|
|
input = torch.randn(5, 10, device=device, dtype=dtype)
|
|
m = MyModule(10, 1, device='meta', dtype=dtype)
|
|
m(input)
|
|
|
|
# Test empty meta module error with torch.nn.Module.to().
|
|
with self.assertRaisesRegex(
|
|
NotImplementedError,
|
|
re.escape(
|
|
"Cannot copy out of meta tensor; no data! Please use torch.nn.Module.to_empty() "
|
|
"instead of torch.nn.Module.to() when moving module from meta to a different "
|
|
"device."
|
|
),
|
|
):
|
|
m.to(device)
|
|
|
|
# Test materializing meta module on a real device.
|
|
m.to_empty(device=device)
|
|
m(input)
|
|
with torch.no_grad():
|
|
torch.nn.init.kaiming_uniform_(m.weight)
|
|
m(input)
|
|
|
|
# Test creating meta module from materialized module.
|
|
m.to_empty(device='meta')
|
|
m(input)
|
|
|
|
def test_module_to_empty_non_recursive(self, device):
|
|
class Layer(nn.Module):
|
|
def __init__(self, in_features, out_features):
|
|
super().__init__()
|
|
self.weight = nn.Parameter(torch.randn(in_features, out_features))
|
|
self.register_buffer('buf', torch.randn(out_features))
|
|
|
|
def forward(self, x):
|
|
return x @ self.weight + self.buf
|
|
|
|
class MyModule(nn.Module):
|
|
def __init__(self, in_features, out_features):
|
|
super().__init__()
|
|
self.weight = nn.Parameter(torch.randn(in_features, out_features))
|
|
self.register_buffer('buf1', torch.randn(out_features))
|
|
self.layer = Layer(out_features, out_features)
|
|
|
|
def forward(self, x):
|
|
return self.layer(x @ self.weight + self.buf1)
|
|
|
|
with torch.device('meta'):
|
|
m = MyModule(3, 5)
|
|
|
|
m.to_empty(device=device, recurse=False)
|
|
|
|
# params/buffers of parent should have been materialized on device
|
|
self.assertTrue(not m.weight.is_meta)
|
|
self.assertTrue(not m.buf1.is_meta)
|
|
|
|
# parameters/buffers of children submodules should still be on meta
|
|
for p in (*m.layer.parameters(), *m.layer.buffers()):
|
|
self.assertTrue(p.is_meta)
|
|
|
|
@skipMeta
|
|
def test_skip_init(self, device):
|
|
torch.manual_seed(1)
|
|
m_initialized = torch.nn.Linear(5, 1)
|
|
m_initialized.to(device)
|
|
|
|
torch.manual_seed(1)
|
|
m_uninitialized = torch.nn.utils.skip_init(torch.nn.Linear, 5, 1, device=device)
|
|
|
|
self.assertEqual(m_initialized.weight.device, m_uninitialized.weight.device)
|
|
self.assertFalse(torch.allclose(m_initialized.weight, m_uninitialized.weight))
|
|
|
|
@skipIfRocm(msg='Not our bug: TransformerEncoderLayer._sa_block still uses FA/ME and effectively takes fastpath')
|
|
@skipIfMps # TODO(hvaara): Investigate as possible bug. macOS 13 passes, while 14 and 15 fails.
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.double, torch.float, torch.half)
|
|
def test_transformerencoderlayer(self, device, dtype):
|
|
if TEST_WITH_ROCM and PLATFORM_SUPPORTS_FLASH_ATTENTION and dtype == torch.half:
|
|
self.skipTest("Skip on ROCM due to Flash Attention tolerances")
|
|
# this is a deterministic test for TransformerEncoderLayer
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
|
|
atol = 1e-5
|
|
rtol = 1e-7
|
|
if "cuda" in device:
|
|
atol = 1e-3
|
|
rtol = 1e-2
|
|
|
|
def _test(training, batch_first, atol, rtol):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
batch_first=batch_first, device=device, dtype=dtype)
|
|
|
|
if not training:
|
|
assert dropout == 0
|
|
model = model.eval()
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
encoder_input = torch.tensor([[[20., 30., 40., 50.]]], device=device, dtype=dtype)
|
|
result = model(encoder_input)
|
|
ref_output = torch.tensor([[[2.258703, 0.127985, -0.697881, 0.170862]]], device=device, dtype=dtype)
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
# 0 values are NOT masked. This shouldn't mask anything.
|
|
mask = torch.tensor([[0]], device=device) == 1
|
|
# TODO: enable fast path for calls with a mask!
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
mask = torch.tensor([[1]], device=device) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
fast_path_device = result.is_cuda or result.is_cpu
|
|
result = result.cpu().detach().numpy()
|
|
# Non Fast Paths
|
|
if training or not batch_first or TEST_WITH_CROSSREF or not fast_path_device:
|
|
# We changed the semenatic, on the non fast path so that fully masked out rows return
|
|
# 0 from attention thus NaNs should no longer be present and the output should be nonzero
|
|
# due to skip connections
|
|
self.assertTrue(not np.isnan(result).any())
|
|
else:
|
|
# Fast Paths
|
|
self.assertTrue(np.isnan(result).all())
|
|
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]], device=device, dtype=dtype))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.272644, 0.119035, -0.691669, 0.153486]],
|
|
[[2.272644, 0.119035, -0.691669, 0.153486]]], device=device, dtype=dtype))
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
# all 0 which is no masking
|
|
mask = torch.tensor([[0, 0]], device=device) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
mask = torch.tensor([[1, 0]], device=device) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.301516, 0.092249, -0.679101, 0.103088]],
|
|
[[2.301516, 0.092249, -0.679101, 0.103088]]], device=device, dtype=dtype))
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]], device=device, dtype=dtype))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.428589, 0.020835, -0.602055, -0.085249],
|
|
[2.427987, 0.021213, -0.602496, -0.084103]],
|
|
[[2.424689, 0.019155, -0.604793, -0.085672],
|
|
[2.413863, 0.022211, -0.612486, -0.072490]],
|
|
[[2.433774, 0.021598, -0.598343, -0.087548],
|
|
[2.425104, 0.019748, -0.604515, -0.084839]],
|
|
[[2.436185, 0.022682, -0.596625, -0.087261],
|
|
[2.433556, 0.021891, -0.598509, -0.086832]],
|
|
[[2.416246, 0.017512, -0.610712, -0.082961],
|
|
[2.422901, 0.024187, -0.606178, -0.074929]]], device=device, dtype=dtype))
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
|
|
# all 0
|
|
mask = torch.zeros([2, 5], device=device) == 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
mask[0, 1] = 1
|
|
mask[1, 3] = 1
|
|
mask[1, 4] = 1
|
|
result = model(encoder_input, src_key_padding_mask=mask)
|
|
ref_output = perm_fn(torch.tensor([[[2.429026, 0.020793, -0.601741, -0.085642],
|
|
[2.428811, 0.021445, -0.601912, -0.084252]],
|
|
[[2.425009, 0.019155, -0.604566, -0.085899],
|
|
[2.415408, 0.02249 , -0.611415, -0.073]],
|
|
[[2.434199, 0.021682, -0.598039, -0.087699],
|
|
[2.42598, 0.019941, -0.603896, -0.085091]],
|
|
[[2.436457, 0.022736, -0.59643 , -0.08736],
|
|
[2.434021, 0.022093, -0.598179, -0.08679]],
|
|
[[2.416531, 0.017498, -0.610513, -0.083181],
|
|
[2.4242, 0.024653, -0.605266, -0.074959]]], device=device, dtype=dtype))
|
|
self.assertEqual(result.shape, ref_output.shape)
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
|
|
# NestedTensor is only supported for the fast path
|
|
# currently, which won't be used if training.
|
|
if (batch_first and not training and
|
|
('cuda' in str(device) or 'cpu' in str(device)) and not TEST_WITH_CROSSREF):
|
|
encoder_input[0][-1] = torch.zeros_like(encoder_input[0][1])
|
|
mask = torch.zeros(encoder_input.shape[:-1], device=device, dtype=torch.bool)
|
|
mask[0][-1] = True
|
|
|
|
nt = torch.nested.nested_tensor([encoder_input[0][:-1], encoder_input[1]], device=device)
|
|
result = model(nt)
|
|
ref_output = torch.tensor(
|
|
[
|
|
[
|
|
[2.4268184, 0.02042419, -0.603311, -0.08476824],
|
|
[2.423306, 0.01889652, -0.6057701, -0.08519465],
|
|
[2.431538, 0.02078694, -0.5999354, -0.08746159],
|
|
[2.4348664, 0.02212971, -0.5975677, -0.08733892],
|
|
[2.423133, 0.02097577, -0.60594773, -0.08113337],
|
|
],
|
|
[
|
|
[2.4279876, 0.02121329, -0.60249615, -0.08410317],
|
|
[2.4138637, 0.02221113, -0.6124869, -0.07249016],
|
|
[2.4251041, 0.01974815, -0.6045152, -0.08483928],
|
|
[2.4335563, 0.0218913, -0.59850943, -0.08683228],
|
|
[2.4229012, 0.02418739, -0.6061784, -0.07492948],
|
|
],
|
|
],
|
|
device=device, dtype=dtype
|
|
)
|
|
result = result.to_padded_tensor(0)
|
|
ref_output[0][-1] = torch.zeros_like(
|
|
ref_output[0][-1], device=device, dtype=dtype
|
|
)
|
|
result[0][-1] = torch.zeros_like(
|
|
result[0][-1], device=device, dtype=dtype
|
|
)
|
|
self.assertEqual(tuple(result.shape), tuple(ref_output.shape))
|
|
if 'cuda' in device:
|
|
if dtype == torch.float:
|
|
atol = 2e-4
|
|
rtol = 4e-3
|
|
else:
|
|
atol = 7e-4
|
|
rtol = 2e-2
|
|
torch.testing.assert_close(result, ref_output, atol=atol, rtol=rtol)
|
|
else:
|
|
torch.testing.assert_close(result, ref_output)
|
|
|
|
|
|
for batch_first in (True, False):
|
|
for training in (True, False):
|
|
if training:
|
|
cm = contextlib.nullcontext()
|
|
else:
|
|
# Fast path requires inference mode.
|
|
cm = torch.no_grad()
|
|
with cm:
|
|
_test(batch_first=batch_first, training=training, atol=atol, rtol=rtol)
|
|
|
|
@onlyCPU
|
|
@dtypes(torch.double)
|
|
def test_transformerencoderlayer_fast_path(self, device, dtype):
|
|
"""
|
|
Test transformer fast path on CPU with different valid mask types and shapes
|
|
"""
|
|
d_model = 512
|
|
nhead = 8
|
|
batch_size = 32
|
|
src_len = 10
|
|
|
|
model = torch.nn.TransformerEncoderLayer(d_model=d_model, nhead=nhead, batch_first=True,
|
|
device=device, dtype=dtype, dropout=0)
|
|
model.eval()
|
|
|
|
# Batched inputs
|
|
src = torch.rand(batch_size, src_len, 512, dtype=dtype)
|
|
|
|
# Attention mask of shape (src_len, src_len)
|
|
src_mask = torch.zeros(src_len, src_len).to(torch.bool)
|
|
with torch.no_grad():
|
|
model(src, src_mask=src_mask)
|
|
|
|
# Padding mask of shape (batch_size, src_len)
|
|
src_key_padding_mask = torch.zeros(batch_size, src_len).to(torch.bool)
|
|
with torch.no_grad():
|
|
model(src, src_key_padding_mask=src_key_padding_mask)
|
|
|
|
# Provide both masks
|
|
with torch.no_grad():
|
|
model(src, src_mask=src_mask, src_key_padding_mask=src_key_padding_mask)
|
|
|
|
|
|
@dtypes(torch.float)
|
|
@dtypesIfCUDA(torch.half, torch.float)
|
|
def test_transformerencoderlayer_gelu(self, device, dtype):
|
|
if TEST_WITH_ROCM and PLATFORM_SUPPORTS_FLASH_ATTENTION and dtype == torch.half:
|
|
self.skipTest("Skip on ROCM due to Flash Attention tolerances")
|
|
# this is a deterministic test for TransformerEncoderLayer with gelu activation
|
|
d_model = 4
|
|
nhead = 2
|
|
dim_feedforward = 16
|
|
dropout = 0.0
|
|
bsz = 2
|
|
|
|
atol = 0
|
|
rtol = 1e-5
|
|
if "cuda" in device:
|
|
atol = 1e-3
|
|
rtol = 1e-2
|
|
|
|
def _test(activation, batch_first, training):
|
|
def perm_fn(x):
|
|
return x.transpose(1, 0) if batch_first else x
|
|
|
|
model = nn.TransformerEncoderLayer(d_model, nhead, dim_feedforward, dropout,
|
|
activation, batch_first=batch_first, device=device, dtype=dtype)
|
|
if not training:
|
|
assert dropout == 0
|
|
model = model.eval()
|
|
|
|
# set constant weights of the model
|
|
for idx, p in enumerate(model.parameters()):
|
|
x = p.data
|
|
sz = x.view(-1).size(0)
|
|
shape = x.shape
|
|
x = torch.cos(torch.arange(0, sz).float().view(shape))
|
|
p.data.copy_(x)
|
|
|
|
# deterministic input
|
|
encoder_input = torch.tensor([[[20., 30., 40., 50.]]], device=device, dtype=dtype)
|
|
result = model(encoder_input)
|
|
ref_output = torch.tensor([[[2.249815, 0.131006, -0.702199, 0.177868]]], device=device, dtype=dtype)
|
|
torch.testing.assert_close(result, ref_output, rtol=rtol, atol=atol)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[1., 2., 3., 4.]],
|
|
[[5., 6., 7., 8.]]], device=device, dtype=dtype))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.264103, 0.121417, -0.696012, 0.159724]],
|
|
[[2.264103, 0.121417, -0.696012, 0.159724]]], device=device, dtype=dtype))
|
|
torch.testing.assert_close(result, ref_output, rtol=rtol, atol=atol)
|
|
|
|
# deterministic input
|
|
encoder_input = perm_fn(torch.tensor([[[0.7462, 0.6653, 0.5679, 0.4891],
|
|
[0.5387, 0.1655, 0.3565, 0.0471]],
|
|
[[0.8335, 0.2799, 0.5031, 0.2947],
|
|
[0.1402, 0.0318, 0.7636, 0.1346]],
|
|
[[0.6333, 0.9344, 0.1376, 0.9938],
|
|
[0.8924, 0.2872, 0.6692, 0.2944]],
|
|
[[0.9897, 0.6915, 0.3154, 0.1733],
|
|
[0.8645, 0.3513, 0.3064, 0.0767]],
|
|
[[0.8117, 0.2366, 0.4838, 0.7881],
|
|
[0.3718, 0.4945, 0.9511, 0.0864]]], device=device, dtype=dtype))
|
|
result = model(encoder_input)
|
|
ref_output = perm_fn(torch.tensor([[[2.42163188, 0.03227153, -0.60714219, -0.05908082],
|
|
[2.42151276, 0.03302179, -0.60722523, -0.05762651]],
|
|
[[2.41926761, 0.02974034, -0.60879519, -0.0621269],
|
|
[2.41626395, 0.03539356, -0.61087842, -0.04978623]],
|
|
[[2.42382808, 0.03218872, -0.6055963, -0.06073591],
|
|
[2.41983477, 0.03085259, -0.60840145, -0.06046414]],
|
|
[[2.42500749, 0.03328855, -0.60476388, -0.0595334],
|
|
[2.4237977, 0.03290575, -0.60561789, -0.05940082]],
|
|
[[2.41383916, 0.02686345, -0.61256377, -0.06380707],
|
|
[2.42000277, 0.03800944, -0.60824798, -0.04754947]]], device=device, dtype=dtype))
|
|
torch.testing.assert_close(result, ref_output, rtol=rtol, atol=atol)
|
|
for activation, batch_first, training in product(('gelu', F.gelu, nn.GELU()), (True, False), (True, False)):
|
|
# Fast path requires inference mode.
|
|
if training:
|
|
cm = contextlib.nullcontext()
|
|
else:
|
|
cm = torch.no_grad()
|
|
with cm:
|
|
_test(activation=activation, batch_first=batch_first, training=training)
|
|
|
|
@skipIfMps # RuntimeError: foreach=True was passed, but can't use the foreach API on mps tensors
|
|
@parametrize_test('foreach', (False, True))
|
|
def test_clip_grad_value(self, foreach, device):
|
|
if torch.device(device).type == 'xla' and foreach:
|
|
raise SkipTest('foreach not supported on XLA')
|
|
if torch.device(device).type == 'mps' and foreach:
|
|
raise SkipTest('foreach not supported on MPS')
|
|
|
|
l = nn.Linear(10, 10).to(device)
|
|
clip_value = 2.5
|
|
|
|
grad_w, grad_b = torch.arange(-50., 50, device=device).view(10, 10).div_(5), torch.ones(10, device=device).mul_(2)
|
|
for grad_list in [[grad_w, grad_b], [grad_w, None]]:
|
|
for p, g in zip(l.parameters(), grad_list):
|
|
p._grad = g.clone().view_as(p.data) if g is not None else g
|
|
|
|
clip_grad_value_(l.parameters(), clip_value, foreach=foreach)
|
|
for p in filter(lambda p: p.grad is not None, l.parameters()):
|
|
self.assertLessEqual(p.grad.data.max(), clip_value)
|
|
self.assertGreaterEqual(p.grad.data.min(), -clip_value)
|
|
|
|
# Should accept a single Tensor as input
|
|
p1, p2 = torch.randn(10, 10, device=device), torch.randn(10, 10, device=device)
|
|
g = torch.arange(-50., 50, device=device).view(10, 10).div_(5)
|
|
p1._grad = g.clone()
|
|
p2._grad = g.clone()
|
|
clip_grad_value_(p1, clip_value, foreach=foreach)
|
|
clip_grad_value_([p2], clip_value, foreach=foreach)
|
|
self.assertEqual(p1.grad, p2.grad)
|
|
|
|
@skipIfMps # TypeError: the MPS framework doesn't support float64
|
|
@parametrize_test('foreach', (False, True))
|
|
@parametrize_test('norm_type', (0.5, 1.5, 2, 4, 'inf'))
|
|
def test_clip_grad_norm(self, norm_type, foreach, device):
|
|
if torch.device(device).type == 'xla' and foreach:
|
|
raise SkipTest('foreach not supported on XLA')
|
|
if torch.device(device).type == 'mps' and foreach:
|
|
raise SkipTest('foreach not supported on MPS')
|
|
|
|
l = nn.Linear(10, 10).to(device)
|
|
max_norm = 2
|
|
|
|
def compute_norm(norm_type):
|
|
norm_type = float(norm_type)
|
|
if norm_type != inf:
|
|
total_norm = 0
|
|
for p in l.parameters():
|
|
total_norm += p.grad.data.abs().pow(norm_type).sum()
|
|
return pow(total_norm, 1. / norm_type)
|
|
else:
|
|
return max(p.grad.data.abs().max() for p in l.parameters())
|
|
|
|
def compare_scaling(grads):
|
|
p_scale = [p.grad.data.div(g).view(-1) for p, g in zip(l.parameters(), grads)]
|
|
scale = torch.cat(p_scale)
|
|
self.assertEqual(scale.std(), 0)
|
|
return scale[0]
|
|
|
|
grads = torch.arange(1., 101, device=device).view(10, 10), torch.ones(10, device=device).div(1000)
|
|
for p, g in zip(l.parameters(), grads):
|
|
p._grad = g.clone().view_as(p.data)
|
|
norm_before = compute_norm(norm_type)
|
|
norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type, foreach=foreach)
|
|
norm_after = compute_norm(norm_type)
|
|
self.assertEqual(norm, norm_before)
|
|
self.assertEqual(norm_after, max_norm)
|
|
self.assertLessEqual(norm_after, norm_before)
|
|
compare_scaling(grads)
|
|
|
|
# decomposed APIs should behave as expected
|
|
grads = torch.arange(1., 101, device=device).view(10, 10), torch.ones(10, device=device).div(1000)
|
|
for p, g in zip(l.parameters(), grads):
|
|
p._grad = g.clone().view_as(p)
|
|
norm_before = compute_norm(norm_type)
|
|
grads = [p.grad for p in l.parameters()]
|
|
total_norm = get_total_norm(grads, norm_type=norm_type, foreach=foreach)
|
|
clip_grads_with_norm_(l.parameters(), max_norm, total_norm, foreach=foreach)
|
|
norm_after = compute_norm(norm_type)
|
|
self.assertEqual(total_norm, norm_before)
|
|
self.assertEqual(norm_after, max_norm)
|
|
self.assertLessEqual(norm_after, norm_before)
|
|
compare_scaling(grads)
|
|
|
|
# Small gradients should be left unchanged
|
|
grads = torch.rand(10, 10, device=device).div(10000), torch.ones(10, device=device).div(500)
|
|
for p, g in zip(l.parameters(), grads):
|
|
p.grad.data.copy_(g)
|
|
norm_before = compute_norm(norm_type)
|
|
norm = clip_grad_norm_(l.parameters(), max_norm, norm_type=norm_type, foreach=foreach)
|
|
norm_after = compute_norm(norm_type)
|
|
self.assertEqual(norm, norm_before)
|
|
self.assertEqual(norm_before, norm_after)
|
|
self.assertLessEqual(norm_after, max_norm)
|
|
scale = compare_scaling(grads)
|
|
self.assertEqual(scale, 1)
|
|
|
|
# Should accept a single Tensor as input
|
|
p1, p2 = torch.randn(10, 10, device=device), torch.randn(10, 10, device=device)
|
|
g = torch.arange(1., 101, device=device).view(10, 10)
|
|
p1._grad = g.clone()
|
|
p2._grad = g.clone()
|
|
clip_grad_norm_(p1, max_norm, norm_type=norm_type, foreach=foreach)
|
|
clip_grad_norm_([p2], max_norm, norm_type=norm_type, foreach=foreach)
|
|
self.assertEqual(p1.grad, p2.grad)
|
|
|
|
# reference issue: https://github.com/pytorch/pytorch/issues/111484
|
|
@onlyCUDA
|
|
@largeTensorTest("42GB", "cuda")
|
|
def test_softmax_forward_64bit_indexing(self, device):
|
|
batch_size = 70
|
|
seq_len = 2048
|
|
vocab_size = 50000
|
|
|
|
shift_labels = torch.zeros(batch_size, seq_len - 1, dtype=torch.long, device=device)
|
|
logits = torch.ones(batch_size, seq_len - 1, vocab_size, dtype=torch.float16, device=device)
|
|
loss_fct = torch.nn.CrossEntropyLoss(reduction="none")
|
|
nll = loss_fct(logits.permute(0, 2, 1), shift_labels).float()
|
|
rtol, atol = torch.testing._comparison.get_tolerances(torch.float16, rtol=None, atol=None)
|
|
self.assertEqual(nll, torch.ones_like(nll) * torch.log(torch.tensor(vocab_size)), rtol=rtol, atol=atol)
|
|
|
|
@onlyCUDA
|
|
@largeTensorTest("20GB", "cuda")
|
|
def test_softmax_backward_64bit_indexing(self, device):
|
|
for numel in (2147483650, 2147483650 + 1):
|
|
x = torch.empty([1, 1, numel], device=device, dtype=torch.float16)
|
|
x.fill_(1.0 / numel)
|
|
out = torch._softmax_backward_data(x, x, 2, x.dtype)
|
|
self.assertEqual(out[0, 0, 0], 1 / numel)
|
|
|
|
# reference issue: https://github.com/pytorch/pytorch/issues/68248
|
|
@onlyCUDA
|
|
def test_adaptiveavg_pool1d_shmem(self, device):
|
|
x = torch.randn(1, 256, 1, 5000, device=device).to(memory_format=torch.channels_last)
|
|
x_cpu = x.cpu()
|
|
x_cpu.requires_grad_()
|
|
x.requires_grad_()
|
|
y = torch.nn.functional.adaptive_avg_pool2d(x, (1, 256))
|
|
y_cpu = torch.nn.functional.adaptive_avg_pool2d(x_cpu, (1, 256))
|
|
grad = torch.randn_like(y)
|
|
grad_cpu = grad.cpu()
|
|
y.backward(grad)
|
|
y_cpu.backward(grad_cpu)
|
|
self.assertEqual(x.grad, x_cpu.grad)
|
|
|
|
@skipMeta
|
|
@expectedFailureMPS # NotImplementedError: aten::channel_shuffle https://github.com/pytorch/pytorch/issues/77764
|
|
def test_channel_shuffle(self, device):
|
|
# 3D tensor
|
|
x = torch.tensor(
|
|
[[[1, 2],
|
|
[5, 6],
|
|
[9, 10],
|
|
[13, 14],
|
|
]], device=device
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[1, 2],
|
|
[9, 10],
|
|
[5, 6],
|
|
[13, 14],
|
|
]], device=device
|
|
)
|
|
# ChannelsFirst
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2).to(device)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast not supported for 3dim
|
|
|
|
# 4D tensor
|
|
x = torch.tensor(
|
|
[[[[1, 2],
|
|
[3, 4]],
|
|
[[5, 6],
|
|
[7, 8]],
|
|
[[9, 10],
|
|
[11, 12]],
|
|
[[13, 14],
|
|
[15, 16]],
|
|
]], device=device
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[[1, 2],
|
|
[3, 4]],
|
|
[[9, 10],
|
|
[11, 12]],
|
|
[[5, 6],
|
|
[7, 8]],
|
|
[[13, 14],
|
|
[15, 16]],
|
|
]], device=device
|
|
)
|
|
# ChannelsFirst NCHW
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2).to(device)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast NHWC
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last), 2).to(device)
|
|
self.assertEqual(len(w), 0)
|
|
y = y.contiguous(memory_format=torch.contiguous_format)
|
|
self.assertEqual(y, y_ref)
|
|
|
|
# 5D tensor
|
|
x = torch.tensor(
|
|
[[[[[1, 2],
|
|
[3, 4]]],
|
|
[[[5, 6],
|
|
[7, 8]]],
|
|
[[[9, 10],
|
|
[11, 12]]],
|
|
[[[13, 14],
|
|
[15, 16]]],
|
|
]], device=device
|
|
)
|
|
y_ref = torch.tensor(
|
|
[[[[[1, 2],
|
|
[3, 4]]],
|
|
[[[9, 10],
|
|
[11, 12]]],
|
|
[[[5, 6],
|
|
[7, 8]]],
|
|
[[[13, 14],
|
|
[15, 16]]],
|
|
]], device=device
|
|
)
|
|
# ChannelsFirst NCHW
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x, 2).to(device)
|
|
self.assertEqual(len(w), 0)
|
|
self.assertEqual(y, y_ref)
|
|
# ChannelsLast NHWC
|
|
with warnings.catch_warnings(record=True) as w:
|
|
y = F.channel_shuffle(x.contiguous(memory_format=torch.channels_last_3d), 2).to(device)
|
|
self.assertEqual(len(w), 0)
|
|
y = y.contiguous(memory_format=torch.contiguous_format)
|
|
self.assertEqual(y, y_ref)
|
|
|
|
|
|
class TestFunctionalPickle(TestCase):
|
|
|
|
# issue gh-38137
|
|
def test_pickle_softsign(self):
|
|
# Make sure it does not throw an exception
|
|
s = pickle.dumps(F.softsign)
|
|
|
|
|
|
class TestFusionUtils(TestCase):
|
|
def test_fuse_conv_bn_requires_grad(self):
|
|
conv = torch.nn.Conv2d(3, 3, 3)
|
|
bn = torch.nn.BatchNorm2d(3)
|
|
cases = itertools.product([True, False], [True, False])
|
|
for w_rg, b_rg in cases:
|
|
conv.weight.requires_grad = w_rg
|
|
conv.bias.requires_grad = b_rg
|
|
weight, bias = \
|
|
fuse_conv_bn_weights(conv.weight, conv.bias,
|
|
bn.running_mean, bn.running_var, bn.eps, bn.weight, bn.bias)
|
|
self.assertEqual(weight.requires_grad, w_rg)
|
|
self.assertEqual(bias.requires_grad, b_rg)
|
|
|
|
def test_fuse_linear_bn_requires_grad(self):
|
|
linear = torch.nn.Linear(3, 3)
|
|
bn = torch.nn.BatchNorm1d(3)
|
|
cases = itertools.product([True, False], [True, False])
|
|
for w_rg, b_rg in cases:
|
|
linear.weight.requires_grad = w_rg
|
|
linear.bias.requires_grad = b_rg
|
|
weight, bias = \
|
|
fuse_linear_bn_weights(linear.weight, linear.bias,
|
|
bn.running_mean, bn.running_var, bn.eps, bn.weight, bn.bias)
|
|
self.assertEqual(weight.requires_grad, w_rg)
|
|
self.assertEqual(bias.requires_grad, b_rg)
|
|
|
|
class TestUtils(TestCase):
|
|
def test_consume_prefix_in_state_dict_if_present(self):
|
|
class Block(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.conv1 = nn.Conv2d(3, 3, 3, bias=True)
|
|
self.conv2 = nn.Conv2d(3, 3, 3, bias=False)
|
|
|
|
class Net(nn.Module):
|
|
def __init__(self) -> None:
|
|
super().__init__()
|
|
self.linear1 = nn.Linear(5, 5)
|
|
self.linear2 = nn.Linear(5, 5)
|
|
net.bn = nn.BatchNorm2d(2)
|
|
self.block = Block()
|
|
|
|
# 0. Case non-DDP model empty state_dict
|
|
net = nn.Module()
|
|
state_dict = net.state_dict()
|
|
nn.modules.utils.consume_prefix_in_state_dict_if_present(state_dict, 'module.')
|
|
# check they are the same preserving order
|
|
self.assertEqual(list(state_dict.keys()), list(net.state_dict().keys()))
|
|
self.assertEqual(list(state_dict._metadata.keys()), list(net.state_dict()._metadata.keys()))
|
|
|
|
# 1. Case non-DDP model test example state_dict
|
|
net = Net()
|
|
state_dict = net.state_dict()
|
|
nn.modules.utils.consume_prefix_in_state_dict_if_present(state_dict, 'module.')
|
|
# Check they are the same preserving order
|
|
self.assertEqual(list(state_dict.keys()), list(net.state_dict().keys()))
|
|
self.assertEqual(list(state_dict._metadata.keys()), list(net.state_dict()._metadata.keys()))
|
|
|
|
# 2. Case DDP model test example state_dict
|
|
state_dict = net.state_dict()
|
|
metadata = state_dict._metadata
|
|
ddp_state_dict = OrderedDict((f'module.{k}', v) for k, v in state_dict.items())
|
|
ddp_state_dict._metadata = OrderedDict({'': metadata['']})
|
|
ddp_state_dict._metadata.update(('module' if k == '' else f'module.{k}', v) for k, v in metadata.items())
|
|
nn.modules.utils.consume_prefix_in_state_dict_if_present(ddp_state_dict, 'module.')
|
|
# Check they are the same preserving order
|
|
self.assertEqual(list(state_dict.keys()), list(ddp_state_dict.keys()))
|
|
self.assertEqual(list(state_dict._metadata.keys()), list(ddp_state_dict._metadata.keys()))
|
|
|
|
|
|
instantiate_device_type_tests(TestNNDeviceType, globals(), allow_mps=True)
|
|
instantiate_parametrized_tests(TestNN)
|
|
|
|
if __name__ == '__main__':
|
|
TestCase._default_dtype_check_enabled = True
|
|
run_tests()
|